module.exports = /******/ (function(modules, runtime) { // webpackBootstrap /******/ "use strict"; /******/ // The module cache /******/ var installedModules = {}; /******/ /******/ // The require function /******/ function __webpack_require__(moduleId) { /******/ /******/ // Check if module is in cache /******/ if(installedModules[moduleId]) { /******/ return installedModules[moduleId].exports; /******/ } /******/ // Create a new module (and put it into the cache) /******/ var module = installedModules[moduleId] = { /******/ i: moduleId, /******/ l: false, /******/ exports: {} /******/ }; /******/ /******/ // Execute the module function /******/ var threw = true; /******/ try { /******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); /******/ threw = false; /******/ } finally { /******/ if(threw) delete installedModules[moduleId]; /******/ } /******/ /******/ // Flag the module as loaded /******/ module.l = true; /******/ /******/ // Return the exports of the module /******/ return module.exports; /******/ } /******/ /******/ /******/ __webpack_require__.ab = __dirname + "/"; /******/ /******/ // the startup function /******/ function startup() { /******/ // Load entry module and return exports /******/ return __webpack_require__(104); /******/ }; /******/ // initialize runtime /******/ runtime(__webpack_require__); /******/ /******/ // run startup /******/ return startup(); /******/ }) /************************************************************************/ /******/ ([ /* 0 */, /* 1 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; Object.defineProperty(exports, "__esModule", { value: true }); const childProcess = __webpack_require__(129); const path = __webpack_require__(622); const util_1 = __webpack_require__(669); const ioUtil = __webpack_require__(672); const exec = util_1.promisify(childProcess.exec); /** * Copies a file or folder. * Based off of shelljs - https://github.com/shelljs/shelljs/blob/9237f66c52e5daa40458f94f9565e18e8132f5a6/src/cp.js * * @param source source path * @param dest destination path * @param options optional. See CopyOptions. */ function cp(source, dest, options = {}) { return __awaiter(this, void 0, void 0, function* () { const { force, recursive } = readCopyOptions(options); const destStat = (yield ioUtil.exists(dest)) ? yield ioUtil.stat(dest) : null; // Dest is an existing file, but not forcing if (destStat && destStat.isFile() && !force) { return; } // If dest is an existing directory, should copy inside. const newDest = destStat && destStat.isDirectory() ? path.join(dest, path.basename(source)) : dest; if (!(yield ioUtil.exists(source))) { throw new Error(`no such file or directory: ${source}`); } const sourceStat = yield ioUtil.stat(source); if (sourceStat.isDirectory()) { if (!recursive) { throw new Error(`Failed to copy. ${source} is a directory, but tried to copy without recursive flag.`); } else { yield cpDirRecursive(source, newDest, 0, force); } } else { if (path.relative(source, newDest) === '') { // a file cannot be copied to itself throw new Error(`'${newDest}' and '${source}' are the same file`); } yield copyFile(source, newDest, force); } }); } exports.cp = cp; /** * Moves a path. * * @param source source path * @param dest destination path * @param options optional. See MoveOptions. */ function mv(source, dest, options = {}) { return __awaiter(this, void 0, void 0, function* () { if (yield ioUtil.exists(dest)) { let destExists = true; if (yield ioUtil.isDirectory(dest)) { // If dest is directory copy src into dest dest = path.join(dest, path.basename(source)); destExists = yield ioUtil.exists(dest); } if (destExists) { if (options.force == null || options.force) { yield rmRF(dest); } else { throw new Error('Destination already exists'); } } } yield mkdirP(path.dirname(dest)); yield ioUtil.rename(source, dest); }); } exports.mv = mv; /** * Remove a path recursively with force * * @param inputPath path to remove */ function rmRF(inputPath) { return __awaiter(this, void 0, void 0, function* () { if (ioUtil.IS_WINDOWS) { // Node doesn't provide a delete operation, only an unlink function. This means that if the file is being used by another // program (e.g. antivirus), it won't be deleted. To address this, we shell out the work to rd/del. try { if (yield ioUtil.isDirectory(inputPath, true)) { yield exec(`rd /s /q "${inputPath}"`); } else { yield exec(`del /f /a "${inputPath}"`); } } catch (err) { // if you try to delete a file that doesn't exist, desired result is achieved // other errors are valid if (err.code !== 'ENOENT') throw err; } // Shelling out fails to remove a symlink folder with missing source, this unlink catches that try { yield ioUtil.unlink(inputPath); } catch (err) { // if you try to delete a file that doesn't exist, desired result is achieved // other errors are valid if (err.code !== 'ENOENT') throw err; } } else { let isDir = false; try { isDir = yield ioUtil.isDirectory(inputPath); } catch (err) { // if you try to delete a file that doesn't exist, desired result is achieved // other errors are valid if (err.code !== 'ENOENT') throw err; return; } if (isDir) { yield exec(`rm -rf "${inputPath}"`); } else { yield ioUtil.unlink(inputPath); } } }); } exports.rmRF = rmRF; /** * Make a directory. Creates the full path with folders in between * Will throw if it fails * * @param fsPath path to create * @returns Promise */ function mkdirP(fsPath) { return __awaiter(this, void 0, void 0, function* () { yield ioUtil.mkdirP(fsPath); }); } exports.mkdirP = mkdirP; /** * Returns path of a tool had the tool actually been invoked. Resolves via paths. * If you check and the tool does not exist, it will throw. * * @param tool name of the tool * @param check whether to check if tool exists * @returns Promise path to tool */ function which(tool, check) { return __awaiter(this, void 0, void 0, function* () { if (!tool) { throw new Error("parameter 'tool' is required"); } // recursive when check=true if (check) { const result = yield which(tool, false); if (!result) { if (ioUtil.IS_WINDOWS) { throw new Error(`Unable to locate executable file: ${tool}. Please verify either the file path exists or the file can be found within a directory specified by the PATH environment variable. Also verify the file has a valid extension for an executable file.`); } else { throw new Error(`Unable to locate executable file: ${tool}. Please verify either the file path exists or the file can be found within a directory specified by the PATH environment variable. Also check the file mode to verify the file is executable.`); } } } try { // build the list of extensions to try const extensions = []; if (ioUtil.IS_WINDOWS && process.env.PATHEXT) { for (const extension of process.env.PATHEXT.split(path.delimiter)) { if (extension) { extensions.push(extension); } } } // if it's rooted, return it if exists. otherwise return empty. if (ioUtil.isRooted(tool)) { const filePath = yield ioUtil.tryGetExecutablePath(tool, extensions); if (filePath) { return filePath; } return ''; } // if any path separators, return empty if (tool.includes('/') || (ioUtil.IS_WINDOWS && tool.includes('\\'))) { return ''; } // build the list of directories // // Note, technically "where" checks the current directory on Windows. From a toolkit perspective, // it feels like we should not do this. Checking the current directory seems like more of a use // case of a shell, and the which() function exposed by the toolkit should strive for consistency // across platforms. const directories = []; if (process.env.PATH) { for (const p of process.env.PATH.split(path.delimiter)) { if (p) { directories.push(p); } } } // return the first match for (const directory of directories) { const filePath = yield ioUtil.tryGetExecutablePath(directory + path.sep + tool, extensions); if (filePath) { return filePath; } } return ''; } catch (err) { throw new Error(`which failed with message ${err.message}`); } }); } exports.which = which; function readCopyOptions(options) { const force = options.force == null ? true : options.force; const recursive = Boolean(options.recursive); return { force, recursive }; } function cpDirRecursive(sourceDir, destDir, currentDepth, force) { return __awaiter(this, void 0, void 0, function* () { // Ensure there is not a run away recursive copy if (currentDepth >= 255) return; currentDepth++; yield mkdirP(destDir); const files = yield ioUtil.readdir(sourceDir); for (const fileName of files) { const srcFile = `${sourceDir}/${fileName}`; const destFile = `${destDir}/${fileName}`; const srcFileStat = yield ioUtil.lstat(srcFile); if (srcFileStat.isDirectory()) { // Recurse yield cpDirRecursive(srcFile, destFile, currentDepth, force); } else { yield copyFile(srcFile, destFile, force); } } // Change the mode for the newly created directory yield ioUtil.chmod(destDir, (yield ioUtil.stat(sourceDir)).mode); }); } // Buffered file copy function copyFile(srcFile, destFile, force) { return __awaiter(this, void 0, void 0, function* () { if ((yield ioUtil.lstat(srcFile)).isSymbolicLink()) { // unlink/re-link it try { yield ioUtil.lstat(destFile); yield ioUtil.unlink(destFile); } catch (e) { // Try to override file permission if (e.code === 'EPERM') { yield ioUtil.chmod(destFile, '0666'); yield ioUtil.unlink(destFile); } // other errors = it doesn't exist, no work to do } // Copy over symlink const symlinkFull = yield ioUtil.readlink(srcFile); yield ioUtil.symlink(symlinkFull, destFile, ioUtil.IS_WINDOWS ? 'junction' : null); } else if (!(yield ioUtil.exists(destFile)) || force) { yield ioUtil.copyFile(srcFile, destFile); } }); } //# sourceMappingURL=io.js.map /***/ }), /* 2 */, /* 3 */, /* 4 */, /* 5 */, /* 6 */, /* 7 */ /***/ (function(module) { function Caseless (dict) { this.dict = dict || {} } Caseless.prototype.set = function (name, value, clobber) { if (typeof name === 'object') { for (var i in name) { this.set(i, name[i], value) } } else { if (typeof clobber === 'undefined') clobber = true var has = this.has(name) if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value else this.dict[has || name] = value return has } } Caseless.prototype.has = function (name) { var keys = Object.keys(this.dict) , name = name.toLowerCase() ; for (var i=0;i -1) { const line = s.substring(0, n); onLine(line); // the rest of the string ... s = s.substring(n + os.EOL.length); n = s.indexOf(os.EOL); } strBuffer = s; } catch (err) { // streaming lines to console is best effort. Don't fail a build. this._debug(`error processing line. Failed with error ${err}`); } } _getSpawnFileName() { if (IS_WINDOWS) { if (this._isCmdFile()) { return process.env['COMSPEC'] || 'cmd.exe'; } } return this.toolPath; } _getSpawnArgs(options) { if (IS_WINDOWS) { if (this._isCmdFile()) { let argline = `/D /S /C "${this._windowsQuoteCmdArg(this.toolPath)}`; for (const a of this.args) { argline += ' '; argline += options.windowsVerbatimArguments ? a : this._windowsQuoteCmdArg(a); } argline += '"'; return [argline]; } } return this.args; } _endsWith(str, end) { return str.endsWith(end); } _isCmdFile() { const upperToolPath = this.toolPath.toUpperCase(); return (this._endsWith(upperToolPath, '.CMD') || this._endsWith(upperToolPath, '.BAT')); } _windowsQuoteCmdArg(arg) { // for .exe, apply the normal quoting rules that libuv applies if (!this._isCmdFile()) { return this._uvQuoteCmdArg(arg); } // otherwise apply quoting rules specific to the cmd.exe command line parser. // the libuv rules are generic and are not designed specifically for cmd.exe // command line parser. // // for a detailed description of the cmd.exe command line parser, refer to // http://stackoverflow.com/questions/4094699/how-does-the-windows-command-interpreter-cmd-exe-parse-scripts/7970912#7970912 // need quotes for empty arg if (!arg) { return '""'; } // determine whether the arg needs to be quoted const cmdSpecialChars = [ ' ', '\t', '&', '(', ')', '[', ']', '{', '}', '^', '=', ';', '!', "'", '+', ',', '`', '~', '|', '<', '>', '"' ]; let needsQuotes = false; for (const char of arg) { if (cmdSpecialChars.some(x => x === char)) { needsQuotes = true; break; } } // short-circuit if quotes not needed if (!needsQuotes) { return arg; } // the following quoting rules are very similar to the rules that by libuv applies. // // 1) wrap the string in quotes // // 2) double-up quotes - i.e. " => "" // // this is different from the libuv quoting rules. libuv replaces " with \", which unfortunately // doesn't work well with a cmd.exe command line. // // note, replacing " with "" also works well if the arg is passed to a downstream .NET console app. // for example, the command line: // foo.exe "myarg:""my val""" // is parsed by a .NET console app into an arg array: // [ "myarg:\"my val\"" ] // which is the same end result when applying libuv quoting rules. although the actual // command line from libuv quoting rules would look like: // foo.exe "myarg:\"my val\"" // // 3) double-up slashes that precede a quote, // e.g. hello \world => "hello \world" // hello\"world => "hello\\""world" // hello\\"world => "hello\\\\""world" // hello world\ => "hello world\\" // // technically this is not required for a cmd.exe command line, or the batch argument parser. // the reasons for including this as a .cmd quoting rule are: // // a) this is optimized for the scenario where the argument is passed from the .cmd file to an // external program. many programs (e.g. .NET console apps) rely on the slash-doubling rule. // // b) it's what we've been doing previously (by deferring to node default behavior) and we // haven't heard any complaints about that aspect. // // note, a weakness of the quoting rules chosen here, is that % is not escaped. in fact, % cannot be // escaped when used on the command line directly - even though within a .cmd file % can be escaped // by using %%. // // the saving grace is, on the command line, %var% is left as-is if var is not defined. this contrasts // the line parsing rules within a .cmd file, where if var is not defined it is replaced with nothing. // // one option that was explored was replacing % with ^% - i.e. %var% => ^%var^%. this hack would // often work, since it is unlikely that var^ would exist, and the ^ character is removed when the // variable is used. the problem, however, is that ^ is not removed when %* is used to pass the args // to an external program. // // an unexplored potential solution for the % escaping problem, is to create a wrapper .cmd file. // % can be escaped within a .cmd file. let reverse = '"'; let quoteHit = true; for (let i = arg.length; i > 0; i--) { // walk the string in reverse reverse += arg[i - 1]; if (quoteHit && arg[i - 1] === '\\') { reverse += '\\'; // double the slash } else if (arg[i - 1] === '"') { quoteHit = true; reverse += '"'; // double the quote } else { quoteHit = false; } } reverse += '"'; return reverse .split('') .reverse() .join(''); } _uvQuoteCmdArg(arg) { // Tool runner wraps child_process.spawn() and needs to apply the same quoting as // Node in certain cases where the undocumented spawn option windowsVerbatimArguments // is used. // // Since this function is a port of quote_cmd_arg from Node 4.x (technically, lib UV, // see https://github.com/nodejs/node/blob/v4.x/deps/uv/src/win/process.c for details), // pasting copyright notice from Node within this function: // // Copyright Joyent, Inc. and other Node contributors. All rights reserved. // // Permission is hereby granted, free of charge, to any person obtaining a copy // of this software and associated documentation files (the "Software"), to // deal in the Software without restriction, including without limitation the // rights to use, copy, modify, merge, publish, distribute, sublicense, and/or // sell copies of the Software, and to permit persons to whom the Software is // furnished to do so, subject to the following conditions: // // The above copyright notice and this permission notice shall be included in // all copies or substantial portions of the Software. // // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR // IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, // FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE // AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER // LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING // FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS // IN THE SOFTWARE. if (!arg) { // Need double quotation for empty argument return '""'; } if (!arg.includes(' ') && !arg.includes('\t') && !arg.includes('"')) { // No quotation needed return arg; } if (!arg.includes('"') && !arg.includes('\\')) { // No embedded double quotes or backslashes, so I can just wrap // quote marks around the whole thing. return `"${arg}"`; } // Expected input/output: // input : hello"world // output: "hello\"world" // input : hello""world // output: "hello\"\"world" // input : hello\world // output: hello\world // input : hello\\world // output: hello\\world // input : hello\"world // output: "hello\\\"world" // input : hello\\"world // output: "hello\\\\\"world" // input : hello world\ // output: "hello world\\" - note the comment in libuv actually reads "hello world\" // but it appears the comment is wrong, it should be "hello world\\" let reverse = '"'; let quoteHit = true; for (let i = arg.length; i > 0; i--) { // walk the string in reverse reverse += arg[i - 1]; if (quoteHit && arg[i - 1] === '\\') { reverse += '\\'; } else if (arg[i - 1] === '"') { quoteHit = true; reverse += '\\'; } else { quoteHit = false; } } reverse += '"'; return reverse .split('') .reverse() .join(''); } _cloneExecOptions(options) { options = options || {}; const result = { cwd: options.cwd || process.cwd(), env: options.env || process.env, silent: options.silent || false, windowsVerbatimArguments: options.windowsVerbatimArguments || false, failOnStdErr: options.failOnStdErr || false, ignoreReturnCode: options.ignoreReturnCode || false, delay: options.delay || 10000 }; result.outStream = options.outStream || process.stdout; result.errStream = options.errStream || process.stderr; return result; } _getSpawnOptions(options, toolPath) { options = options || {}; const result = {}; result.cwd = options.cwd; result.env = options.env; result['windowsVerbatimArguments'] = options.windowsVerbatimArguments || this._isCmdFile(); if (options.windowsVerbatimArguments) { result.argv0 = `"${toolPath}"`; } return result; } /** * Exec a tool. * Output will be streamed to the live console. * Returns promise with return code * * @param tool path to tool to exec * @param options optional exec options. See ExecOptions * @returns number */ exec() { return __awaiter(this, void 0, void 0, function* () { // root the tool path if it is unrooted and contains relative pathing if (!ioUtil.isRooted(this.toolPath) && (this.toolPath.includes('/') || (IS_WINDOWS && this.toolPath.includes('\\')))) { // prefer options.cwd if it is specified, however options.cwd may also need to be rooted this.toolPath = path.resolve(process.cwd(), this.options.cwd || process.cwd(), this.toolPath); } // if the tool is only a file name, then resolve it from the PATH // otherwise verify it exists (add extension on Windows if necessary) this.toolPath = yield io.which(this.toolPath, true); return new Promise((resolve, reject) => { this._debug(`exec tool: ${this.toolPath}`); this._debug('arguments:'); for (const arg of this.args) { this._debug(` ${arg}`); } const optionsNonNull = this._cloneExecOptions(this.options); if (!optionsNonNull.silent && optionsNonNull.outStream) { optionsNonNull.outStream.write(this._getCommandString(optionsNonNull) + os.EOL); } const state = new ExecState(optionsNonNull, this.toolPath); state.on('debug', (message) => { this._debug(message); }); const fileName = this._getSpawnFileName(); const cp = child.spawn(fileName, this._getSpawnArgs(optionsNonNull), this._getSpawnOptions(this.options, fileName)); const stdbuffer = ''; if (cp.stdout) { cp.stdout.on('data', (data) => { if (this.options.listeners && this.options.listeners.stdout) { this.options.listeners.stdout(data); } if (!optionsNonNull.silent && optionsNonNull.outStream) { optionsNonNull.outStream.write(data); } this._processLineBuffer(data, stdbuffer, (line) => { if (this.options.listeners && this.options.listeners.stdline) { this.options.listeners.stdline(line); } }); }); } const errbuffer = ''; if (cp.stderr) { cp.stderr.on('data', (data) => { state.processStderr = true; if (this.options.listeners && this.options.listeners.stderr) { this.options.listeners.stderr(data); } if (!optionsNonNull.silent && optionsNonNull.errStream && optionsNonNull.outStream) { const s = optionsNonNull.failOnStdErr ? optionsNonNull.errStream : optionsNonNull.outStream; s.write(data); } this._processLineBuffer(data, errbuffer, (line) => { if (this.options.listeners && this.options.listeners.errline) { this.options.listeners.errline(line); } }); }); } cp.on('error', (err) => { state.processError = err.message; state.processExited = true; state.processClosed = true; state.CheckComplete(); }); cp.on('exit', (code) => { state.processExitCode = code; state.processExited = true; this._debug(`Exit code ${code} received from tool '${this.toolPath}'`); state.CheckComplete(); }); cp.on('close', (code) => { state.processExitCode = code; state.processExited = true; state.processClosed = true; this._debug(`STDIO streams have closed for tool '${this.toolPath}'`); state.CheckComplete(); }); state.on('done', (error, exitCode) => { if (stdbuffer.length > 0) { this.emit('stdline', stdbuffer); } if (errbuffer.length > 0) { this.emit('errline', errbuffer); } cp.removeAllListeners(); if (error) { reject(error); } else { resolve(exitCode); } }); if (this.options.input) { if (!cp.stdin) { throw new Error('child process missing stdin'); } cp.stdin.end(this.options.input); } }); }); } } exports.ToolRunner = ToolRunner; /** * Convert an arg string to an array of args. Handles escaping * * @param argString string of arguments * @returns string[] array of arguments */ function argStringToArray(argString) { const args = []; let inQuotes = false; let escaped = false; let arg = ''; function append(c) { // we only escape double quotes. if (escaped && c !== '"') { arg += '\\'; } arg += c; escaped = false; } for (let i = 0; i < argString.length; i++) { const c = argString.charAt(i); if (c === '"') { if (!escaped) { inQuotes = !inQuotes; } else { append(c); } continue; } if (c === '\\' && escaped) { append(c); continue; } if (c === '\\' && inQuotes) { escaped = true; continue; } if (c === ' ' && !inQuotes) { if (arg.length > 0) { args.push(arg); arg = ''; } continue; } append(c); } if (arg.length > 0) { args.push(arg.trim()); } return args; } exports.argStringToArray = argStringToArray; class ExecState extends events.EventEmitter { constructor(options, toolPath) { super(); this.processClosed = false; // tracks whether the process has exited and stdio is closed this.processError = ''; this.processExitCode = 0; this.processExited = false; // tracks whether the process has exited this.processStderr = false; // tracks whether stderr was written to this.delay = 10000; // 10 seconds this.done = false; this.timeout = null; if (!toolPath) { throw new Error('toolPath must not be empty'); } this.options = options; this.toolPath = toolPath; if (options.delay) { this.delay = options.delay; } } CheckComplete() { if (this.done) { return; } if (this.processClosed) { this._setResult(); } else if (this.processExited) { this.timeout = setTimeout(ExecState.HandleTimeout, this.delay, this); } } _debug(message) { this.emit('debug', message); } _setResult() { // determine whether there is an error let error; if (this.processExited) { if (this.processError) { error = new Error(`There was an error when attempting to execute the process '${this.toolPath}'. This may indicate the process failed to start. Error: ${this.processError}`); } else if (this.processExitCode !== 0 && !this.options.ignoreReturnCode) { error = new Error(`The process '${this.toolPath}' failed with exit code ${this.processExitCode}`); } else if (this.processStderr && this.options.failOnStdErr) { error = new Error(`The process '${this.toolPath}' failed because one or more lines were written to the STDERR stream`); } } // clear the timeout if (this.timeout) { clearTimeout(this.timeout); this.timeout = null; } this.done = true; this.emit('done', error, this.processExitCode); } static HandleTimeout(state) { if (state.done) { return; } if (!state.processClosed && state.processExited) { const message = `The STDIO streams did not close within ${state.delay / 1000} seconds of the exit event from process '${state.toolPath}'. This may indicate a child process inherited the STDIO streams and has not yet exited.`; state._debug(message); } state._setResult(); } } //# sourceMappingURL=toolrunner.js.map /***/ }), /* 10 */, /* 11 */, /* 12 */, /* 13 */ /***/ (function(module) { "use strict"; var replace = String.prototype.replace; var percentTwenties = /%20/g; module.exports = { 'default': 'RFC3986', formatters: { RFC1738: function (value) { return replace.call(value, percentTwenties, '+'); }, RFC3986: function (value) { return value; } }, RFC1738: 'RFC1738', RFC3986: 'RFC3986' }; /***/ }), /* 14 */, /* 15 */, /* 16 */ /***/ (function(module) { module.exports = require("tls"); /***/ }), /* 17 */, /* 18 */, /* 19 */, /* 20 */, /* 21 */, /* 22 */, /* 23 */, /* 24 */, /* 25 */, /* 26 */, /* 27 */, /* 28 */ /***/ (function(module) { "use strict"; module.exports = function generate_comment(it, $keyword, $ruleType) { var out = ' '; var $schema = it.schema[$keyword]; var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $comment = it.util.toQuotedString($schema); if (it.opts.$comment === true) { out += ' console.log(' + ($comment) + ');'; } else if (typeof it.opts.$comment == 'function') { out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; } return out; } /***/ }), /* 29 */, /* 30 */, /* 31 */, /* 32 */, /* 33 */, /* 34 */, /* 35 */ /***/ (function(module) { "use strict"; module.exports = function generate_propertyNames(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; out += 'var ' + ($errs) + ' = errors;'; if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; var $key = 'key' + $lvl, $idx = 'idx' + $lvl, $i = 'i' + $lvl, $invalidName = '\' + ' + $key + ' + \'', $dataNxt = $it.dataLevel = it.dataLevel + 1, $nextData = 'data' + $dataNxt, $dataProperties = 'dataProperties' + $lvl, $ownProperties = it.opts.ownProperties, $currentBaseId = it.baseId; if ($ownProperties) { out += ' var ' + ($dataProperties) + ' = undefined; '; } if ($ownProperties) { out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; } else { out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; } out += ' var startErrs' + ($lvl) + ' = errors; '; var $passData = $key; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } it.compositeRule = $it.compositeRule = $wasComposite; out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' All rights reserved. // If you have no idea what ASN.1 or BER is, see this: // ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc var Ber = __webpack_require__(249); // --- Exported API module.exports = { Ber: Ber, BerReader: Ber.Reader, BerWriter: Ber.Writer }; /***/ }), /* 63 */, /* 64 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. var assert = __webpack_require__(477); var crypto = __webpack_require__(417); var http = __webpack_require__(605); var util = __webpack_require__(669); var sshpk = __webpack_require__(650); var jsprim = __webpack_require__(348); var utils = __webpack_require__(909); var sprintf = __webpack_require__(669).format; var HASH_ALGOS = utils.HASH_ALGOS; var PK_ALGOS = utils.PK_ALGOS; var InvalidAlgorithmError = utils.InvalidAlgorithmError; var HttpSignatureError = utils.HttpSignatureError; var validateAlgorithm = utils.validateAlgorithm; ///--- Globals var AUTHZ_FMT = 'Signature keyId="%s",algorithm="%s",headers="%s",signature="%s"'; ///--- Specific Errors function MissingHeaderError(message) { HttpSignatureError.call(this, message, MissingHeaderError); } util.inherits(MissingHeaderError, HttpSignatureError); function StrictParsingError(message) { HttpSignatureError.call(this, message, StrictParsingError); } util.inherits(StrictParsingError, HttpSignatureError); /* See createSigner() */ function RequestSigner(options) { assert.object(options, 'options'); var alg = []; if (options.algorithm !== undefined) { assert.string(options.algorithm, 'options.algorithm'); alg = validateAlgorithm(options.algorithm); } this.rs_alg = alg; /* * RequestSigners come in two varieties: ones with an rs_signFunc, and ones * with an rs_signer. * * rs_signFunc-based RequestSigners have to build up their entire signing * string within the rs_lines array and give it to rs_signFunc as a single * concat'd blob. rs_signer-based RequestSigners can add a line at a time to * their signing state by using rs_signer.update(), thus only needing to * buffer the hash function state and one line at a time. */ if (options.sign !== undefined) { assert.func(options.sign, 'options.sign'); this.rs_signFunc = options.sign; } else if (alg[0] === 'hmac' && options.key !== undefined) { assert.string(options.keyId, 'options.keyId'); this.rs_keyId = options.keyId; if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) throw (new TypeError('options.key for HMAC must be a string or Buffer')); /* * Make an rs_signer for HMACs, not a rs_signFunc -- HMACs digest their * data in chunks rather than requiring it all to be given in one go * at the end, so they are more similar to signers than signFuncs. */ this.rs_signer = crypto.createHmac(alg[1].toUpperCase(), options.key); this.rs_signer.sign = function () { var digest = this.digest('base64'); return ({ hashAlgorithm: alg[1], toString: function () { return (digest); } }); }; } else if (options.key !== undefined) { var key = options.key; if (typeof (key) === 'string' || Buffer.isBuffer(key)) key = sshpk.parsePrivateKey(key); assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), 'options.key must be a sshpk.PrivateKey'); this.rs_key = key; assert.string(options.keyId, 'options.keyId'); this.rs_keyId = options.keyId; if (!PK_ALGOS[key.type]) { throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + 'keys are not supported')); } if (alg[0] !== undefined && key.type !== alg[0]) { throw (new InvalidAlgorithmError('options.key must be a ' + alg[0].toUpperCase() + ' key, was given a ' + key.type.toUpperCase() + ' key instead')); } this.rs_signer = key.createSign(alg[1]); } else { throw (new TypeError('options.sign (func) or options.key is required')); } this.rs_headers = []; this.rs_lines = []; } /** * Adds a header to be signed, with its value, into this signer. * * @param {String} header * @param {String} value * @return {String} value written */ RequestSigner.prototype.writeHeader = function (header, value) { assert.string(header, 'header'); header = header.toLowerCase(); assert.string(value, 'value'); this.rs_headers.push(header); if (this.rs_signFunc) { this.rs_lines.push(header + ': ' + value); } else { var line = header + ': ' + value; if (this.rs_headers.length > 0) line = '\n' + line; this.rs_signer.update(line); } return (value); }; /** * Adds a default Date header, returning its value. * * @return {String} */ RequestSigner.prototype.writeDateHeader = function () { return (this.writeHeader('date', jsprim.rfc1123(new Date()))); }; /** * Adds the request target line to be signed. * * @param {String} method, HTTP method (e.g. 'get', 'post', 'put') * @param {String} path */ RequestSigner.prototype.writeTarget = function (method, path) { assert.string(method, 'method'); assert.string(path, 'path'); method = method.toLowerCase(); this.writeHeader('(request-target)', method + ' ' + path); }; /** * Calculate the value for the Authorization header on this request * asynchronously. * * @param {Func} callback (err, authz) */ RequestSigner.prototype.sign = function (cb) { assert.func(cb, 'callback'); if (this.rs_headers.length < 1) throw (new Error('At least one header must be signed')); var alg, authz; if (this.rs_signFunc) { var data = this.rs_lines.join('\n'); var self = this; this.rs_signFunc(data, function (err, sig) { if (err) { cb(err); return; } try { assert.object(sig, 'signature'); assert.string(sig.keyId, 'signature.keyId'); assert.string(sig.algorithm, 'signature.algorithm'); assert.string(sig.signature, 'signature.signature'); alg = validateAlgorithm(sig.algorithm); authz = sprintf(AUTHZ_FMT, sig.keyId, sig.algorithm, self.rs_headers.join(' '), sig.signature); } catch (e) { cb(e); return; } cb(null, authz); }); } else { try { var sigObj = this.rs_signer.sign(); } catch (e) { cb(e); return; } alg = (this.rs_alg[0] || this.rs_key.type) + '-' + sigObj.hashAlgorithm; var signature = sigObj.toString(); authz = sprintf(AUTHZ_FMT, this.rs_keyId, alg, this.rs_headers.join(' '), signature); cb(null, authz); } }; ///--- Exported API module.exports = { /** * Identifies whether a given object is a request signer or not. * * @param {Object} object, the object to identify * @returns {Boolean} */ isSigner: function (obj) { if (typeof (obj) === 'object' && obj instanceof RequestSigner) return (true); return (false); }, /** * Creates a request signer, used to asynchronously build a signature * for a request (does not have to be an http.ClientRequest). * * @param {Object} options, either: * - {String} keyId * - {String|Buffer} key * - {String} algorithm (optional, required for HMAC) * or: * - {Func} sign (data, cb) * @return {RequestSigner} */ createSigner: function createSigner(options) { return (new RequestSigner(options)); }, /** * Adds an 'Authorization' header to an http.ClientRequest object. * * Note that this API will add a Date header if it's not already set. Any * other headers in the options.headers array MUST be present, or this * will throw. * * You shouldn't need to check the return type; it's just there if you want * to be pedantic. * * The optional flag indicates whether parsing should use strict enforcement * of the version draft-cavage-http-signatures-04 of the spec or beyond. * The default is to be loose and support * older versions for compatibility. * * @param {Object} request an instance of http.ClientRequest. * @param {Object} options signing parameters object: * - {String} keyId required. * - {String} key required (either a PEM or HMAC key). * - {Array} headers optional; defaults to ['date']. * - {String} algorithm optional (unless key is HMAC); * default is the same as the sshpk default * signing algorithm for the type of key given * - {String} httpVersion optional; defaults to '1.1'. * - {Boolean} strict optional; defaults to 'false'. * @return {Boolean} true if Authorization (and optionally Date) were added. * @throws {TypeError} on bad parameter types (input). * @throws {InvalidAlgorithmError} if algorithm was bad or incompatible with * the given key. * @throws {sshpk.KeyParseError} if key was bad. * @throws {MissingHeaderError} if a header to be signed was specified but * was not present. */ signRequest: function signRequest(request, options) { assert.object(request, 'request'); assert.object(options, 'options'); assert.optionalString(options.algorithm, 'options.algorithm'); assert.string(options.keyId, 'options.keyId'); assert.optionalArrayOfString(options.headers, 'options.headers'); assert.optionalString(options.httpVersion, 'options.httpVersion'); if (!request.getHeader('Date')) request.setHeader('Date', jsprim.rfc1123(new Date())); if (!options.headers) options.headers = ['date']; if (!options.httpVersion) options.httpVersion = '1.1'; var alg = []; if (options.algorithm) { options.algorithm = options.algorithm.toLowerCase(); alg = validateAlgorithm(options.algorithm); } var i; var stringToSign = ''; for (i = 0; i < options.headers.length; i++) { if (typeof (options.headers[i]) !== 'string') throw new TypeError('options.headers must be an array of Strings'); var h = options.headers[i].toLowerCase(); if (h === 'request-line') { if (!options.strict) { /** * We allow headers from the older spec drafts if strict parsing isn't * specified in options. */ stringToSign += request.method + ' ' + request.path + ' HTTP/' + options.httpVersion; } else { /* Strict parsing doesn't allow older draft headers. */ throw (new StrictParsingError('request-line is not a valid header ' + 'with strict parsing enabled.')); } } else if (h === '(request-target)') { stringToSign += '(request-target): ' + request.method.toLowerCase() + ' ' + request.path; } else { var value = request.getHeader(h); if (value === undefined || value === '') { throw new MissingHeaderError(h + ' was not in the request'); } stringToSign += h + ': ' + value; } if ((i + 1) < options.headers.length) stringToSign += '\n'; } /* This is just for unit tests. */ if (request.hasOwnProperty('_stringToSign')) { request._stringToSign = stringToSign; } var signature; if (alg[0] === 'hmac') { if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) throw (new TypeError('options.key must be a string or Buffer')); var hmac = crypto.createHmac(alg[1].toUpperCase(), options.key); hmac.update(stringToSign); signature = hmac.digest('base64'); } else { var key = options.key; if (typeof (key) === 'string' || Buffer.isBuffer(key)) key = sshpk.parsePrivateKey(options.key); assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), 'options.key must be a sshpk.PrivateKey'); if (!PK_ALGOS[key.type]) { throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + 'keys are not supported')); } if (alg[0] !== undefined && key.type !== alg[0]) { throw (new InvalidAlgorithmError('options.key must be a ' + alg[0].toUpperCase() + ' key, was given a ' + key.type.toUpperCase() + ' key instead')); } var signer = key.createSign(alg[1]); signer.update(stringToSign); var sigObj = signer.sign(); if (!HASH_ALGOS[sigObj.hashAlgorithm]) { throw (new InvalidAlgorithmError(sigObj.hashAlgorithm.toUpperCase() + ' is not a supported hash algorithm')); } options.algorithm = key.type + '-' + sigObj.hashAlgorithm; signature = sigObj.toString(); assert.notStrictEqual(signature, '', 'empty signature produced'); } var authzHeaderName = options.authorizationHeaderName || 'Authorization'; request.setHeader(authzHeaderName, sprintf(AUTHZ_FMT, options.keyId, options.algorithm, options.headers.join(' '), signature)); return true; } }; /***/ }), /* 65 */, /* 66 */, /* 67 */, /* 68 */, /* 69 */ /***/ (function(module) { // populates missing values module.exports = function(dst, src) { Object.keys(src).forEach(function(prop) { dst[prop] = dst[prop] || src[prop]; }); return dst; }; /***/ }), /* 70 */, /* 71 */, /* 72 */, /* 73 */, /* 74 */, /* 75 */, /* 76 */, /* 77 */, /* 78 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, readSSHPrivate: readSSHPrivate, write: write }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var crypto = __webpack_require__(417); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var rfc4253 = __webpack_require__(538); var SSHBuffer = __webpack_require__(940); var errors = __webpack_require__(753); var bcrypt; function read(buf, options) { return (pem.read(buf, options)); } var MAGIC = 'openssh-key-v1'; function readSSHPrivate(type, buf, options) { buf = new SSHBuffer({buffer: buf}); var magic = buf.readCString(); assert.strictEqual(magic, MAGIC, 'bad magic string'); var cipher = buf.readString(); var kdf = buf.readString(); var kdfOpts = buf.readBuffer(); var nkeys = buf.readInt(); if (nkeys !== 1) { throw (new Error('OpenSSH-format key file contains ' + 'multiple keys: this is unsupported.')); } var pubKey = buf.readBuffer(); if (type === 'public') { assert.ok(buf.atEnd(), 'excess bytes left after key'); return (rfc4253.read(pubKey)); } var privKeyBlob = buf.readBuffer(); assert.ok(buf.atEnd(), 'excess bytes left after key'); var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); switch (kdf) { case 'none': if (cipher !== 'none') { throw (new Error('OpenSSH-format key uses KDF "none" ' + 'but specifies a cipher other than "none"')); } break; case 'bcrypt': var salt = kdfOptsBuf.readBuffer(); var rounds = kdfOptsBuf.readInt(); var cinf = utils.opensshCipherInfo(cipher); if (bcrypt === undefined) { bcrypt = __webpack_require__(641); } if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from(options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'OpenSSH')); } var pass = new Uint8Array(options.passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = Buffer.from(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createDecipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(privKeyBlob); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privKeyBlob = Buffer.concat(chunks); break; default: throw (new Error( 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); } buf = new SSHBuffer({buffer: privKeyBlob}); var checkInt1 = buf.readInt(); var checkInt2 = buf.readInt(); if (checkInt1 !== checkInt2) { throw (new Error('Incorrect passphrase supplied, could not ' + 'decrypt key')); } var ret = {}; var key = rfc4253.readInternal(ret, 'private', buf.remainder()); buf.skip(ret.consumed); var comment = buf.readString(); key.comment = comment; return (key); } function write(key, options) { var pubKey; if (PrivateKey.isPrivateKey(key)) pubKey = key.toPublic(); else pubKey = key; var cipher = 'none'; var kdf = 'none'; var kdfopts = Buffer.alloc(0); var cinf = { blockSize: 8 }; var passphrase; if (options !== undefined) { passphrase = options.passphrase; if (typeof (passphrase) === 'string') passphrase = Buffer.from(passphrase, 'utf-8'); if (passphrase !== undefined) { assert.buffer(passphrase, 'options.passphrase'); assert.optionalString(options.cipher, 'options.cipher'); cipher = options.cipher; if (cipher === undefined) cipher = 'aes128-ctr'; cinf = utils.opensshCipherInfo(cipher); kdf = 'bcrypt'; } } var privBuf; if (PrivateKey.isPrivateKey(key)) { privBuf = new SSHBuffer({}); var checkInt = crypto.randomBytes(4).readUInt32BE(0); privBuf.writeInt(checkInt); privBuf.writeInt(checkInt); privBuf.write(key.toBuffer('rfc4253')); privBuf.writeString(key.comment || ''); var n = 1; while (privBuf._offset % cinf.blockSize !== 0) privBuf.writeChar(n++); privBuf = privBuf.toBuffer(); } switch (kdf) { case 'none': break; case 'bcrypt': var salt = crypto.randomBytes(16); var rounds = 16; var kdfssh = new SSHBuffer({}); kdfssh.writeBuffer(salt); kdfssh.writeInt(rounds); kdfopts = kdfssh.toBuffer(); if (bcrypt === undefined) { bcrypt = __webpack_require__(641); } var pass = new Uint8Array(passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = Buffer.from(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createCipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { throw (e); }); cipherStream.write(privBuf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privBuf = Buffer.concat(chunks); break; default: throw (new Error('Unsupported kdf ' + kdf)); } var buf = new SSHBuffer({}); buf.writeCString(MAGIC); buf.writeString(cipher); /* cipher */ buf.writeString(kdf); /* kdf */ buf.writeBuffer(kdfopts); /* kdfoptions */ buf.writeInt(1); /* nkeys */ buf.writeBuffer(pubKey.toBuffer('rfc4253')); if (privBuf) buf.writeBuffer(privBuf); buf = buf.toBuffer(); var header; if (PrivateKey.isPrivateKey(key)) header = 'OPENSSH PRIVATE KEY'; else header = 'OPENSSH PUBLIC KEY'; var tmp = buf.toString('base64'); var len = tmp.length + (tmp.length / 70) + 18 + 16 + header.length*2 + 10; buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 70; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } /***/ }), /* 79 */, /* 80 */, /* 81 */, /* 82 */ /***/ (function(__unusedmodule, exports) { "use strict"; // We use any as a valid input type /* eslint-disable @typescript-eslint/no-explicit-any */ Object.defineProperty(exports, "__esModule", { value: true }); /** * Sanitizes an input into a string so it can be passed into issueCommand safely * @param input input to sanitize into a string */ function toCommandValue(input) { if (input === null || input === undefined) { return ''; } else if (typeof input === 'string' || input instanceof String) { return input; } return JSON.stringify(input); } exports.toCommandValue = toCommandValue; //# sourceMappingURL=utils.js.map /***/ }), /* 83 */, /* 84 */, /* 85 */ /***/ (function(module) { "use strict"; module.exports = function generate__limitItems(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $op = $keyword == 'maxItems' ? '>' : '<'; out += 'if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; var $errorKeyword = $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should NOT have '; if ($keyword == 'maxItems') { out += 'more'; } else { out += 'fewer'; } out += ' than '; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { out += '' + ($schema); } out += ' items\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /* 86 */, /* 87 */ /***/ (function(module) { module.exports = require("os"); /***/ }), /* 88 */, /* 89 */, /* 90 */, /* 91 */ /***/ (function(module, __unusedexports, __webpack_require__) { var serialOrdered = __webpack_require__(892); // Public API module.exports = serial; /** * Runs iterator over provided array elements in series * * @param {array|object} list - array or object (named list) to iterate over * @param {function} iterator - iterator to run * @param {function} callback - invoked when all elements processed * @returns {function} - jobs terminator */ function serial(list, iterator, callback) { return serialOrdered(list, iterator, null, callback); } /***/ }), /* 92 */, /* 93 */, /* 94 */, /* 95 */, /* 96 */, /* 97 */, /* 98 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var Buffer = __webpack_require__(215).Buffer; var algInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y'], sizePart: 'p' }, 'rsa': { parts: ['e', 'n'], sizePart: 'n' }, 'ecdsa': { parts: ['curve', 'Q'], sizePart: 'Q' }, 'ed25519': { parts: ['A'], sizePart: 'A' } }; algInfo['curve25519'] = algInfo['ed25519']; var algPrivInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y', 'x'] }, 'rsa': { parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] }, 'ecdsa': { parts: ['curve', 'Q', 'd'] }, 'ed25519': { parts: ['A', 'k'] } }; algPrivInfo['curve25519'] = algPrivInfo['ed25519']; var hashAlgs = { 'md5': true, 'sha1': true, 'sha256': true, 'sha384': true, 'sha512': true }; /* * Taken from * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf */ var curves = { 'nistp256': { size: 256, pkcs8oid: '1.2.840.10045.3.1.7', p: Buffer.from(('00' + 'ffffffff 00000001 00000000 00000000' + '00000000 ffffffff ffffffff ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF 00000001 00000000 00000000' + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'c49d3608 86e70493 6a6678e1 139d26b7' + '819f7e90'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff 00000000 ffffffff ffffffff' + 'bce6faad a7179e84 f3b9cac2 fc632551'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + '77037d81 2deb33a0 f4a13945 d898c296' + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + '2bce3357 6b315ece cbb64068 37bf51f5'). replace(/ /g, ''), 'hex') }, 'nistp384': { size: 384, pkcs8oid: '1.3.132.0.34', p: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffe' + 'ffffffff 00000000 00000000 ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( 'b3312fa7 e23ee7e4 988e056b e3f82d19' + '181d9c6e fe814112 0314088f 5013875a' + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'a335926a a319a27a 1d00896a 6773a482' + '7acdac73'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff c7634d81 f4372ddf' + '581a0db2 48b0a77a ecec196a ccc52973'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + '6e1d3b62 8ba79b98 59f741e0 82542a38' + '5502f25d bf55296c 3a545e38 72760ab7' + '3617de4a 96262c6f 5d9e98bf 9292dc29' + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). replace(/ /g, ''), 'hex') }, 'nistp521': { size: 521, pkcs8oid: '1.3.132.0.35', p: Buffer.from(( '01ffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffff').replace(/ /g, ''), 'hex'), a: Buffer.from(('01FF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(('51' + '953eb961 8e1c9a1f 929a21a0 b68540ee' + 'a2da725b 99b315f3 b8b48991 8ef109e1' + '56193951 ec7e937b 1652c0bd 3bb1bf07' + '3573df88 3d2c34f1 ef451fd4 6b503f00'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'd09e8800 291cb853 96cc6717 393284aa' + 'a0da64ba').replace(/ /g, ''), 'hex'), n: Buffer.from(('01ff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffa' + '51868783 bf2f966b 7fcc0148 f709a5d0' + '3bb5c9b8 899c47ae bb6fb71e 91386409'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + '9c648139 053fb521 f828af60 6b4d3dba' + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + '3348b3c1 856a429b f97e7e31 c2e5bd66' + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + '98f54449 579b4468 17afbd17 273e662c' + '97ee7299 5ef42640 c550b901 3fad0761' + '353c7086 a272c240 88be9476 9fd16650'). replace(/ /g, ''), 'hex') } }; module.exports = { info: algInfo, privInfo: algPrivInfo, hashAlgs: hashAlgs, curves: curves }; /***/ }), /* 99 */, /* 100 */, /* 101 */, /* 102 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; // For internal use, subject to change. var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; result["default"] = mod; return result; }; Object.defineProperty(exports, "__esModule", { value: true }); // We use any as a valid input type /* eslint-disable @typescript-eslint/no-explicit-any */ const fs = __importStar(__webpack_require__(747)); const os = __importStar(__webpack_require__(87)); const utils_1 = __webpack_require__(82); function issueCommand(command, message) { const filePath = process.env[`GITHUB_${command}`]; if (!filePath) { throw new Error(`Unable to find environment variable for file command ${command}`); } if (!fs.existsSync(filePath)) { throw new Error(`Missing file at path: ${filePath}`); } fs.appendFileSync(filePath, `${utils_1.toCommandValue(message)}${os.EOL}`, { encoding: 'utf8' }); } exports.issueCommand = issueCommand; //# sourceMappingURL=file-command.js.map /***/ }), /* 103 */, /* 104 */ /***/ (function(__unusedmodule, __unusedexports, __webpack_require__) { const core = __webpack_require__(470); const exec = __webpack_require__(986); const fs = __webpack_require__(747); const request = __webpack_require__(335); let fail_ci; let verbose; try { const name = core.getInput("name"); const token = core.getInput("token"); const flags = core.getInput("flags"); const file = core.getInput("file"); const files = core.getInput("files"); const env_vars = core.getInput("env_vars"); const dir = core.getInput("directory"); const write_path = core.getInput("path_to_write_report"); const working_dir = core.getInput("working-directory"); const xcode_derived_data = core.getInput("xcode_derived_data"); const xcode_package = core.getInput("xcode_package"); fail_ci = core.getInput("fail_ci_if_error").toLowerCase(); verbose = core.getInput("verbose").toLowerCase(); if ( fail_ci === "yes" || fail_ci === "y" || fail_ci === "true" || fail_ci === "t" || fail_ci === "1" ) { fail_ci = true; } else { fail_ci = false; } if ( verbose === "yes" || verbose === "y" || verbose === "true" || verbose === "t" || verbose === "1" ) { verbose = true; } else { verbose = false; } request({ json: false, maxAttempts: 10, timeout: 3000, url: "https://codecov.io/bash" }, (error, response, body) => { try { if (error && fail_ci) { throw error; } else if (error) { core.warning(`Codecov warning: ${error.message}`); } fs.writeFile("codecov.sh", body, err => { if (err && fail_ci) { throw err; } else if (err) { core.warning(`Codecov warning: ${err.message}`); } let output = ""; let execError = ""; const options = {}; options.listeners = { stdout: data => { output += data.toString(); }, stderr: data => { execError += data.toString(); } }; options.env = Object.assign(process.env, { GITHUB_ACTION: process.env.GITHUB_ACTION, GITHUB_RUN_ID: process.env.GITHUB_RUN_ID, GITHUB_REF: process.env.GITHUB_REF, GITHUB_REPOSITORY: process.env.GITHUB_REPOSITORY, GITHUB_SHA: process.env.GITHUB_SHA, GITHUB_HEAD_REF: process.env.GITHUB_HEAD_REF || '' }); if(token){ options.env.CODECOV_TOKEN = token } const env_vars_arg = [] for (let env_var of env_vars.split(",")) { let env_var_clean = env_var.trim(); if (env_var_clean) { options.env[env_var_clean] = process.env[env_var_clean]; env_vars_arg.push(env_var_clean) } } const execArgs = ["codecov.sh"]; execArgs.push("-Q", "github-action"); if (file) { execArgs.push( "-f", `${file}` ); } if (files) { files.split(',').forEach(f => { execArgs.push( "-f", `${f}` ); }); } if (dir) { execArgs.push( "-s", `${dir}` ); } execArgs.push( "-n", `${name}`, "-F", `${flags}` ); if (fail_ci) { execArgs.push( "-Z" ); } if (env_vars_arg.length) { execArgs.push( "-e", env_vars_arg.join(",") ); } if (write_path) { execArgs.push( "-q", `${write_path}` ); } if (verbose) { execArgs.push( "-v" ); } if (working_dir) { options.cwd = working_dir; } if (xcode_derived_data) { execArgs.push( "-D", `${xcode_derived_data}` ); } if (xcode_package) { execArgs.push( "-J", `${xcode_package}` ); } exec.exec("bash", execArgs, options) .catch(err => { if (fail_ci) { core.setFailed( `Codecov failed with the following error: ${err.message}` ); } else { core.warning(`Codecov warning: ${err.message}`); } }) .then(() => { unlinkFile(); }); const unlinkFile = () => { fs.unlink("codecov.sh", err => { if (err && fail_ci) { throw err; } else if (err) { core.warning(`Codecov warning: ${err.message}`); } }); }; }); } catch (error) { core.setFailed( `Codecov failed with the following error: ${error.message}` ); } }); } catch (error) { if (fail_ci) { core.setFailed(`Codecov failed with the following error: ${error.message}`); } else { core.warning(`Codecov warning: ${error.message}`); } } /***/ }), /* 105 */, /* 106 */, /* 107 */ /***/ (function(module) { "use strict"; module.exports = function generate_allOf(it, $keyword, $ruleType) { var out = ' '; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $currentBaseId = $it.baseId, $allSchemasEmpty = true; var arr1 = $schema; if (arr1) { var $sch, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $sch = arr1[$i += 1]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { $allSchemasEmpty = false; $it.schema = $sch; $it.schemaPath = $schemaPath + '[' + $i + ']'; $it.errSchemaPath = $errSchemaPath + '/' + $i; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } } if ($breakOnError) { if ($allSchemasEmpty) { out += ' if (true) { '; } else { out += ' ' + ($closingBraces.slice(0, -1)) + ' '; } } out = it.util.cleanUpCode(out); return out; } /***/ }), /* 108 */, /* 109 */, /* 110 */, /* 111 */, /* 112 */, /* 113 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { var crypto = __webpack_require__(417) function sha (key, body, algorithm) { return crypto.createHmac(algorithm, key).update(body).digest('base64') } function rsa (key, body) { return crypto.createSign('RSA-SHA1').update(body).sign(key, 'base64') } function rfc3986 (str) { return encodeURIComponent(str) .replace(/!/g,'%21') .replace(/\*/g,'%2A') .replace(/\(/g,'%28') .replace(/\)/g,'%29') .replace(/'/g,'%27') } // Maps object to bi-dimensional array // Converts { foo: 'A', bar: [ 'b', 'B' ]} to // [ ['foo', 'A'], ['bar', 'b'], ['bar', 'B'] ] function map (obj) { var key, val, arr = [] for (key in obj) { val = obj[key] if (Array.isArray(val)) for (var i = 0; i < val.length; i++) arr.push([key, val[i]]) else if (typeof val === 'object') for (var prop in val) arr.push([key + '[' + prop + ']', val[prop]]) else arr.push([key, val]) } return arr } // Compare function for sort function compare (a, b) { return a > b ? 1 : a < b ? -1 : 0 } function generateBase (httpMethod, base_uri, params) { // adapted from https://dev.twitter.com/docs/auth/oauth and // https://dev.twitter.com/docs/auth/creating-signature // Parameter normalization // http://tools.ietf.org/html/rfc5849#section-3.4.1.3.2 var normalized = map(params) // 1. First, the name and value of each parameter are encoded .map(function (p) { return [ rfc3986(p[0]), rfc3986(p[1] || '') ] }) // 2. The parameters are sorted by name, using ascending byte value // ordering. If two or more parameters share the same name, they // are sorted by their value. .sort(function (a, b) { return compare(a[0], b[0]) || compare(a[1], b[1]) }) // 3. The name of each parameter is concatenated to its corresponding // value using an "=" character (ASCII code 61) as a separator, even // if the value is empty. .map(function (p) { return p.join('=') }) // 4. The sorted name/value pairs are concatenated together into a // single string by using an "&" character (ASCII code 38) as // separator. .join('&') var base = [ rfc3986(httpMethod ? httpMethod.toUpperCase() : 'GET'), rfc3986(base_uri), rfc3986(normalized) ].join('&') return base } function hmacsign (httpMethod, base_uri, params, consumer_secret, token_secret) { var base = generateBase(httpMethod, base_uri, params) var key = [ consumer_secret || '', token_secret || '' ].map(rfc3986).join('&') return sha(key, base, 'sha1') } function hmacsign256 (httpMethod, base_uri, params, consumer_secret, token_secret) { var base = generateBase(httpMethod, base_uri, params) var key = [ consumer_secret || '', token_secret || '' ].map(rfc3986).join('&') return sha(key, base, 'sha256') } function rsasign (httpMethod, base_uri, params, private_key, token_secret) { var base = generateBase(httpMethod, base_uri, params) var key = private_key || '' return rsa(key, base) } function plaintext (consumer_secret, token_secret) { var key = [ consumer_secret || '', token_secret || '' ].map(rfc3986).join('&') return key } function sign (signMethod, httpMethod, base_uri, params, consumer_secret, token_secret) { var method var skipArgs = 1 switch (signMethod) { case 'RSA-SHA1': method = rsasign break case 'HMAC-SHA1': method = hmacsign break case 'HMAC-SHA256': method = hmacsign256 break case 'PLAINTEXT': method = plaintext skipArgs = 4 break default: throw new Error('Signature method not supported: ' + signMethod) } return method.apply(null, [].slice.call(arguments, skipArgs)) } exports.hmacsign = hmacsign exports.hmacsign256 = hmacsign256 exports.rsasign = rsasign exports.plaintext = plaintext exports.sign = sign exports.rfc3986 = rfc3986 exports.generateBase = generateBase /***/ }), /* 114 */, /* 115 */, /* 116 */, /* 117 */, /* 118 */, /* 119 */, /* 120 */, /* 121 */, /* 122 */, /* 123 */, /* 124 */, /* 125 */, /* 126 */, /* 127 */, /* 128 */, /* 129 */ /***/ (function(module) { module.exports = require("child_process"); /***/ }), /* 130 */, /* 131 */, /* 132 */, /* 133 */, /* 134 */, /* 135 */, /* 136 */, /* 137 */, /* 138 */, /* 139 */ /***/ (function(module) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { return { pending: toPendingState, fulfilled: toFulfilledState, rejected: toRejectedState, inspect: inspect }; function toPendingState() { return { state: 'pending' }; } function toRejectedState(e) { return { state: 'rejected', reason: e }; } function toFulfilledState(x) { return { state: 'fulfilled', value: x }; } function inspect(handler) { var state = handler.state(); return state === 0 ? toPendingState() : state > 0 ? toFulfilledState(handler.value) : toRejectedState(handler.value); } }); }(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); /***/ }), /* 140 */ /***/ (function(module) { module.exports = {"$id":"afterRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), /* 141 */, /* 142 */, /* 143 */, /* 144 */, /* 145 */, /* 146 */, /* 147 */ /***/ (function(module) { // API module.exports = state; /** * Creates initial state object * for iteration over list * * @param {array|object} list - list to iterate over * @param {function|null} sortMethod - function to use for keys sort, * or `null` to keep them as is * @returns {object} - initial state object */ function state(list, sortMethod) { var isNamedList = !Array.isArray(list) , initState = { index : 0, keyedList: isNamedList || sortMethod ? Object.keys(list) : null, jobs : {}, results : isNamedList ? {} : [], size : isNamedList ? Object.keys(list).length : list.length } ; if (sortMethod) { // sort array keys based on it's values // sort object's keys just on own merit initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) { return sortMethod(list[a], list[b]); }); } return initState; } /***/ }), /* 148 */, /* 149 */ /***/ (function(module, exports, __webpack_require__) { /* eslint-disable node/no-deprecated-api */ var buffer = __webpack_require__(293) var Buffer = buffer.Buffer // alternative to using Object.keys for old browsers function copyProps (src, dst) { for (var key in src) { dst[key] = src[key] } } if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { module.exports = buffer } else { // Copy properties from require('buffer') copyProps(buffer, exports) exports.Buffer = SafeBuffer } function SafeBuffer (arg, encodingOrOffset, length) { return Buffer(arg, encodingOrOffset, length) } SafeBuffer.prototype = Object.create(Buffer.prototype) // Copy static methods from Buffer copyProps(Buffer, SafeBuffer) SafeBuffer.from = function (arg, encodingOrOffset, length) { if (typeof arg === 'number') { throw new TypeError('Argument must not be a number') } return Buffer(arg, encodingOrOffset, length) } SafeBuffer.alloc = function (size, fill, encoding) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } var buf = Buffer(size) if (fill !== undefined) { if (typeof encoding === 'string') { buf.fill(fill, encoding) } else { buf.fill(fill) } } else { buf.fill(0) } return buf } SafeBuffer.allocUnsafe = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return Buffer(size) } SafeBuffer.allocUnsafeSlow = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return buffer.SlowBuffer(size) } /***/ }), /* 150 */, /* 151 */, /* 152 */ /***/ (function(module, __unusedexports, __webpack_require__) { var Stream = __webpack_require__(413).Stream; var util = __webpack_require__(669); module.exports = DelayedStream; function DelayedStream() { this.source = null; this.dataSize = 0; this.maxDataSize = 1024 * 1024; this.pauseStream = true; this._maxDataSizeExceeded = false; this._released = false; this._bufferedEvents = []; } util.inherits(DelayedStream, Stream); DelayedStream.create = function(source, options) { var delayedStream = new this(); options = options || {}; for (var option in options) { delayedStream[option] = options[option]; } delayedStream.source = source; var realEmit = source.emit; source.emit = function() { delayedStream._handleEmit(arguments); return realEmit.apply(source, arguments); }; source.on('error', function() {}); if (delayedStream.pauseStream) { source.pause(); } return delayedStream; }; Object.defineProperty(DelayedStream.prototype, 'readable', { configurable: true, enumerable: true, get: function() { return this.source.readable; } }); DelayedStream.prototype.setEncoding = function() { return this.source.setEncoding.apply(this.source, arguments); }; DelayedStream.prototype.resume = function() { if (!this._released) { this.release(); } this.source.resume(); }; DelayedStream.prototype.pause = function() { this.source.pause(); }; DelayedStream.prototype.release = function() { this._released = true; this._bufferedEvents.forEach(function(args) { this.emit.apply(this, args); }.bind(this)); this._bufferedEvents = []; }; DelayedStream.prototype.pipe = function() { var r = Stream.prototype.pipe.apply(this, arguments); this.resume(); return r; }; DelayedStream.prototype._handleEmit = function(args) { if (this._released) { this.emit.apply(this, args); return; } if (args[0] === 'data') { this.dataSize += args[1].length; this._checkIfMaxDataSizeExceeded(); } this._bufferedEvents.push(args); }; DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { if (this._maxDataSizeExceeded) { return; } if (this.dataSize <= this.maxDataSize) { return; } this._maxDataSizeExceeded = true; var message = 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' this.emit('error', new Error(message)); }; /***/ }), /* 153 */, /* 154 */ /***/ (function(module) { "use strict"; module.exports = function generate_contains(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $idx = 'i' + $lvl, $dataNxt = $it.dataLevel = it.dataLevel + 1, $nextData = 'data' + $dataNxt, $currentBaseId = it.baseId, $nonEmptySchema = (it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all)); out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; if ($nonEmptySchema) { var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); var $passData = $data + '[' + $idx + ']'; $it.dataPathArr[$dataNxt] = $idx; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } out += ' if (' + ($nextValid) + ') break; } '; it.compositeRule = $it.compositeRule = $wasComposite; out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {'; } else { out += ' if (' + ($data) + '.length == 0) {'; } var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'should contain a valid item\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else { '; if ($nonEmptySchema) { out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; } if (it.opts.allErrors) { out += ' } '; } out = it.util.cleanUpCode(out); return out; } /***/ }), /* 155 */, /* 156 */, /* 157 */ /***/ (function(module, __unusedexports, __webpack_require__) { var async = __webpack_require__(751) , abort = __webpack_require__(566) ; // API module.exports = iterate; /** * Iterates over each job object * * @param {array|object} list - array or object (named list) to iterate over * @param {function} iterator - iterator to run * @param {object} state - current job status * @param {function} callback - invoked when all elements processed */ function iterate(list, iterator, state, callback) { // store current index var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; state.jobs[key] = runJob(iterator, key, list[key], function(error, output) { // don't repeat yourself // skip secondary callbacks if (!(key in state.jobs)) { return; } // clean up jobs delete state.jobs[key]; if (error) { // don't process rest of the results // stop still active jobs // and reset the list abort(state); } else { state.results[key] = output; } // return salvaged results callback(error, state.results); }); } /** * Runs iterator over provided job element * * @param {function} iterator - iterator to invoke * @param {string|number} key - key/index of the element in the list of jobs * @param {mixed} item - job description * @param {function} callback - invoked after iterator is done with the job * @returns {function|mixed} - job abort function or something else */ function runJob(iterator, key, item, callback) { var aborter; // allow shortcut if iterator expects only two arguments if (iterator.length == 2) { aborter = iterator(item, async(callback)); } // otherwise go with full three arguments else { aborter = iterator(item, key, async(callback)); } return aborter; } /***/ }), /* 158 */, /* 159 */, /* 160 */, /* 161 */, /* 162 */ /***/ (function(module) { module.exports = {"$id":"content.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["size","mimeType"],"properties":{"size":{"type":"integer"},"compression":{"type":"integer"},"mimeType":{"type":"string"},"text":{"type":"string"},"encoding":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /* 163 */, /* 164 */, /* 165 */, /* 166 */, /* 167 */, /* 168 */, /* 169 */, /* 170 */, /* 171 */, /* 172 */, /* 173 */, /* 174 */, /* 175 */, /* 176 */, /* 177 */, /* 178 */, /* 179 */, /* 180 */, /* 181 */ /***/ (function(module) { module.exports = {"$id":"pageTimings.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","properties":{"onContentLoad":{"type":"number","min":-1},"onLoad":{"type":"number","min":-1},"comment":{"type":"string"}}}; /***/ }), /* 182 */, /* 183 */, /* 184 */, /* 185 */, /* 186 */, /* 187 */, /* 188 */, /* 189 */, /* 190 */, /* 191 */ /***/ (function(module) { module.exports = require("querystring"); /***/ }), /* 192 */, /* 193 */, /* 194 */, /* 195 */, /* 196 */ /***/ (function(module, __unusedexports, __webpack_require__) { (function(nacl) { 'use strict'; // Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. // Public domain. // // Implementation derived from TweetNaCl version 20140427. // See for details: http://tweetnacl.cr.yp.to/ var gf = function(init) { var i, r = new Float64Array(16); if (init) for (i = 0; i < init.length; i++) r[i] = init[i]; return r; }; // Pluggable, initialized in high-level API below. var randombytes = function(/* x, n */) { throw new Error('no PRNG'); }; var _0 = new Uint8Array(16); var _9 = new Uint8Array(32); _9[0] = 9; var gf0 = gf(), gf1 = gf([1]), _121665 = gf([0xdb41, 1]), D = gf([0x78a3, 0x1359, 0x4dca, 0x75eb, 0xd8ab, 0x4141, 0x0a4d, 0x0070, 0xe898, 0x7779, 0x4079, 0x8cc7, 0xfe73, 0x2b6f, 0x6cee, 0x5203]), D2 = gf([0xf159, 0x26b2, 0x9b94, 0xebd6, 0xb156, 0x8283, 0x149a, 0x00e0, 0xd130, 0xeef3, 0x80f2, 0x198e, 0xfce7, 0x56df, 0xd9dc, 0x2406]), X = gf([0xd51a, 0x8f25, 0x2d60, 0xc956, 0xa7b2, 0x9525, 0xc760, 0x692c, 0xdc5c, 0xfdd6, 0xe231, 0xc0a4, 0x53fe, 0xcd6e, 0x36d3, 0x2169]), Y = gf([0x6658, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666]), I = gf([0xa0b0, 0x4a0e, 0x1b27, 0xc4ee, 0xe478, 0xad2f, 0x1806, 0x2f43, 0xd7a7, 0x3dfb, 0x0099, 0x2b4d, 0xdf0b, 0x4fc1, 0x2480, 0x2b83]); function ts64(x, i, h, l) { x[i] = (h >> 24) & 0xff; x[i+1] = (h >> 16) & 0xff; x[i+2] = (h >> 8) & 0xff; x[i+3] = h & 0xff; x[i+4] = (l >> 24) & 0xff; x[i+5] = (l >> 16) & 0xff; x[i+6] = (l >> 8) & 0xff; x[i+7] = l & 0xff; } function vn(x, xi, y, yi, n) { var i,d = 0; for (i = 0; i < n; i++) d |= x[xi+i]^y[yi+i]; return (1 & ((d - 1) >>> 8)) - 1; } function crypto_verify_16(x, xi, y, yi) { return vn(x,xi,y,yi,16); } function crypto_verify_32(x, xi, y, yi) { return vn(x,xi,y,yi,32); } function core_salsa20(o, p, k, c) { var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, x15 = j15, u; for (var i = 0; i < 20; i += 2) { u = x0 + x12 | 0; x4 ^= u<<7 | u>>>(32-7); u = x4 + x0 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x4 | 0; x12 ^= u<<13 | u>>>(32-13); u = x12 + x8 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x1 | 0; x9 ^= u<<7 | u>>>(32-7); u = x9 + x5 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x9 | 0; x1 ^= u<<13 | u>>>(32-13); u = x1 + x13 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x6 | 0; x14 ^= u<<7 | u>>>(32-7); u = x14 + x10 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x14 | 0; x6 ^= u<<13 | u>>>(32-13); u = x6 + x2 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x11 | 0; x3 ^= u<<7 | u>>>(32-7); u = x3 + x15 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x3 | 0; x11 ^= u<<13 | u>>>(32-13); u = x11 + x7 | 0; x15 ^= u<<18 | u>>>(32-18); u = x0 + x3 | 0; x1 ^= u<<7 | u>>>(32-7); u = x1 + x0 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x1 | 0; x3 ^= u<<13 | u>>>(32-13); u = x3 + x2 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x4 | 0; x6 ^= u<<7 | u>>>(32-7); u = x6 + x5 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x6 | 0; x4 ^= u<<13 | u>>>(32-13); u = x4 + x7 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x9 | 0; x11 ^= u<<7 | u>>>(32-7); u = x11 + x10 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x11 | 0; x9 ^= u<<13 | u>>>(32-13); u = x9 + x8 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x14 | 0; x12 ^= u<<7 | u>>>(32-7); u = x12 + x15 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x12 | 0; x14 ^= u<<13 | u>>>(32-13); u = x14 + x13 | 0; x15 ^= u<<18 | u>>>(32-18); } x0 = x0 + j0 | 0; x1 = x1 + j1 | 0; x2 = x2 + j2 | 0; x3 = x3 + j3 | 0; x4 = x4 + j4 | 0; x5 = x5 + j5 | 0; x6 = x6 + j6 | 0; x7 = x7 + j7 | 0; x8 = x8 + j8 | 0; x9 = x9 + j9 | 0; x10 = x10 + j10 | 0; x11 = x11 + j11 | 0; x12 = x12 + j12 | 0; x13 = x13 + j13 | 0; x14 = x14 + j14 | 0; x15 = x15 + j15 | 0; o[ 0] = x0 >>> 0 & 0xff; o[ 1] = x0 >>> 8 & 0xff; o[ 2] = x0 >>> 16 & 0xff; o[ 3] = x0 >>> 24 & 0xff; o[ 4] = x1 >>> 0 & 0xff; o[ 5] = x1 >>> 8 & 0xff; o[ 6] = x1 >>> 16 & 0xff; o[ 7] = x1 >>> 24 & 0xff; o[ 8] = x2 >>> 0 & 0xff; o[ 9] = x2 >>> 8 & 0xff; o[10] = x2 >>> 16 & 0xff; o[11] = x2 >>> 24 & 0xff; o[12] = x3 >>> 0 & 0xff; o[13] = x3 >>> 8 & 0xff; o[14] = x3 >>> 16 & 0xff; o[15] = x3 >>> 24 & 0xff; o[16] = x4 >>> 0 & 0xff; o[17] = x4 >>> 8 & 0xff; o[18] = x4 >>> 16 & 0xff; o[19] = x4 >>> 24 & 0xff; o[20] = x5 >>> 0 & 0xff; o[21] = x5 >>> 8 & 0xff; o[22] = x5 >>> 16 & 0xff; o[23] = x5 >>> 24 & 0xff; o[24] = x6 >>> 0 & 0xff; o[25] = x6 >>> 8 & 0xff; o[26] = x6 >>> 16 & 0xff; o[27] = x6 >>> 24 & 0xff; o[28] = x7 >>> 0 & 0xff; o[29] = x7 >>> 8 & 0xff; o[30] = x7 >>> 16 & 0xff; o[31] = x7 >>> 24 & 0xff; o[32] = x8 >>> 0 & 0xff; o[33] = x8 >>> 8 & 0xff; o[34] = x8 >>> 16 & 0xff; o[35] = x8 >>> 24 & 0xff; o[36] = x9 >>> 0 & 0xff; o[37] = x9 >>> 8 & 0xff; o[38] = x9 >>> 16 & 0xff; o[39] = x9 >>> 24 & 0xff; o[40] = x10 >>> 0 & 0xff; o[41] = x10 >>> 8 & 0xff; o[42] = x10 >>> 16 & 0xff; o[43] = x10 >>> 24 & 0xff; o[44] = x11 >>> 0 & 0xff; o[45] = x11 >>> 8 & 0xff; o[46] = x11 >>> 16 & 0xff; o[47] = x11 >>> 24 & 0xff; o[48] = x12 >>> 0 & 0xff; o[49] = x12 >>> 8 & 0xff; o[50] = x12 >>> 16 & 0xff; o[51] = x12 >>> 24 & 0xff; o[52] = x13 >>> 0 & 0xff; o[53] = x13 >>> 8 & 0xff; o[54] = x13 >>> 16 & 0xff; o[55] = x13 >>> 24 & 0xff; o[56] = x14 >>> 0 & 0xff; o[57] = x14 >>> 8 & 0xff; o[58] = x14 >>> 16 & 0xff; o[59] = x14 >>> 24 & 0xff; o[60] = x15 >>> 0 & 0xff; o[61] = x15 >>> 8 & 0xff; o[62] = x15 >>> 16 & 0xff; o[63] = x15 >>> 24 & 0xff; } function core_hsalsa20(o,p,k,c) { var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, x15 = j15, u; for (var i = 0; i < 20; i += 2) { u = x0 + x12 | 0; x4 ^= u<<7 | u>>>(32-7); u = x4 + x0 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x4 | 0; x12 ^= u<<13 | u>>>(32-13); u = x12 + x8 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x1 | 0; x9 ^= u<<7 | u>>>(32-7); u = x9 + x5 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x9 | 0; x1 ^= u<<13 | u>>>(32-13); u = x1 + x13 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x6 | 0; x14 ^= u<<7 | u>>>(32-7); u = x14 + x10 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x14 | 0; x6 ^= u<<13 | u>>>(32-13); u = x6 + x2 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x11 | 0; x3 ^= u<<7 | u>>>(32-7); u = x3 + x15 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x3 | 0; x11 ^= u<<13 | u>>>(32-13); u = x11 + x7 | 0; x15 ^= u<<18 | u>>>(32-18); u = x0 + x3 | 0; x1 ^= u<<7 | u>>>(32-7); u = x1 + x0 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x1 | 0; x3 ^= u<<13 | u>>>(32-13); u = x3 + x2 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x4 | 0; x6 ^= u<<7 | u>>>(32-7); u = x6 + x5 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x6 | 0; x4 ^= u<<13 | u>>>(32-13); u = x4 + x7 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x9 | 0; x11 ^= u<<7 | u>>>(32-7); u = x11 + x10 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x11 | 0; x9 ^= u<<13 | u>>>(32-13); u = x9 + x8 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x14 | 0; x12 ^= u<<7 | u>>>(32-7); u = x12 + x15 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x12 | 0; x14 ^= u<<13 | u>>>(32-13); u = x14 + x13 | 0; x15 ^= u<<18 | u>>>(32-18); } o[ 0] = x0 >>> 0 & 0xff; o[ 1] = x0 >>> 8 & 0xff; o[ 2] = x0 >>> 16 & 0xff; o[ 3] = x0 >>> 24 & 0xff; o[ 4] = x5 >>> 0 & 0xff; o[ 5] = x5 >>> 8 & 0xff; o[ 6] = x5 >>> 16 & 0xff; o[ 7] = x5 >>> 24 & 0xff; o[ 8] = x10 >>> 0 & 0xff; o[ 9] = x10 >>> 8 & 0xff; o[10] = x10 >>> 16 & 0xff; o[11] = x10 >>> 24 & 0xff; o[12] = x15 >>> 0 & 0xff; o[13] = x15 >>> 8 & 0xff; o[14] = x15 >>> 16 & 0xff; o[15] = x15 >>> 24 & 0xff; o[16] = x6 >>> 0 & 0xff; o[17] = x6 >>> 8 & 0xff; o[18] = x6 >>> 16 & 0xff; o[19] = x6 >>> 24 & 0xff; o[20] = x7 >>> 0 & 0xff; o[21] = x7 >>> 8 & 0xff; o[22] = x7 >>> 16 & 0xff; o[23] = x7 >>> 24 & 0xff; o[24] = x8 >>> 0 & 0xff; o[25] = x8 >>> 8 & 0xff; o[26] = x8 >>> 16 & 0xff; o[27] = x8 >>> 24 & 0xff; o[28] = x9 >>> 0 & 0xff; o[29] = x9 >>> 8 & 0xff; o[30] = x9 >>> 16 & 0xff; o[31] = x9 >>> 24 & 0xff; } function crypto_core_salsa20(out,inp,k,c) { core_salsa20(out,inp,k,c); } function crypto_core_hsalsa20(out,inp,k,c) { core_hsalsa20(out,inp,k,c); } var sigma = new Uint8Array([101, 120, 112, 97, 110, 100, 32, 51, 50, 45, 98, 121, 116, 101, 32, 107]); // "expand 32-byte k" function crypto_stream_salsa20_xor(c,cpos,m,mpos,b,n,k) { var z = new Uint8Array(16), x = new Uint8Array(64); var u, i; for (i = 0; i < 16; i++) z[i] = 0; for (i = 0; i < 8; i++) z[i] = n[i]; while (b >= 64) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < 64; i++) c[cpos+i] = m[mpos+i] ^ x[i]; u = 1; for (i = 8; i < 16; i++) { u = u + (z[i] & 0xff) | 0; z[i] = u & 0xff; u >>>= 8; } b -= 64; cpos += 64; mpos += 64; } if (b > 0) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < b; i++) c[cpos+i] = m[mpos+i] ^ x[i]; } return 0; } function crypto_stream_salsa20(c,cpos,b,n,k) { var z = new Uint8Array(16), x = new Uint8Array(64); var u, i; for (i = 0; i < 16; i++) z[i] = 0; for (i = 0; i < 8; i++) z[i] = n[i]; while (b >= 64) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < 64; i++) c[cpos+i] = x[i]; u = 1; for (i = 8; i < 16; i++) { u = u + (z[i] & 0xff) | 0; z[i] = u & 0xff; u >>>= 8; } b -= 64; cpos += 64; } if (b > 0) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < b; i++) c[cpos+i] = x[i]; } return 0; } function crypto_stream(c,cpos,d,n,k) { var s = new Uint8Array(32); crypto_core_hsalsa20(s,n,k,sigma); var sn = new Uint8Array(8); for (var i = 0; i < 8; i++) sn[i] = n[i+16]; return crypto_stream_salsa20(c,cpos,d,sn,s); } function crypto_stream_xor(c,cpos,m,mpos,d,n,k) { var s = new Uint8Array(32); crypto_core_hsalsa20(s,n,k,sigma); var sn = new Uint8Array(8); for (var i = 0; i < 8; i++) sn[i] = n[i+16]; return crypto_stream_salsa20_xor(c,cpos,m,mpos,d,sn,s); } /* * Port of Andrew Moon's Poly1305-donna-16. Public domain. * https://github.com/floodyberry/poly1305-donna */ var poly1305 = function(key) { this.buffer = new Uint8Array(16); this.r = new Uint16Array(10); this.h = new Uint16Array(10); this.pad = new Uint16Array(8); this.leftover = 0; this.fin = 0; var t0, t1, t2, t3, t4, t5, t6, t7; t0 = key[ 0] & 0xff | (key[ 1] & 0xff) << 8; this.r[0] = ( t0 ) & 0x1fff; t1 = key[ 2] & 0xff | (key[ 3] & 0xff) << 8; this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; t2 = key[ 4] & 0xff | (key[ 5] & 0xff) << 8; this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; t3 = key[ 6] & 0xff | (key[ 7] & 0xff) << 8; this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; t4 = key[ 8] & 0xff | (key[ 9] & 0xff) << 8; this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; this.r[5] = ((t4 >>> 1)) & 0x1ffe; t5 = key[10] & 0xff | (key[11] & 0xff) << 8; this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; t6 = key[12] & 0xff | (key[13] & 0xff) << 8; this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; t7 = key[14] & 0xff | (key[15] & 0xff) << 8; this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; this.r[9] = ((t7 >>> 5)) & 0x007f; this.pad[0] = key[16] & 0xff | (key[17] & 0xff) << 8; this.pad[1] = key[18] & 0xff | (key[19] & 0xff) << 8; this.pad[2] = key[20] & 0xff | (key[21] & 0xff) << 8; this.pad[3] = key[22] & 0xff | (key[23] & 0xff) << 8; this.pad[4] = key[24] & 0xff | (key[25] & 0xff) << 8; this.pad[5] = key[26] & 0xff | (key[27] & 0xff) << 8; this.pad[6] = key[28] & 0xff | (key[29] & 0xff) << 8; this.pad[7] = key[30] & 0xff | (key[31] & 0xff) << 8; }; poly1305.prototype.blocks = function(m, mpos, bytes) { var hibit = this.fin ? 0 : (1 << 11); var t0, t1, t2, t3, t4, t5, t6, t7, c; var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; var h0 = this.h[0], h1 = this.h[1], h2 = this.h[2], h3 = this.h[3], h4 = this.h[4], h5 = this.h[5], h6 = this.h[6], h7 = this.h[7], h8 = this.h[8], h9 = this.h[9]; var r0 = this.r[0], r1 = this.r[1], r2 = this.r[2], r3 = this.r[3], r4 = this.r[4], r5 = this.r[5], r6 = this.r[6], r7 = this.r[7], r8 = this.r[8], r9 = this.r[9]; while (bytes >= 16) { t0 = m[mpos+ 0] & 0xff | (m[mpos+ 1] & 0xff) << 8; h0 += ( t0 ) & 0x1fff; t1 = m[mpos+ 2] & 0xff | (m[mpos+ 3] & 0xff) << 8; h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; t2 = m[mpos+ 4] & 0xff | (m[mpos+ 5] & 0xff) << 8; h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; t3 = m[mpos+ 6] & 0xff | (m[mpos+ 7] & 0xff) << 8; h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; t4 = m[mpos+ 8] & 0xff | (m[mpos+ 9] & 0xff) << 8; h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; h5 += ((t4 >>> 1)) & 0x1fff; t5 = m[mpos+10] & 0xff | (m[mpos+11] & 0xff) << 8; h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; t6 = m[mpos+12] & 0xff | (m[mpos+13] & 0xff) << 8; h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; t7 = m[mpos+14] & 0xff | (m[mpos+15] & 0xff) << 8; h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; h9 += ((t7 >>> 5)) | hibit; c = 0; d0 = c; d0 += h0 * r0; d0 += h1 * (5 * r9); d0 += h2 * (5 * r8); d0 += h3 * (5 * r7); d0 += h4 * (5 * r6); c = (d0 >>> 13); d0 &= 0x1fff; d0 += h5 * (5 * r5); d0 += h6 * (5 * r4); d0 += h7 * (5 * r3); d0 += h8 * (5 * r2); d0 += h9 * (5 * r1); c += (d0 >>> 13); d0 &= 0x1fff; d1 = c; d1 += h0 * r1; d1 += h1 * r0; d1 += h2 * (5 * r9); d1 += h3 * (5 * r8); d1 += h4 * (5 * r7); c = (d1 >>> 13); d1 &= 0x1fff; d1 += h5 * (5 * r6); d1 += h6 * (5 * r5); d1 += h7 * (5 * r4); d1 += h8 * (5 * r3); d1 += h9 * (5 * r2); c += (d1 >>> 13); d1 &= 0x1fff; d2 = c; d2 += h0 * r2; d2 += h1 * r1; d2 += h2 * r0; d2 += h3 * (5 * r9); d2 += h4 * (5 * r8); c = (d2 >>> 13); d2 &= 0x1fff; d2 += h5 * (5 * r7); d2 += h6 * (5 * r6); d2 += h7 * (5 * r5); d2 += h8 * (5 * r4); d2 += h9 * (5 * r3); c += (d2 >>> 13); d2 &= 0x1fff; d3 = c; d3 += h0 * r3; d3 += h1 * r2; d3 += h2 * r1; d3 += h3 * r0; d3 += h4 * (5 * r9); c = (d3 >>> 13); d3 &= 0x1fff; d3 += h5 * (5 * r8); d3 += h6 * (5 * r7); d3 += h7 * (5 * r6); d3 += h8 * (5 * r5); d3 += h9 * (5 * r4); c += (d3 >>> 13); d3 &= 0x1fff; d4 = c; d4 += h0 * r4; d4 += h1 * r3; d4 += h2 * r2; d4 += h3 * r1; d4 += h4 * r0; c = (d4 >>> 13); d4 &= 0x1fff; d4 += h5 * (5 * r9); d4 += h6 * (5 * r8); d4 += h7 * (5 * r7); d4 += h8 * (5 * r6); d4 += h9 * (5 * r5); c += (d4 >>> 13); d4 &= 0x1fff; d5 = c; d5 += h0 * r5; d5 += h1 * r4; d5 += h2 * r3; d5 += h3 * r2; d5 += h4 * r1; c = (d5 >>> 13); d5 &= 0x1fff; d5 += h5 * r0; d5 += h6 * (5 * r9); d5 += h7 * (5 * r8); d5 += h8 * (5 * r7); d5 += h9 * (5 * r6); c += (d5 >>> 13); d5 &= 0x1fff; d6 = c; d6 += h0 * r6; d6 += h1 * r5; d6 += h2 * r4; d6 += h3 * r3; d6 += h4 * r2; c = (d6 >>> 13); d6 &= 0x1fff; d6 += h5 * r1; d6 += h6 * r0; d6 += h7 * (5 * r9); d6 += h8 * (5 * r8); d6 += h9 * (5 * r7); c += (d6 >>> 13); d6 &= 0x1fff; d7 = c; d7 += h0 * r7; d7 += h1 * r6; d7 += h2 * r5; d7 += h3 * r4; d7 += h4 * r3; c = (d7 >>> 13); d7 &= 0x1fff; d7 += h5 * r2; d7 += h6 * r1; d7 += h7 * r0; d7 += h8 * (5 * r9); d7 += h9 * (5 * r8); c += (d7 >>> 13); d7 &= 0x1fff; d8 = c; d8 += h0 * r8; d8 += h1 * r7; d8 += h2 * r6; d8 += h3 * r5; d8 += h4 * r4; c = (d8 >>> 13); d8 &= 0x1fff; d8 += h5 * r3; d8 += h6 * r2; d8 += h7 * r1; d8 += h8 * r0; d8 += h9 * (5 * r9); c += (d8 >>> 13); d8 &= 0x1fff; d9 = c; d9 += h0 * r9; d9 += h1 * r8; d9 += h2 * r7; d9 += h3 * r6; d9 += h4 * r5; c = (d9 >>> 13); d9 &= 0x1fff; d9 += h5 * r4; d9 += h6 * r3; d9 += h7 * r2; d9 += h8 * r1; d9 += h9 * r0; c += (d9 >>> 13); d9 &= 0x1fff; c = (((c << 2) + c)) | 0; c = (c + d0) | 0; d0 = c & 0x1fff; c = (c >>> 13); d1 += c; h0 = d0; h1 = d1; h2 = d2; h3 = d3; h4 = d4; h5 = d5; h6 = d6; h7 = d7; h8 = d8; h9 = d9; mpos += 16; bytes -= 16; } this.h[0] = h0; this.h[1] = h1; this.h[2] = h2; this.h[3] = h3; this.h[4] = h4; this.h[5] = h5; this.h[6] = h6; this.h[7] = h7; this.h[8] = h8; this.h[9] = h9; }; poly1305.prototype.finish = function(mac, macpos) { var g = new Uint16Array(10); var c, mask, f, i; if (this.leftover) { i = this.leftover; this.buffer[i++] = 1; for (; i < 16; i++) this.buffer[i] = 0; this.fin = 1; this.blocks(this.buffer, 0, 16); } c = this.h[1] >>> 13; this.h[1] &= 0x1fff; for (i = 2; i < 10; i++) { this.h[i] += c; c = this.h[i] >>> 13; this.h[i] &= 0x1fff; } this.h[0] += (c * 5); c = this.h[0] >>> 13; this.h[0] &= 0x1fff; this.h[1] += c; c = this.h[1] >>> 13; this.h[1] &= 0x1fff; this.h[2] += c; g[0] = this.h[0] + 5; c = g[0] >>> 13; g[0] &= 0x1fff; for (i = 1; i < 10; i++) { g[i] = this.h[i] + c; c = g[i] >>> 13; g[i] &= 0x1fff; } g[9] -= (1 << 13); mask = (c ^ 1) - 1; for (i = 0; i < 10; i++) g[i] &= mask; mask = ~mask; for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; this.h[0] = ((this.h[0] ) | (this.h[1] << 13) ) & 0xffff; this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10) ) & 0xffff; this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7) ) & 0xffff; this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4) ) & 0xffff; this.h[4] = ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11) ) & 0xffff; this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8) ) & 0xffff; this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5) ) & 0xffff; f = this.h[0] + this.pad[0]; this.h[0] = f & 0xffff; for (i = 1; i < 8; i++) { f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; this.h[i] = f & 0xffff; } mac[macpos+ 0] = (this.h[0] >>> 0) & 0xff; mac[macpos+ 1] = (this.h[0] >>> 8) & 0xff; mac[macpos+ 2] = (this.h[1] >>> 0) & 0xff; mac[macpos+ 3] = (this.h[1] >>> 8) & 0xff; mac[macpos+ 4] = (this.h[2] >>> 0) & 0xff; mac[macpos+ 5] = (this.h[2] >>> 8) & 0xff; mac[macpos+ 6] = (this.h[3] >>> 0) & 0xff; mac[macpos+ 7] = (this.h[3] >>> 8) & 0xff; mac[macpos+ 8] = (this.h[4] >>> 0) & 0xff; mac[macpos+ 9] = (this.h[4] >>> 8) & 0xff; mac[macpos+10] = (this.h[5] >>> 0) & 0xff; mac[macpos+11] = (this.h[5] >>> 8) & 0xff; mac[macpos+12] = (this.h[6] >>> 0) & 0xff; mac[macpos+13] = (this.h[6] >>> 8) & 0xff; mac[macpos+14] = (this.h[7] >>> 0) & 0xff; mac[macpos+15] = (this.h[7] >>> 8) & 0xff; }; poly1305.prototype.update = function(m, mpos, bytes) { var i, want; if (this.leftover) { want = (16 - this.leftover); if (want > bytes) want = bytes; for (i = 0; i < want; i++) this.buffer[this.leftover + i] = m[mpos+i]; bytes -= want; mpos += want; this.leftover += want; if (this.leftover < 16) return; this.blocks(this.buffer, 0, 16); this.leftover = 0; } if (bytes >= 16) { want = bytes - (bytes % 16); this.blocks(m, mpos, want); mpos += want; bytes -= want; } if (bytes) { for (i = 0; i < bytes; i++) this.buffer[this.leftover + i] = m[mpos+i]; this.leftover += bytes; } }; function crypto_onetimeauth(out, outpos, m, mpos, n, k) { var s = new poly1305(k); s.update(m, mpos, n); s.finish(out, outpos); return 0; } function crypto_onetimeauth_verify(h, hpos, m, mpos, n, k) { var x = new Uint8Array(16); crypto_onetimeauth(x,0,m,mpos,n,k); return crypto_verify_16(h,hpos,x,0); } function crypto_secretbox(c,m,d,n,k) { var i; if (d < 32) return -1; crypto_stream_xor(c,0,m,0,d,n,k); crypto_onetimeauth(c, 16, c, 32, d - 32, c); for (i = 0; i < 16; i++) c[i] = 0; return 0; } function crypto_secretbox_open(m,c,d,n,k) { var i; var x = new Uint8Array(32); if (d < 32) return -1; crypto_stream(x,0,32,n,k); if (crypto_onetimeauth_verify(c, 16,c, 32,d - 32,x) !== 0) return -1; crypto_stream_xor(m,0,c,0,d,n,k); for (i = 0; i < 32; i++) m[i] = 0; return 0; } function set25519(r, a) { var i; for (i = 0; i < 16; i++) r[i] = a[i]|0; } function car25519(o) { var i, v, c = 1; for (i = 0; i < 16; i++) { v = o[i] + c + 65535; c = Math.floor(v / 65536); o[i] = v - c * 65536; } o[0] += c-1 + 37 * (c-1); } function sel25519(p, q, b) { var t, c = ~(b-1); for (var i = 0; i < 16; i++) { t = c & (p[i] ^ q[i]); p[i] ^= t; q[i] ^= t; } } function pack25519(o, n) { var i, j, b; var m = gf(), t = gf(); for (i = 0; i < 16; i++) t[i] = n[i]; car25519(t); car25519(t); car25519(t); for (j = 0; j < 2; j++) { m[0] = t[0] - 0xffed; for (i = 1; i < 15; i++) { m[i] = t[i] - 0xffff - ((m[i-1]>>16) & 1); m[i-1] &= 0xffff; } m[15] = t[15] - 0x7fff - ((m[14]>>16) & 1); b = (m[15]>>16) & 1; m[14] &= 0xffff; sel25519(t, m, 1-b); } for (i = 0; i < 16; i++) { o[2*i] = t[i] & 0xff; o[2*i+1] = t[i]>>8; } } function neq25519(a, b) { var c = new Uint8Array(32), d = new Uint8Array(32); pack25519(c, a); pack25519(d, b); return crypto_verify_32(c, 0, d, 0); } function par25519(a) { var d = new Uint8Array(32); pack25519(d, a); return d[0] & 1; } function unpack25519(o, n) { var i; for (i = 0; i < 16; i++) o[i] = n[2*i] + (n[2*i+1] << 8); o[15] &= 0x7fff; } function A(o, a, b) { for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; } function Z(o, a, b) { for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; } function M(o, a, b) { var v, c, t0 = 0, t1 = 0, t2 = 0, t3 = 0, t4 = 0, t5 = 0, t6 = 0, t7 = 0, t8 = 0, t9 = 0, t10 = 0, t11 = 0, t12 = 0, t13 = 0, t14 = 0, t15 = 0, t16 = 0, t17 = 0, t18 = 0, t19 = 0, t20 = 0, t21 = 0, t22 = 0, t23 = 0, t24 = 0, t25 = 0, t26 = 0, t27 = 0, t28 = 0, t29 = 0, t30 = 0, b0 = b[0], b1 = b[1], b2 = b[2], b3 = b[3], b4 = b[4], b5 = b[5], b6 = b[6], b7 = b[7], b8 = b[8], b9 = b[9], b10 = b[10], b11 = b[11], b12 = b[12], b13 = b[13], b14 = b[14], b15 = b[15]; v = a[0]; t0 += v * b0; t1 += v * b1; t2 += v * b2; t3 += v * b3; t4 += v * b4; t5 += v * b5; t6 += v * b6; t7 += v * b7; t8 += v * b8; t9 += v * b9; t10 += v * b10; t11 += v * b11; t12 += v * b12; t13 += v * b13; t14 += v * b14; t15 += v * b15; v = a[1]; t1 += v * b0; t2 += v * b1; t3 += v * b2; t4 += v * b3; t5 += v * b4; t6 += v * b5; t7 += v * b6; t8 += v * b7; t9 += v * b8; t10 += v * b9; t11 += v * b10; t12 += v * b11; t13 += v * b12; t14 += v * b13; t15 += v * b14; t16 += v * b15; v = a[2]; t2 += v * b0; t3 += v * b1; t4 += v * b2; t5 += v * b3; t6 += v * b4; t7 += v * b5; t8 += v * b6; t9 += v * b7; t10 += v * b8; t11 += v * b9; t12 += v * b10; t13 += v * b11; t14 += v * b12; t15 += v * b13; t16 += v * b14; t17 += v * b15; v = a[3]; t3 += v * b0; t4 += v * b1; t5 += v * b2; t6 += v * b3; t7 += v * b4; t8 += v * b5; t9 += v * b6; t10 += v * b7; t11 += v * b8; t12 += v * b9; t13 += v * b10; t14 += v * b11; t15 += v * b12; t16 += v * b13; t17 += v * b14; t18 += v * b15; v = a[4]; t4 += v * b0; t5 += v * b1; t6 += v * b2; t7 += v * b3; t8 += v * b4; t9 += v * b5; t10 += v * b6; t11 += v * b7; t12 += v * b8; t13 += v * b9; t14 += v * b10; t15 += v * b11; t16 += v * b12; t17 += v * b13; t18 += v * b14; t19 += v * b15; v = a[5]; t5 += v * b0; t6 += v * b1; t7 += v * b2; t8 += v * b3; t9 += v * b4; t10 += v * b5; t11 += v * b6; t12 += v * b7; t13 += v * b8; t14 += v * b9; t15 += v * b10; t16 += v * b11; t17 += v * b12; t18 += v * b13; t19 += v * b14; t20 += v * b15; v = a[6]; t6 += v * b0; t7 += v * b1; t8 += v * b2; t9 += v * b3; t10 += v * b4; t11 += v * b5; t12 += v * b6; t13 += v * b7; t14 += v * b8; t15 += v * b9; t16 += v * b10; t17 += v * b11; t18 += v * b12; t19 += v * b13; t20 += v * b14; t21 += v * b15; v = a[7]; t7 += v * b0; t8 += v * b1; t9 += v * b2; t10 += v * b3; t11 += v * b4; t12 += v * b5; t13 += v * b6; t14 += v * b7; t15 += v * b8; t16 += v * b9; t17 += v * b10; t18 += v * b11; t19 += v * b12; t20 += v * b13; t21 += v * b14; t22 += v * b15; v = a[8]; t8 += v * b0; t9 += v * b1; t10 += v * b2; t11 += v * b3; t12 += v * b4; t13 += v * b5; t14 += v * b6; t15 += v * b7; t16 += v * b8; t17 += v * b9; t18 += v * b10; t19 += v * b11; t20 += v * b12; t21 += v * b13; t22 += v * b14; t23 += v * b15; v = a[9]; t9 += v * b0; t10 += v * b1; t11 += v * b2; t12 += v * b3; t13 += v * b4; t14 += v * b5; t15 += v * b6; t16 += v * b7; t17 += v * b8; t18 += v * b9; t19 += v * b10; t20 += v * b11; t21 += v * b12; t22 += v * b13; t23 += v * b14; t24 += v * b15; v = a[10]; t10 += v * b0; t11 += v * b1; t12 += v * b2; t13 += v * b3; t14 += v * b4; t15 += v * b5; t16 += v * b6; t17 += v * b7; t18 += v * b8; t19 += v * b9; t20 += v * b10; t21 += v * b11; t22 += v * b12; t23 += v * b13; t24 += v * b14; t25 += v * b15; v = a[11]; t11 += v * b0; t12 += v * b1; t13 += v * b2; t14 += v * b3; t15 += v * b4; t16 += v * b5; t17 += v * b6; t18 += v * b7; t19 += v * b8; t20 += v * b9; t21 += v * b10; t22 += v * b11; t23 += v * b12; t24 += v * b13; t25 += v * b14; t26 += v * b15; v = a[12]; t12 += v * b0; t13 += v * b1; t14 += v * b2; t15 += v * b3; t16 += v * b4; t17 += v * b5; t18 += v * b6; t19 += v * b7; t20 += v * b8; t21 += v * b9; t22 += v * b10; t23 += v * b11; t24 += v * b12; t25 += v * b13; t26 += v * b14; t27 += v * b15; v = a[13]; t13 += v * b0; t14 += v * b1; t15 += v * b2; t16 += v * b3; t17 += v * b4; t18 += v * b5; t19 += v * b6; t20 += v * b7; t21 += v * b8; t22 += v * b9; t23 += v * b10; t24 += v * b11; t25 += v * b12; t26 += v * b13; t27 += v * b14; t28 += v * b15; v = a[14]; t14 += v * b0; t15 += v * b1; t16 += v * b2; t17 += v * b3; t18 += v * b4; t19 += v * b5; t20 += v * b6; t21 += v * b7; t22 += v * b8; t23 += v * b9; t24 += v * b10; t25 += v * b11; t26 += v * b12; t27 += v * b13; t28 += v * b14; t29 += v * b15; v = a[15]; t15 += v * b0; t16 += v * b1; t17 += v * b2; t18 += v * b3; t19 += v * b4; t20 += v * b5; t21 += v * b6; t22 += v * b7; t23 += v * b8; t24 += v * b9; t25 += v * b10; t26 += v * b11; t27 += v * b12; t28 += v * b13; t29 += v * b14; t30 += v * b15; t0 += 38 * t16; t1 += 38 * t17; t2 += 38 * t18; t3 += 38 * t19; t4 += 38 * t20; t5 += 38 * t21; t6 += 38 * t22; t7 += 38 * t23; t8 += 38 * t24; t9 += 38 * t25; t10 += 38 * t26; t11 += 38 * t27; t12 += 38 * t28; t13 += 38 * t29; t14 += 38 * t30; // t15 left as is // first car c = 1; v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; t0 += c-1 + 37 * (c-1); // second car c = 1; v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; t0 += c-1 + 37 * (c-1); o[ 0] = t0; o[ 1] = t1; o[ 2] = t2; o[ 3] = t3; o[ 4] = t4; o[ 5] = t5; o[ 6] = t6; o[ 7] = t7; o[ 8] = t8; o[ 9] = t9; o[10] = t10; o[11] = t11; o[12] = t12; o[13] = t13; o[14] = t14; o[15] = t15; } function S(o, a) { M(o, a, a); } function inv25519(o, i) { var c = gf(); var a; for (a = 0; a < 16; a++) c[a] = i[a]; for (a = 253; a >= 0; a--) { S(c, c); if(a !== 2 && a !== 4) M(c, c, i); } for (a = 0; a < 16; a++) o[a] = c[a]; } function pow2523(o, i) { var c = gf(); var a; for (a = 0; a < 16; a++) c[a] = i[a]; for (a = 250; a >= 0; a--) { S(c, c); if(a !== 1) M(c, c, i); } for (a = 0; a < 16; a++) o[a] = c[a]; } function crypto_scalarmult(q, n, p) { var z = new Uint8Array(32); var x = new Float64Array(80), r, i; var a = gf(), b = gf(), c = gf(), d = gf(), e = gf(), f = gf(); for (i = 0; i < 31; i++) z[i] = n[i]; z[31]=(n[31]&127)|64; z[0]&=248; unpack25519(x,p); for (i = 0; i < 16; i++) { b[i]=x[i]; d[i]=a[i]=c[i]=0; } a[0]=d[0]=1; for (i=254; i>=0; --i) { r=(z[i>>>3]>>>(i&7))&1; sel25519(a,b,r); sel25519(c,d,r); A(e,a,c); Z(a,a,c); A(c,b,d); Z(b,b,d); S(d,e); S(f,a); M(a,c,a); M(c,b,e); A(e,a,c); Z(a,a,c); S(b,a); Z(c,d,f); M(a,c,_121665); A(a,a,d); M(c,c,a); M(a,d,f); M(d,b,x); S(b,e); sel25519(a,b,r); sel25519(c,d,r); } for (i = 0; i < 16; i++) { x[i+16]=a[i]; x[i+32]=c[i]; x[i+48]=b[i]; x[i+64]=d[i]; } var x32 = x.subarray(32); var x16 = x.subarray(16); inv25519(x32,x32); M(x16,x16,x32); pack25519(q,x16); return 0; } function crypto_scalarmult_base(q, n) { return crypto_scalarmult(q, n, _9); } function crypto_box_keypair(y, x) { randombytes(x, 32); return crypto_scalarmult_base(y, x); } function crypto_box_beforenm(k, y, x) { var s = new Uint8Array(32); crypto_scalarmult(s, x, y); return crypto_core_hsalsa20(k, _0, s, sigma); } var crypto_box_afternm = crypto_secretbox; var crypto_box_open_afternm = crypto_secretbox_open; function crypto_box(c, m, d, n, y, x) { var k = new Uint8Array(32); crypto_box_beforenm(k, y, x); return crypto_box_afternm(c, m, d, n, k); } function crypto_box_open(m, c, d, n, y, x) { var k = new Uint8Array(32); crypto_box_beforenm(k, y, x); return crypto_box_open_afternm(m, c, d, n, k); } var K = [ 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817 ]; function crypto_hashblocks_hl(hh, hl, m, n) { var wh = new Int32Array(16), wl = new Int32Array(16), bh0, bh1, bh2, bh3, bh4, bh5, bh6, bh7, bl0, bl1, bl2, bl3, bl4, bl5, bl6, bl7, th, tl, i, j, h, l, a, b, c, d; var ah0 = hh[0], ah1 = hh[1], ah2 = hh[2], ah3 = hh[3], ah4 = hh[4], ah5 = hh[5], ah6 = hh[6], ah7 = hh[7], al0 = hl[0], al1 = hl[1], al2 = hl[2], al3 = hl[3], al4 = hl[4], al5 = hl[5], al6 = hl[6], al7 = hl[7]; var pos = 0; while (n >= 128) { for (i = 0; i < 16; i++) { j = 8 * i + pos; wh[i] = (m[j+0] << 24) | (m[j+1] << 16) | (m[j+2] << 8) | m[j+3]; wl[i] = (m[j+4] << 24) | (m[j+5] << 16) | (m[j+6] << 8) | m[j+7]; } for (i = 0; i < 80; i++) { bh0 = ah0; bh1 = ah1; bh2 = ah2; bh3 = ah3; bh4 = ah4; bh5 = ah5; bh6 = ah6; bh7 = ah7; bl0 = al0; bl1 = al1; bl2 = al2; bl3 = al3; bl4 = al4; bl5 = al5; bl6 = al6; bl7 = al7; // add h = ah7; l = al7; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; // Sigma1 h = ((ah4 >>> 14) | (al4 << (32-14))) ^ ((ah4 >>> 18) | (al4 << (32-18))) ^ ((al4 >>> (41-32)) | (ah4 << (32-(41-32)))); l = ((al4 >>> 14) | (ah4 << (32-14))) ^ ((al4 >>> 18) | (ah4 << (32-18))) ^ ((ah4 >>> (41-32)) | (al4 << (32-(41-32)))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // Ch h = (ah4 & ah5) ^ (~ah4 & ah6); l = (al4 & al5) ^ (~al4 & al6); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // K h = K[i*2]; l = K[i*2+1]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // w h = wh[i%16]; l = wl[i%16]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; th = c & 0xffff | d << 16; tl = a & 0xffff | b << 16; // add h = th; l = tl; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; // Sigma0 h = ((ah0 >>> 28) | (al0 << (32-28))) ^ ((al0 >>> (34-32)) | (ah0 << (32-(34-32)))) ^ ((al0 >>> (39-32)) | (ah0 << (32-(39-32)))); l = ((al0 >>> 28) | (ah0 << (32-28))) ^ ((ah0 >>> (34-32)) | (al0 << (32-(34-32)))) ^ ((ah0 >>> (39-32)) | (al0 << (32-(39-32)))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // Maj h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; bh7 = (c & 0xffff) | (d << 16); bl7 = (a & 0xffff) | (b << 16); // add h = bh3; l = bl3; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = th; l = tl; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; bh3 = (c & 0xffff) | (d << 16); bl3 = (a & 0xffff) | (b << 16); ah1 = bh0; ah2 = bh1; ah3 = bh2; ah4 = bh3; ah5 = bh4; ah6 = bh5; ah7 = bh6; ah0 = bh7; al1 = bl0; al2 = bl1; al3 = bl2; al4 = bl3; al5 = bl4; al6 = bl5; al7 = bl6; al0 = bl7; if (i%16 === 15) { for (j = 0; j < 16; j++) { // add h = wh[j]; l = wl[j]; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = wh[(j+9)%16]; l = wl[(j+9)%16]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // sigma0 th = wh[(j+1)%16]; tl = wl[(j+1)%16]; h = ((th >>> 1) | (tl << (32-1))) ^ ((th >>> 8) | (tl << (32-8))) ^ (th >>> 7); l = ((tl >>> 1) | (th << (32-1))) ^ ((tl >>> 8) | (th << (32-8))) ^ ((tl >>> 7) | (th << (32-7))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // sigma1 th = wh[(j+14)%16]; tl = wl[(j+14)%16]; h = ((th >>> 19) | (tl << (32-19))) ^ ((tl >>> (61-32)) | (th << (32-(61-32)))) ^ (th >>> 6); l = ((tl >>> 19) | (th << (32-19))) ^ ((th >>> (61-32)) | (tl << (32-(61-32)))) ^ ((tl >>> 6) | (th << (32-6))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; wh[j] = (c & 0xffff) | (d << 16); wl[j] = (a & 0xffff) | (b << 16); } } } // add h = ah0; l = al0; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[0]; l = hl[0]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[0] = ah0 = (c & 0xffff) | (d << 16); hl[0] = al0 = (a & 0xffff) | (b << 16); h = ah1; l = al1; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[1]; l = hl[1]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[1] = ah1 = (c & 0xffff) | (d << 16); hl[1] = al1 = (a & 0xffff) | (b << 16); h = ah2; l = al2; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[2]; l = hl[2]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[2] = ah2 = (c & 0xffff) | (d << 16); hl[2] = al2 = (a & 0xffff) | (b << 16); h = ah3; l = al3; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[3]; l = hl[3]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[3] = ah3 = (c & 0xffff) | (d << 16); hl[3] = al3 = (a & 0xffff) | (b << 16); h = ah4; l = al4; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[4]; l = hl[4]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[4] = ah4 = (c & 0xffff) | (d << 16); hl[4] = al4 = (a & 0xffff) | (b << 16); h = ah5; l = al5; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[5]; l = hl[5]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[5] = ah5 = (c & 0xffff) | (d << 16); hl[5] = al5 = (a & 0xffff) | (b << 16); h = ah6; l = al6; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[6]; l = hl[6]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[6] = ah6 = (c & 0xffff) | (d << 16); hl[6] = al6 = (a & 0xffff) | (b << 16); h = ah7; l = al7; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[7]; l = hl[7]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[7] = ah7 = (c & 0xffff) | (d << 16); hl[7] = al7 = (a & 0xffff) | (b << 16); pos += 128; n -= 128; } return n; } function crypto_hash(out, m, n) { var hh = new Int32Array(8), hl = new Int32Array(8), x = new Uint8Array(256), i, b = n; hh[0] = 0x6a09e667; hh[1] = 0xbb67ae85; hh[2] = 0x3c6ef372; hh[3] = 0xa54ff53a; hh[4] = 0x510e527f; hh[5] = 0x9b05688c; hh[6] = 0x1f83d9ab; hh[7] = 0x5be0cd19; hl[0] = 0xf3bcc908; hl[1] = 0x84caa73b; hl[2] = 0xfe94f82b; hl[3] = 0x5f1d36f1; hl[4] = 0xade682d1; hl[5] = 0x2b3e6c1f; hl[6] = 0xfb41bd6b; hl[7] = 0x137e2179; crypto_hashblocks_hl(hh, hl, m, n); n %= 128; for (i = 0; i < n; i++) x[i] = m[b-n+i]; x[n] = 128; n = 256-128*(n<112?1:0); x[n-9] = 0; ts64(x, n-8, (b / 0x20000000) | 0, b << 3); crypto_hashblocks_hl(hh, hl, x, n); for (i = 0; i < 8; i++) ts64(out, 8*i, hh[i], hl[i]); return 0; } function add(p, q) { var a = gf(), b = gf(), c = gf(), d = gf(), e = gf(), f = gf(), g = gf(), h = gf(), t = gf(); Z(a, p[1], p[0]); Z(t, q[1], q[0]); M(a, a, t); A(b, p[0], p[1]); A(t, q[0], q[1]); M(b, b, t); M(c, p[3], q[3]); M(c, c, D2); M(d, p[2], q[2]); A(d, d, d); Z(e, b, a); Z(f, d, c); A(g, d, c); A(h, b, a); M(p[0], e, f); M(p[1], h, g); M(p[2], g, f); M(p[3], e, h); } function cswap(p, q, b) { var i; for (i = 0; i < 4; i++) { sel25519(p[i], q[i], b); } } function pack(r, p) { var tx = gf(), ty = gf(), zi = gf(); inv25519(zi, p[2]); M(tx, p[0], zi); M(ty, p[1], zi); pack25519(r, ty); r[31] ^= par25519(tx) << 7; } function scalarmult(p, q, s) { var b, i; set25519(p[0], gf0); set25519(p[1], gf1); set25519(p[2], gf1); set25519(p[3], gf0); for (i = 255; i >= 0; --i) { b = (s[(i/8)|0] >> (i&7)) & 1; cswap(p, q, b); add(q, p); add(p, p); cswap(p, q, b); } } function scalarbase(p, s) { var q = [gf(), gf(), gf(), gf()]; set25519(q[0], X); set25519(q[1], Y); set25519(q[2], gf1); M(q[3], X, Y); scalarmult(p, q, s); } function crypto_sign_keypair(pk, sk, seeded) { var d = new Uint8Array(64); var p = [gf(), gf(), gf(), gf()]; var i; if (!seeded) randombytes(sk, 32); crypto_hash(d, sk, 32); d[0] &= 248; d[31] &= 127; d[31] |= 64; scalarbase(p, d); pack(pk, p); for (i = 0; i < 32; i++) sk[i+32] = pk[i]; return 0; } var L = new Float64Array([0xed, 0xd3, 0xf5, 0x5c, 0x1a, 0x63, 0x12, 0x58, 0xd6, 0x9c, 0xf7, 0xa2, 0xde, 0xf9, 0xde, 0x14, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0x10]); function modL(r, x) { var carry, i, j, k; for (i = 63; i >= 32; --i) { carry = 0; for (j = i - 32, k = i - 12; j < k; ++j) { x[j] += carry - 16 * x[i] * L[j - (i - 32)]; carry = (x[j] + 128) >> 8; x[j] -= carry * 256; } x[j] += carry; x[i] = 0; } carry = 0; for (j = 0; j < 32; j++) { x[j] += carry - (x[31] >> 4) * L[j]; carry = x[j] >> 8; x[j] &= 255; } for (j = 0; j < 32; j++) x[j] -= carry * L[j]; for (i = 0; i < 32; i++) { x[i+1] += x[i] >> 8; r[i] = x[i] & 255; } } function reduce(r) { var x = new Float64Array(64), i; for (i = 0; i < 64; i++) x[i] = r[i]; for (i = 0; i < 64; i++) r[i] = 0; modL(r, x); } // Note: difference from C - smlen returned, not passed as argument. function crypto_sign(sm, m, n, sk) { var d = new Uint8Array(64), h = new Uint8Array(64), r = new Uint8Array(64); var i, j, x = new Float64Array(64); var p = [gf(), gf(), gf(), gf()]; crypto_hash(d, sk, 32); d[0] &= 248; d[31] &= 127; d[31] |= 64; var smlen = n + 64; for (i = 0; i < n; i++) sm[64 + i] = m[i]; for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; crypto_hash(r, sm.subarray(32), n+32); reduce(r); scalarbase(p, r); pack(sm, p); for (i = 32; i < 64; i++) sm[i] = sk[i]; crypto_hash(h, sm, n + 64); reduce(h); for (i = 0; i < 64; i++) x[i] = 0; for (i = 0; i < 32; i++) x[i] = r[i]; for (i = 0; i < 32; i++) { for (j = 0; j < 32; j++) { x[i+j] += h[i] * d[j]; } } modL(sm.subarray(32), x); return smlen; } function unpackneg(r, p) { var t = gf(), chk = gf(), num = gf(), den = gf(), den2 = gf(), den4 = gf(), den6 = gf(); set25519(r[2], gf1); unpack25519(r[1], p); S(num, r[1]); M(den, num, D); Z(num, num, r[2]); A(den, r[2], den); S(den2, den); S(den4, den2); M(den6, den4, den2); M(t, den6, num); M(t, t, den); pow2523(t, t); M(t, t, num); M(t, t, den); M(t, t, den); M(r[0], t, den); S(chk, r[0]); M(chk, chk, den); if (neq25519(chk, num)) M(r[0], r[0], I); S(chk, r[0]); M(chk, chk, den); if (neq25519(chk, num)) return -1; if (par25519(r[0]) === (p[31]>>7)) Z(r[0], gf0, r[0]); M(r[3], r[0], r[1]); return 0; } function crypto_sign_open(m, sm, n, pk) { var i, mlen; var t = new Uint8Array(32), h = new Uint8Array(64); var p = [gf(), gf(), gf(), gf()], q = [gf(), gf(), gf(), gf()]; mlen = -1; if (n < 64) return -1; if (unpackneg(q, pk)) return -1; for (i = 0; i < n; i++) m[i] = sm[i]; for (i = 0; i < 32; i++) m[i+32] = pk[i]; crypto_hash(h, m, n); reduce(h); scalarmult(p, q, h); scalarbase(q, sm.subarray(32)); add(p, q); pack(t, p); n -= 64; if (crypto_verify_32(sm, 0, t, 0)) { for (i = 0; i < n; i++) m[i] = 0; return -1; } for (i = 0; i < n; i++) m[i] = sm[i + 64]; mlen = n; return mlen; } var crypto_secretbox_KEYBYTES = 32, crypto_secretbox_NONCEBYTES = 24, crypto_secretbox_ZEROBYTES = 32, crypto_secretbox_BOXZEROBYTES = 16, crypto_scalarmult_BYTES = 32, crypto_scalarmult_SCALARBYTES = 32, crypto_box_PUBLICKEYBYTES = 32, crypto_box_SECRETKEYBYTES = 32, crypto_box_BEFORENMBYTES = 32, crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, crypto_sign_BYTES = 64, crypto_sign_PUBLICKEYBYTES = 32, crypto_sign_SECRETKEYBYTES = 64, crypto_sign_SEEDBYTES = 32, crypto_hash_BYTES = 64; nacl.lowlevel = { crypto_core_hsalsa20: crypto_core_hsalsa20, crypto_stream_xor: crypto_stream_xor, crypto_stream: crypto_stream, crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, crypto_stream_salsa20: crypto_stream_salsa20, crypto_onetimeauth: crypto_onetimeauth, crypto_onetimeauth_verify: crypto_onetimeauth_verify, crypto_verify_16: crypto_verify_16, crypto_verify_32: crypto_verify_32, crypto_secretbox: crypto_secretbox, crypto_secretbox_open: crypto_secretbox_open, crypto_scalarmult: crypto_scalarmult, crypto_scalarmult_base: crypto_scalarmult_base, crypto_box_beforenm: crypto_box_beforenm, crypto_box_afternm: crypto_box_afternm, crypto_box: crypto_box, crypto_box_open: crypto_box_open, crypto_box_keypair: crypto_box_keypair, crypto_hash: crypto_hash, crypto_sign: crypto_sign, crypto_sign_keypair: crypto_sign_keypair, crypto_sign_open: crypto_sign_open, crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, crypto_sign_BYTES: crypto_sign_BYTES, crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, crypto_hash_BYTES: crypto_hash_BYTES }; /* High-level API */ function checkLengths(k, n) { if (k.length !== crypto_secretbox_KEYBYTES) throw new Error('bad key size'); if (n.length !== crypto_secretbox_NONCEBYTES) throw new Error('bad nonce size'); } function checkBoxLengths(pk, sk) { if (pk.length !== crypto_box_PUBLICKEYBYTES) throw new Error('bad public key size'); if (sk.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); } function checkArrayTypes() { var t, i; for (i = 0; i < arguments.length; i++) { if ((t = Object.prototype.toString.call(arguments[i])) !== '[object Uint8Array]') throw new TypeError('unexpected type ' + t + ', use Uint8Array'); } } function cleanup(arr) { for (var i = 0; i < arr.length; i++) arr[i] = 0; } // TODO: Completely remove this in v0.15. if (!nacl.util) { nacl.util = {}; nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); }; } nacl.randomBytes = function(n) { var b = new Uint8Array(n); randombytes(b, n); return b; }; nacl.secretbox = function(msg, nonce, key) { checkArrayTypes(msg, nonce, key); checkLengths(key, nonce); var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); var c = new Uint8Array(m.length); for (var i = 0; i < msg.length; i++) m[i+crypto_secretbox_ZEROBYTES] = msg[i]; crypto_secretbox(c, m, m.length, nonce, key); return c.subarray(crypto_secretbox_BOXZEROBYTES); }; nacl.secretbox.open = function(box, nonce, key) { checkArrayTypes(box, nonce, key); checkLengths(key, nonce); var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); var m = new Uint8Array(c.length); for (var i = 0; i < box.length; i++) c[i+crypto_secretbox_BOXZEROBYTES] = box[i]; if (c.length < 32) return false; if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return false; return m.subarray(crypto_secretbox_ZEROBYTES); }; nacl.secretbox.keyLength = crypto_secretbox_KEYBYTES; nacl.secretbox.nonceLength = crypto_secretbox_NONCEBYTES; nacl.secretbox.overheadLength = crypto_secretbox_BOXZEROBYTES; nacl.scalarMult = function(n, p) { checkArrayTypes(n, p); if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); if (p.length !== crypto_scalarmult_BYTES) throw new Error('bad p size'); var q = new Uint8Array(crypto_scalarmult_BYTES); crypto_scalarmult(q, n, p); return q; }; nacl.scalarMult.base = function(n) { checkArrayTypes(n); if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); var q = new Uint8Array(crypto_scalarmult_BYTES); crypto_scalarmult_base(q, n); return q; }; nacl.scalarMult.scalarLength = crypto_scalarmult_SCALARBYTES; nacl.scalarMult.groupElementLength = crypto_scalarmult_BYTES; nacl.box = function(msg, nonce, publicKey, secretKey) { var k = nacl.box.before(publicKey, secretKey); return nacl.secretbox(msg, nonce, k); }; nacl.box.before = function(publicKey, secretKey) { checkArrayTypes(publicKey, secretKey); checkBoxLengths(publicKey, secretKey); var k = new Uint8Array(crypto_box_BEFORENMBYTES); crypto_box_beforenm(k, publicKey, secretKey); return k; }; nacl.box.after = nacl.secretbox; nacl.box.open = function(msg, nonce, publicKey, secretKey) { var k = nacl.box.before(publicKey, secretKey); return nacl.secretbox.open(msg, nonce, k); }; nacl.box.open.after = nacl.secretbox.open; nacl.box.keyPair = function() { var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); crypto_box_keypair(pk, sk); return {publicKey: pk, secretKey: sk}; }; nacl.box.keyPair.fromSecretKey = function(secretKey) { checkArrayTypes(secretKey); if (secretKey.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); crypto_scalarmult_base(pk, secretKey); return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; }; nacl.box.publicKeyLength = crypto_box_PUBLICKEYBYTES; nacl.box.secretKeyLength = crypto_box_SECRETKEYBYTES; nacl.box.sharedKeyLength = crypto_box_BEFORENMBYTES; nacl.box.nonceLength = crypto_box_NONCEBYTES; nacl.box.overheadLength = nacl.secretbox.overheadLength; nacl.sign = function(msg, secretKey) { checkArrayTypes(msg, secretKey); if (secretKey.length !== crypto_sign_SECRETKEYBYTES) throw new Error('bad secret key size'); var signedMsg = new Uint8Array(crypto_sign_BYTES+msg.length); crypto_sign(signedMsg, msg, msg.length, secretKey); return signedMsg; }; nacl.sign.open = function(signedMsg, publicKey) { if (arguments.length !== 2) throw new Error('nacl.sign.open accepts 2 arguments; did you mean to use nacl.sign.detached.verify?'); checkArrayTypes(signedMsg, publicKey); if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) throw new Error('bad public key size'); var tmp = new Uint8Array(signedMsg.length); var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); if (mlen < 0) return null; var m = new Uint8Array(mlen); for (var i = 0; i < m.length; i++) m[i] = tmp[i]; return m; }; nacl.sign.detached = function(msg, secretKey) { var signedMsg = nacl.sign(msg, secretKey); var sig = new Uint8Array(crypto_sign_BYTES); for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; return sig; }; nacl.sign.detached.verify = function(msg, sig, publicKey) { checkArrayTypes(msg, sig, publicKey); if (sig.length !== crypto_sign_BYTES) throw new Error('bad signature size'); if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) throw new Error('bad public key size'); var sm = new Uint8Array(crypto_sign_BYTES + msg.length); var m = new Uint8Array(crypto_sign_BYTES + msg.length); var i; for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; for (i = 0; i < msg.length; i++) sm[i+crypto_sign_BYTES] = msg[i]; return (crypto_sign_open(m, sm, sm.length, publicKey) >= 0); }; nacl.sign.keyPair = function() { var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); crypto_sign_keypair(pk, sk); return {publicKey: pk, secretKey: sk}; }; nacl.sign.keyPair.fromSecretKey = function(secretKey) { checkArrayTypes(secretKey); if (secretKey.length !== crypto_sign_SECRETKEYBYTES) throw new Error('bad secret key size'); var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; }; nacl.sign.keyPair.fromSeed = function(seed) { checkArrayTypes(seed); if (seed.length !== crypto_sign_SEEDBYTES) throw new Error('bad seed size'); var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); for (var i = 0; i < 32; i++) sk[i] = seed[i]; crypto_sign_keypair(pk, sk, true); return {publicKey: pk, secretKey: sk}; }; nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; nacl.sign.seedLength = crypto_sign_SEEDBYTES; nacl.sign.signatureLength = crypto_sign_BYTES; nacl.hash = function(msg) { checkArrayTypes(msg); var h = new Uint8Array(crypto_hash_BYTES); crypto_hash(h, msg, msg.length); return h; }; nacl.hash.hashLength = crypto_hash_BYTES; nacl.verify = function(x, y) { checkArrayTypes(x, y); // Zero length arguments are considered not equal. if (x.length === 0 || y.length === 0) return false; if (x.length !== y.length) return false; return (vn(x, 0, y, 0, x.length) === 0) ? true : false; }; nacl.setPRNG = function(fn) { randombytes = fn; }; (function() { // Initialize PRNG if environment provides CSPRNG. // If not, methods calling randombytes will throw. var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; if (crypto && crypto.getRandomValues) { // Browsers. var QUOTA = 65536; nacl.setPRNG(function(x, n) { var i, v = new Uint8Array(n); for (i = 0; i < n; i += QUOTA) { crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); } for (i = 0; i < n; i++) x[i] = v[i]; cleanup(v); }); } else if (true) { // Node.js. crypto = __webpack_require__(417); if (crypto && crypto.randomBytes) { nacl.setPRNG(function(x, n) { var i, v = crypto.randomBytes(n); for (i = 0; i < n; i++) x[i] = v[i]; cleanup(v); }); } } })(); })( true && module.exports ? module.exports : (self.nacl = self.nacl || {})); /***/ }), /* 197 */, /* 198 */, /* 199 */, /* 200 */, /* 201 */, /* 202 */, /* 203 */, /* 204 */, /* 205 */, /* 206 */, /* 207 */, /* 208 */, /* 209 */, /* 210 */, /* 211 */ /***/ (function(module) { module.exports = require("https"); /***/ }), /* 212 */, /* 213 */ /***/ (function(module) { module.exports = require("punycode"); /***/ }), /* 214 */, /* 215 */ /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; /* eslint-disable node/no-deprecated-api */ var buffer = __webpack_require__(293) var Buffer = buffer.Buffer var safer = {} var key for (key in buffer) { if (!buffer.hasOwnProperty(key)) continue if (key === 'SlowBuffer' || key === 'Buffer') continue safer[key] = buffer[key] } var Safer = safer.Buffer = {} for (key in Buffer) { if (!Buffer.hasOwnProperty(key)) continue if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue Safer[key] = Buffer[key] } safer.Buffer.prototype = Buffer.prototype if (!Safer.from || Safer.from === Uint8Array.from) { Safer.from = function (value, encodingOrOffset, length) { if (typeof value === 'number') { throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) } if (value && typeof value.length === 'undefined') { throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) } return Buffer(value, encodingOrOffset, length) } } if (!Safer.alloc) { Safer.alloc = function (size, fill, encoding) { if (typeof size !== 'number') { throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) } if (size < 0 || size >= 2 * (1 << 30)) { throw new RangeError('The value "' + size + '" is invalid for option "size"') } var buf = Buffer(size) if (!fill || fill.length === 0) { buf.fill(0) } else if (typeof encoding === 'string') { buf.fill(fill, encoding) } else { buf.fill(fill) } return buf } } if (!safer.kStringMaxLength) { try { safer.kStringMaxLength = process.binding('buffer').kStringMaxLength } catch (e) { // we can't determine kStringMaxLength in environments where process.binding // is unsupported, so let's not set it } } if (!safer.constants) { safer.constants = { MAX_LENGTH: safer.kMaxLength } if (safer.kStringMaxLength) { safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength } } module.exports = safer /***/ }), /* 216 */, /* 217 */, /* 218 */, /* 219 */, /* 220 */, /* 221 */ /***/ (function(module) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { return { formatError: formatError, formatObject: formatObject, tryStringify: tryStringify }; /** * Format an error into a string. If e is an Error and has a stack property, * it's returned. Otherwise, e is formatted using formatObject, with a * warning added about e not being a proper Error. * @param {*} e * @returns {String} formatted string, suitable for output to developers */ function formatError(e) { var s = typeof e === 'object' && e !== null && (e.stack || e.message) ? e.stack || e.message : formatObject(e); return e instanceof Error ? s : s + ' (WARNING: non-Error used)'; } /** * Format an object, detecting "plain" objects and running them through * JSON.stringify if possible. * @param {Object} o * @returns {string} */ function formatObject(o) { var s = String(o); if(s === '[object Object]' && typeof JSON !== 'undefined') { s = tryStringify(o, s); } return s; } /** * Try to return the result of JSON.stringify(x). If that fails, return * defaultValue * @param {*} x * @param {*} defaultValue * @returns {String|*} JSON.stringify(x) or defaultValue */ function tryStringify(x, defaultValue) { try { return JSON.stringify(x); } catch(e) { return defaultValue; } } }); }(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); /***/ }), /* 222 */ /***/ (function(module) { module.exports = {"$id":"browser.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /* 223 */, /* 224 */, /* 225 */, /* 226 */ /***/ (function(module) { module.exports = {"$id":"response.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["status","statusText","httpVersion","cookies","headers","content","redirectURL","headersSize","bodySize"],"properties":{"status":{"type":"integer"},"statusText":{"type":"string"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"content":{"$ref":"content.json#"},"redirectURL":{"type":"string"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), /* 227 */, /* 228 */, /* 229 */, /* 230 */, /* 231 */, /* 232 */, /* 233 */ /***/ (function(module) { "use strict"; module.exports = function generate_dependencies(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $schemaDeps = {}, $propertyDeps = {}, $ownProperties = it.opts.ownProperties; for ($property in $schema) { var $sch = $schema[$property]; var $deps = Array.isArray($sch) ? $propertyDeps : $schemaDeps; $deps[$property] = $sch; } out += 'var ' + ($errs) + ' = errors;'; var $currentErrorPath = it.errorPath; out += 'var missing' + ($lvl) + ';'; for (var $property in $propertyDeps) { $deps = $propertyDeps[$property]; if ($deps.length) { out += ' if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; if ($ownProperties) { out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; } if ($breakOnError) { out += ' && ( '; var arr1 = $deps; if (arr1) { var $propertyKey, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $propertyKey = arr1[$i += 1]; if ($i) { out += ' || '; } var $prop = it.util.getProperty($propertyKey), $useData = $data + $prop; out += ' ( ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; } } out += ')) { '; var $propertyPath = 'missing' + $lvl, $missingProperty = '\' + ' + $propertyPath + ' + \''; if (it.opts._errorDataPathProperty) { it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; } var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should have '; if ($deps.length == 1) { out += 'property ' + (it.util.escapeQuotes($deps[0])); } else { out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); } out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } } else { out += ' ) { '; var arr2 = $deps; if (arr2) { var $propertyKey, i2 = -1, l2 = arr2.length - 1; while (i2 < l2) { $propertyKey = arr2[i2 += 1]; var $prop = it.util.getProperty($propertyKey), $missingProperty = it.util.escapeQuotes($propertyKey), $useData = $data + $prop; if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); } out += ' if ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should have '; if ($deps.length == 1) { out += 'property ' + (it.util.escapeQuotes($deps[0])); } else { out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); } out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; } } } out += ' } '; if ($breakOnError) { $closingBraces += '}'; out += ' else { '; } } } it.errorPath = $currentErrorPath; var $currentBaseId = $it.baseId; for (var $property in $schemaDeps) { var $sch = $schemaDeps[$property]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; if ($ownProperties) { out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; } out += ') { '; $it.schema = $sch; $it.schemaPath = $schemaPath + it.util.getProperty($property); $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; out += ' } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } if ($breakOnError) { out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; } out = it.util.cleanUpCode(out); return out; } /***/ }), /* 234 */, /* 235 */, /* 236 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*! * Copyright (c) 2015, Salesforce.com, Inc. * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ var net = __webpack_require__(631); var urlParse = __webpack_require__(835).parse; var util = __webpack_require__(669); var pubsuffix = __webpack_require__(847); var Store = __webpack_require__(582).Store; var MemoryCookieStore = __webpack_require__(530).MemoryCookieStore; var pathMatch = __webpack_require__(542).pathMatch; var VERSION = __webpack_require__(525); var punycode; try { punycode = __webpack_require__(213); } catch(e) { console.warn("tough-cookie: can't load punycode; won't use punycode for domain normalization"); } // From RFC6265 S4.1.1 // note that it excludes \x3B ";" var COOKIE_OCTETS = /^[\x21\x23-\x2B\x2D-\x3A\x3C-\x5B\x5D-\x7E]+$/; var CONTROL_CHARS = /[\x00-\x1F]/; // From Chromium // '\r', '\n' and '\0' should be treated as a terminator in // the "relaxed" mode, see: // https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/parsed_cookie.cc#L60 var TERMINATORS = ['\n', '\r', '\0']; // RFC6265 S4.1.1 defines path value as 'any CHAR except CTLs or ";"' // Note ';' is \x3B var PATH_VALUE = /[\x20-\x3A\x3C-\x7E]+/; // date-time parsing constants (RFC6265 S5.1.1) var DATE_DELIM = /[\x09\x20-\x2F\x3B-\x40\x5B-\x60\x7B-\x7E]/; var MONTH_TO_NUM = { jan:0, feb:1, mar:2, apr:3, may:4, jun:5, jul:6, aug:7, sep:8, oct:9, nov:10, dec:11 }; var NUM_TO_MONTH = [ 'Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec' ]; var NUM_TO_DAY = [ 'Sun','Mon','Tue','Wed','Thu','Fri','Sat' ]; var MAX_TIME = 2147483647000; // 31-bit max var MIN_TIME = 0; // 31-bit min /* * Parses a Natural number (i.e., non-negative integer) with either the * *DIGIT ( non-digit *OCTET ) * or * *DIGIT * grammar (RFC6265 S5.1.1). * * The "trailingOK" boolean controls if the grammar accepts a * "( non-digit *OCTET )" trailer. */ function parseDigits(token, minDigits, maxDigits, trailingOK) { var count = 0; while (count < token.length) { var c = token.charCodeAt(count); // "non-digit = %x00-2F / %x3A-FF" if (c <= 0x2F || c >= 0x3A) { break; } count++; } // constrain to a minimum and maximum number of digits. if (count < minDigits || count > maxDigits) { return null; } if (!trailingOK && count != token.length) { return null; } return parseInt(token.substr(0,count), 10); } function parseTime(token) { var parts = token.split(':'); var result = [0,0,0]; /* RF6256 S5.1.1: * time = hms-time ( non-digit *OCTET ) * hms-time = time-field ":" time-field ":" time-field * time-field = 1*2DIGIT */ if (parts.length !== 3) { return null; } for (var i = 0; i < 3; i++) { // "time-field" must be strictly "1*2DIGIT", HOWEVER, "hms-time" can be // followed by "( non-digit *OCTET )" so therefore the last time-field can // have a trailer var trailingOK = (i == 2); var num = parseDigits(parts[i], 1, 2, trailingOK); if (num === null) { return null; } result[i] = num; } return result; } function parseMonth(token) { token = String(token).substr(0,3).toLowerCase(); var num = MONTH_TO_NUM[token]; return num >= 0 ? num : null; } /* * RFC6265 S5.1.1 date parser (see RFC for full grammar) */ function parseDate(str) { if (!str) { return; } /* RFC6265 S5.1.1: * 2. Process each date-token sequentially in the order the date-tokens * appear in the cookie-date */ var tokens = str.split(DATE_DELIM); if (!tokens) { return; } var hour = null; var minute = null; var second = null; var dayOfMonth = null; var month = null; var year = null; for (var i=0; i= 70 && year <= 99) { year += 1900; } else if (year >= 0 && year <= 69) { year += 2000; } } } } /* RFC 6265 S5.1.1 * "5. Abort these steps and fail to parse the cookie-date if: * * at least one of the found-day-of-month, found-month, found- * year, or found-time flags is not set, * * the day-of-month-value is less than 1 or greater than 31, * * the year-value is less than 1601, * * the hour-value is greater than 23, * * the minute-value is greater than 59, or * * the second-value is greater than 59. * (Note that leap seconds cannot be represented in this syntax.)" * * So, in order as above: */ if ( dayOfMonth === null || month === null || year === null || second === null || dayOfMonth < 1 || dayOfMonth > 31 || year < 1601 || hour > 23 || minute > 59 || second > 59 ) { return; } return new Date(Date.UTC(year, month, dayOfMonth, hour, minute, second)); } function formatDate(date) { var d = date.getUTCDate(); d = d >= 10 ? d : '0'+d; var h = date.getUTCHours(); h = h >= 10 ? h : '0'+h; var m = date.getUTCMinutes(); m = m >= 10 ? m : '0'+m; var s = date.getUTCSeconds(); s = s >= 10 ? s : '0'+s; return NUM_TO_DAY[date.getUTCDay()] + ', ' + d+' '+ NUM_TO_MONTH[date.getUTCMonth()] +' '+ date.getUTCFullYear() +' '+ h+':'+m+':'+s+' GMT'; } // S5.1.2 Canonicalized Host Names function canonicalDomain(str) { if (str == null) { return null; } str = str.trim().replace(/^\./,''); // S4.1.2.3 & S5.2.3: ignore leading . // convert to IDN if any non-ASCII characters if (punycode && /[^\u0001-\u007f]/.test(str)) { str = punycode.toASCII(str); } return str.toLowerCase(); } // S5.1.3 Domain Matching function domainMatch(str, domStr, canonicalize) { if (str == null || domStr == null) { return null; } if (canonicalize !== false) { str = canonicalDomain(str); domStr = canonicalDomain(domStr); } /* * "The domain string and the string are identical. (Note that both the * domain string and the string will have been canonicalized to lower case at * this point)" */ if (str == domStr) { return true; } /* "All of the following [three] conditions hold:" (order adjusted from the RFC) */ /* "* The string is a host name (i.e., not an IP address)." */ if (net.isIP(str)) { return false; } /* "* The domain string is a suffix of the string" */ var idx = str.indexOf(domStr); if (idx <= 0) { return false; // it's a non-match (-1) or prefix (0) } // e.g "a.b.c".indexOf("b.c") === 2 // 5 === 3+2 if (str.length !== domStr.length + idx) { // it's not a suffix return false; } /* "* The last character of the string that is not included in the domain * string is a %x2E (".") character." */ if (str.substr(idx-1,1) !== '.') { return false; } return true; } // RFC6265 S5.1.4 Paths and Path-Match /* * "The user agent MUST use an algorithm equivalent to the following algorithm * to compute the default-path of a cookie:" * * Assumption: the path (and not query part or absolute uri) is passed in. */ function defaultPath(path) { // "2. If the uri-path is empty or if the first character of the uri-path is not // a %x2F ("/") character, output %x2F ("/") and skip the remaining steps. if (!path || path.substr(0,1) !== "/") { return "/"; } // "3. If the uri-path contains no more than one %x2F ("/") character, output // %x2F ("/") and skip the remaining step." if (path === "/") { return path; } var rightSlash = path.lastIndexOf("/"); if (rightSlash === 0) { return "/"; } // "4. Output the characters of the uri-path from the first character up to, // but not including, the right-most %x2F ("/")." return path.slice(0, rightSlash); } function trimTerminator(str) { for (var t = 0; t < TERMINATORS.length; t++) { var terminatorIdx = str.indexOf(TERMINATORS[t]); if (terminatorIdx !== -1) { str = str.substr(0,terminatorIdx); } } return str; } function parseCookiePair(cookiePair, looseMode) { cookiePair = trimTerminator(cookiePair); var firstEq = cookiePair.indexOf('='); if (looseMode) { if (firstEq === 0) { // '=' is immediately at start cookiePair = cookiePair.substr(1); firstEq = cookiePair.indexOf('='); // might still need to split on '=' } } else { // non-loose mode if (firstEq <= 0) { // no '=' or is at start return; // needs to have non-empty "cookie-name" } } var cookieName, cookieValue; if (firstEq <= 0) { cookieName = ""; cookieValue = cookiePair.trim(); } else { cookieName = cookiePair.substr(0, firstEq).trim(); cookieValue = cookiePair.substr(firstEq+1).trim(); } if (CONTROL_CHARS.test(cookieName) || CONTROL_CHARS.test(cookieValue)) { return; } var c = new Cookie(); c.key = cookieName; c.value = cookieValue; return c; } function parse(str, options) { if (!options || typeof options !== 'object') { options = {}; } str = str.trim(); // We use a regex to parse the "name-value-pair" part of S5.2 var firstSemi = str.indexOf(';'); // S5.2 step 1 var cookiePair = (firstSemi === -1) ? str : str.substr(0, firstSemi); var c = parseCookiePair(cookiePair, !!options.loose); if (!c) { return; } if (firstSemi === -1) { return c; } // S5.2.3 "unparsed-attributes consist of the remainder of the set-cookie-string // (including the %x3B (";") in question)." plus later on in the same section // "discard the first ";" and trim". var unparsed = str.slice(firstSemi + 1).trim(); // "If the unparsed-attributes string is empty, skip the rest of these // steps." if (unparsed.length === 0) { return c; } /* * S5.2 says that when looping over the items "[p]rocess the attribute-name * and attribute-value according to the requirements in the following * subsections" for every item. Plus, for many of the individual attributes * in S5.3 it says to use the "attribute-value of the last attribute in the * cookie-attribute-list". Therefore, in this implementation, we overwrite * the previous value. */ var cookie_avs = unparsed.split(';'); while (cookie_avs.length) { var av = cookie_avs.shift().trim(); if (av.length === 0) { // happens if ";;" appears continue; } var av_sep = av.indexOf('='); var av_key, av_value; if (av_sep === -1) { av_key = av; av_value = null; } else { av_key = av.substr(0,av_sep); av_value = av.substr(av_sep+1); } av_key = av_key.trim().toLowerCase(); if (av_value) { av_value = av_value.trim(); } switch(av_key) { case 'expires': // S5.2.1 if (av_value) { var exp = parseDate(av_value); // "If the attribute-value failed to parse as a cookie date, ignore the // cookie-av." if (exp) { // over and underflow not realistically a concern: V8's getTime() seems to // store something larger than a 32-bit time_t (even with 32-bit node) c.expires = exp; } } break; case 'max-age': // S5.2.2 if (av_value) { // "If the first character of the attribute-value is not a DIGIT or a "-" // character ...[or]... If the remainder of attribute-value contains a // non-DIGIT character, ignore the cookie-av." if (/^-?[0-9]+$/.test(av_value)) { var delta = parseInt(av_value, 10); // "If delta-seconds is less than or equal to zero (0), let expiry-time // be the earliest representable date and time." c.setMaxAge(delta); } } break; case 'domain': // S5.2.3 // "If the attribute-value is empty, the behavior is undefined. However, // the user agent SHOULD ignore the cookie-av entirely." if (av_value) { // S5.2.3 "Let cookie-domain be the attribute-value without the leading %x2E // (".") character." var domain = av_value.trim().replace(/^\./, ''); if (domain) { // "Convert the cookie-domain to lower case." c.domain = domain.toLowerCase(); } } break; case 'path': // S5.2.4 /* * "If the attribute-value is empty or if the first character of the * attribute-value is not %x2F ("/"): * Let cookie-path be the default-path. * Otherwise: * Let cookie-path be the attribute-value." * * We'll represent the default-path as null since it depends on the * context of the parsing. */ c.path = av_value && av_value[0] === "/" ? av_value : null; break; case 'secure': // S5.2.5 /* * "If the attribute-name case-insensitively matches the string "Secure", * the user agent MUST append an attribute to the cookie-attribute-list * with an attribute-name of Secure and an empty attribute-value." */ c.secure = true; break; case 'httponly': // S5.2.6 -- effectively the same as 'secure' c.httpOnly = true; break; default: c.extensions = c.extensions || []; c.extensions.push(av); break; } } return c; } // avoid the V8 deoptimization monster! function jsonParse(str) { var obj; try { obj = JSON.parse(str); } catch (e) { return e; } return obj; } function fromJSON(str) { if (!str) { return null; } var obj; if (typeof str === 'string') { obj = jsonParse(str); if (obj instanceof Error) { return null; } } else { // assume it's an Object obj = str; } var c = new Cookie(); for (var i=0; i 1) { var lindex = path.lastIndexOf('/'); if (lindex === 0) { break; } path = path.substr(0,lindex); permutations.push(path); } permutations.push('/'); return permutations; } function getCookieContext(url) { if (url instanceof Object) { return url; } // NOTE: decodeURI will throw on malformed URIs (see GH-32). // Therefore, we will just skip decoding for such URIs. try { url = decodeURI(url); } catch(err) { // Silently swallow error } return urlParse(url); } function Cookie(options) { options = options || {}; Object.keys(options).forEach(function(prop) { if (Cookie.prototype.hasOwnProperty(prop) && Cookie.prototype[prop] !== options[prop] && prop.substr(0,1) !== '_') { this[prop] = options[prop]; } }, this); this.creation = this.creation || new Date(); // used to break creation ties in cookieCompare(): Object.defineProperty(this, 'creationIndex', { configurable: false, enumerable: false, // important for assert.deepEqual checks writable: true, value: ++Cookie.cookiesCreated }); } Cookie.cookiesCreated = 0; // incremented each time a cookie is created Cookie.parse = parse; Cookie.fromJSON = fromJSON; Cookie.prototype.key = ""; Cookie.prototype.value = ""; // the order in which the RFC has them: Cookie.prototype.expires = "Infinity"; // coerces to literal Infinity Cookie.prototype.maxAge = null; // takes precedence over expires for TTL Cookie.prototype.domain = null; Cookie.prototype.path = null; Cookie.prototype.secure = false; Cookie.prototype.httpOnly = false; Cookie.prototype.extensions = null; // set by the CookieJar: Cookie.prototype.hostOnly = null; // boolean when set Cookie.prototype.pathIsDefault = null; // boolean when set Cookie.prototype.creation = null; // Date when set; defaulted by Cookie.parse Cookie.prototype.lastAccessed = null; // Date when set Object.defineProperty(Cookie.prototype, 'creationIndex', { configurable: true, enumerable: false, writable: true, value: 0 }); Cookie.serializableProperties = Object.keys(Cookie.prototype) .filter(function(prop) { return !( Cookie.prototype[prop] instanceof Function || prop === 'creationIndex' || prop.substr(0,1) === '_' ); }); Cookie.prototype.inspect = function inspect() { var now = Date.now(); return 'Cookie="'+this.toString() + '; hostOnly='+(this.hostOnly != null ? this.hostOnly : '?') + '; aAge='+(this.lastAccessed ? (now-this.lastAccessed.getTime())+'ms' : '?') + '; cAge='+(this.creation ? (now-this.creation.getTime())+'ms' : '?') + '"'; }; // Use the new custom inspection symbol to add the custom inspect function if // available. if (util.inspect.custom) { Cookie.prototype[util.inspect.custom] = Cookie.prototype.inspect; } Cookie.prototype.toJSON = function() { var obj = {}; var props = Cookie.serializableProperties; for (var i=0; i buf.length || buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') return (false); return (true); } function findDNSSECHeader(buf) { // private case first if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) return (false); var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) return (true); // public-key RFC3110 ? // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' // skip any comment-lines if (typeof (buf) !== 'string') { buf = buf.toString('ascii'); } var lines = buf.split('\n'); var line = 0; /* JSSTYLED */ while (lines[line].match(/^\;/)) line++; if (lines[line].toString('ascii').match(/\. IN KEY /)) return (true); if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) return (true); return (false); } function write(key, options) { throw (new Error('"auto" format cannot be used for writing')); } /***/ }), /* 242 */ /***/ (function(module, exports) { (function(){ // Copyright (c) 2005 Tom Wu // All Rights Reserved. // See "LICENSE" for details. // Basic JavaScript BN library - subset useful for RSA encryption. // Bits per digit var dbits; // JavaScript engine analysis var canary = 0xdeadbeefcafe; var j_lm = ((canary&0xffffff)==0xefcafe); // (public) Constructor function BigInteger(a,b,c) { if(a != null) if("number" == typeof a) this.fromNumber(a,b,c); else if(b == null && "string" != typeof a) this.fromString(a,256); else this.fromString(a,b); } // return new, unset BigInteger function nbi() { return new BigInteger(null); } // am: Compute w_j += (x*this_i), propagate carries, // c is initial carry, returns final carry. // c < 3*dvalue, x < 2*dvalue, this_i < dvalue // We need to select the fastest one that works in this environment. // am1: use a single mult and divide to get the high bits, // max digit bits should be 26 because // max internal value = 2*dvalue^2-2*dvalue (< 2^53) function am1(i,x,w,j,c,n) { while(--n >= 0) { var v = x*this[i++]+w[j]+c; c = Math.floor(v/0x4000000); w[j++] = v&0x3ffffff; } return c; } // am2 avoids a big mult-and-extract completely. // Max digit bits should be <= 30 because we do bitwise ops // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) function am2(i,x,w,j,c,n) { var xl = x&0x7fff, xh = x>>15; while(--n >= 0) { var l = this[i]&0x7fff; var h = this[i++]>>15; var m = xh*l+h*xl; l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); w[j++] = l&0x3fffffff; } return c; } // Alternately, set max digit bits to 28 since some // browsers slow down when dealing with 32-bit numbers. function am3(i,x,w,j,c,n) { var xl = x&0x3fff, xh = x>>14; while(--n >= 0) { var l = this[i]&0x3fff; var h = this[i++]>>14; var m = xh*l+h*xl; l = xl*l+((m&0x3fff)<<14)+w[j]+c; c = (l>>28)+(m>>14)+xh*h; w[j++] = l&0xfffffff; } return c; } var inBrowser = typeof navigator !== "undefined"; if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { BigInteger.prototype.am = am2; dbits = 30; } else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { BigInteger.prototype.am = am1; dbits = 26; } else { // Mozilla/Netscape seems to prefer am3 BigInteger.prototype.am = am3; dbits = 28; } BigInteger.prototype.DB = dbits; BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; r.t = this.t; r.s = this.s; } // (protected) set from integer value x, -DV <= x < DV function bnpFromInt(x) { this.t = 1; this.s = (x<0)?-1:0; if(x > 0) this[0] = x; else if(x < -1) this[0] = x+this.DV; else this.t = 0; } // return bigint initialized to value function nbv(i) { var r = nbi(); r.fromInt(i); return r; } // (protected) set from string and radix function bnpFromString(s,b) { var k; if(b == 16) k = 4; else if(b == 8) k = 3; else if(b == 256) k = 8; // byte array else if(b == 2) k = 1; else if(b == 32) k = 5; else if(b == 4) k = 2; else { this.fromRadix(s,b); return; } this.t = 0; this.s = 0; var i = s.length, mi = false, sh = 0; while(--i >= 0) { var x = (k==8)?s[i]&0xff:intAt(s,i); if(x < 0) { if(s.charAt(i) == "-") mi = true; continue; } mi = false; if(sh == 0) this[this.t++] = x; else if(sh+k > this.DB) { this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); } else this[this.t-1] |= x<= this.DB) sh -= this.DB; } if(k == 8 && (s[0]&0x80) != 0) { this.s = -1; if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; } // (public) return string representation in given radix function bnToString(b) { if(this.s < 0) return "-"+this.negate().toString(b); var k; if(b == 16) k = 4; else if(b == 8) k = 3; else if(b == 2) k = 1; else if(b == 32) k = 5; else if(b == 4) k = 2; else return this.toRadix(b); var km = (1< 0) { if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } while(i >= 0) { if(p < k) { d = (this[i]&((1<>(p+=this.DB-k); } else { d = (this[i]>>(p-=k))&km; if(p <= 0) { p += this.DB; --i; } } if(d > 0) m = true; if(m) r += int2char(d); } } return m?r:"0"; } // (public) -this function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } // (public) |this| function bnAbs() { return (this.s<0)?this.negate():this; } // (public) return + if this > a, - if this < a, 0 if equal function bnCompareTo(a) { var r = this.s-a.s; if(r != 0) return r; var i = this.t; r = i-a.t; if(r != 0) return (this.s<0)?-r:r; while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; return 0; } // returns bit length of the integer x function nbits(x) { var r = 1, t; if((t=x>>>16) != 0) { x = t; r += 16; } if((t=x>>8) != 0) { x = t; r += 8; } if((t=x>>4) != 0) { x = t; r += 4; } if((t=x>>2) != 0) { x = t; r += 2; } if((t=x>>1) != 0) { x = t; r += 1; } return r; } // (public) return the number of bits in "this" function bnBitLength() { if(this.t <= 0) return 0; return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); } // (protected) r = this << n*DB function bnpDLShiftTo(n,r) { var i; for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; for(i = n-1; i >= 0; --i) r[i] = 0; r.t = this.t+n; r.s = this.s; } // (protected) r = this >> n*DB function bnpDRShiftTo(n,r) { for(var i = n; i < this.t; ++i) r[i-n] = this[i]; r.t = Math.max(this.t-n,0); r.s = this.s; } // (protected) r = this << n function bnpLShiftTo(n,r) { var bs = n%this.DB; var cbs = this.DB-bs; var bm = (1<= 0; --i) { r[i+ds+1] = (this[i]>>cbs)|c; c = (this[i]&bm)<= 0; --i) r[i] = 0; r[ds] = c; r.t = this.t+ds+1; r.s = this.s; r.clamp(); } // (protected) r = this >> n function bnpRShiftTo(n,r) { r.s = this.s; var ds = Math.floor(n/this.DB); if(ds >= this.t) { r.t = 0; return; } var bs = n%this.DB; var cbs = this.DB-bs; var bm = (1<>bs; for(var i = ds+1; i < this.t; ++i) { r[i-ds-1] |= (this[i]&bm)<>bs; } if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; } if(a.t < this.t) { c -= a.s; while(i < this.t) { c += this[i]; r[i++] = c&this.DM; c >>= this.DB; } c += this.s; } else { c += this.s; while(i < a.t) { c -= a[i]; r[i++] = c&this.DM; c >>= this.DB; } c -= a.s; } r.s = (c<0)?-1:0; if(c < -1) r[i++] = this.DV+c; else if(c > 0) r[i++] = c; r.t = i; r.clamp(); } // (protected) r = this * a, r != this,a (HAC 14.12) // "this" should be the larger one if appropriate. function bnpMultiplyTo(a,r) { var x = this.abs(), y = a.abs(); var i = x.t; r.t = i+y.t; while(--i >= 0) r[i] = 0; for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); r.s = 0; r.clamp(); if(this.s != a.s) BigInteger.ZERO.subTo(r,r); } // (protected) r = this^2, r != this (HAC 14.16) function bnpSquareTo(r) { var x = this.abs(); var i = r.t = 2*x.t; while(--i >= 0) r[i] = 0; for(i = 0; i < x.t-1; ++i) { var c = x.am(i,x[i],r,2*i,0,1); if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { r[i+x.t] -= x.DV; r[i+x.t+1] = 1; } } if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); r.s = 0; r.clamp(); } // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) // r != q, this != m. q or r may be null. function bnpDivRemTo(m,q,r) { var pm = m.abs(); if(pm.t <= 0) return; var pt = this.abs(); if(pt.t < pm.t) { if(q != null) q.fromInt(0); if(r != null) this.copyTo(r); return; } if(r == null) r = nbi(); var y = nbi(), ts = this.s, ms = m.s; var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } else { pm.copyTo(y); pt.copyTo(r); } var ys = y.t; var y0 = y[ys-1]; if(y0 == 0) return; var yt = y0*(1<1)?y[ys-2]>>this.F2:0); var d1 = this.FV/yt, d2 = (1<= 0) { r[r.t++] = 1; r.subTo(t,r); } BigInteger.ONE.dlShiftTo(ys,t); t.subTo(y,y); // "negative" y so we can replace sub with am later while(y.t < ys) y[y.t++] = 0; while(--j >= 0) { // Estimate quotient digit var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out y.dlShiftTo(j,t); r.subTo(t,r); while(r[i] < --qd) r.subTo(t,r); } } if(q != null) { r.drShiftTo(ys,q); if(ts != ms) BigInteger.ZERO.subTo(q,q); } r.t = ys; r.clamp(); if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder if(ts < 0) BigInteger.ZERO.subTo(r,r); } // (public) this mod a function bnMod(a) { var r = nbi(); this.abs().divRemTo(a,null,r); if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); return r; } // Modular reduction using "classic" algorithm function Classic(m) { this.m = m; } function cConvert(x) { if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); else return x; } function cRevert(x) { return x; } function cReduce(x) { x.divRemTo(this.m,null,x); } function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } Classic.prototype.convert = cConvert; Classic.prototype.revert = cRevert; Classic.prototype.reduce = cReduce; Classic.prototype.mulTo = cMulTo; Classic.prototype.sqrTo = cSqrTo; // (protected) return "-1/this % 2^DB"; useful for Mont. reduction // justification: // xy == 1 (mod m) // xy = 1+km // xy(2-xy) = (1+km)(1-km) // x[y(2-xy)] = 1-k^2m^2 // x[y(2-xy)] == 1 (mod m^2) // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. // JS multiply "overflows" differently from C/C++, so care is needed here. function bnpInvDigit() { if(this.t < 1) return 0; var x = this[0]; if((x&1) == 0) return 0; var y = x&3; // y == 1/x mod 2^2 y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 // last step - calculate inverse mod DV directly; // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits // we really want the negative inverse, and -DV < y < DV return (y>0)?this.DV-y:-y; } // Montgomery reduction function Montgomery(m) { this.m = m; this.mp = m.invDigit(); this.mpl = this.mp&0x7fff; this.mph = this.mp>>15; this.um = (1<<(m.DB-15))-1; this.mt2 = 2*m.t; } // xR mod m function montConvert(x) { var r = nbi(); x.abs().dlShiftTo(this.m.t,r); r.divRemTo(this.m,null,r); if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); return r; } // x/R mod m function montRevert(x) { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } // x = x/R mod m (HAC 14.32) function montReduce(x) { while(x.t <= this.mt2) // pad x so am has enough room later x[x.t++] = 0; for(var i = 0; i < this.m.t; ++i) { // faster way of calculating u0 = x[i]*mp mod DV var j = x[i]&0x7fff; var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; // use am to combine the multiply-shift-add into one call j = i+this.m.t; x[j] += this.m.am(0,u0,x,i,0,this.m.t); // propagate carry while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } } x.clamp(); x.drShiftTo(this.m.t,x); if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } // r = "x^2/R mod m"; x != r function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } // r = "xy/R mod m"; x,y != r function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } Montgomery.prototype.convert = montConvert; Montgomery.prototype.revert = montRevert; Montgomery.prototype.reduce = montReduce; Montgomery.prototype.mulTo = montMulTo; Montgomery.prototype.sqrTo = montSqrTo; // (protected) true iff this is even function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) function bnpExp(e,z) { if(e > 0xffffffff || e < 1) return BigInteger.ONE; var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; g.copyTo(r); while(--i >= 0) { z.sqrTo(r,r2); if((e&(1< 0) z.mulTo(r2,g,r); else { var t = r; r = r2; r2 = t; } } return z.revert(r); } // (public) this^e % m, 0 <= e < 2^32 function bnModPowInt(e,m) { var z; if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); return this.exp(e,z); } // protected BigInteger.prototype.copyTo = bnpCopyTo; BigInteger.prototype.fromInt = bnpFromInt; BigInteger.prototype.fromString = bnpFromString; BigInteger.prototype.clamp = bnpClamp; BigInteger.prototype.dlShiftTo = bnpDLShiftTo; BigInteger.prototype.drShiftTo = bnpDRShiftTo; BigInteger.prototype.lShiftTo = bnpLShiftTo; BigInteger.prototype.rShiftTo = bnpRShiftTo; BigInteger.prototype.subTo = bnpSubTo; BigInteger.prototype.multiplyTo = bnpMultiplyTo; BigInteger.prototype.squareTo = bnpSquareTo; BigInteger.prototype.divRemTo = bnpDivRemTo; BigInteger.prototype.invDigit = bnpInvDigit; BigInteger.prototype.isEven = bnpIsEven; BigInteger.prototype.exp = bnpExp; // public BigInteger.prototype.toString = bnToString; BigInteger.prototype.negate = bnNegate; BigInteger.prototype.abs = bnAbs; BigInteger.prototype.compareTo = bnCompareTo; BigInteger.prototype.bitLength = bnBitLength; BigInteger.prototype.mod = bnMod; BigInteger.prototype.modPowInt = bnModPowInt; // "constants" BigInteger.ZERO = nbv(0); BigInteger.ONE = nbv(1); // Copyright (c) 2005-2009 Tom Wu // All Rights Reserved. // See "LICENSE" for details. // Extended JavaScript BN functions, required for RSA private ops. // Version 1.1: new BigInteger("0", 10) returns "proper" zero // Version 1.2: square() API, isProbablePrime fix // (public) function bnClone() { var r = nbi(); this.copyTo(r); return r; } // (public) return value as integer function bnIntValue() { if(this.s < 0) { if(this.t == 1) return this[0]-this.DV; else if(this.t == 0) return -1; } else if(this.t == 1) return this[0]; else if(this.t == 0) return 0; // assumes 16 < DB < 32 return ((this[1]&((1<<(32-this.DB))-1))<>24; } // (public) return value as short (assumes DB>=16) function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } // (protected) return x s.t. r^x < DV function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } // (public) 0 if this == 0, 1 if this > 0 function bnSigNum() { if(this.s < 0) return -1; else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; else return 1; } // (protected) convert to radix string function bnpToRadix(b) { if(b == null) b = 10; if(this.signum() == 0 || b < 2 || b > 36) return "0"; var cs = this.chunkSize(b); var a = Math.pow(b,cs); var d = nbv(a), y = nbi(), z = nbi(), r = ""; this.divRemTo(d,y,z); while(y.signum() > 0) { r = (a+z.intValue()).toString(b).substr(1) + r; y.divRemTo(d,y,z); } return z.intValue().toString(b) + r; } // (protected) convert from radix string function bnpFromRadix(s,b) { this.fromInt(0); if(b == null) b = 10; var cs = this.chunkSize(b); var d = Math.pow(b,cs), mi = false, j = 0, w = 0; for(var i = 0; i < s.length; ++i) { var x = intAt(s,i); if(x < 0) { if(s.charAt(i) == "-" && this.signum() == 0) mi = true; continue; } w = b*w+x; if(++j >= cs) { this.dMultiply(d); this.dAddOffset(w,0); j = 0; w = 0; } } if(j > 0) { this.dMultiply(Math.pow(b,j)); this.dAddOffset(w,0); } if(mi) BigInteger.ZERO.subTo(this,this); } // (protected) alternate constructor function bnpFromNumber(a,b,c) { if("number" == typeof b) { // new BigInteger(int,int,RNG) if(a < 2) this.fromInt(1); else { this.fromNumber(a,c); if(!this.testBit(a-1)) // force MSB set this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); if(this.isEven()) this.dAddOffset(1,0); // force odd while(!this.isProbablePrime(b)) { this.dAddOffset(2,0); if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); } } } else { // new BigInteger(int,RNG) var x = new Array(), t = a&7; x.length = (a>>3)+1; b.nextBytes(x); if(t > 0) x[0] &= ((1< 0) { if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) r[k++] = d|(this.s<<(this.DB-p)); while(i >= 0) { if(p < 8) { d = (this[i]&((1<>(p+=this.DB-8); } else { d = (this[i]>>(p-=8))&0xff; if(p <= 0) { p += this.DB; --i; } } if((d&0x80) != 0) d |= -256; if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; if(k > 0 || d != this.s) r[k++] = d; } } return r; } function bnEquals(a) { return(this.compareTo(a)==0); } function bnMin(a) { return(this.compareTo(a)<0)?this:a; } function bnMax(a) { return(this.compareTo(a)>0)?this:a; } // (protected) r = this op a (bitwise) function bnpBitwiseTo(a,op,r) { var i, f, m = Math.min(a.t,this.t); for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); if(a.t < this.t) { f = a.s&this.DM; for(i = m; i < this.t; ++i) r[i] = op(this[i],f); r.t = this.t; } else { f = this.s&this.DM; for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); r.t = a.t; } r.s = op(this.s,a.s); r.clamp(); } // (public) this & a function op_and(x,y) { return x&y; } function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } // (public) this | a function op_or(x,y) { return x|y; } function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } // (public) this ^ a function op_xor(x,y) { return x^y; } function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } // (public) this & ~a function op_andnot(x,y) { return x&~y; } function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } // (public) ~this function bnNot() { var r = nbi(); for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; r.t = this.t; r.s = ~this.s; return r; } // (public) this << n function bnShiftLeft(n) { var r = nbi(); if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); return r; } // (public) this >> n function bnShiftRight(n) { var r = nbi(); if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); return r; } // return index of lowest 1-bit in x, x < 2^31 function lbit(x) { if(x == 0) return -1; var r = 0; if((x&0xffff) == 0) { x >>= 16; r += 16; } if((x&0xff) == 0) { x >>= 8; r += 8; } if((x&0xf) == 0) { x >>= 4; r += 4; } if((x&3) == 0) { x >>= 2; r += 2; } if((x&1) == 0) ++r; return r; } // (public) returns index of lowest 1-bit (or -1 if none) function bnGetLowestSetBit() { for(var i = 0; i < this.t; ++i) if(this[i] != 0) return i*this.DB+lbit(this[i]); if(this.s < 0) return this.t*this.DB; return -1; } // return number of 1 bits in x function cbit(x) { var r = 0; while(x != 0) { x &= x-1; ++r; } return r; } // (public) return number of set bits function bnBitCount() { var r = 0, x = this.s&this.DM; for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); return r; } // (public) true iff nth bit is set function bnTestBit(n) { var j = Math.floor(n/this.DB); if(j >= this.t) return(this.s!=0); return((this[j]&(1<<(n%this.DB)))!=0); } // (protected) this op (1<>= this.DB; } if(a.t < this.t) { c += a.s; while(i < this.t) { c += this[i]; r[i++] = c&this.DM; c >>= this.DB; } c += this.s; } else { c += this.s; while(i < a.t) { c += a[i]; r[i++] = c&this.DM; c >>= this.DB; } c += a.s; } r.s = (c<0)?-1:0; if(c > 0) r[i++] = c; else if(c < -1) r[i++] = this.DV+c; r.t = i; r.clamp(); } // (public) this + a function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } // (public) this - a function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } // (public) this * a function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } // (public) this^2 function bnSquare() { var r = nbi(); this.squareTo(r); return r; } // (public) this / a function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } // (public) this % a function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } // (public) [this/a,this%a] function bnDivideAndRemainder(a) { var q = nbi(), r = nbi(); this.divRemTo(a,q,r); return new Array(q,r); } // (protected) this *= n, this >= 0, 1 < n < DV function bnpDMultiply(n) { this[this.t] = this.am(0,n-1,this,0,0,this.t); ++this.t; this.clamp(); } // (protected) this += n << w words, this >= 0 function bnpDAddOffset(n,w) { if(n == 0) return; while(this.t <= w) this[this.t++] = 0; this[w] += n; while(this[w] >= this.DV) { this[w] -= this.DV; if(++w >= this.t) this[this.t++] = 0; ++this[w]; } } // A "null" reducer function NullExp() {} function nNop(x) { return x; } function nMulTo(x,y,r) { x.multiplyTo(y,r); } function nSqrTo(x,r) { x.squareTo(r); } NullExp.prototype.convert = nNop; NullExp.prototype.revert = nNop; NullExp.prototype.mulTo = nMulTo; NullExp.prototype.sqrTo = nSqrTo; // (public) this^e function bnPow(e) { return this.exp(e,new NullExp()); } // (protected) r = lower n words of "this * a", a.t <= n // "this" should be the larger one if appropriate. function bnpMultiplyLowerTo(a,n,r) { var i = Math.min(this.t+a.t,n); r.s = 0; // assumes a,this >= 0 r.t = i; while(i > 0) r[--i] = 0; var j; for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); r.clamp(); } // (protected) r = "this * a" without lower n words, n > 0 // "this" should be the larger one if appropriate. function bnpMultiplyUpperTo(a,n,r) { --n; var i = r.t = this.t+a.t-n; r.s = 0; // assumes a,this >= 0 while(--i >= 0) r[i] = 0; for(i = Math.max(n-this.t,0); i < a.t; ++i) r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); r.clamp(); r.drShiftTo(1,r); } // Barrett modular reduction function Barrett(m) { // setup Barrett this.r2 = nbi(); this.q3 = nbi(); BigInteger.ONE.dlShiftTo(2*m.t,this.r2); this.mu = this.r2.divide(m); this.m = m; } function barrettConvert(x) { if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); else if(x.compareTo(this.m) < 0) return x; else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } } function barrettRevert(x) { return x; } // x = x mod m (HAC 14.42) function barrettReduce(x) { x.drShiftTo(this.m.t-1,this.r2); if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); x.subTo(this.r2,x); while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } // r = x^2 mod m; x != r function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } // r = x*y mod m; x,y != r function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } Barrett.prototype.convert = barrettConvert; Barrett.prototype.revert = barrettRevert; Barrett.prototype.reduce = barrettReduce; Barrett.prototype.mulTo = barrettMulTo; Barrett.prototype.sqrTo = barrettSqrTo; // (public) this^e % m (HAC 14.85) function bnModPow(e,m) { var i = e.bitLength(), k, r = nbv(1), z; if(i <= 0) return r; else if(i < 18) k = 1; else if(i < 48) k = 3; else if(i < 144) k = 4; else if(i < 768) k = 5; else k = 6; if(i < 8) z = new Classic(m); else if(m.isEven()) z = new Barrett(m); else z = new Montgomery(m); // precomputation var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { var g2 = nbi(); z.sqrTo(g[1],g2); while(n <= km) { g[n] = nbi(); z.mulTo(g2,g[n-2],g[n]); n += 2; } } var j = e.t-1, w, is1 = true, r2 = nbi(), t; i = nbits(e[j])-1; while(j >= 0) { if(i >= k1) w = (e[j]>>(i-k1))&km; else { w = (e[j]&((1<<(i+1))-1))<<(k1-i); if(j > 0) w |= e[j-1]>>(this.DB+i-k1); } n = k; while((w&1) == 0) { w >>= 1; --n; } if((i -= n) < 0) { i += this.DB; --j; } if(is1) { // ret == 1, don't bother squaring or multiplying it g[w].copyTo(r); is1 = false; } else { while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } z.mulTo(r2,g[w],r); } while(j >= 0 && (e[j]&(1< 0) { x.rShiftTo(g,x); y.rShiftTo(g,y); } while(x.signum() > 0) { if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); if(x.compareTo(y) >= 0) { x.subTo(y,x); x.rShiftTo(1,x); } else { y.subTo(x,y); y.rShiftTo(1,y); } } if(g > 0) y.lShiftTo(g,y); return y; } // (protected) this % n, n < 2^26 function bnpModInt(n) { if(n <= 0) return 0; var d = this.DV%n, r = (this.s<0)?n-1:0; if(this.t > 0) if(d == 0) r = this[0]%n; else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; return r; } // (public) 1/this % m (HAC 14.61) function bnModInverse(m) { var ac = m.isEven(); if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; var u = m.clone(), v = this.clone(); var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); while(u.signum() != 0) { while(u.isEven()) { u.rShiftTo(1,u); if(ac) { if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } a.rShiftTo(1,a); } else if(!b.isEven()) b.subTo(m,b); b.rShiftTo(1,b); } while(v.isEven()) { v.rShiftTo(1,v); if(ac) { if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } c.rShiftTo(1,c); } else if(!d.isEven()) d.subTo(m,d); d.rShiftTo(1,d); } if(u.compareTo(v) >= 0) { u.subTo(v,u); if(ac) a.subTo(c,a); b.subTo(d,b); } else { v.subTo(u,v); if(ac) c.subTo(a,c); d.subTo(b,d); } } if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; if(d.compareTo(m) >= 0) return d.subtract(m); if(d.signum() < 0) d.addTo(m,d); else return d; if(d.signum() < 0) return d.add(m); else return d; } var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; var lplim = (1<<26)/lowprimes[lowprimes.length-1]; // (public) test primality with certainty >= 1-.5^t function bnIsProbablePrime(t) { var i, x = this.abs(); if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { for(i = 0; i < lowprimes.length; ++i) if(x[0] == lowprimes[i]) return true; return false; } if(x.isEven()) return false; i = 1; while(i < lowprimes.length) { var m = lowprimes[i], j = i+1; while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; m = x.modInt(m); while(i < j) if(m%lowprimes[i++] == 0) return false; } return x.millerRabin(t); } // (protected) true if probably prime (HAC 4.24, Miller-Rabin) function bnpMillerRabin(t) { var n1 = this.subtract(BigInteger.ONE); var k = n1.getLowestSetBit(); if(k <= 0) return false; var r = n1.shiftRight(k); t = (t+1)>>1; if(t > lowprimes.length) t = lowprimes.length; var a = nbi(); for(var i = 0; i < t; ++i) { //Pick bases at random, instead of starting at 2 a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); var y = a.modPow(r,this); if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { var j = 1; while(j++ < k && y.compareTo(n1) != 0) { y = y.modPowInt(2,this); if(y.compareTo(BigInteger.ONE) == 0) return false; } if(y.compareTo(n1) != 0) return false; } } return true; } // protected BigInteger.prototype.chunkSize = bnpChunkSize; BigInteger.prototype.toRadix = bnpToRadix; BigInteger.prototype.fromRadix = bnpFromRadix; BigInteger.prototype.fromNumber = bnpFromNumber; BigInteger.prototype.bitwiseTo = bnpBitwiseTo; BigInteger.prototype.changeBit = bnpChangeBit; BigInteger.prototype.addTo = bnpAddTo; BigInteger.prototype.dMultiply = bnpDMultiply; BigInteger.prototype.dAddOffset = bnpDAddOffset; BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; BigInteger.prototype.modInt = bnpModInt; BigInteger.prototype.millerRabin = bnpMillerRabin; // public BigInteger.prototype.clone = bnClone; BigInteger.prototype.intValue = bnIntValue; BigInteger.prototype.byteValue = bnByteValue; BigInteger.prototype.shortValue = bnShortValue; BigInteger.prototype.signum = bnSigNum; BigInteger.prototype.toByteArray = bnToByteArray; BigInteger.prototype.equals = bnEquals; BigInteger.prototype.min = bnMin; BigInteger.prototype.max = bnMax; BigInteger.prototype.and = bnAnd; BigInteger.prototype.or = bnOr; BigInteger.prototype.xor = bnXor; BigInteger.prototype.andNot = bnAndNot; BigInteger.prototype.not = bnNot; BigInteger.prototype.shiftLeft = bnShiftLeft; BigInteger.prototype.shiftRight = bnShiftRight; BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; BigInteger.prototype.bitCount = bnBitCount; BigInteger.prototype.testBit = bnTestBit; BigInteger.prototype.setBit = bnSetBit; BigInteger.prototype.clearBit = bnClearBit; BigInteger.prototype.flipBit = bnFlipBit; BigInteger.prototype.add = bnAdd; BigInteger.prototype.subtract = bnSubtract; BigInteger.prototype.multiply = bnMultiply; BigInteger.prototype.divide = bnDivide; BigInteger.prototype.remainder = bnRemainder; BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; BigInteger.prototype.modPow = bnModPow; BigInteger.prototype.modInverse = bnModInverse; BigInteger.prototype.pow = bnPow; BigInteger.prototype.gcd = bnGCD; BigInteger.prototype.isProbablePrime = bnIsProbablePrime; // JSBN-specific extension BigInteger.prototype.square = bnSquare; // Expose the Barrett function BigInteger.prototype.Barrett = Barrett // BigInteger interfaces not implemented in jsbn: // BigInteger(int signum, byte[] magnitude) // double doubleValue() // float floatValue() // int hashCode() // long longValue() // static BigInteger valueOf(long val) // Random number generator - requires a PRNG backend, e.g. prng4.js // For best results, put code like // // in your main HTML document. var rng_state; var rng_pool; var rng_pptr; // Mix in a 32-bit integer into the pool function rng_seed_int(x) { rng_pool[rng_pptr++] ^= x & 255; rng_pool[rng_pptr++] ^= (x >> 8) & 255; rng_pool[rng_pptr++] ^= (x >> 16) & 255; rng_pool[rng_pptr++] ^= (x >> 24) & 255; if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; } // Mix in the current time (w/milliseconds) into the pool function rng_seed_time() { rng_seed_int(new Date().getTime()); } // Initialize the pool with junk if needed. if(rng_pool == null) { rng_pool = new Array(); rng_pptr = 0; var t; if(typeof window !== "undefined" && window.crypto) { if (window.crypto.getRandomValues) { // Use webcrypto if available var ua = new Uint8Array(32); window.crypto.getRandomValues(ua); for(t = 0; t < 32; ++t) rng_pool[rng_pptr++] = ua[t]; } else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { // Extract entropy (256 bits) from NS4 RNG if available var z = window.crypto.random(32); for(t = 0; t < z.length; ++t) rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; } } while(rng_pptr < rng_psize) { // extract some randomness from Math.random() t = Math.floor(65536 * Math.random()); rng_pool[rng_pptr++] = t >>> 8; rng_pool[rng_pptr++] = t & 255; } rng_pptr = 0; rng_seed_time(); //rng_seed_int(window.screenX); //rng_seed_int(window.screenY); } function rng_get_byte() { if(rng_state == null) { rng_seed_time(); rng_state = prng_newstate(); rng_state.init(rng_pool); for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) rng_pool[rng_pptr] = 0; rng_pptr = 0; //rng_pool = null; } // TODO: allow reseeding after first request return rng_state.next(); } function rng_get_bytes(ba) { var i; for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); } function SecureRandom() {} SecureRandom.prototype.nextBytes = rng_get_bytes; // prng4.js - uses Arcfour as a PRNG function Arcfour() { this.i = 0; this.j = 0; this.S = new Array(); } // Initialize arcfour context from key, an array of ints, each from [0..255] function ARC4init(key) { var i, j, t; for(i = 0; i < 256; ++i) this.S[i] = i; j = 0; for(i = 0; i < 256; ++i) { j = (j + this.S[i] + key[i % key.length]) & 255; t = this.S[i]; this.S[i] = this.S[j]; this.S[j] = t; } this.i = 0; this.j = 0; } function ARC4next() { var t; this.i = (this.i + 1) & 255; this.j = (this.j + this.S[this.i]) & 255; t = this.S[this.i]; this.S[this.i] = this.S[this.j]; this.S[this.j] = t; return this.S[(t + this.S[this.i]) & 255]; } Arcfour.prototype.init = ARC4init; Arcfour.prototype.next = ARC4next; // Plug in your RNG constructor here function prng_newstate() { return new Arcfour(); } // Pool size must be a multiple of 4 and greater than 32. // An array of bytes the size of the pool will be passed to init() var rng_psize = 256; BigInteger.SecureRandom = SecureRandom; BigInteger.BigInteger = BigInteger; if (true) { exports = module.exports = BigInteger; } else {} }).call(this); /***/ }), /* 243 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var net = __webpack_require__(631) , tls = __webpack_require__(16) , http = __webpack_require__(605) , https = __webpack_require__(211) , events = __webpack_require__(614) , assert = __webpack_require__(357) , util = __webpack_require__(669) , Buffer = __webpack_require__(149).Buffer ; exports.httpOverHttp = httpOverHttp exports.httpsOverHttp = httpsOverHttp exports.httpOverHttps = httpOverHttps exports.httpsOverHttps = httpsOverHttps function httpOverHttp(options) { var agent = new TunnelingAgent(options) agent.request = http.request return agent } function httpsOverHttp(options) { var agent = new TunnelingAgent(options) agent.request = http.request agent.createSocket = createSecureSocket agent.defaultPort = 443 return agent } function httpOverHttps(options) { var agent = new TunnelingAgent(options) agent.request = https.request return agent } function httpsOverHttps(options) { var agent = new TunnelingAgent(options) agent.request = https.request agent.createSocket = createSecureSocket agent.defaultPort = 443 return agent } function TunnelingAgent(options) { var self = this self.options = options || {} self.proxyOptions = self.options.proxy || {} self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets self.requests = [] self.sockets = [] self.on('free', function onFree(socket, host, port) { for (var i = 0, len = self.requests.length; i < len; ++i) { var pending = self.requests[i] if (pending.host === host && pending.port === port) { // Detect the request to connect same origin server, // reuse the connection. self.requests.splice(i, 1) pending.request.onSocket(socket) return } } socket.destroy() self.removeSocket(socket) }) } util.inherits(TunnelingAgent, events.EventEmitter) TunnelingAgent.prototype.addRequest = function addRequest(req, options) { var self = this // Legacy API: addRequest(req, host, port, path) if (typeof options === 'string') { options = { host: options, port: arguments[2], path: arguments[3] }; } if (self.sockets.length >= this.maxSockets) { // We are over limit so we'll add it to the queue. self.requests.push({host: options.host, port: options.port, request: req}) return } // If we are under maxSockets create a new one. self.createConnection({host: options.host, port: options.port, request: req}) } TunnelingAgent.prototype.createConnection = function createConnection(pending) { var self = this self.createSocket(pending, function(socket) { socket.on('free', onFree) socket.on('close', onCloseOrRemove) socket.on('agentRemove', onCloseOrRemove) pending.request.onSocket(socket) function onFree() { self.emit('free', socket, pending.host, pending.port) } function onCloseOrRemove(err) { self.removeSocket(socket) socket.removeListener('free', onFree) socket.removeListener('close', onCloseOrRemove) socket.removeListener('agentRemove', onCloseOrRemove) } }) } TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { var self = this var placeholder = {} self.sockets.push(placeholder) var connectOptions = mergeOptions({}, self.proxyOptions, { method: 'CONNECT' , path: options.host + ':' + options.port , agent: false } ) if (connectOptions.proxyAuth) { connectOptions.headers = connectOptions.headers || {} connectOptions.headers['Proxy-Authorization'] = 'Basic ' + Buffer.from(connectOptions.proxyAuth).toString('base64') } debug('making CONNECT request') var connectReq = self.request(connectOptions) connectReq.useChunkedEncodingByDefault = false // for v0.6 connectReq.once('response', onResponse) // for v0.6 connectReq.once('upgrade', onUpgrade) // for v0.6 connectReq.once('connect', onConnect) // for v0.7 or later connectReq.once('error', onError) connectReq.end() function onResponse(res) { // Very hacky. This is necessary to avoid http-parser leaks. res.upgrade = true } function onUpgrade(res, socket, head) { // Hacky. process.nextTick(function() { onConnect(res, socket, head) }) } function onConnect(res, socket, head) { connectReq.removeAllListeners() socket.removeAllListeners() if (res.statusCode === 200) { assert.equal(head.length, 0) debug('tunneling connection has established') self.sockets[self.sockets.indexOf(placeholder)] = socket cb(socket) } else { debug('tunneling socket could not be established, statusCode=%d', res.statusCode) var error = new Error('tunneling socket could not be established, ' + 'statusCode=' + res.statusCode) error.code = 'ECONNRESET' options.request.emit('error', error) self.removeSocket(placeholder) } } function onError(cause) { connectReq.removeAllListeners() debug('tunneling socket could not be established, cause=%s\n', cause.message, cause.stack) var error = new Error('tunneling socket could not be established, ' + 'cause=' + cause.message) error.code = 'ECONNRESET' options.request.emit('error', error) self.removeSocket(placeholder) } } TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { var pos = this.sockets.indexOf(socket) if (pos === -1) return this.sockets.splice(pos, 1) var pending = this.requests.shift() if (pending) { // If we have pending requests and a socket gets closed a new one // needs to be created to take over in the pool for the one that closed. this.createConnection(pending) } } function createSecureSocket(options, cb) { var self = this TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { // 0 is dummy port for v0.6 var secureSocket = tls.connect(0, mergeOptions({}, self.options, { servername: options.host , socket: socket } )) self.sockets[self.sockets.indexOf(socket)] = secureSocket cb(secureSocket) }) } function mergeOptions(target) { for (var i = 1, len = arguments.length; i < len; ++i) { var overrides = arguments[i] if (typeof overrides === 'object') { var keys = Object.keys(overrides) for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { var k = keys[j] if (overrides[k] !== undefined) { target[k] = overrides[k] } } } } return target } var debug if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { debug = function() { var args = Array.prototype.slice.call(arguments) if (typeof args[0] === 'string') { args[0] = 'TUNNEL: ' + args[0] } else { args.unshift('TUNNEL:') } console.error.apply(console, args) } } else { debug = function() {} } exports.debug = debug // for test /***/ }), /* 244 */, /* 245 */, /* 246 */, /* 247 */, /* 248 */, /* 249 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. var errors = __webpack_require__(584); var types = __webpack_require__(362); var Reader = __webpack_require__(733); var Writer = __webpack_require__(998); // --- Exports module.exports = { Reader: Reader, Writer: Writer }; for (var t in types) { if (types.hasOwnProperty(t)) module.exports[t] = types[t]; } for (var e in errors) { if (errors.hasOwnProperty(e)) module.exports[e] = errors[e]; } /***/ }), /* 250 */, /* 251 */, /* 252 */, /* 253 */, /* 254 */ /***/ (function(module, __unusedexports, __webpack_require__) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function () { var makePromise = __webpack_require__(313); var Scheduler = __webpack_require__(483); var async = __webpack_require__(709).asap; return makePromise({ scheduler: new Scheduler(async) }); }); })(typeof define === 'function' && define.amd ? define : function (factory) { module.exports = factory(require); }); /***/ }), /* 255 */, /* 256 */, /* 257 */, /* 258 */, /* 259 */, /* 260 */, /* 261 */, /* 262 */, /* 263 */, /* 264 */, /* 265 */, /* 266 */ /***/ (function(module) { "use strict"; module.exports = function generate_ref(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $async, $refCode; if ($schema == '#' || $schema == '#/') { if (it.isRoot) { $async = it.async; $refCode = 'validate'; } else { $async = it.root.schema.$async === true; $refCode = 'root.refVal[0]'; } } else { var $refVal = it.resolveRef(it.baseId, $schema, it.isRoot); if ($refVal === undefined) { var $message = it.MissingRefError.message(it.baseId, $schema); if (it.opts.missingRefs == 'fail') { it.logger.error($message); var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('$ref') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { ref: \'' + (it.util.escapeQuotes($schema)) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \'can\\\'t resolve reference ' + (it.util.escapeQuotes($schema)) + '\' '; } if (it.opts.verbose) { out += ' , schema: ' + (it.util.toQuotedString($schema)) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } if ($breakOnError) { out += ' if (false) { '; } } else if (it.opts.missingRefs == 'ignore') { it.logger.warn($message); if ($breakOnError) { out += ' if (true) { '; } } else { throw new it.MissingRefError(it.baseId, $schema, $message); } } else if ($refVal.inline) { var $it = it.util.copy(it); $it.level++; var $nextValid = 'valid' + $it.level; $it.schema = $refVal.schema; $it.schemaPath = ''; $it.errSchemaPath = $schema; var $code = it.validate($it).replace(/validate\.schema/g, $refVal.code); out += ' ' + ($code) + ' '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; } } else { $async = $refVal.$async === true || (it.async && $refVal.$async !== false); $refCode = $refVal.code; } } if ($refCode) { var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; if (it.opts.passContext) { out += ' ' + ($refCode) + '.call(this, '; } else { out += ' ' + ($refCode) + '( '; } out += ' ' + ($data) + ', (dataPath || \'\')'; if (it.errorPath != '""') { out += ' + ' + (it.errorPath); } var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ', rootData) '; var __callValidate = out; out = $$outStack.pop(); if ($async) { if (!it.async) throw new Error('async schema referenced by sync schema'); if ($breakOnError) { out += ' var ' + ($valid) + '; '; } out += ' try { await ' + (__callValidate) + '; '; if ($breakOnError) { out += ' ' + ($valid) + ' = true; '; } out += ' } catch (e) { if (!(e instanceof ValidationError)) throw e; if (vErrors === null) vErrors = e.errors; else vErrors = vErrors.concat(e.errors); errors = vErrors.length; '; if ($breakOnError) { out += ' ' + ($valid) + ' = false; '; } out += ' } '; if ($breakOnError) { out += ' if (' + ($valid) + ') { '; } } else { out += ' if (!' + (__callValidate) + ') { if (vErrors === null) vErrors = ' + ($refCode) + '.errors; else vErrors = vErrors.concat(' + ($refCode) + '.errors); errors = vErrors.length; } '; if ($breakOnError) { out += ' else { '; } } } return out; } /***/ }), /* 267 */, /* 268 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2018 Joyent, Inc. module.exports = { read: read, write: write }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var crypto = __webpack_require__(417); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pkcs1 = __webpack_require__(449); var pkcs8 = __webpack_require__(707); var sshpriv = __webpack_require__(78); var rfc4253 = __webpack_require__(538); var errors = __webpack_require__(753); var OID_PBES2 = '1.2.840.113549.1.5.13'; var OID_PBKDF2 = '1.2.840.113549.1.5.12'; var OID_TO_CIPHER = { '1.2.840.113549.3.7': '3des-cbc', '2.16.840.1.101.3.4.1.2': 'aes128-cbc', '2.16.840.1.101.3.4.1.42': 'aes256-cbc' }; var CIPHER_TO_OID = {}; Object.keys(OID_TO_CIPHER).forEach(function (k) { CIPHER_TO_OID[OID_TO_CIPHER[k]] = k; }); var OID_TO_HASH = { '1.2.840.113549.2.7': 'sha1', '1.2.840.113549.2.9': 'sha256', '1.2.840.113549.2.11': 'sha512' }; var HASH_TO_OID = {}; Object.keys(OID_TO_HASH).forEach(function (k) { HASH_TO_OID[OID_TO_HASH[k]] = k; }); /* * For reading we support both PKCS#1 and PKCS#8. If we find a private key, * we just take the public component of it and use that. */ function read(buf, options, forceType) { var input = buf; if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var lines = buf.trim().split(/[\r\n]+/g); var m; var si = -1; while (!m && si < lines.length) { m = lines[++si].match(/*JSSTYLED*/ /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); } assert.ok(m, 'invalid PEM header'); var m2; var ei = lines.length; while (!m2 && ei > 0) { m2 = lines[--ei].match(/*JSSTYLED*/ /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); } assert.ok(m2, 'invalid PEM footer'); /* Begin and end banners must match key type */ assert.equal(m[2], m2[2]); var type = m[2].toLowerCase(); var alg; if (m[1]) { /* They also must match algorithms, if given */ assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); alg = m[1].trim(); } lines = lines.slice(si, ei + 1); var headers = {}; while (true) { lines = lines.slice(1); m = lines[0].match(/*JSSTYLED*/ /^([A-Za-z0-9-]+): (.+)$/); if (!m) break; headers[m[1].toLowerCase()] = m[2]; } /* Chop off the first and last lines */ lines = lines.slice(0, -1).join(''); buf = Buffer.from(lines, 'base64'); var cipher, key, iv; if (headers['proc-type']) { var parts = headers['proc-type'].split(','); if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from( options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'PEM')); } else { parts = headers['dek-info'].split(','); assert.ok(parts.length === 2); cipher = parts[0].toLowerCase(); iv = Buffer.from(parts[1], 'hex'); key = utils.opensslKeyDeriv(cipher, iv, options.passphrase, 1).key; } } } if (alg && alg.toLowerCase() === 'encrypted') { var eder = new asn1.BerReader(buf); var pbesEnd; eder.readSequence(); eder.readSequence(); pbesEnd = eder.offset + eder.length; var method = eder.readOID(); if (method !== OID_PBES2) { throw (new Error('Unsupported PEM/PKCS8 encryption ' + 'scheme: ' + method)); } eder.readSequence(); /* PBES2-params */ eder.readSequence(); /* keyDerivationFunc */ var kdfEnd = eder.offset + eder.length; var kdfOid = eder.readOID(); if (kdfOid !== OID_PBKDF2) throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); eder.readSequence(); var salt = eder.readString(asn1.Ber.OctetString, true); var iterations = eder.readInt(); var hashAlg = 'sha1'; if (eder.offset < kdfEnd) { eder.readSequence(); var hashAlgOid = eder.readOID(); hashAlg = OID_TO_HASH[hashAlgOid]; if (hashAlg === undefined) { throw (new Error('Unsupported PBKDF2 hash: ' + hashAlgOid)); } } eder._offset = kdfEnd; eder.readSequence(); /* encryptionScheme */ var cipherOid = eder.readOID(); cipher = OID_TO_CIPHER[cipherOid]; if (cipher === undefined) { throw (new Error('Unsupported PBES2 cipher: ' + cipherOid)); } iv = eder.readString(asn1.Ber.OctetString, true); eder._offset = pbesEnd; buf = eder.readString(asn1.Ber.OctetString, true); if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from( options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'PEM')); } var cinfo = utils.opensshCipherInfo(cipher); cipher = cinfo.opensslName; key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, options.passphrase); alg = undefined; } if (cipher && key && iv) { var cipherStream = crypto.createDecipheriv(cipher, key, iv); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(buf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); buf = Buffer.concat(chunks); } /* The new OpenSSH internal format abuses PEM headers */ if (alg && alg.toLowerCase() === 'openssh') return (sshpriv.readSSHPrivate(type, buf, options)); if (alg && alg.toLowerCase() === 'ssh2') return (rfc4253.readType(type, buf, options)); var der = new asn1.BerReader(buf); der.originalInput = input; /* * All of the PEM file types start with a sequence tag, so chop it * off here */ der.readSequence(); /* PKCS#1 type keys name an algorithm in the banner explicitly */ if (alg) { if (forceType) assert.strictEqual(forceType, 'pkcs1'); return (pkcs1.readPkcs1(alg, type, der)); } else { if (forceType) assert.strictEqual(forceType, 'pkcs8'); return (pkcs8.readPkcs8(alg, type, der)); } } function write(key, options, type) { assert.object(key); var alg = { 'ecdsa': 'EC', 'rsa': 'RSA', 'dsa': 'DSA', 'ed25519': 'EdDSA' }[key.type]; var header; var der = new asn1.BerWriter(); if (PrivateKey.isPrivateKey(key)) { if (type && type === 'pkcs8') { header = 'PRIVATE KEY'; pkcs8.writePkcs8(der, key); } else { if (type) assert.strictEqual(type, 'pkcs1'); header = alg + ' PRIVATE KEY'; pkcs1.writePkcs1(der, key); } } else if (Key.isKey(key)) { if (type && type === 'pkcs1') { header = alg + ' PUBLIC KEY'; pkcs1.writePkcs1(der, key); } else { if (type) assert.strictEqual(type, 'pkcs8'); header = 'PUBLIC KEY'; pkcs8.writePkcs8(der, key); } } else { throw (new Error('key is not a Key or PrivateKey')); } var tmp = der.buffer.toString('base64'); var len = tmp.length + (tmp.length / 64) + 18 + 16 + header.length*2 + 10; var buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 64; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } /***/ }), /* 269 */, /* 270 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { bufferSplit: bufferSplit, addRSAMissing: addRSAMissing, calculateDSAPublic: calculateDSAPublic, calculateED25519Public: calculateED25519Public, calculateX25519Public: calculateX25519Public, mpNormalize: mpNormalize, mpDenormalize: mpDenormalize, ecNormalize: ecNormalize, countZeros: countZeros, assertCompatible: assertCompatible, isCompatible: isCompatible, opensslKeyDeriv: opensslKeyDeriv, opensshCipherInfo: opensshCipherInfo, publicFromPrivateECDSA: publicFromPrivateECDSA, zeroPadToLength: zeroPadToLength, writeBitString: writeBitString, readBitString: readBitString, pbkdf2: pbkdf2 }; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var PrivateKey = __webpack_require__(502); var Key = __webpack_require__(852); var crypto = __webpack_require__(417); var algs = __webpack_require__(98); var asn1 = __webpack_require__(62); var ec = __webpack_require__(729); var jsbn = __webpack_require__(242).BigInteger; var nacl = __webpack_require__(196); var MAX_CLASS_DEPTH = 3; function isCompatible(obj, klass, needVer) { if (obj === null || typeof (obj) !== 'object') return (false); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return (true); var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); if (!proto || ++depth > MAX_CLASS_DEPTH) return (false); } if (proto.constructor.name !== klass.name) return (false); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); if (ver[0] != needVer[0] || ver[1] < needVer[1]) return (false); return (true); } function assertCompatible(obj, klass, needVer, name) { if (name === undefined) name = 'object'; assert.ok(obj, name + ' must not be null'); assert.object(obj, name + ' must be an object'); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return; var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, name + ' must be a ' + klass.name + ' instance'); } assert.strictEqual(proto.constructor.name, klass.name, name + ' must be a ' + klass.name + ' instance'); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], name + ' must be compatible with ' + klass.name + ' klass ' + 'version ' + needVer[0] + '.' + needVer[1]); } var CIPHER_LEN = { 'des-ede3-cbc': { key: 24, iv: 8 }, 'aes-128-cbc': { key: 16, iv: 16 }, 'aes-256-cbc': { key: 32, iv: 16 } }; var PKCS5_SALT_LEN = 8; function opensslKeyDeriv(cipher, salt, passphrase, count) { assert.buffer(salt, 'salt'); assert.buffer(passphrase, 'passphrase'); assert.number(count, 'iteration count'); var clen = CIPHER_LEN[cipher]; assert.object(clen, 'supported cipher'); salt = salt.slice(0, PKCS5_SALT_LEN); var D, D_prev, bufs; var material = Buffer.alloc(0); while (material.length < clen.key + clen.iv) { bufs = []; if (D_prev) bufs.push(D_prev); bufs.push(passphrase); bufs.push(salt); D = Buffer.concat(bufs); for (var j = 0; j < count; ++j) D = crypto.createHash('md5').update(D).digest(); material = Buffer.concat([material, D]); D_prev = D; } return ({ key: material.slice(0, clen.key), iv: material.slice(clen.key, clen.key + clen.iv) }); } /* See: RFC2898 */ function pbkdf2(hashAlg, salt, iterations, size, passphrase) { var hkey = Buffer.alloc(salt.length + 4); salt.copy(hkey); var gen = 0, ts = []; var i = 1; while (gen < size) { var t = T(i++); gen += t.length; ts.push(t); } return (Buffer.concat(ts).slice(0, size)); function T(I) { hkey.writeUInt32BE(I, hkey.length - 4); var hmac = crypto.createHmac(hashAlg, passphrase); hmac.update(hkey); var Ti = hmac.digest(); var Uc = Ti; var c = 1; while (c++ < iterations) { hmac = crypto.createHmac(hashAlg, passphrase); hmac.update(Uc); Uc = hmac.digest(); for (var x = 0; x < Ti.length; ++x) Ti[x] ^= Uc[x]; } return (Ti); } } /* Count leading zero bits on a buffer */ function countZeros(buf) { var o = 0, obit = 8; while (o < buf.length) { var mask = (1 << obit); if ((buf[o] & mask) === mask) break; obit--; if (obit < 0) { o++; obit = 8; } } return (o*8 + (8 - obit) - 1); } function bufferSplit(buf, chr) { assert.buffer(buf); assert.string(chr); var parts = []; var lastPart = 0; var matches = 0; for (var i = 0; i < buf.length; ++i) { if (buf[i] === chr.charCodeAt(matches)) ++matches; else if (buf[i] === chr.charCodeAt(0)) matches = 1; else matches = 0; if (matches >= chr.length) { var newPart = i + 1; parts.push(buf.slice(lastPart, newPart - matches)); lastPart = newPart; matches = 0; } } if (lastPart <= buf.length) parts.push(buf.slice(lastPart, buf.length)); return (parts); } function ecNormalize(buf, addZero) { assert.buffer(buf); if (buf[0] === 0x00 && buf[1] === 0x04) { if (addZero) return (buf); return (buf.slice(1)); } else if (buf[0] === 0x04) { if (!addZero) return (buf); } else { while (buf[0] === 0x00) buf = buf.slice(1); if (buf[0] === 0x02 || buf[0] === 0x03) throw (new Error('Compressed elliptic curve points ' + 'are not supported')); if (buf[0] !== 0x04) throw (new Error('Not a valid elliptic curve point')); if (!addZero) return (buf); } var b = Buffer.alloc(buf.length + 1); b[0] = 0x0; buf.copy(b, 1); return (b); } function readBitString(der, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var buf = der.readString(tag, true); assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + 'not supported (0x' + buf[0].toString(16) + ')'); return (buf.slice(1)); } function writeBitString(der, buf, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); der.writeBuffer(b, tag); } function mpNormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) buf = buf.slice(1); if ((buf[0] & 0x80) === 0x80) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function mpDenormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00) buf = buf.slice(1); return (buf); } function zeroPadToLength(buf, len) { assert.buffer(buf); assert.number(len); while (buf.length > len) { assert.equal(buf[0], 0x00); buf = buf.slice(1); } while (buf.length < len) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function bigintToMpBuf(bigint) { var buf = Buffer.from(bigint.toByteArray()); buf = mpNormalize(buf); return (buf); } function calculateDSAPublic(g, p, x) { assert.buffer(g); assert.buffer(p); assert.buffer(x); g = new jsbn(g); p = new jsbn(p); x = new jsbn(x); var y = g.modPow(x, p); var ybuf = bigintToMpBuf(y); return (ybuf); } function calculateED25519Public(k) { assert.buffer(k); var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function calculateX25519Public(k) { assert.buffer(k); var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function addRSAMissing(key) { assert.object(key); assertCompatible(key, PrivateKey, [1, 1]); var d = new jsbn(key.part.d.data); var buf; if (!key.part.dmodp) { var p = new jsbn(key.part.p.data); var dmodp = d.mod(p.subtract(1)); buf = bigintToMpBuf(dmodp); key.part.dmodp = {name: 'dmodp', data: buf}; key.parts.push(key.part.dmodp); } if (!key.part.dmodq) { var q = new jsbn(key.part.q.data); var dmodq = d.mod(q.subtract(1)); buf = bigintToMpBuf(dmodq); key.part.dmodq = {name: 'dmodq', data: buf}; key.parts.push(key.part.dmodq); } } function publicFromPrivateECDSA(curveName, priv) { assert.string(curveName, 'curveName'); assert.buffer(priv); var params = algs.curves[curveName]; var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); var d = new jsbn(mpNormalize(priv)); var pub = G.multiply(d); pub = Buffer.from(curve.encodePointHex(pub), 'hex'); var parts = []; parts.push({name: 'curve', data: Buffer.from(curveName)}); parts.push({name: 'Q', data: pub}); var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); return (key); } function opensshCipherInfo(cipher) { var inf = {}; switch (cipher) { case '3des-cbc': inf.keySize = 24; inf.blockSize = 8; inf.opensslName = 'des-ede3-cbc'; break; case 'blowfish-cbc': inf.keySize = 16; inf.blockSize = 8; inf.opensslName = 'bf-cbc'; break; case 'aes128-cbc': case 'aes128-ctr': case 'aes128-gcm@openssh.com': inf.keySize = 16; inf.blockSize = 16; inf.opensslName = 'aes-128-' + cipher.slice(7, 10); break; case 'aes192-cbc': case 'aes192-ctr': case 'aes192-gcm@openssh.com': inf.keySize = 24; inf.blockSize = 16; inf.opensslName = 'aes-192-' + cipher.slice(7, 10); break; case 'aes256-cbc': case 'aes256-ctr': case 'aes256-gcm@openssh.com': inf.keySize = 32; inf.blockSize = 16; inf.opensslName = 'aes-256-' + cipher.slice(7, 10); break; default: throw (new Error( 'Unsupported openssl cipher "' + cipher + '"')); } return (inf); } /***/ }), /* 271 */, /* 272 */, /* 273 */, /* 274 */, /* 275 */, /* 276 */, /* 277 */, /* 278 */, /* 279 */, /* 280 */ /***/ (function(module) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { /** * Custom error type for promises rejected by promise.timeout * @param {string} message * @constructor */ function TimeoutError (message) { Error.call(this); this.message = message; this.name = TimeoutError.name; if (typeof Error.captureStackTrace === 'function') { Error.captureStackTrace(this, TimeoutError); } } TimeoutError.prototype = Object.create(Error.prototype); TimeoutError.prototype.constructor = TimeoutError; return TimeoutError; }); }(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); /***/ }), /* 281 */ /***/ (function(module) { "use strict"; module.exports = function generate_enum(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $i = 'i' + $lvl, $vSchema = 'schema' + $lvl; if (!$isData) { out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; } out += 'var ' + ($valid) + ';'; if ($isData) { out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; } out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; if ($isData) { out += ' } '; } out += ' if (!' + ($valid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should be equal to one of the allowed values\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' }'; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /* 282 */, /* 283 */, /* 284 */, /* 285 */, /* 286 */ /***/ (function(__unusedmodule, exports) { // Copyright Joyent, Inc. and other Node contributors. // // Permission is hereby granted, free of charge, to any person obtaining a // copy of this software and associated documentation files (the // "Software"), to deal in the Software without restriction, including // without limitation the rights to use, copy, modify, merge, publish, // distribute, sublicense, and/or sell copies of the Software, and to permit // persons to whom the Software is furnished to do so, subject to the // following conditions: // // The above copyright notice and this permission notice shall be included // in all copies or substantial portions of the Software. // // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN // NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, // DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE // USE OR OTHER DEALINGS IN THE SOFTWARE. // NOTE: These type checking functions intentionally don't use `instanceof` // because it is fragile and can be easily faked with `Object.create()`. function isArray(arg) { if (Array.isArray) { return Array.isArray(arg); } return objectToString(arg) === '[object Array]'; } exports.isArray = isArray; function isBoolean(arg) { return typeof arg === 'boolean'; } exports.isBoolean = isBoolean; function isNull(arg) { return arg === null; } exports.isNull = isNull; function isNullOrUndefined(arg) { return arg == null; } exports.isNullOrUndefined = isNullOrUndefined; function isNumber(arg) { return typeof arg === 'number'; } exports.isNumber = isNumber; function isString(arg) { return typeof arg === 'string'; } exports.isString = isString; function isSymbol(arg) { return typeof arg === 'symbol'; } exports.isSymbol = isSymbol; function isUndefined(arg) { return arg === void 0; } exports.isUndefined = isUndefined; function isRegExp(re) { return objectToString(re) === '[object RegExp]'; } exports.isRegExp = isRegExp; function isObject(arg) { return typeof arg === 'object' && arg !== null; } exports.isObject = isObject; function isDate(d) { return objectToString(d) === '[object Date]'; } exports.isDate = isDate; function isError(e) { return (objectToString(e) === '[object Error]' || e instanceof Error); } exports.isError = isError; function isFunction(arg) { return typeof arg === 'function'; } exports.isFunction = isFunction; function isPrimitive(arg) { return arg === null || typeof arg === 'boolean' || typeof arg === 'number' || typeof arg === 'string' || typeof arg === 'symbol' || // ES6 symbol typeof arg === 'undefined'; } exports.isPrimitive = isPrimitive; exports.isBuffer = Buffer.isBuffer; function objectToString(o) { return Object.prototype.toString.call(o); } /***/ }), /* 287 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var url = __webpack_require__(835) var qs = __webpack_require__(386) var caseless = __webpack_require__(7) var uuid = __webpack_require__(826) var oauth = __webpack_require__(113) var crypto = __webpack_require__(417) var Buffer = __webpack_require__(149).Buffer function OAuth (request) { this.request = request this.params = null } OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) { var oa = {} for (var i in _oauth) { oa['oauth_' + i] = _oauth[i] } if (!oa.oauth_version) { oa.oauth_version = '1.0' } if (!oa.oauth_timestamp) { oa.oauth_timestamp = Math.floor(Date.now() / 1000).toString() } if (!oa.oauth_nonce) { oa.oauth_nonce = uuid().replace(/-/g, '') } if (!oa.oauth_signature_method) { oa.oauth_signature_method = 'HMAC-SHA1' } var consumer_secret_or_private_key = oa.oauth_consumer_secret || oa.oauth_private_key // eslint-disable-line camelcase delete oa.oauth_consumer_secret delete oa.oauth_private_key var token_secret = oa.oauth_token_secret // eslint-disable-line camelcase delete oa.oauth_token_secret var realm = oa.oauth_realm delete oa.oauth_realm delete oa.oauth_transport_method var baseurl = uri.protocol + '//' + uri.host + uri.pathname var params = qsLib.parse([].concat(query, form, qsLib.stringify(oa)).join('&')) oa.oauth_signature = oauth.sign( oa.oauth_signature_method, method, baseurl, params, consumer_secret_or_private_key, // eslint-disable-line camelcase token_secret // eslint-disable-line camelcase ) if (realm) { oa.realm = realm } return oa } OAuth.prototype.buildBodyHash = function (_oauth, body) { if (['HMAC-SHA1', 'RSA-SHA1'].indexOf(_oauth.signature_method || 'HMAC-SHA1') < 0) { this.request.emit('error', new Error('oauth: ' + _oauth.signature_method + ' signature_method not supported with body_hash signing.')) } var shasum = crypto.createHash('sha1') shasum.update(body || '') var sha1 = shasum.digest('hex') return Buffer.from(sha1, 'hex').toString('base64') } OAuth.prototype.concatParams = function (oa, sep, wrap) { wrap = wrap || '' var params = Object.keys(oa).filter(function (i) { return i !== 'realm' && i !== 'oauth_signature' }).sort() if (oa.realm) { params.splice(0, 0, 'realm') } params.push('oauth_signature') return params.map(function (i) { return i + '=' + wrap + oauth.rfc3986(oa[i]) + wrap }).join(sep) } OAuth.prototype.onRequest = function (_oauth) { var self = this self.params = _oauth var uri = self.request.uri || {} var method = self.request.method || '' var headers = caseless(self.request.headers) var body = self.request.body || '' var qsLib = self.request.qsLib || qs var form var query var contentType = headers.get('content-type') || '' var formContentType = 'application/x-www-form-urlencoded' var transport = _oauth.transport_method || 'header' if (contentType.slice(0, formContentType.length) === formContentType) { contentType = formContentType form = body } if (uri.query) { query = uri.query } if (transport === 'body' && (method !== 'POST' || contentType !== formContentType)) { self.request.emit('error', new Error('oauth: transport_method of body requires POST ' + 'and content-type ' + formContentType)) } if (!form && typeof _oauth.body_hash === 'boolean') { _oauth.body_hash = self.buildBodyHash(_oauth, self.request.body.toString()) } var oa = self.buildParams(_oauth, uri, method, query, form, qsLib) switch (transport) { case 'header': self.request.setHeader('Authorization', 'OAuth ' + self.concatParams(oa, ',', '"')) break case 'query': var href = self.request.uri.href += (query ? '&' : '?') + self.concatParams(oa, '&') self.request.uri = url.parse(href) self.request.path = self.request.uri.path break case 'body': self.request.body = (form ? form + '&' : '') + self.concatParams(oa, '&') break default: self.request.emit('error', new Error('oauth: transport_method invalid')) } } exports.OAuth = OAuth /***/ }), /* 288 */, /* 289 */, /* 290 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = { DiffieHellman: DiffieHellman, generateECDSA: generateECDSA, generateED25519: generateED25519 }; var assert = __webpack_require__(477); var crypto = __webpack_require__(417); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var nacl = __webpack_require__(196); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); var ecdh = __webpack_require__(886); var ec = __webpack_require__(729); var jsbn = __webpack_require__(242).BigInteger; function DiffieHellman(key) { utils.assertCompatible(key, Key, [1, 4], 'key'); this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); this._algo = key.type; this._curve = key.curve; this._key = key; if (key.type === 'dsa') { if (!CRYPTO_HAVE_ECDH) { throw (new Error('Due to bugs in the node 0.10 ' + 'crypto API, node 0.12.x or later is required ' + 'to use DH')); } this._dh = crypto.createDiffieHellman( key.part.p.data, undefined, key.part.g.data, undefined); this._p = key.part.p; this._g = key.part.g; if (this._isPriv) this._dh.setPrivateKey(key.part.x.data); this._dh.setPublicKey(key.part.y.data); } else if (key.type === 'ecdsa') { if (!CRYPTO_HAVE_ECDH) { this._ecParams = new X9ECParameters(this._curve); if (this._isPriv) { this._priv = new ECPrivate( this._ecParams, key.part.d.data); } return; } var curve = { 'nistp256': 'prime256v1', 'nistp384': 'secp384r1', 'nistp521': 'secp521r1' }[key.curve]; this._dh = crypto.createECDH(curve); if (typeof (this._dh) !== 'object' || typeof (this._dh.setPrivateKey) !== 'function') { CRYPTO_HAVE_ECDH = false; DiffieHellman.call(this, key); return; } if (this._isPriv) this._dh.setPrivateKey(key.part.d.data); this._dh.setPublicKey(key.part.Q.data); } else if (key.type === 'curve25519') { if (this._isPriv) { utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); this._priv = key.part.k.data; } } else { throw (new Error('DH not supported for ' + key.type + ' keys')); } } DiffieHellman.prototype.getPublicKey = function () { if (this._isPriv) return (this._key.toPublic()); return (this._key); }; DiffieHellman.prototype.getPrivateKey = function () { if (this._isPriv) return (this._key); else return (undefined); }; DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; DiffieHellman.prototype._keyCheck = function (pk, isPub) { assert.object(pk, 'key'); if (!isPub) utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); utils.assertCompatible(pk, Key, [1, 4], 'key'); if (pk.type !== this._algo) { throw (new Error('A ' + pk.type + ' key cannot be used in ' + this._algo + ' Diffie-Hellman')); } if (pk.curve !== this._curve) { throw (new Error('A key from the ' + pk.curve + ' curve ' + 'cannot be used with a ' + this._curve + ' Diffie-Hellman')); } if (pk.type === 'dsa') { assert.deepEqual(pk.part.p, this._p, 'DSA key prime does not match'); assert.deepEqual(pk.part.g, this._g, 'DSA key generator does not match'); } }; DiffieHellman.prototype.setKey = function (pk) { this._keyCheck(pk); if (pk.type === 'dsa') { this._dh.setPrivateKey(pk.part.x.data); this._dh.setPublicKey(pk.part.y.data); } else if (pk.type === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { this._dh.setPrivateKey(pk.part.d.data); this._dh.setPublicKey(pk.part.Q.data); } else { this._priv = new ECPrivate( this._ecParams, pk.part.d.data); } } else if (pk.type === 'curve25519') { var k = pk.part.k; if (!pk.part.k) k = pk.part.r; this._priv = k.data; if (this._priv[0] === 0x00) this._priv = this._priv.slice(1); this._priv = this._priv.slice(0, 32); } this._key = pk; this._isPriv = true; }; DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; DiffieHellman.prototype.computeSecret = function (otherpk) { this._keyCheck(otherpk, true); if (!this._isPriv) throw (new Error('DH exchange has not been initialized with ' + 'a private key yet')); var pub; if (this._algo === 'dsa') { return (this._dh.computeSecret( otherpk.part.y.data)); } else if (this._algo === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { return (this._dh.computeSecret( otherpk.part.Q.data)); } else { pub = new ECPublic( this._ecParams, otherpk.part.Q.data); return (this._priv.deriveSharedSecret(pub)); } } else if (this._algo === 'curve25519') { pub = otherpk.part.A.data; while (pub[0] === 0x00 && pub.length > 32) pub = pub.slice(1); var priv = this._priv; assert.strictEqual(pub.length, 32); assert.strictEqual(priv.length, 32); var secret = nacl.box.before(new Uint8Array(pub), new Uint8Array(priv)); return (Buffer.from(secret)); } throw (new Error('Invalid algorithm: ' + this._algo)); }; DiffieHellman.prototype.generateKey = function () { var parts = []; var priv, pub; if (this._algo === 'dsa') { this._dh.generateKeys(); parts.push({name: 'p', data: this._p.data}); parts.push({name: 'q', data: this._key.part.q.data}); parts.push({name: 'g', data: this._g.data}); parts.push({name: 'y', data: this._dh.getPublicKey()}); parts.push({name: 'x', data: this._dh.getPrivateKey()}); this._key = new PrivateKey({ type: 'dsa', parts: parts }); this._isPriv = true; return (this._key); } else if (this._algo === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { this._dh.generateKeys(); parts.push({name: 'curve', data: Buffer.from(this._curve)}); parts.push({name: 'Q', data: this._dh.getPublicKey()}); parts.push({name: 'd', data: this._dh.getPrivateKey()}); this._key = new PrivateKey({ type: 'ecdsa', curve: this._curve, parts: parts }); this._isPriv = true; return (this._key); } else { var n = this._ecParams.getN(); var r = new jsbn(crypto.randomBytes(n.bitLength())); var n1 = n.subtract(jsbn.ONE); priv = r.mod(n1).add(jsbn.ONE); pub = this._ecParams.getG().multiply(priv); priv = Buffer.from(priv.toByteArray()); pub = Buffer.from(this._ecParams.getCurve(). encodePointHex(pub), 'hex'); this._priv = new ECPrivate(this._ecParams, priv); parts.push({name: 'curve', data: Buffer.from(this._curve)}); parts.push({name: 'Q', data: pub}); parts.push({name: 'd', data: priv}); this._key = new PrivateKey({ type: 'ecdsa', curve: this._curve, parts: parts }); this._isPriv = true; return (this._key); } } else if (this._algo === 'curve25519') { var pair = nacl.box.keyPair(); priv = Buffer.from(pair.secretKey); pub = Buffer.from(pair.publicKey); priv = Buffer.concat([priv, pub]); assert.strictEqual(priv.length, 64); assert.strictEqual(pub.length, 32); parts.push({name: 'A', data: pub}); parts.push({name: 'k', data: priv}); this._key = new PrivateKey({ type: 'curve25519', parts: parts }); this._isPriv = true; return (this._key); } throw (new Error('Invalid algorithm: ' + this._algo)); }; DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey; /* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */ function X9ECParameters(name) { var params = algs.curves[name]; assert.object(params); var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var n = new jsbn(params.n); var h = jsbn.ONE; var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); this.curve = curve; this.g = G; this.n = n; this.h = h; } X9ECParameters.prototype.getCurve = function () { return (this.curve); }; X9ECParameters.prototype.getG = function () { return (this.g); }; X9ECParameters.prototype.getN = function () { return (this.n); }; X9ECParameters.prototype.getH = function () { return (this.h); }; function ECPublic(params, buffer) { this._params = params; if (buffer[0] === 0x00) buffer = buffer.slice(1); this._pub = params.getCurve().decodePointHex(buffer.toString('hex')); } function ECPrivate(params, buffer) { this._params = params; this._priv = new jsbn(utils.mpNormalize(buffer)); } ECPrivate.prototype.deriveSharedSecret = function (pubKey) { assert.ok(pubKey instanceof ECPublic); var S = pubKey._pub.multiply(this._priv); return (Buffer.from(S.getX().toBigInteger().toByteArray())); }; function generateED25519() { var pair = nacl.sign.keyPair(); var priv = Buffer.from(pair.secretKey); var pub = Buffer.from(pair.publicKey); assert.strictEqual(priv.length, 64); assert.strictEqual(pub.length, 32); var parts = []; parts.push({name: 'A', data: pub}); parts.push({name: 'k', data: priv.slice(0, 32)}); var key = new PrivateKey({ type: 'ed25519', parts: parts }); return (key); } /* Generates a new ECDSA private key on a given curve. */ function generateECDSA(curve) { var parts = []; var key; if (CRYPTO_HAVE_ECDH) { /* * Node crypto doesn't expose key generation directly, but the * ECDH instances can generate keys. It turns out this just * calls into the OpenSSL generic key generator, and we can * read its output happily without doing an actual DH. So we * use that here. */ var osCurve = { 'nistp256': 'prime256v1', 'nistp384': 'secp384r1', 'nistp521': 'secp521r1' }[curve]; var dh = crypto.createECDH(osCurve); dh.generateKeys(); parts.push({name: 'curve', data: Buffer.from(curve)}); parts.push({name: 'Q', data: dh.getPublicKey()}); parts.push({name: 'd', data: dh.getPrivateKey()}); key = new PrivateKey({ type: 'ecdsa', curve: curve, parts: parts }); return (key); } else { var ecParams = new X9ECParameters(curve); /* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */ var n = ecParams.getN(); /* * The crypto.randomBytes() function can only give us whole * bytes, so taking a nod from X9.62, we round up. */ var cByteLen = Math.ceil((n.bitLength() + 64) / 8); var c = new jsbn(crypto.randomBytes(cByteLen)); var n1 = n.subtract(jsbn.ONE); var priv = c.mod(n1).add(jsbn.ONE); var pub = ecParams.getG().multiply(priv); priv = Buffer.from(priv.toByteArray()); pub = Buffer.from(ecParams.getCurve(). encodePointHex(pub), 'hex'); parts.push({name: 'curve', data: Buffer.from(curve)}); parts.push({name: 'Q', data: pub}); parts.push({name: 'd', data: priv}); key = new PrivateKey({ type: 'ecdsa', curve: curve, parts: parts }); return (key); } } /***/ }), /* 291 */, /* 292 */, /* 293 */ /***/ (function(module) { module.exports = require("buffer"); /***/ }), /* 294 */, /* 295 */, /* 296 */, /* 297 */, /* 298 */ /***/ (function(module) { "use strict"; function formatHostname (hostname) { // canonicalize the hostname, so that 'oogle.com' won't match 'google.com' return hostname.replace(/^\.*/, '.').toLowerCase() } function parseNoProxyZone (zone) { zone = zone.trim().toLowerCase() var zoneParts = zone.split(':', 2) var zoneHost = formatHostname(zoneParts[0]) var zonePort = zoneParts[1] var hasPort = zone.indexOf(':') > -1 return {hostname: zoneHost, port: zonePort, hasPort: hasPort} } function uriInNoProxy (uri, noProxy) { var port = uri.port || (uri.protocol === 'https:' ? '443' : '80') var hostname = formatHostname(uri.hostname) var noProxyList = noProxy.split(',') // iterate through the noProxyList until it finds a match. return noProxyList.map(parseNoProxyZone).some(function (noProxyZone) { var isMatchedAt = hostname.indexOf(noProxyZone.hostname) var hostnameMatched = ( isMatchedAt > -1 && (isMatchedAt === hostname.length - noProxyZone.hostname.length) ) if (noProxyZone.hasPort) { return (port === noProxyZone.port) && hostnameMatched } return hostnameMatched }) } function getProxyFromURI (uri) { // Decide the proper request proxy to use based on the request URI object and the // environmental variables (NO_PROXY, HTTP_PROXY, etc.) // respect NO_PROXY environment variables (see: https://lynx.invisible-island.net/lynx2.8.7/breakout/lynx_help/keystrokes/environments.html) var noProxy = process.env.NO_PROXY || process.env.no_proxy || '' // if the noProxy is a wildcard then return null if (noProxy === '*') { return null } // if the noProxy is not empty and the uri is found return null if (noProxy !== '' && uriInNoProxy(uri, noProxy)) { return null } // Check for HTTP or HTTPS Proxy in environment Else default to null if (uri.protocol === 'http:') { return process.env.HTTP_PROXY || process.env.http_proxy || null } if (uri.protocol === 'https:') { return process.env.HTTPS_PROXY || process.env.https_proxy || process.env.HTTP_PROXY || process.env.http_proxy || null } // if none of that works, return null // (What uri protocol are you using then?) return null } module.exports = getProxyFromURI /***/ }), /* 299 */, /* 300 */, /* 301 */, /* 302 */, /* 303 */, /* 304 */, /* 305 */, /* 306 */, /* 307 */, /* 308 */, /* 309 */, /* 310 */, /* 311 */, /* 312 */, /* 313 */ /***/ (function(module) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { return function makePromise(environment) { var tasks = environment.scheduler; var emitRejection = initEmitRejection(); var objectCreate = Object.create || function(proto) { function Child() {} Child.prototype = proto; return new Child(); }; /** * Create a promise whose fate is determined by resolver * @constructor * @returns {Promise} promise * @name Promise */ function Promise(resolver, handler) { this._handler = resolver === Handler ? handler : init(resolver); } /** * Run the supplied resolver * @param resolver * @returns {Pending} */ function init(resolver) { var handler = new Pending(); try { resolver(promiseResolve, promiseReject, promiseNotify); } catch (e) { promiseReject(e); } return handler; /** * Transition from pre-resolution state to post-resolution state, notifying * all listeners of the ultimate fulfillment or rejection * @param {*} x resolution value */ function promiseResolve (x) { handler.resolve(x); } /** * Reject this promise with reason, which will be used verbatim * @param {Error|*} reason rejection reason, strongly suggested * to be an Error type */ function promiseReject (reason) { handler.reject(reason); } /** * @deprecated * Issue a progress event, notifying all progress listeners * @param {*} x progress event payload to pass to all listeners */ function promiseNotify (x) { handler.notify(x); } } // Creation Promise.resolve = resolve; Promise.reject = reject; Promise.never = never; Promise._defer = defer; Promise._handler = getHandler; /** * Returns a trusted promise. If x is already a trusted promise, it is * returned, otherwise returns a new trusted Promise which follows x. * @param {*} x * @return {Promise} promise */ function resolve(x) { return isPromise(x) ? x : new Promise(Handler, new Async(getHandler(x))); } /** * Return a reject promise with x as its reason (x is used verbatim) * @param {*} x * @returns {Promise} rejected promise */ function reject(x) { return new Promise(Handler, new Async(new Rejected(x))); } /** * Return a promise that remains pending forever * @returns {Promise} forever-pending promise. */ function never() { return foreverPendingPromise; // Should be frozen } /** * Creates an internal {promise, resolver} pair * @private * @returns {Promise} */ function defer() { return new Promise(Handler, new Pending()); } // Transformation and flow control /** * Transform this promise's fulfillment value, returning a new Promise * for the transformed result. If the promise cannot be fulfilled, onRejected * is called with the reason. onProgress *may* be called with updates toward * this promise's fulfillment. * @param {function=} onFulfilled fulfillment handler * @param {function=} onRejected rejection handler * @param {function=} onProgress @deprecated progress handler * @return {Promise} new promise */ Promise.prototype.then = function(onFulfilled, onRejected, onProgress) { var parent = this._handler; var state = parent.join().state(); if ((typeof onFulfilled !== 'function' && state > 0) || (typeof onRejected !== 'function' && state < 0)) { // Short circuit: value will not change, simply share handler return new this.constructor(Handler, parent); } var p = this._beget(); var child = p._handler; parent.chain(child, parent.receiver, onFulfilled, onRejected, onProgress); return p; }; /** * If this promise cannot be fulfilled due to an error, call onRejected to * handle the error. Shortcut for .then(undefined, onRejected) * @param {function?} onRejected * @return {Promise} */ Promise.prototype['catch'] = function(onRejected) { return this.then(void 0, onRejected); }; /** * Creates a new, pending promise of the same type as this promise * @private * @returns {Promise} */ Promise.prototype._beget = function() { return begetFrom(this._handler, this.constructor); }; function begetFrom(parent, Promise) { var child = new Pending(parent.receiver, parent.join().context); return new Promise(Handler, child); } // Array combinators Promise.all = all; Promise.race = race; Promise._traverse = traverse; /** * Return a promise that will fulfill when all promises in the * input array have fulfilled, or will reject when one of the * promises rejects. * @param {array} promises array of promises * @returns {Promise} promise for array of fulfillment values */ function all(promises) { return traverseWith(snd, null, promises); } /** * Array> -> Promise> * @private * @param {function} f function to apply to each promise's value * @param {Array} promises array of promises * @returns {Promise} promise for transformed values */ function traverse(f, promises) { return traverseWith(tryCatch2, f, promises); } function traverseWith(tryMap, f, promises) { var handler = typeof f === 'function' ? mapAt : settleAt; var resolver = new Pending(); var pending = promises.length >>> 0; var results = new Array(pending); for (var i = 0, x; i < promises.length && !resolver.resolved; ++i) { x = promises[i]; if (x === void 0 && !(i in promises)) { --pending; continue; } traverseAt(promises, handler, i, x, resolver); } if(pending === 0) { resolver.become(new Fulfilled(results)); } return new Promise(Handler, resolver); function mapAt(i, x, resolver) { if(!resolver.resolved) { traverseAt(promises, settleAt, i, tryMap(f, x, i), resolver); } } function settleAt(i, x, resolver) { results[i] = x; if(--pending === 0) { resolver.become(new Fulfilled(results)); } } } function traverseAt(promises, handler, i, x, resolver) { if (maybeThenable(x)) { var h = getHandlerMaybeThenable(x); var s = h.state(); if (s === 0) { h.fold(handler, i, void 0, resolver); } else if (s > 0) { handler(i, h.value, resolver); } else { resolver.become(h); visitRemaining(promises, i+1, h); } } else { handler(i, x, resolver); } } Promise._visitRemaining = visitRemaining; function visitRemaining(promises, start, handler) { for(var i=start; i * MIT Licensed * */ var extend = __webpack_require__(374); var when = __webpack_require__(493); var request = __webpack_require__(830); var RetryStrategies = __webpack_require__(689); var _ = __webpack_require__(557); var DEFAULTS = { maxAttempts: 5, // try 5 times retryDelay: 5000, // wait for 5s before trying again fullResponse: true, // resolve promise with the full response object promiseFactory: defaultPromiseFactory // Function to use a different promise implementation library }; // Default promise factory which use bluebird function defaultPromiseFactory(resolver) { return when.promise(resolver); } /** * It calls the promiseFactory function passing it the resolver for the promise * * @param {Object} requestInstance - The Request Retry instance * @param {Function} promiseFactoryFn - The Request Retry instance * @return {Object} - The promise instance */ function makePromise(requestInstance, promiseFactoryFn) { // Resolver function wich assigns the promise (resolve, reject) functions // to the requestInstance function Resolver(resolve, reject) { this._resolve = resolve; this._reject = reject; } return promiseFactoryFn(Resolver.bind(requestInstance)); } function Request(url, options, f, retryConfig) { // ('url') if(_.isString(url)){ // ('url', f) if(_.isFunction(options)){ f = options; } if(!_.isObject(options)){ options = {}; } // ('url', {object}) options.url = url; } if(_.isObject(url)){ if(_.isFunction(options)){ f = options; } options = url; } this.maxAttempts = retryConfig.maxAttempts; this.retryDelay = retryConfig.retryDelay; this.fullResponse = retryConfig.fullResponse; this.attempts = 0; /** * Option object * @type {Object} */ this.options = options; /** * Return true if the request should be retried * @type {Function} (err, response, body, options) -> [Boolean, Object (optional)] */ this.retryStrategy = _.isFunction(options.retryStrategy) ? options.retryStrategy : RetryStrategies.HTTPOrNetworkError; /** * Return a number representing how long request-retry should wait before trying again the request * @type {Boolean} (err, response, body) -> Number */ this.delayStrategy = _.isFunction(options.delayStrategy) ? options.delayStrategy : function() { return this.retryDelay; }; this._timeout = null; this._req = null; this._callback = _.isFunction(f) ? _.once(f) : null; // create the promise only when no callback was provided if (!this._callback) { this._promise = makePromise(this, retryConfig.promiseFactory); } this.reply = function requestRetryReply(err, response, body) { if (this._callback) { return this._callback(err, response, body); } if (err) { return this._reject(err); } // resolve with the full response or just the body response = this.fullResponse ? response : body; this._resolve(response); }; } Request.request = request; Request.prototype._tryUntilFail = function () { this.maxAttempts--; this.attempts++; this._req = Request.request(this.options, async function (err, response, body) { if (response) { response.attempts = this.attempts; } if (err) { err.attempts = this.attempts; } var mustRetry = await Promise.resolve(this.retryStrategy(err, response, body, _.cloneDeep(this.options))); if (_.isObject(mustRetry) && _.has(mustRetry, 'mustRetry')) { if (_.isObject(mustRetry.options)) { this.options = mustRetry.options; //if retryStrategy supposes different request options for retry } mustRetry = mustRetry.mustRetry; } if (mustRetry && this.maxAttempts > 0) { this._timeout = setTimeout(this._tryUntilFail.bind(this), this.delayStrategy.call(this, err, response, body)); return; } this.reply(err, response, body); }.bind(this)); }; Request.prototype.abort = function () { if (this._req) { this._req.abort(); } clearTimeout(this._timeout); this.reply(new Error('Aborted')); }; // expose request methods from RequestRetry ['end', 'on', 'emit', 'once', 'setMaxListeners', 'start', 'removeListener', 'pipe', 'write', 'auth'].forEach(function (requestMethod) { Request.prototype[requestMethod] = function exposedRequestMethod () { return this._req[requestMethod].apply(this._req, arguments); }; }); // expose promise methods ['then', 'catch', 'finally', 'fail', 'done'].forEach(function (promiseMethod) { Request.prototype[promiseMethod] = function exposedPromiseMethod () { if (this._callback) { throw new Error('A callback was provided but waiting a promise, use only one pattern'); } return this._promise[promiseMethod].apply(this._promise, arguments); }; }); function Factory(url, options, f) { var retryConfig = _.chain(_.isObject(url) ? url : options || {}).defaults(DEFAULTS).pick(Object.keys(DEFAULTS)).value(); var req = new Factory.Request(url, options, f, retryConfig); req._tryUntilFail(); return req; } // adds a helper for HTTP method `verb` to object `obj` function makeHelper(obj, verb) { obj[verb] = function helper(url, options, f) { // ('url') if(_.isString(url)){ // ('url', f) if(_.isFunction(options)){ f = options; } if(!_.isObject(options)){ options = {}; } // ('url', {object}) options.url = url; } if(_.isObject(url)){ if(_.isFunction(options)){ f = options; } options = url; } options.method = verb.toUpperCase(); return obj(options, f); }; } function defaults(defaultOptions, defaultF) { var factory = function (options, f) { if (typeof options === "string") { options = { uri: options }; } return Factory.apply(null, [ extend(true, {}, defaultOptions, options), f || defaultF ]); }; factory.defaults = function (newDefaultOptions, newDefaultF) { return defaults.apply(null, [ extend(true, {}, defaultOptions, newDefaultOptions), newDefaultF || defaultF ]); }; factory.Request = Request; factory.RetryStrategies = RetryStrategies; ['get', 'head', 'post', 'put', 'patch', 'delete'].forEach(function (verb) { makeHelper(factory, verb); }); factory.del = factory['delete']; ['jar', 'cookie'].forEach(function (method) { factory[method] = factory.Request.request[method]; }); return factory; } module.exports = Factory; Factory.defaults = defaults; Factory.Request = Request; Factory.RetryStrategies = RetryStrategies; // define .get/.post/... helpers ['get', 'head', 'post', 'put', 'patch', 'delete'].forEach(function (verb) { makeHelper(Factory, verb); }); Factory.del = Factory['delete']; ['jar', 'cookie'].forEach(function (method) { Factory[method] = Factory.Request.request[method]; }); /***/ }), /* 336 */, /* 337 */ /***/ (function(module) { module.exports = {"$schema":"http://json-schema.org/draft-06/schema#","$id":"http://json-schema.org/draft-06/schema#","title":"Core schema meta-schema","definitions":{"schemaArray":{"type":"array","minItems":1,"items":{"$ref":"#"}},"nonNegativeInteger":{"type":"integer","minimum":0},"nonNegativeIntegerDefault0":{"allOf":[{"$ref":"#/definitions/nonNegativeInteger"},{"default":0}]},"simpleTypes":{"enum":["array","boolean","integer","null","number","object","string"]},"stringArray":{"type":"array","items":{"type":"string"},"uniqueItems":true,"default":[]}},"type":["object","boolean"],"properties":{"$id":{"type":"string","format":"uri-reference"},"$schema":{"type":"string","format":"uri"},"$ref":{"type":"string","format":"uri-reference"},"title":{"type":"string"},"description":{"type":"string"},"default":{},"examples":{"type":"array","items":{}},"multipleOf":{"type":"number","exclusiveMinimum":0},"maximum":{"type":"number"},"exclusiveMaximum":{"type":"number"},"minimum":{"type":"number"},"exclusiveMinimum":{"type":"number"},"maxLength":{"$ref":"#/definitions/nonNegativeInteger"},"minLength":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"pattern":{"type":"string","format":"regex"},"additionalItems":{"$ref":"#"},"items":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/schemaArray"}],"default":{}},"maxItems":{"$ref":"#/definitions/nonNegativeInteger"},"minItems":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"uniqueItems":{"type":"boolean","default":false},"contains":{"$ref":"#"},"maxProperties":{"$ref":"#/definitions/nonNegativeInteger"},"minProperties":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"required":{"$ref":"#/definitions/stringArray"},"additionalProperties":{"$ref":"#"},"definitions":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"properties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"patternProperties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"dependencies":{"type":"object","additionalProperties":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/stringArray"}]}},"propertyNames":{"$ref":"#"},"const":{},"enum":{"type":"array","minItems":1,"uniqueItems":true},"type":{"anyOf":[{"$ref":"#/definitions/simpleTypes"},{"type":"array","items":{"$ref":"#/definitions/simpleTypes"},"minItems":1,"uniqueItems":true}]},"format":{"type":"string"},"allOf":{"$ref":"#/definitions/schemaArray"},"anyOf":{"$ref":"#/definitions/schemaArray"},"oneOf":{"$ref":"#/definitions/schemaArray"},"not":{"$ref":"#"}},"default":{}}; /***/ }), /* 338 */, /* 339 */ /***/ (function(module) { module.exports = {"$schema":"http://json-schema.org/draft-07/schema#","$id":"https://raw.githubusercontent.com/epoberezkin/ajv/master/lib/refs/data.json#","description":"Meta-schema for $data reference (JSON Schema extension proposal)","type":"object","required":["$data"],"properties":{"$data":{"type":"string","anyOf":[{"format":"relative-json-pointer"},{"format":"json-pointer"}]}},"additionalProperties":false}; /***/ }), /* 340 */ /***/ (function(module) { "use strict"; var traverse = module.exports = function (schema, opts, cb) { // Legacy support for v0.3.1 and earlier. if (typeof opts == 'function') { cb = opts; opts = {}; } cb = opts.cb || cb; var pre = (typeof cb == 'function') ? cb : cb.pre || function() {}; var post = cb.post || function() {}; _traverse(opts, pre, post, schema, '', schema); }; traverse.keywords = { additionalItems: true, items: true, contains: true, additionalProperties: true, propertyNames: true, not: true }; traverse.arrayKeywords = { items: true, allOf: true, anyOf: true, oneOf: true }; traverse.propsKeywords = { definitions: true, properties: true, patternProperties: true, dependencies: true }; traverse.skipKeywords = { default: true, enum: true, const: true, required: true, maximum: true, minimum: true, exclusiveMaximum: true, exclusiveMinimum: true, multipleOf: true, maxLength: true, minLength: true, pattern: true, format: true, maxItems: true, minItems: true, uniqueItems: true, maxProperties: true, minProperties: true }; function _traverse(opts, pre, post, schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex) { if (schema && typeof schema == 'object' && !Array.isArray(schema)) { pre(schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex); for (var key in schema) { var sch = schema[key]; if (Array.isArray(sch)) { if (key in traverse.arrayKeywords) { for (var i=0; i', $notOp = $isMax ? '>' : '<', $errorKeyword = undefined; if ($isDataExcl) { var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), $exclusive = 'exclusive' + $lvl, $exclType = 'exclType' + $lvl, $exclIsNumber = 'exclIsNumber' + $lvl, $opExpr = 'op' + $lvl, $opStr = '\' + ' + $opExpr + ' + \''; out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; $schemaValueExcl = 'schemaExcl' + $lvl; out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; var $errorKeyword = $exclusiveKeyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; if ($schema === undefined) { $errorKeyword = $exclusiveKeyword; $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; $schemaValue = $schemaValueExcl; $isData = $isDataExcl; } } else { var $exclIsNumber = typeof $schemaExcl == 'number', $opStr = $op; if ($exclIsNumber && $isData) { var $opExpr = '\'' + $opStr + '\''; out += ' if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; } else { if ($exclIsNumber && $schema === undefined) { $exclusive = true; $errorKeyword = $exclusiveKeyword; $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; $schemaValue = $schemaExcl; $notOp += '='; } else { if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { $exclusive = true; $errorKeyword = $exclusiveKeyword; $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; $notOp += '='; } else { $exclusive = false; $opStr += '='; } } var $opExpr = '\'' + $opStr + '\''; out += ' if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; } } $errorKeyword = $errorKeyword || $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should be ' + ($opStr) + ' '; if ($isData) { out += '\' + ' + ($schemaValue); } else { out += '' + ($schemaValue) + '\''; } } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /* 342 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. var assert = __webpack_require__(477); var util = __webpack_require__(669); var utils = __webpack_require__(909); ///--- Globals var HASH_ALGOS = utils.HASH_ALGOS; var PK_ALGOS = utils.PK_ALGOS; var HttpSignatureError = utils.HttpSignatureError; var InvalidAlgorithmError = utils.InvalidAlgorithmError; var validateAlgorithm = utils.validateAlgorithm; var State = { New: 0, Params: 1 }; var ParamsState = { Name: 0, Quote: 1, Value: 2, Comma: 3 }; ///--- Specific Errors function ExpiredRequestError(message) { HttpSignatureError.call(this, message, ExpiredRequestError); } util.inherits(ExpiredRequestError, HttpSignatureError); function InvalidHeaderError(message) { HttpSignatureError.call(this, message, InvalidHeaderError); } util.inherits(InvalidHeaderError, HttpSignatureError); function InvalidParamsError(message) { HttpSignatureError.call(this, message, InvalidParamsError); } util.inherits(InvalidParamsError, HttpSignatureError); function MissingHeaderError(message) { HttpSignatureError.call(this, message, MissingHeaderError); } util.inherits(MissingHeaderError, HttpSignatureError); function StrictParsingError(message) { HttpSignatureError.call(this, message, StrictParsingError); } util.inherits(StrictParsingError, HttpSignatureError); ///--- Exported API module.exports = { /** * Parses the 'Authorization' header out of an http.ServerRequest object. * * Note that this API will fully validate the Authorization header, and throw * on any error. It will not however check the signature, or the keyId format * as those are specific to your environment. You can use the options object * to pass in extra constraints. * * As a response object you can expect this: * * { * "scheme": "Signature", * "params": { * "keyId": "foo", * "algorithm": "rsa-sha256", * "headers": [ * "date" or "x-date", * "digest" * ], * "signature": "base64" * }, * "signingString": "ready to be passed to crypto.verify()" * } * * @param {Object} request an http.ServerRequest. * @param {Object} options an optional options object with: * - clockSkew: allowed clock skew in seconds (default 300). * - headers: required header names (def: date or x-date) * - algorithms: algorithms to support (default: all). * - strict: should enforce latest spec parsing * (default: false). * @return {Object} parsed out object (see above). * @throws {TypeError} on invalid input. * @throws {InvalidHeaderError} on an invalid Authorization header error. * @throws {InvalidParamsError} if the params in the scheme are invalid. * @throws {MissingHeaderError} if the params indicate a header not present, * either in the request headers from the params, * or not in the params from a required header * in options. * @throws {StrictParsingError} if old attributes are used in strict parsing * mode. * @throws {ExpiredRequestError} if the value of date or x-date exceeds skew. */ parseRequest: function parseRequest(request, options) { assert.object(request, 'request'); assert.object(request.headers, 'request.headers'); if (options === undefined) { options = {}; } if (options.headers === undefined) { options.headers = [request.headers['x-date'] ? 'x-date' : 'date']; } assert.object(options, 'options'); assert.arrayOfString(options.headers, 'options.headers'); assert.optionalFinite(options.clockSkew, 'options.clockSkew'); var authzHeaderName = options.authorizationHeaderName || 'authorization'; if (!request.headers[authzHeaderName]) { throw new MissingHeaderError('no ' + authzHeaderName + ' header ' + 'present in the request'); } options.clockSkew = options.clockSkew || 300; var i = 0; var state = State.New; var substate = ParamsState.Name; var tmpName = ''; var tmpValue = ''; var parsed = { scheme: '', params: {}, signingString: '' }; var authz = request.headers[authzHeaderName]; for (i = 0; i < authz.length; i++) { var c = authz.charAt(i); switch (Number(state)) { case State.New: if (c !== ' ') parsed.scheme += c; else state = State.Params; break; case State.Params: switch (Number(substate)) { case ParamsState.Name: var code = c.charCodeAt(0); // restricted name of A-Z / a-z if ((code >= 0x41 && code <= 0x5a) || // A-Z (code >= 0x61 && code <= 0x7a)) { // a-z tmpName += c; } else if (c === '=') { if (tmpName.length === 0) throw new InvalidHeaderError('bad param format'); substate = ParamsState.Quote; } else { throw new InvalidHeaderError('bad param format'); } break; case ParamsState.Quote: if (c === '"') { tmpValue = ''; substate = ParamsState.Value; } else { throw new InvalidHeaderError('bad param format'); } break; case ParamsState.Value: if (c === '"') { parsed.params[tmpName] = tmpValue; substate = ParamsState.Comma; } else { tmpValue += c; } break; case ParamsState.Comma: if (c === ',') { tmpName = ''; substate = ParamsState.Name; } else { throw new InvalidHeaderError('bad param format'); } break; default: throw new Error('Invalid substate'); } break; default: throw new Error('Invalid substate'); } } if (!parsed.params.headers || parsed.params.headers === '') { if (request.headers['x-date']) { parsed.params.headers = ['x-date']; } else { parsed.params.headers = ['date']; } } else { parsed.params.headers = parsed.params.headers.split(' '); } // Minimally validate the parsed object if (!parsed.scheme || parsed.scheme !== 'Signature') throw new InvalidHeaderError('scheme was not "Signature"'); if (!parsed.params.keyId) throw new InvalidHeaderError('keyId was not specified'); if (!parsed.params.algorithm) throw new InvalidHeaderError('algorithm was not specified'); if (!parsed.params.signature) throw new InvalidHeaderError('signature was not specified'); // Check the algorithm against the official list parsed.params.algorithm = parsed.params.algorithm.toLowerCase(); try { validateAlgorithm(parsed.params.algorithm); } catch (e) { if (e instanceof InvalidAlgorithmError) throw (new InvalidParamsError(parsed.params.algorithm + ' is not ' + 'supported')); else throw (e); } // Build the signingString for (i = 0; i < parsed.params.headers.length; i++) { var h = parsed.params.headers[i].toLowerCase(); parsed.params.headers[i] = h; if (h === 'request-line') { if (!options.strict) { /* * We allow headers from the older spec drafts if strict parsing isn't * specified in options. */ parsed.signingString += request.method + ' ' + request.url + ' HTTP/' + request.httpVersion; } else { /* Strict parsing doesn't allow older draft headers. */ throw (new StrictParsingError('request-line is not a valid header ' + 'with strict parsing enabled.')); } } else if (h === '(request-target)') { parsed.signingString += '(request-target): ' + request.method.toLowerCase() + ' ' + request.url; } else { var value = request.headers[h]; if (value === undefined) throw new MissingHeaderError(h + ' was not in the request'); parsed.signingString += h + ': ' + value; } if ((i + 1) < parsed.params.headers.length) parsed.signingString += '\n'; } // Check against the constraints var date; if (request.headers.date || request.headers['x-date']) { if (request.headers['x-date']) { date = new Date(request.headers['x-date']); } else { date = new Date(request.headers.date); } var now = new Date(); var skew = Math.abs(now.getTime() - date.getTime()); if (skew > options.clockSkew * 1000) { throw new ExpiredRequestError('clock skew of ' + (skew / 1000) + 's was greater than ' + options.clockSkew + 's'); } } options.headers.forEach(function (hdr) { // Remember that we already checked any headers in the params // were in the request, so if this passes we're good. if (parsed.params.headers.indexOf(hdr.toLowerCase()) < 0) throw new MissingHeaderError(hdr + ' was not a signed header'); }); if (options.algorithms) { if (options.algorithms.indexOf(parsed.params.algorithm) === -1) throw new InvalidParamsError(parsed.params.algorithm + ' is not a supported algorithm'); } parsed.algorithm = parsed.params.algorithm.toUpperCase(); parsed.keyId = parsed.params.keyId; return parsed; } }; /***/ }), /* 343 */ /***/ (function(module) { "use strict"; module.exports = function generate_properties(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $key = 'key' + $lvl, $idx = 'idx' + $lvl, $dataNxt = $it.dataLevel = it.dataLevel + 1, $nextData = 'data' + $dataNxt, $dataProperties = 'dataProperties' + $lvl; var $schemaKeys = Object.keys($schema || {}), $pProperties = it.schema.patternProperties || {}, $pPropertyKeys = Object.keys($pProperties), $aProperties = it.schema.additionalProperties, $someProperties = $schemaKeys.length || $pPropertyKeys.length, $noAdditional = $aProperties === false, $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, $removeAdditional = it.opts.removeAdditional, $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, $ownProperties = it.opts.ownProperties, $currentBaseId = it.baseId; var $required = it.schema.required; if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) var $requiredHash = it.util.toHash($required); out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; if ($ownProperties) { out += ' var ' + ($dataProperties) + ' = undefined;'; } if ($checkAdditional) { if ($ownProperties) { out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; } else { out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; } if ($someProperties) { out += ' var isAdditional' + ($lvl) + ' = !(false '; if ($schemaKeys.length) { if ($schemaKeys.length > 8) { out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; } else { var arr1 = $schemaKeys; if (arr1) { var $propertyKey, i1 = -1, l1 = arr1.length - 1; while (i1 < l1) { $propertyKey = arr1[i1 += 1]; out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; } } } } if ($pPropertyKeys.length) { var arr2 = $pPropertyKeys; if (arr2) { var $pProperty, $i = -1, l2 = arr2.length - 1; while ($i < l2) { $pProperty = arr2[$i += 1]; out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; } } } out += ' ); if (isAdditional' + ($lvl) + ') { '; } if ($removeAdditional == 'all') { out += ' delete ' + ($data) + '[' + ($key) + ']; '; } else { var $currentErrorPath = it.errorPath; var $additionalProperty = '\' + ' + $key + ' + \''; if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); } if ($noAdditional) { if ($removeAdditional) { out += ' delete ' + ($data) + '[' + ($key) + ']; '; } else { out += ' ' + ($nextValid) + ' = false; '; var $currErrSchemaPath = $errSchemaPath; $errSchemaPath = it.errSchemaPath + '/additionalProperties'; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is an invalid additional property'; } else { out += 'should NOT have additional properties'; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } $errSchemaPath = $currErrSchemaPath; if ($breakOnError) { out += ' break; '; } } } else if ($additionalIsSchema) { if ($removeAdditional == 'failing') { out += ' var ' + ($errs) + ' = errors; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; $it.schema = $aProperties; $it.schemaPath = it.schemaPath + '.additionalProperties'; $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); var $passData = $data + '[' + $key + ']'; $it.dataPathArr[$dataNxt] = $key; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; it.compositeRule = $it.compositeRule = $wasComposite; } else { $it.schema = $aProperties; $it.schemaPath = it.schemaPath + '.additionalProperties'; $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); var $passData = $data + '[' + $key + ']'; $it.dataPathArr[$dataNxt] = $key; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } if ($breakOnError) { out += ' if (!' + ($nextValid) + ') break; '; } } } it.errorPath = $currentErrorPath; } if ($someProperties) { out += ' } '; } out += ' } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } var $useDefaults = it.opts.useDefaults && !it.compositeRule; if ($schemaKeys.length) { var arr3 = $schemaKeys; if (arr3) { var $propertyKey, i3 = -1, l3 = arr3.length - 1; while (i3 < l3) { $propertyKey = arr3[i3 += 1]; var $sch = $schema[$propertyKey]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { var $prop = it.util.getProperty($propertyKey), $passData = $data + $prop, $hasDefault = $useDefaults && $sch.default !== undefined; $it.schema = $sch; $it.schemaPath = $schemaPath + $prop; $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { $code = it.util.varReplace($code, $nextData, $passData); var $useData = $passData; } else { var $useData = $nextData; out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; } if ($hasDefault) { out += ' ' + ($code) + ' '; } else { if ($requiredHash && $requiredHash[$propertyKey]) { out += ' if ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') { ' + ($nextValid) + ' = false; '; var $currentErrorPath = it.errorPath, $currErrSchemaPath = $errSchemaPath, $missingProperty = it.util.escapeQuotes($propertyKey); if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); } $errSchemaPath = it.errSchemaPath + '/required'; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is a required property'; } else { out += 'should have required property \\\'' + ($missingProperty) + '\\\''; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } $errSchemaPath = $currErrSchemaPath; it.errorPath = $currentErrorPath; out += ' } else { '; } else { if ($breakOnError) { out += ' if ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') { ' + ($nextValid) + ' = true; } else { '; } else { out += ' if (' + ($useData) + ' !== undefined '; if ($ownProperties) { out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ' ) { '; } } out += ' ' + ($code) + ' } '; } } if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } } if ($pPropertyKeys.length) { var arr4 = $pPropertyKeys; if (arr4) { var $pProperty, i4 = -1, l4 = arr4.length - 1; while (i4 < l4) { $pProperty = arr4[i4 += 1]; var $sch = $pProperties[$pProperty]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { $it.schema = $sch; $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); if ($ownProperties) { out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; } else { out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; } out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); var $passData = $data + '[' + $key + ']'; $it.dataPathArr[$dataNxt] = $key; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } if ($breakOnError) { out += ' if (!' + ($nextValid) + ') break; '; } out += ' } '; if ($breakOnError) { out += ' else ' + ($nextValid) + ' = true; '; } out += ' } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } } } if ($breakOnError) { out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; } out = it.util.cleanUpCode(out); return out; } /***/ }), /* 344 */, /* 345 */, /* 346 */, /* 347 */, /* 348 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { /* * lib/jsprim.js: utilities for primitive JavaScript types */ var mod_assert = __webpack_require__(477); var mod_util = __webpack_require__(669); var mod_extsprintf = __webpack_require__(697); var mod_verror = __webpack_require__(956); var mod_jsonschema = __webpack_require__(703); /* * Public interface */ exports.deepCopy = deepCopy; exports.deepEqual = deepEqual; exports.isEmpty = isEmpty; exports.hasKey = hasKey; exports.forEachKey = forEachKey; exports.pluck = pluck; exports.flattenObject = flattenObject; exports.flattenIter = flattenIter; exports.validateJsonObject = validateJsonObjectJS; exports.validateJsonObjectJS = validateJsonObjectJS; exports.randElt = randElt; exports.extraProperties = extraProperties; exports.mergeObjects = mergeObjects; exports.startsWith = startsWith; exports.endsWith = endsWith; exports.parseInteger = parseInteger; exports.iso8601 = iso8601; exports.rfc1123 = rfc1123; exports.parseDateTime = parseDateTime; exports.hrtimediff = hrtimeDiff; exports.hrtimeDiff = hrtimeDiff; exports.hrtimeAccum = hrtimeAccum; exports.hrtimeAdd = hrtimeAdd; exports.hrtimeNanosec = hrtimeNanosec; exports.hrtimeMicrosec = hrtimeMicrosec; exports.hrtimeMillisec = hrtimeMillisec; /* * Deep copy an acyclic *basic* Javascript object. This only handles basic * scalars (strings, numbers, booleans) and arbitrarily deep arrays and objects * containing these. This does *not* handle instances of other classes. */ function deepCopy(obj) { var ret, key; var marker = '__deepCopy'; if (obj && obj[marker]) throw (new Error('attempted deep copy of cyclic object')); if (obj && obj.constructor == Object) { ret = {}; obj[marker] = true; for (key in obj) { if (key == marker) continue; ret[key] = deepCopy(obj[key]); } delete (obj[marker]); return (ret); } if (obj && obj.constructor == Array) { ret = []; obj[marker] = true; for (key = 0; key < obj.length; key++) ret.push(deepCopy(obj[key])); delete (obj[marker]); return (ret); } /* * It must be a primitive type -- just return it. */ return (obj); } function deepEqual(obj1, obj2) { if (typeof (obj1) != typeof (obj2)) return (false); if (obj1 === null || obj2 === null || typeof (obj1) != 'object') return (obj1 === obj2); if (obj1.constructor != obj2.constructor) return (false); var k; for (k in obj1) { if (!obj2.hasOwnProperty(k)) return (false); if (!deepEqual(obj1[k], obj2[k])) return (false); } for (k in obj2) { if (!obj1.hasOwnProperty(k)) return (false); } return (true); } function isEmpty(obj) { var key; for (key in obj) return (false); return (true); } function hasKey(obj, key) { mod_assert.equal(typeof (key), 'string'); return (Object.prototype.hasOwnProperty.call(obj, key)); } function forEachKey(obj, callback) { for (var key in obj) { if (hasKey(obj, key)) { callback(key, obj[key]); } } } function pluck(obj, key) { mod_assert.equal(typeof (key), 'string'); return (pluckv(obj, key)); } function pluckv(obj, key) { if (obj === null || typeof (obj) !== 'object') return (undefined); if (obj.hasOwnProperty(key)) return (obj[key]); var i = key.indexOf('.'); if (i == -1) return (undefined); var key1 = key.substr(0, i); if (!obj.hasOwnProperty(key1)) return (undefined); return (pluckv(obj[key1], key.substr(i + 1))); } /* * Invoke callback(row) for each entry in the array that would be returned by * flattenObject(data, depth). This is just like flattenObject(data, * depth).forEach(callback), except that the intermediate array is never * created. */ function flattenIter(data, depth, callback) { doFlattenIter(data, depth, [], callback); } function doFlattenIter(data, depth, accum, callback) { var each; var key; if (depth === 0) { each = accum.slice(0); each.push(data); callback(each); return; } mod_assert.ok(data !== null); mod_assert.equal(typeof (data), 'object'); mod_assert.equal(typeof (depth), 'number'); mod_assert.ok(depth >= 0); for (key in data) { each = accum.slice(0); each.push(key); doFlattenIter(data[key], depth - 1, each, callback); } } function flattenObject(data, depth) { if (depth === 0) return ([ data ]); mod_assert.ok(data !== null); mod_assert.equal(typeof (data), 'object'); mod_assert.equal(typeof (depth), 'number'); mod_assert.ok(depth >= 0); var rv = []; var key; for (key in data) { flattenObject(data[key], depth - 1).forEach(function (p) { rv.push([ key ].concat(p)); }); } return (rv); } function startsWith(str, prefix) { return (str.substr(0, prefix.length) == prefix); } function endsWith(str, suffix) { return (str.substr( str.length - suffix.length, suffix.length) == suffix); } function iso8601(d) { if (typeof (d) == 'number') d = new Date(d); mod_assert.ok(d.constructor === Date); return (mod_extsprintf.sprintf('%4d-%02d-%02dT%02d:%02d:%02d.%03dZ', d.getUTCFullYear(), d.getUTCMonth() + 1, d.getUTCDate(), d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), d.getUTCMilliseconds())); } var RFC1123_MONTHS = [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec']; var RFC1123_DAYS = [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat']; function rfc1123(date) { return (mod_extsprintf.sprintf('%s, %02d %s %04d %02d:%02d:%02d GMT', RFC1123_DAYS[date.getUTCDay()], date.getUTCDate(), RFC1123_MONTHS[date.getUTCMonth()], date.getUTCFullYear(), date.getUTCHours(), date.getUTCMinutes(), date.getUTCSeconds())); } /* * Parses a date expressed as a string, as either a number of milliseconds since * the epoch or any string format that Date accepts, giving preference to the * former where these two sets overlap (e.g., small numbers). */ function parseDateTime(str) { /* * This is irritatingly implicit, but significantly more concise than * alternatives. The "+str" will convert a string containing only a * number directly to a Number, or NaN for other strings. Thus, if the * conversion succeeds, we use it (this is the milliseconds-since-epoch * case). Otherwise, we pass the string directly to the Date * constructor to parse. */ var numeric = +str; if (!isNaN(numeric)) { return (new Date(numeric)); } else { return (new Date(str)); } } /* * Number.*_SAFE_INTEGER isn't present before node v0.12, so we hardcode * the ES6 definitions here, while allowing for them to someday be higher. */ var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; var MIN_SAFE_INTEGER = Number.MIN_SAFE_INTEGER || -9007199254740991; /* * Default options for parseInteger(). */ var PI_DEFAULTS = { base: 10, allowSign: true, allowPrefix: false, allowTrailing: false, allowImprecise: false, trimWhitespace: false, leadingZeroIsOctal: false }; var CP_0 = 0x30; var CP_9 = 0x39; var CP_A = 0x41; var CP_B = 0x42; var CP_O = 0x4f; var CP_T = 0x54; var CP_X = 0x58; var CP_Z = 0x5a; var CP_a = 0x61; var CP_b = 0x62; var CP_o = 0x6f; var CP_t = 0x74; var CP_x = 0x78; var CP_z = 0x7a; var PI_CONV_DEC = 0x30; var PI_CONV_UC = 0x37; var PI_CONV_LC = 0x57; /* * A stricter version of parseInt() that provides options for changing what * is an acceptable string (for example, disallowing trailing characters). */ function parseInteger(str, uopts) { mod_assert.string(str, 'str'); mod_assert.optionalObject(uopts, 'options'); var baseOverride = false; var options = PI_DEFAULTS; if (uopts) { baseOverride = hasKey(uopts, 'base'); options = mergeObjects(options, uopts); mod_assert.number(options.base, 'options.base'); mod_assert.ok(options.base >= 2, 'options.base >= 2'); mod_assert.ok(options.base <= 36, 'options.base <= 36'); mod_assert.bool(options.allowSign, 'options.allowSign'); mod_assert.bool(options.allowPrefix, 'options.allowPrefix'); mod_assert.bool(options.allowTrailing, 'options.allowTrailing'); mod_assert.bool(options.allowImprecise, 'options.allowImprecise'); mod_assert.bool(options.trimWhitespace, 'options.trimWhitespace'); mod_assert.bool(options.leadingZeroIsOctal, 'options.leadingZeroIsOctal'); if (options.leadingZeroIsOctal) { mod_assert.ok(!baseOverride, '"base" and "leadingZeroIsOctal" are ' + 'mutually exclusive'); } } var c; var pbase = -1; var base = options.base; var start; var mult = 1; var value = 0; var idx = 0; var len = str.length; /* Trim any whitespace on the left side. */ if (options.trimWhitespace) { while (idx < len && isSpace(str.charCodeAt(idx))) { ++idx; } } /* Check the number for a leading sign. */ if (options.allowSign) { if (str[idx] === '-') { idx += 1; mult = -1; } else if (str[idx] === '+') { idx += 1; } } /* Parse the base-indicating prefix if there is one. */ if (str[idx] === '0') { if (options.allowPrefix) { pbase = prefixToBase(str.charCodeAt(idx + 1)); if (pbase !== -1 && (!baseOverride || pbase === base)) { base = pbase; idx += 2; } } if (pbase === -1 && options.leadingZeroIsOctal) { base = 8; } } /* Parse the actual digits. */ for (start = idx; idx < len; ++idx) { c = translateDigit(str.charCodeAt(idx)); if (c !== -1 && c < base) { value *= base; value += c; } else { break; } } /* If we didn't parse any digits, we have an invalid number. */ if (start === idx) { return (new Error('invalid number: ' + JSON.stringify(str))); } /* Trim any whitespace on the right side. */ if (options.trimWhitespace) { while (idx < len && isSpace(str.charCodeAt(idx))) { ++idx; } } /* Check for trailing characters. */ if (idx < len && !options.allowTrailing) { return (new Error('trailing characters after number: ' + JSON.stringify(str.slice(idx)))); } /* If our value is 0, we return now, to avoid returning -0. */ if (value === 0) { return (0); } /* Calculate our final value. */ var result = value * mult; /* * If the string represents a value that cannot be precisely represented * by JavaScript, then we want to check that: * * - We never increased the value past MAX_SAFE_INTEGER * - We don't make the result negative and below MIN_SAFE_INTEGER * * Because we only ever increment the value during parsing, there's no * chance of moving past MAX_SAFE_INTEGER and then dropping below it * again, losing precision in the process. This means that we only need * to do our checks here, at the end. */ if (!options.allowImprecise && (value > MAX_SAFE_INTEGER || result < MIN_SAFE_INTEGER)) { return (new Error('number is outside of the supported range: ' + JSON.stringify(str.slice(start, idx)))); } return (result); } /* * Interpret a character code as a base-36 digit. */ function translateDigit(d) { if (d >= CP_0 && d <= CP_9) { /* '0' to '9' -> 0 to 9 */ return (d - PI_CONV_DEC); } else if (d >= CP_A && d <= CP_Z) { /* 'A' - 'Z' -> 10 to 35 */ return (d - PI_CONV_UC); } else if (d >= CP_a && d <= CP_z) { /* 'a' - 'z' -> 10 to 35 */ return (d - PI_CONV_LC); } else { /* Invalid character code */ return (-1); } } /* * Test if a value matches the ECMAScript definition of trimmable whitespace. */ function isSpace(c) { return (c === 0x20) || (c >= 0x0009 && c <= 0x000d) || (c === 0x00a0) || (c === 0x1680) || (c === 0x180e) || (c >= 0x2000 && c <= 0x200a) || (c === 0x2028) || (c === 0x2029) || (c === 0x202f) || (c === 0x205f) || (c === 0x3000) || (c === 0xfeff); } /* * Determine which base a character indicates (e.g., 'x' indicates hex). */ function prefixToBase(c) { if (c === CP_b || c === CP_B) { /* 0b/0B (binary) */ return (2); } else if (c === CP_o || c === CP_O) { /* 0o/0O (octal) */ return (8); } else if (c === CP_t || c === CP_T) { /* 0t/0T (decimal) */ return (10); } else if (c === CP_x || c === CP_X) { /* 0x/0X (hexadecimal) */ return (16); } else { /* Not a meaningful character */ return (-1); } } function validateJsonObjectJS(schema, input) { var report = mod_jsonschema.validate(input, schema); if (report.errors.length === 0) return (null); /* Currently, we only do anything useful with the first error. */ var error = report.errors[0]; /* The failed property is given by a URI with an irrelevant prefix. */ var propname = error['property']; var reason = error['message'].toLowerCase(); var i, j; /* * There's at least one case where the property error message is * confusing at best. We work around this here. */ if ((i = reason.indexOf('the property ')) != -1 && (j = reason.indexOf(' is not defined in the schema and the ' + 'schema does not allow additional properties')) != -1) { i += 'the property '.length; if (propname === '') propname = reason.substr(i, j - i); else propname = propname + '.' + reason.substr(i, j - i); reason = 'unsupported property'; } var rv = new mod_verror.VError('property "%s": %s', propname, reason); rv.jsv_details = error; return (rv); } function randElt(arr) { mod_assert.ok(Array.isArray(arr) && arr.length > 0, 'randElt argument must be a non-empty array'); return (arr[Math.floor(Math.random() * arr.length)]); } function assertHrtime(a) { mod_assert.ok(a[0] >= 0 && a[1] >= 0, 'negative numbers not allowed in hrtimes'); mod_assert.ok(a[1] < 1e9, 'nanoseconds column overflow'); } /* * Compute the time elapsed between hrtime readings A and B, where A is later * than B. hrtime readings come from Node's process.hrtime(). There is no * defined way to represent negative deltas, so it's illegal to diff B from A * where the time denoted by B is later than the time denoted by A. If this * becomes valuable, we can define a representation and extend the * implementation to support it. */ function hrtimeDiff(a, b) { assertHrtime(a); assertHrtime(b); mod_assert.ok(a[0] > b[0] || (a[0] == b[0] && a[1] >= b[1]), 'negative differences not allowed'); var rv = [ a[0] - b[0], 0 ]; if (a[1] >= b[1]) { rv[1] = a[1] - b[1]; } else { rv[0]--; rv[1] = 1e9 - (b[1] - a[1]); } return (rv); } /* * Convert a hrtime reading from the array format returned by Node's * process.hrtime() into a scalar number of nanoseconds. */ function hrtimeNanosec(a) { assertHrtime(a); return (Math.floor(a[0] * 1e9 + a[1])); } /* * Convert a hrtime reading from the array format returned by Node's * process.hrtime() into a scalar number of microseconds. */ function hrtimeMicrosec(a) { assertHrtime(a); return (Math.floor(a[0] * 1e6 + a[1] / 1e3)); } /* * Convert a hrtime reading from the array format returned by Node's * process.hrtime() into a scalar number of milliseconds. */ function hrtimeMillisec(a) { assertHrtime(a); return (Math.floor(a[0] * 1e3 + a[1] / 1e6)); } /* * Add two hrtime readings A and B, overwriting A with the result of the * addition. This function is useful for accumulating several hrtime intervals * into a counter. Returns A. */ function hrtimeAccum(a, b) { assertHrtime(a); assertHrtime(b); /* * Accumulate the nanosecond component. */ a[1] += b[1]; if (a[1] >= 1e9) { /* * The nanosecond component overflowed, so carry to the seconds * field. */ a[0]++; a[1] -= 1e9; } /* * Accumulate the seconds component. */ a[0] += b[0]; return (a); } /* * Add two hrtime readings A and B, returning the result as a new hrtime array. * Does not modify either input argument. */ function hrtimeAdd(a, b) { assertHrtime(a); var rv = [ a[0], a[1] ]; return (hrtimeAccum(rv, b)); } /* * Check an object for unexpected properties. Accepts the object to check, and * an array of allowed property names (strings). Returns an array of key names * that were found on the object, but did not appear in the list of allowed * properties. If no properties were found, the returned array will be of * zero length. */ function extraProperties(obj, allowed) { mod_assert.ok(typeof (obj) === 'object' && obj !== null, 'obj argument must be a non-null object'); mod_assert.ok(Array.isArray(allowed), 'allowed argument must be an array of strings'); for (var i = 0; i < allowed.length; i++) { mod_assert.ok(typeof (allowed[i]) === 'string', 'allowed argument must be an array of strings'); } return (Object.keys(obj).filter(function (key) { return (allowed.indexOf(key) === -1); })); } /* * Given three sets of properties "provided" (may be undefined), "overrides" * (required), and "defaults" (may be undefined), construct an object containing * the union of these sets with "overrides" overriding "provided", and * "provided" overriding "defaults". None of the input objects are modified. */ function mergeObjects(provided, overrides, defaults) { var rv, k; rv = {}; if (defaults) { for (k in defaults) rv[k] = defaults[k]; } if (provided) { for (k in provided) rv[k] = provided[k]; } if (overrides) { for (k in overrides) rv[k] = overrides[k]; } return (rv); } /***/ }), /* 349 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = { read: read, verify: verify, sign: sign, signAsync: signAsync, write: write }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var Identity = __webpack_require__(378); var Signature = __webpack_require__(575); var Certificate = __webpack_require__(752); var pkcs8 = __webpack_require__(707); /* * This file is based on RFC5280 (X.509). */ /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function verify(cert, key) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); var algParts = sig.algo.split('-'); if (algParts[0] !== key.type) return (false); var blob = sig.cache; if (blob === undefined) { var der = new asn1.BerWriter(); writeTBSCert(cert, der); blob = der.buffer; } var verifier = key.createVerify(algParts[1]); verifier.write(blob); return (verifier.verify(sig.signature)); } function Local(i) { return (asn1.Ber.Context | asn1.Ber.Constructor | i); } function Context(i) { return (asn1.Ber.Context | i); } var SIGN_ALGS = { 'rsa-md5': '1.2.840.113549.1.1.4', 'rsa-sha1': '1.2.840.113549.1.1.5', 'rsa-sha256': '1.2.840.113549.1.1.11', 'rsa-sha384': '1.2.840.113549.1.1.12', 'rsa-sha512': '1.2.840.113549.1.1.13', 'dsa-sha1': '1.2.840.10040.4.3', 'dsa-sha256': '2.16.840.1.101.3.4.3.2', 'ecdsa-sha1': '1.2.840.10045.4.1', 'ecdsa-sha256': '1.2.840.10045.4.3.2', 'ecdsa-sha384': '1.2.840.10045.4.3.3', 'ecdsa-sha512': '1.2.840.10045.4.3.4', 'ed25519-sha512': '1.3.101.112' }; Object.keys(SIGN_ALGS).forEach(function (k) { SIGN_ALGS[SIGN_ALGS[k]] = k; }); SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; var EXTS = { 'issuerKeyId': '2.5.29.35', 'altName': '2.5.29.17', 'basicConstraints': '2.5.29.19', 'keyUsage': '2.5.29.15', 'extKeyUsage': '2.5.29.37' }; function read(buf, options) { if (typeof (buf) === 'string') { buf = Buffer.from(buf, 'binary'); } assert.buffer(buf, 'buf'); var der = new asn1.BerReader(buf); der.readSequence(); if (Math.abs(der.length - der.remain) > 1) { throw (new Error('DER sequence does not contain whole byte ' + 'stream')); } var tbsStart = der.offset; der.readSequence(); var sigOffset = der.offset + der.length; var tbsEnd = sigOffset; if (der.peek() === Local(0)) { der.readSequence(Local(0)); var version = der.readInt(); assert.ok(version <= 3, 'only x.509 versions up to v3 supported'); } var cert = {}; cert.signatures = {}; var sig = (cert.signatures.x509 = {}); sig.extras = {}; cert.serial = readMPInt(der, 'serial'); der.readSequence(); var after = der.offset + der.length; var certAlgOid = der.readOID(); var certAlg = SIGN_ALGS[certAlgOid]; if (certAlg === undefined) throw (new Error('unknown signature algorithm ' + certAlgOid)); der._offset = after; cert.issuer = Identity.parseAsn1(der); der.readSequence(); cert.validFrom = readDate(der); cert.validUntil = readDate(der); cert.subjects = [Identity.parseAsn1(der)]; der.readSequence(); after = der.offset + der.length; cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); der._offset = after; /* issuerUniqueID */ if (der.peek() === Local(1)) { der.readSequence(Local(1)); sig.extras.issuerUniqueID = buf.slice(der.offset, der.offset + der.length); der._offset += der.length; } /* subjectUniqueID */ if (der.peek() === Local(2)) { der.readSequence(Local(2)); sig.extras.subjectUniqueID = buf.slice(der.offset, der.offset + der.length); der._offset += der.length; } /* extensions */ if (der.peek() === Local(3)) { der.readSequence(Local(3)); var extEnd = der.offset + der.length; der.readSequence(); while (der.offset < extEnd) readExtension(cert, buf, der); assert.strictEqual(der.offset, extEnd); } assert.strictEqual(der.offset, sigOffset); der.readSequence(); after = der.offset + der.length; var sigAlgOid = der.readOID(); var sigAlg = SIGN_ALGS[sigAlgOid]; if (sigAlg === undefined) throw (new Error('unknown signature algorithm ' + sigAlgOid)); der._offset = after; var sigData = der.readString(asn1.Ber.BitString, true); if (sigData[0] === 0) sigData = sigData.slice(1); var algParts = sigAlg.split('-'); sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); sig.signature.hashAlgorithm = algParts[1]; sig.algo = sigAlg; sig.cache = buf.slice(tbsStart, tbsEnd); return (new Certificate(cert)); } function readDate(der) { if (der.peek() === asn1.Ber.UTCTime) { return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); } else if (der.peek() === asn1.Ber.GeneralizedTime) { return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); } else { throw (new Error('Unsupported date format')); } } function writeDate(der, date) { if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); } else { der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); } } /* RFC5280, section 4.2.1.6 (GeneralName type) */ var ALTNAME = { OtherName: Local(0), RFC822Name: Context(1), DNSName: Context(2), X400Address: Local(3), DirectoryName: Local(4), EDIPartyName: Local(5), URI: Context(6), IPAddress: Context(7), OID: Context(8) }; /* RFC5280, section 4.2.1.12 (KeyPurposeId) */ var EXTPURPOSE = { 'serverAuth': '1.3.6.1.5.5.7.3.1', 'clientAuth': '1.3.6.1.5.5.7.3.2', 'codeSigning': '1.3.6.1.5.5.7.3.3', /* See https://github.com/joyent/oid-docs/blob/master/root.md */ 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' }; var EXTPURPOSE_REV = {}; Object.keys(EXTPURPOSE).forEach(function (k) { EXTPURPOSE_REV[EXTPURPOSE[k]] = k; }); var KEYUSEBITS = [ 'signature', 'identity', 'keyEncryption', 'encryption', 'keyAgreement', 'ca', 'crl' ]; function readExtension(cert, buf, der) { der.readSequence(); var after = der.offset + der.length; var extId = der.readOID(); var id; var sig = cert.signatures.x509; if (!sig.extras.exts) sig.extras.exts = []; var critical; if (der.peek() === asn1.Ber.Boolean) critical = der.readBoolean(); switch (extId) { case (EXTS.basicConstraints): der.readSequence(asn1.Ber.OctetString); der.readSequence(); var bcEnd = der.offset + der.length; var ca = false; if (der.peek() === asn1.Ber.Boolean) ca = der.readBoolean(); if (cert.purposes === undefined) cert.purposes = []; if (ca === true) cert.purposes.push('ca'); var bc = { oid: extId, critical: critical }; if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) bc.pathLen = der.readInt(); sig.extras.exts.push(bc); break; case (EXTS.extKeyUsage): der.readSequence(asn1.Ber.OctetString); der.readSequence(); if (cert.purposes === undefined) cert.purposes = []; var ekEnd = der.offset + der.length; while (der.offset < ekEnd) { var oid = der.readOID(); cert.purposes.push(EXTPURPOSE_REV[oid] || oid); } /* * This is a bit of a hack: in the case where we have a cert * that's only allowed to do serverAuth or clientAuth (and not * the other), we want to make sure all our Subjects are of * the right type. But we already parsed our Subjects and * decided if they were hosts or users earlier (since it appears * first in the cert). * * So we go through and mutate them into the right kind here if * it doesn't match. This might not be hugely beneficial, as it * seems that single-purpose certs are not often seen in the * wild. */ if (cert.purposes.indexOf('serverAuth') !== -1 && cert.purposes.indexOf('clientAuth') === -1) { cert.subjects.forEach(function (ide) { if (ide.type !== 'host') { ide.type = 'host'; ide.hostname = ide.uid || ide.email || ide.components[0].value; } }); } else if (cert.purposes.indexOf('clientAuth') !== -1 && cert.purposes.indexOf('serverAuth') === -1) { cert.subjects.forEach(function (ide) { if (ide.type !== 'user') { ide.type = 'user'; ide.uid = ide.hostname || ide.email || ide.components[0].value; } }); } sig.extras.exts.push({ oid: extId, critical: critical }); break; case (EXTS.keyUsage): der.readSequence(asn1.Ber.OctetString); var bits = der.readString(asn1.Ber.BitString, true); var setBits = readBitField(bits, KEYUSEBITS); setBits.forEach(function (bit) { if (cert.purposes === undefined) cert.purposes = []; if (cert.purposes.indexOf(bit) === -1) cert.purposes.push(bit); }); sig.extras.exts.push({ oid: extId, critical: critical, bits: bits }); break; case (EXTS.altName): der.readSequence(asn1.Ber.OctetString); der.readSequence(); var aeEnd = der.offset + der.length; while (der.offset < aeEnd) { switch (der.peek()) { case ALTNAME.OtherName: case ALTNAME.EDIPartyName: der.readSequence(); der._offset += der.length; break; case ALTNAME.OID: der.readOID(ALTNAME.OID); break; case ALTNAME.RFC822Name: /* RFC822 specifies email addresses */ var email = der.readString(ALTNAME.RFC822Name); id = Identity.forEmail(email); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; case ALTNAME.DirectoryName: der.readSequence(ALTNAME.DirectoryName); id = Identity.parseAsn1(der); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; case ALTNAME.DNSName: var host = der.readString( ALTNAME.DNSName); id = Identity.forHost(host); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; default: der.readString(der.peek()); break; } } sig.extras.exts.push({ oid: extId, critical: critical }); break; default: sig.extras.exts.push({ oid: extId, critical: critical, data: der.readString(asn1.Ber.OctetString, true) }); break; } der._offset = after; } var UTCTIME_RE = /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; function utcTimeToDate(t) { var m = t.match(UTCTIME_RE); assert.ok(m, 'timestamps must be in UTC'); var d = new Date(); var thisYear = d.getUTCFullYear(); var century = Math.floor(thisYear / 100) * 100; var year = parseInt(m[1], 10); if (thisYear % 100 < 50 && year >= 60) year += (century - 1); else year += century; d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); if (m[6] && m[6].length > 0) d.setUTCSeconds(parseInt(m[6], 10)); return (d); } var GTIME_RE = /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; function gTimeToDate(t) { var m = t.match(GTIME_RE); assert.ok(m); var d = new Date(); d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, parseInt(m[3], 10)); d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); if (m[6] && m[6].length > 0) d.setUTCSeconds(parseInt(m[6], 10)); return (d); } function zeroPad(n, m) { if (m === undefined) m = 2; var s = '' + n; while (s.length < m) s = '0' + s; return (s); } function dateToUTCTime(d) { var s = ''; s += zeroPad(d.getUTCFullYear() % 100); s += zeroPad(d.getUTCMonth() + 1); s += zeroPad(d.getUTCDate()); s += zeroPad(d.getUTCHours()); s += zeroPad(d.getUTCMinutes()); s += zeroPad(d.getUTCSeconds()); s += 'Z'; return (s); } function dateToGTime(d) { var s = ''; s += zeroPad(d.getUTCFullYear(), 4); s += zeroPad(d.getUTCMonth() + 1); s += zeroPad(d.getUTCDate()); s += zeroPad(d.getUTCHours()); s += zeroPad(d.getUTCMinutes()); s += zeroPad(d.getUTCSeconds()); s += 'Z'; return (s); } function sign(cert, key) { if (cert.signatures.x509 === undefined) cert.signatures.x509 = {}; var sig = cert.signatures.x509; sig.algo = key.type + '-' + key.defaultHashAlgorithm(); if (SIGN_ALGS[sig.algo] === undefined) return (false); var der = new asn1.BerWriter(); writeTBSCert(cert, der); var blob = der.buffer; sig.cache = blob; var signer = key.createSign(); signer.write(blob); cert.signatures.x509.signature = signer.sign(); return (true); } function signAsync(cert, signer, done) { if (cert.signatures.x509 === undefined) cert.signatures.x509 = {}; var sig = cert.signatures.x509; var der = new asn1.BerWriter(); writeTBSCert(cert, der); var blob = der.buffer; sig.cache = blob; signer(blob, function (err, signature) { if (err) { done(err); return; } sig.algo = signature.type + '-' + signature.hashAlgorithm; if (SIGN_ALGS[sig.algo] === undefined) { done(new Error('Invalid signing algorithm "' + sig.algo + '"')); return; } sig.signature = signature; done(); }); } function write(cert, options) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); var der = new asn1.BerWriter(); der.startSequence(); if (sig.cache) { der._ensure(sig.cache.length); sig.cache.copy(der._buf, der._offset); der._offset += sig.cache.length; } else { writeTBSCert(cert, der); } der.startSequence(); der.writeOID(SIGN_ALGS[sig.algo]); if (sig.algo.match(/^rsa-/)) der.writeNull(); der.endSequence(); var sigData = sig.signature.toBuffer('asn1'); var data = Buffer.alloc(sigData.length + 1); data[0] = 0; sigData.copy(data, 1); der.writeBuffer(data, asn1.Ber.BitString); der.endSequence(); return (der.buffer); } function writeTBSCert(cert, der) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); der.startSequence(); der.startSequence(Local(0)); der.writeInt(2); der.endSequence(); der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer); der.startSequence(); der.writeOID(SIGN_ALGS[sig.algo]); if (sig.algo.match(/^rsa-/)) der.writeNull(); der.endSequence(); cert.issuer.toAsn1(der); der.startSequence(); writeDate(der, cert.validFrom); writeDate(der, cert.validUntil); der.endSequence(); var subject = cert.subjects[0]; var altNames = cert.subjects.slice(1); subject.toAsn1(der); pkcs8.writePkcs8(der, cert.subjectKey); if (sig.extras && sig.extras.issuerUniqueID) { der.writeBuffer(sig.extras.issuerUniqueID, Local(1)); } if (sig.extras && sig.extras.subjectUniqueID) { der.writeBuffer(sig.extras.subjectUniqueID, Local(2)); } if (altNames.length > 0 || subject.type === 'host' || (cert.purposes !== undefined && cert.purposes.length > 0) || (sig.extras && sig.extras.exts)) { der.startSequence(Local(3)); der.startSequence(); var exts = []; if (cert.purposes !== undefined && cert.purposes.length > 0) { exts.push({ oid: EXTS.basicConstraints, critical: true }); exts.push({ oid: EXTS.keyUsage, critical: true }); exts.push({ oid: EXTS.extKeyUsage, critical: true }); } exts.push({ oid: EXTS.altName }); if (sig.extras && sig.extras.exts) exts = sig.extras.exts; for (var i = 0; i < exts.length; ++i) { der.startSequence(); der.writeOID(exts[i].oid); if (exts[i].critical !== undefined) der.writeBoolean(exts[i].critical); if (exts[i].oid === EXTS.altName) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); if (subject.type === 'host') { der.writeString(subject.hostname, Context(2)); } for (var j = 0; j < altNames.length; ++j) { if (altNames[j].type === 'host') { der.writeString( altNames[j].hostname, ALTNAME.DNSName); } else if (altNames[j].type === 'email') { der.writeString( altNames[j].email, ALTNAME.RFC822Name); } else { /* * Encode anything else as a * DN style name for now. */ der.startSequence( ALTNAME.DirectoryName); altNames[j].toAsn1(der); der.endSequence(); } } der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.basicConstraints) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); var ca = (cert.purposes.indexOf('ca') !== -1); var pathLen = exts[i].pathLen; der.writeBoolean(ca); if (pathLen !== undefined) der.writeInt(pathLen); der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.extKeyUsage) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); cert.purposes.forEach(function (purpose) { if (purpose === 'ca') return; if (KEYUSEBITS.indexOf(purpose) !== -1) return; var oid = purpose; if (EXTPURPOSE[purpose] !== undefined) oid = EXTPURPOSE[purpose]; der.writeOID(oid); }); der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.keyUsage) { der.startSequence(asn1.Ber.OctetString); /* * If we parsed this certificate from a byte * stream (i.e. we didn't generate it in sshpk) * then we'll have a ".bits" property on the * ext with the original raw byte contents. * * If we have this, use it here instead of * regenerating it. This guarantees we output * the same data we parsed, so signatures still * validate. */ if (exts[i].bits !== undefined) { der.writeBuffer(exts[i].bits, asn1.Ber.BitString); } else { var bits = writeBitField(cert.purposes, KEYUSEBITS); der.writeBuffer(bits, asn1.Ber.BitString); } der.endSequence(); } else { der.writeBuffer(exts[i].data, asn1.Ber.OctetString); } der.endSequence(); } der.endSequence(); der.endSequence(); } der.endSequence(); } /* * Reads an ASN.1 BER bitfield out of the Buffer produced by doing * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw * contents of the BitString tag, which is a count of unused bits followed by * the bits as a right-padded byte string. * * `bits` is the Buffer, `bitIndex` should contain an array of string names * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. * * Returns an array of Strings, the names of the bits that were set to 1. */ function readBitField(bits, bitIndex) { var bitLen = 8 * (bits.length - 1) - bits[0]; var setBits = {}; for (var i = 0; i < bitLen; ++i) { var byteN = 1 + Math.floor(i / 8); var bit = 7 - (i % 8); var mask = 1 << bit; var bitVal = ((bits[byteN] & mask) !== 0); var name = bitIndex[i]; if (bitVal && typeof (name) === 'string') { setBits[name] = true; } } return (Object.keys(setBits)); } /* * `setBits` is an array of strings, containing the names for each bit that * sould be set to 1. `bitIndex` is same as in `readBitField()`. * * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. */ function writeBitField(setBits, bitIndex) { var bitLen = bitIndex.length; var blen = Math.ceil(bitLen / 8); var unused = blen * 8 - bitLen; var bits = Buffer.alloc(1 + blen); // zero-filled bits[0] = unused; for (var i = 0; i < bitLen; ++i) { var byteN = 1 + Math.floor(i / 8); var bit = 7 - (i % 8); var mask = 1 << bit; var name = bitIndex[i]; if (name === undefined) continue; var bitVal = (setBits.indexOf(name) !== -1); if (bitVal) { bits[byteN] |= mask; } } return (bits); } /***/ }), /* 350 */, /* 351 */, /* 352 */, /* 353 */, /* 354 */, /* 355 */, /* 356 */, /* 357 */ /***/ (function(module) { module.exports = require("assert"); /***/ }), /* 358 */, /* 359 */ /***/ (function(module) { "use strict"; module.exports = function generate_pattern(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); out += 'if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; } out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; if ($isData) { out += '' + ($schemaValue); } else { out += '' + (it.util.toQuotedString($schema)); } out += ' } '; if (it.opts.messages !== false) { out += ' , message: \'should match pattern "'; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { out += '' + (it.util.escapeQuotes($schema)); } out += '"\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + (it.util.toQuotedString($schema)); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /* 360 */, /* 361 */, /* 362 */ /***/ (function(module) { // Copyright 2011 Mark Cavage All rights reserved. module.exports = { EOC: 0, Boolean: 1, Integer: 2, BitString: 3, OctetString: 4, Null: 5, OID: 6, ObjectDescriptor: 7, External: 8, Real: 9, // float Enumeration: 10, PDV: 11, Utf8String: 12, RelativeOID: 13, Sequence: 16, Set: 17, NumericString: 18, PrintableString: 19, T61String: 20, VideotexString: 21, IA5String: 22, UTCTime: 23, GeneralizedTime: 24, GraphicString: 25, VisibleString: 26, GeneralString: 28, UniversalString: 29, CharacterString: 30, BMPString: 31, Constructor: 32, Context: 128 }; /***/ }), /* 363 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { Verifier: Verifier, Signer: Signer }; var nacl = __webpack_require__(196); var stream = __webpack_require__(413); var util = __webpack_require__(669); var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var Signature = __webpack_require__(575); function Verifier(key, hashAlgo) { if (hashAlgo.toLowerCase() !== 'sha512') throw (new Error('ED25519 only supports the use of ' + 'SHA-512 hashes')); this.key = key; this.chunks = []; stream.Writable.call(this, {}); } util.inherits(Verifier, stream.Writable); Verifier.prototype._write = function (chunk, enc, cb) { this.chunks.push(chunk); cb(); }; Verifier.prototype.update = function (chunk) { if (typeof (chunk) === 'string') chunk = Buffer.from(chunk, 'binary'); this.chunks.push(chunk); }; Verifier.prototype.verify = function (signature, fmt) { var sig; if (Signature.isSignature(signature, [2, 0])) { if (signature.type !== 'ed25519') return (false); sig = signature.toBuffer('raw'); } else if (typeof (signature) === 'string') { sig = Buffer.from(signature, 'base64'); } else if (Signature.isSignature(signature, [1, 0])) { throw (new Error('signature was created by too old ' + 'a version of sshpk and cannot be verified')); } assert.buffer(sig); return (nacl.sign.detached.verify( new Uint8Array(Buffer.concat(this.chunks)), new Uint8Array(sig), new Uint8Array(this.key.part.A.data))); }; function Signer(key, hashAlgo) { if (hashAlgo.toLowerCase() !== 'sha512') throw (new Error('ED25519 only supports the use of ' + 'SHA-512 hashes')); this.key = key; this.chunks = []; stream.Writable.call(this, {}); } util.inherits(Signer, stream.Writable); Signer.prototype._write = function (chunk, enc, cb) { this.chunks.push(chunk); cb(); }; Signer.prototype.update = function (chunk) { if (typeof (chunk) === 'string') chunk = Buffer.from(chunk, 'binary'); this.chunks.push(chunk); }; Signer.prototype.sign = function () { var sig = nacl.sign.detached( new Uint8Array(Buffer.concat(this.chunks)), new Uint8Array(Buffer.concat([ this.key.part.k.data, this.key.part.A.data]))); var sigBuf = Buffer.from(sig); var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); sigObj.hashAlgorithm = 'sha512'; return (sigObj); }; /***/ }), /* 364 */, /* 365 */, /* 366 */, /* 367 */, /* 368 */, /* 369 */, /* 370 */, /* 371 */, /* 372 */, /* 373 */, /* 374 */ /***/ (function(module) { "use strict"; var hasOwn = Object.prototype.hasOwnProperty; var toStr = Object.prototype.toString; var defineProperty = Object.defineProperty; var gOPD = Object.getOwnPropertyDescriptor; var isArray = function isArray(arr) { if (typeof Array.isArray === 'function') { return Array.isArray(arr); } return toStr.call(arr) === '[object Array]'; }; var isPlainObject = function isPlainObject(obj) { if (!obj || toStr.call(obj) !== '[object Object]') { return false; } var hasOwnConstructor = hasOwn.call(obj, 'constructor'); var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); // Not own constructor property must be Object if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { return false; } // Own properties are enumerated firstly, so to speed up, // if last one is own, then all properties are own. var key; for (key in obj) { /**/ } return typeof key === 'undefined' || hasOwn.call(obj, key); }; // If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target var setProperty = function setProperty(target, options) { if (defineProperty && options.name === '__proto__') { defineProperty(target, options.name, { enumerable: true, configurable: true, value: options.newValue, writable: true }); } else { target[options.name] = options.newValue; } }; // Return undefined instead of __proto__ if '__proto__' is not an own property var getProperty = function getProperty(obj, name) { if (name === '__proto__') { if (!hasOwn.call(obj, name)) { return void 0; } else if (gOPD) { // In early versions of node, obj['__proto__'] is buggy when obj has // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. return gOPD(obj, name).value; } } return obj[name]; }; module.exports = function extend() { var options, name, src, copy, copyIsArray, clone; var target = arguments[0]; var i = 1; var length = arguments.length; var deep = false; // Handle a deep copy situation if (typeof target === 'boolean') { deep = target; target = arguments[1] || {}; // skip the boolean and the target i = 2; } if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { target = {}; } for (; i < length; ++i) { options = arguments[i]; // Only deal with non-null/undefined values if (options != null) { // Extend the base object for (name in options) { src = getProperty(target, name); copy = getProperty(options, name); // Prevent never-ending loop if (target !== copy) { // Recurse if we're merging plain objects or arrays if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { if (copyIsArray) { copyIsArray = false; clone = src && isArray(src) ? src : []; } else { clone = src && isPlainObject(src) ? src : {}; } // Never move original objects, clone them setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); // Don't bring in undefined values } else if (typeof copy !== 'undefined') { setProperty(target, { name: name, newValue: copy }); } } } } } // Return the modified object return target; }; /***/ }), /* 375 */, /* 376 */, /* 377 */, /* 378 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = Identity; var assert = __webpack_require__(477); var algs = __webpack_require__(98); var crypto = __webpack_require__(417); var Fingerprint = __webpack_require__(400); var Signature = __webpack_require__(575); var errs = __webpack_require__(753); var util = __webpack_require__(669); var utils = __webpack_require__(270); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; /*JSSTYLED*/ var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; var oids = {}; oids.cn = '2.5.4.3'; oids.o = '2.5.4.10'; oids.ou = '2.5.4.11'; oids.l = '2.5.4.7'; oids.s = '2.5.4.8'; oids.c = '2.5.4.6'; oids.sn = '2.5.4.4'; oids.postalCode = '2.5.4.17'; oids.serialNumber = '2.5.4.5'; oids.street = '2.5.4.9'; oids.x500UniqueIdentifier = '2.5.4.45'; oids.role = '2.5.4.72'; oids.telephoneNumber = '2.5.4.20'; oids.description = '2.5.4.13'; oids.dc = '0.9.2342.19200300.100.1.25'; oids.uid = '0.9.2342.19200300.100.1.1'; oids.mail = '0.9.2342.19200300.100.1.3'; oids.title = '2.5.4.12'; oids.gn = '2.5.4.42'; oids.initials = '2.5.4.43'; oids.pseudonym = '2.5.4.65'; oids.emailAddress = '1.2.840.113549.1.9.1'; var unoids = {}; Object.keys(oids).forEach(function (k) { unoids[oids[k]] = k; }); function Identity(opts) { var self = this; assert.object(opts, 'options'); assert.arrayOfObject(opts.components, 'options.components'); this.components = opts.components; this.componentLookup = {}; this.components.forEach(function (c) { if (c.name && !c.oid) c.oid = oids[c.name]; if (c.oid && !c.name) c.name = unoids[c.oid]; if (self.componentLookup[c.name] === undefined) self.componentLookup[c.name] = []; self.componentLookup[c.name].push(c); }); if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { this.cn = this.componentLookup.cn[0].value; } assert.optionalString(opts.type, 'options.type'); if (opts.type === undefined) { if (this.components.length === 1 && this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.dc && this.components.length === this.componentLookup.dc.length) { this.type = 'host'; this.hostname = this.componentLookup.dc.map( function (c) { return (c.value); }).join('.'); } else if (this.componentLookup.uid && this.components.length === this.componentLookup.uid.length) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.uid && this.componentLookup.uid.length === 1) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.mail && this.componentLookup.mail.length === 1) { this.type = 'email'; this.email = this.componentLookup.mail[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1) { this.type = 'user'; this.uid = this.componentLookup.cn[0].value; } else { this.type = 'unknown'; } } else { this.type = opts.type; if (this.type === 'host') this.hostname = opts.hostname; else if (this.type === 'user') this.uid = opts.uid; else if (this.type === 'email') this.email = opts.email; else throw (new Error('Unknown type ' + this.type)); } } Identity.prototype.toString = function () { return (this.components.map(function (c) { var n = c.name.toUpperCase(); /*JSSTYLED*/ n = n.replace(/=/g, '\\='); var v = c.value; /*JSSTYLED*/ v = v.replace(/,/g, '\\,'); return (n + '=' + v); }).join(', ')); }; Identity.prototype.get = function (name, asArray) { assert.string(name, 'name'); var arr = this.componentLookup[name]; if (arr === undefined || arr.length === 0) return (undefined); if (!asArray && arr.length > 1) throw (new Error('Multiple values for attribute ' + name)); if (!asArray) return (arr[0].value); return (arr.map(function (c) { return (c.value); })); }; Identity.prototype.toArray = function (idx) { return (this.components.map(function (c) { return ({ name: c.name, value: c.value }); })); }; /* * These are from X.680 -- PrintableString allowed chars are in section 37.4 * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 * (the basic ASCII character set). */ /* JSSTYLED */ var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; /* JSSTYLED */ var NOT_IA5 = /[^\x00-\x7f]/; Identity.prototype.toAsn1 = function (der, tag) { der.startSequence(tag); this.components.forEach(function (c) { der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); der.startSequence(); der.writeOID(c.oid); /* * If we fit in a PrintableString, use that. Otherwise use an * IA5String or UTF8String. * * If this identity was parsed from a DN, use the ASN.1 types * from the original representation (otherwise this might not * be a full match for the original in some validators). */ if (c.asn1type === asn1.Ber.Utf8String || c.value.match(NOT_IA5)) { var v = Buffer.from(c.value, 'utf8'); der.writeBuffer(v, asn1.Ber.Utf8String); } else if (c.asn1type === asn1.Ber.IA5String || c.value.match(NOT_PRINTABLE)) { der.writeString(c.value, asn1.Ber.IA5String); } else { var type = asn1.Ber.PrintableString; if (c.asn1type !== undefined) type = c.asn1type; der.writeString(c.value, type); } der.endSequence(); der.endSequence(); }); der.endSequence(); }; function globMatch(a, b) { if (a === '**' || b === '**') return (true); var aParts = a.split('.'); var bParts = b.split('.'); if (aParts.length !== bParts.length) return (false); for (var i = 0; i < aParts.length; ++i) { if (aParts[i] === '*' || bParts[i] === '*') continue; if (aParts[i] !== bParts[i]) return (false); } return (true); } Identity.prototype.equals = function (other) { if (!Identity.isIdentity(other, [1, 0])) return (false); if (other.components.length !== this.components.length) return (false); for (var i = 0; i < this.components.length; ++i) { if (this.components[i].oid !== other.components[i].oid) return (false); if (!globMatch(this.components[i].value, other.components[i].value)) { return (false); } } return (true); }; Identity.forHost = function (hostname) { assert.string(hostname, 'hostname'); return (new Identity({ type: 'host', hostname: hostname, components: [ { name: 'cn', value: hostname } ] })); }; Identity.forUser = function (uid) { assert.string(uid, 'uid'); return (new Identity({ type: 'user', uid: uid, components: [ { name: 'uid', value: uid } ] })); }; Identity.forEmail = function (email) { assert.string(email, 'email'); return (new Identity({ type: 'email', email: email, components: [ { name: 'mail', value: email } ] })); }; Identity.parseDN = function (dn) { assert.string(dn, 'dn'); var parts = ['']; var idx = 0; var rem = dn; while (rem.length > 0) { var m; /*JSSTYLED*/ if ((m = /^,/.exec(rem)) !== null) { parts[++idx] = ''; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^\\,/.exec(rem)) !== null) { parts[idx] += ','; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^\\./.exec(rem)) !== null) { parts[idx] += m[0]; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { parts[idx] += m[0]; rem = rem.slice(m[0].length); } else { throw (new Error('Failed to parse DN')); } } var cmps = parts.map(function (c) { c = c.trim(); var eqPos = c.indexOf('='); while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') eqPos = c.indexOf('=', eqPos + 1); if (eqPos === -1) { throw (new Error('Failed to parse DN')); } /*JSSTYLED*/ var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); var value = c.slice(eqPos + 1); return ({ name: name, value: value }); }); return (new Identity({ components: cmps })); }; Identity.fromArray = function (components) { assert.arrayOfObject(components, 'components'); components.forEach(function (cmp) { assert.object(cmp, 'component'); assert.string(cmp.name, 'component.name'); if (!Buffer.isBuffer(cmp.value) && !(typeof (cmp.value) === 'string')) { throw (new Error('Invalid component value')); } }); return (new Identity({ components: components })); }; Identity.parseAsn1 = function (der, top) { var components = []; der.readSequence(top); var end = der.offset + der.length; while (der.offset < end) { der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); var after = der.offset + der.length; der.readSequence(); var oid = der.readOID(); var type = der.peek(); var value; switch (type) { case asn1.Ber.PrintableString: case asn1.Ber.IA5String: case asn1.Ber.OctetString: case asn1.Ber.T61String: value = der.readString(type); break; case asn1.Ber.Utf8String: value = der.readString(type, true); value = value.toString('utf8'); break; case asn1.Ber.CharacterString: case asn1.Ber.BMPString: value = der.readString(type, true); value = value.toString('utf16le'); break; default: throw (new Error('Unknown asn1 type ' + type)); } components.push({ oid: oid, asn1type: type, value: value }); der._offset = after; } der._offset = end; return (new Identity({ components: components })); }; Identity.isIdentity = function (obj, ver) { return (utils.isCompatible(obj, Identity, ver)); }; /* * API versions for Identity: * [1,0] -- initial ver */ Identity.prototype._sshpkApiVersion = [1, 0]; Identity._oldVersionDetect = function (obj) { return ([1, 0]); }; /***/ }), /* 379 */, /* 380 */ /***/ (function(module) { module.exports = {"$id":"request.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["method","url","httpVersion","cookies","headers","queryString","headersSize","bodySize"],"properties":{"method":{"type":"string"},"url":{"type":"string","format":"uri"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"queryString":{"type":"array","items":{"$ref":"query.json#"}},"postData":{"$ref":"postData.json#"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), /* 381 */, /* 382 */ /***/ (function(module, __unusedexports, __webpack_require__) { var stream = __webpack_require__(413) function isStream (obj) { return obj instanceof stream.Stream } function isReadable (obj) { return isStream(obj) && typeof obj._read == 'function' && typeof obj._readableState == 'object' } function isWritable (obj) { return isStream(obj) && typeof obj._write == 'function' && typeof obj._writableState == 'object' } function isDuplex (obj) { return isReadable(obj) && isWritable(obj) } module.exports = isStream module.exports.isReadable = isReadable module.exports.isWritable = isWritable module.exports.isDuplex = isDuplex /***/ }), /* 383 */ /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; //all requires must be explicit because browserify won't work with dynamic requires module.exports = { '$ref': __webpack_require__(266), allOf: __webpack_require__(107), anyOf: __webpack_require__(902), '$comment': __webpack_require__(28), const: __webpack_require__(662), contains: __webpack_require__(154), dependencies: __webpack_require__(233), 'enum': __webpack_require__(281), format: __webpack_require__(687), 'if': __webpack_require__(479), items: __webpack_require__(643), maximum: __webpack_require__(341), minimum: __webpack_require__(341), maxItems: __webpack_require__(85), minItems: __webpack_require__(85), maxLength: __webpack_require__(772), minLength: __webpack_require__(772), maxProperties: __webpack_require__(560), minProperties: __webpack_require__(560), multipleOf: __webpack_require__(397), not: __webpack_require__(673), oneOf: __webpack_require__(653), pattern: __webpack_require__(359), properties: __webpack_require__(343), propertyNames: __webpack_require__(35), required: __webpack_require__(858), uniqueItems: __webpack_require__(899), validate: __webpack_require__(967) }; /***/ }), /* 384 */, /* 385 */, /* 386 */ /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var stringify = __webpack_require__(897); var parse = __webpack_require__(755); var formats = __webpack_require__(13); module.exports = { formats: formats, parse: parse, stringify: stringify }; /***/ }), /* 387 */, /* 388 */, /* 389 */, /* 390 */, /* 391 */, /* 392 */, /* 393 */, /* 394 */, /* 395 */, /* 396 */, /* 397 */ /***/ (function(module) { "use strict"; module.exports = function generate_multipleOf(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } out += 'var division' + ($lvl) + ';if ('; if ($isData) { out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; } out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; if (it.opts.multipleOfPrecision) { out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; } else { out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; } out += ' ) '; if ($isData) { out += ' ) '; } out += ' ) { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should be multiple of '; if ($isData) { out += '\' + ' + ($schemaValue); } else { out += '' + ($schemaValue) + '\''; } } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /* 398 */, /* 399 */, /* 400 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2018 Joyent, Inc. module.exports = Fingerprint; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var crypto = __webpack_require__(417); var errs = __webpack_require__(753); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var Certificate = __webpack_require__(752); var utils = __webpack_require__(270); var FingerprintFormatError = errs.FingerprintFormatError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; function Fingerprint(opts) { assert.object(opts, 'options'); assert.string(opts.type, 'options.type'); assert.buffer(opts.hash, 'options.hash'); assert.string(opts.algorithm, 'options.algorithm'); this.algorithm = opts.algorithm.toLowerCase(); if (algs.hashAlgs[this.algorithm] !== true) throw (new InvalidAlgorithmError(this.algorithm)); this.hash = opts.hash; this.type = opts.type; this.hashType = opts.hashType; } Fingerprint.prototype.toString = function (format) { if (format === undefined) { if (this.algorithm === 'md5' || this.hashType === 'spki') format = 'hex'; else format = 'base64'; } assert.string(format); switch (format) { case 'hex': if (this.hashType === 'spki') return (this.hash.toString('hex')); return (addColons(this.hash.toString('hex'))); case 'base64': if (this.hashType === 'spki') return (this.hash.toString('base64')); return (sshBase64Format(this.algorithm, this.hash.toString('base64'))); default: throw (new FingerprintFormatError(undefined, format)); } }; Fingerprint.prototype.matches = function (other) { assert.object(other, 'key or certificate'); if (this.type === 'key' && this.hashType !== 'ssh') { utils.assertCompatible(other, Key, [1, 7], 'key with spki'); if (PrivateKey.isPrivateKey(other)) { utils.assertCompatible(other, PrivateKey, [1, 6], 'privatekey with spki support'); } } else if (this.type === 'key') { utils.assertCompatible(other, Key, [1, 0], 'key'); } else { utils.assertCompatible(other, Certificate, [1, 0], 'certificate'); } var theirHash = other.hash(this.algorithm, this.hashType); var theirHash2 = crypto.createHash(this.algorithm). update(theirHash).digest('base64'); if (this.hash2 === undefined) this.hash2 = crypto.createHash(this.algorithm). update(this.hash).digest('base64'); return (this.hash2 === theirHash2); }; /*JSSTYLED*/ var base64RE = /^[A-Za-z0-9+\/=]+$/; /*JSSTYLED*/ var hexRE = /^[a-fA-F0-9]+$/; Fingerprint.parse = function (fp, options) { assert.string(fp, 'fingerprint'); var alg, hash, enAlgs; if (Array.isArray(options)) { enAlgs = options; options = {}; } assert.optionalObject(options, 'options'); if (options === undefined) options = {}; if (options.enAlgs !== undefined) enAlgs = options.enAlgs; if (options.algorithms !== undefined) enAlgs = options.algorithms; assert.optionalArrayOfString(enAlgs, 'algorithms'); var hashType = 'ssh'; if (options.hashType !== undefined) hashType = options.hashType; assert.string(hashType, 'options.hashType'); var parts = fp.split(':'); if (parts.length == 2) { alg = parts[0].toLowerCase(); if (!base64RE.test(parts[1])) throw (new FingerprintFormatError(fp)); try { hash = Buffer.from(parts[1], 'base64'); } catch (e) { throw (new FingerprintFormatError(fp)); } } else if (parts.length > 2) { alg = 'md5'; if (parts[0].toLowerCase() === 'md5') parts = parts.slice(1); parts = parts.map(function (p) { while (p.length < 2) p = '0' + p; if (p.length > 2) throw (new FingerprintFormatError(fp)); return (p); }); parts = parts.join(''); if (!hexRE.test(parts) || parts.length % 2 !== 0) throw (new FingerprintFormatError(fp)); try { hash = Buffer.from(parts, 'hex'); } catch (e) { throw (new FingerprintFormatError(fp)); } } else { if (hexRE.test(fp)) { hash = Buffer.from(fp, 'hex'); } else if (base64RE.test(fp)) { hash = Buffer.from(fp, 'base64'); } else { throw (new FingerprintFormatError(fp)); } switch (hash.length) { case 32: alg = 'sha256'; break; case 16: alg = 'md5'; break; case 20: alg = 'sha1'; break; case 64: alg = 'sha512'; break; default: throw (new FingerprintFormatError(fp)); } /* Plain hex/base64: guess it's probably SPKI unless told. */ if (options.hashType === undefined) hashType = 'spki'; } if (alg === undefined) throw (new FingerprintFormatError(fp)); if (algs.hashAlgs[alg] === undefined) throw (new InvalidAlgorithmError(alg)); if (enAlgs !== undefined) { enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); if (enAlgs.indexOf(alg) === -1) throw (new InvalidAlgorithmError(alg)); } return (new Fingerprint({ algorithm: alg, hash: hash, type: options.type || 'key', hashType: hashType })); }; function addColons(s) { /*JSSTYLED*/ return (s.replace(/(.{2})(?=.)/g, '$1:')); } function base64Strip(s) { /*JSSTYLED*/ return (s.replace(/=*$/, '')); } function sshBase64Format(alg, h) { return (alg.toUpperCase() + ':' + base64Strip(h)); } Fingerprint.isFingerprint = function (obj, ver) { return (utils.isCompatible(obj, Fingerprint, ver)); }; /* * API versions for Fingerprint: * [1,0] -- initial ver * [1,1] -- first tagged ver * [1,2] -- hashType and spki support */ Fingerprint.prototype._sshpkApiVersion = [1, 2]; Fingerprint._oldVersionDetect = function (obj) { assert.func(obj.toString); assert.func(obj.matches); return ([1, 0]); }; /***/ }), /* 401 */, /* 402 */, /* 403 */, /* 404 */, /* 405 */ /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var RETRIABLE_ERRORS = ['ECONNRESET', 'ENOTFOUND', 'ESOCKETTIMEDOUT', 'ETIMEDOUT', 'ECONNREFUSED', 'EHOSTUNREACH', 'EPIPE', 'EAI_AGAIN']; var _ = __webpack_require__(557); /** * @param {Null | Object} err * @param {Object} response * @return {Boolean} true if the request had a network error */ function NetworkError(err /*, response*/ ) { return err && _.includes(RETRIABLE_ERRORS, err.code); } NetworkError.RETRIABLE_ERRORS = RETRIABLE_ERRORS; module.exports = NetworkError; /***/ }), /* 406 */, /* 407 */, /* 408 */, /* 409 */, /* 410 */, /* 411 */, /* 412 */, /* 413 */ /***/ (function(module) { module.exports = require("stream"); /***/ }), /* 414 */, /* 415 */, /* 416 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var fs = __webpack_require__(747) var qs = __webpack_require__(191) var validate = __webpack_require__(846) var extend = __webpack_require__(374) function Har (request) { this.request = request } Har.prototype.reducer = function (obj, pair) { // new property ? if (obj[pair.name] === undefined) { obj[pair.name] = pair.value return obj } // existing? convert to array var arr = [ obj[pair.name], pair.value ] obj[pair.name] = arr return obj } Har.prototype.prep = function (data) { // construct utility properties data.queryObj = {} data.headersObj = {} data.postData.jsonObj = false data.postData.paramsObj = false // construct query objects if (data.queryString && data.queryString.length) { data.queryObj = data.queryString.reduce(this.reducer, {}) } // construct headers objects if (data.headers && data.headers.length) { // loweCase header keys data.headersObj = data.headers.reduceRight(function (headers, header) { headers[header.name] = header.value return headers }, {}) } // construct Cookie header if (data.cookies && data.cookies.length) { var cookies = data.cookies.map(function (cookie) { return cookie.name + '=' + cookie.value }) if (cookies.length) { data.headersObj.cookie = cookies.join('; ') } } // prep body function some (arr) { return arr.some(function (type) { return data.postData.mimeType.indexOf(type) === 0 }) } if (some([ 'multipart/mixed', 'multipart/related', 'multipart/form-data', 'multipart/alternative'])) { // reset values data.postData.mimeType = 'multipart/form-data' } else if (some([ 'application/x-www-form-urlencoded'])) { if (!data.postData.params) { data.postData.text = '' } else { data.postData.paramsObj = data.postData.params.reduce(this.reducer, {}) // always overwrite data.postData.text = qs.stringify(data.postData.paramsObj) } } else if (some([ 'text/json', 'text/x-json', 'application/json', 'application/x-json'])) { data.postData.mimeType = 'application/json' if (data.postData.text) { try { data.postData.jsonObj = JSON.parse(data.postData.text) } catch (e) { this.request.debug(e) // force back to text/plain data.postData.mimeType = 'text/plain' } } } return data } Har.prototype.options = function (options) { // skip if no har property defined if (!options.har) { return options } var har = {} extend(har, options.har) // only process the first entry if (har.log && har.log.entries) { har = har.log.entries[0] } // add optional properties to make validation successful har.url = har.url || options.url || options.uri || options.baseUrl || '/' har.httpVersion = har.httpVersion || 'HTTP/1.1' har.queryString = har.queryString || [] har.headers = har.headers || [] har.cookies = har.cookies || [] har.postData = har.postData || {} har.postData.mimeType = har.postData.mimeType || 'application/octet-stream' har.bodySize = 0 har.headersSize = 0 har.postData.size = 0 if (!validate.request(har)) { return options } // clean up and get some utility properties var req = this.prep(har) // construct new options if (req.url) { options.url = req.url } if (req.method) { options.method = req.method } if (Object.keys(req.queryObj).length) { options.qs = req.queryObj } if (Object.keys(req.headersObj).length) { options.headers = req.headersObj } function test (type) { return req.postData.mimeType.indexOf(type) === 0 } if (test('application/x-www-form-urlencoded')) { options.form = req.postData.paramsObj } else if (test('application/json')) { if (req.postData.jsonObj) { options.body = req.postData.jsonObj options.json = true } } else if (test('multipart/form-data')) { options.formData = {} req.postData.params.forEach(function (param) { var attachment = {} if (!param.fileName && !param.contentType) { options.formData[param.name] = param.value return } // attempt to read from disk! if (param.fileName && !param.value) { attachment.value = fs.createReadStream(param.fileName) } else if (param.value) { attachment.value = param.value } if (param.fileName) { attachment.options = { filename: param.fileName, contentType: param.contentType ? param.contentType : null } } options.formData[param.name] = attachment }) } else { if (req.postData.text) { options.body = req.postData.text } } return options } exports.Har = Har /***/ }), /* 417 */ /***/ (function(module) { module.exports = require("crypto"); /***/ }), /* 418 */, /* 419 */, /* 420 */, /* 421 */, /* 422 */, /* 423 */, /* 424 */ /***/ (function(module, __unusedexports, __webpack_require__) { var iterate = __webpack_require__(157) , initState = __webpack_require__(147) , terminator = __webpack_require__(939) ; // Public API module.exports = parallel; /** * Runs iterator over provided array elements in parallel * * @param {array|object} list - array or object (named list) to iterate over * @param {function} iterator - iterator to run * @param {function} callback - invoked when all elements processed * @returns {function} - jobs terminator */ function parallel(list, iterator, callback) { var state = initState(list); while (state.index < (state['keyedList'] || list).length) { iterate(list, iterator, state, function(error, result) { if (error) { callback(error, result); return; } // looks like it's the last one if (Object.keys(state.jobs).length === 0) { callback(null, state.results); return; } }); state.index++; } return terminator.bind(state, callback); } /***/ }), /* 425 */, /* 426 */, /* 427 */, /* 428 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(477); var crypto = __webpack_require__(417); var sshpk = __webpack_require__(650); var utils = __webpack_require__(909); var HASH_ALGOS = utils.HASH_ALGOS; var PK_ALGOS = utils.PK_ALGOS; var InvalidAlgorithmError = utils.InvalidAlgorithmError; var HttpSignatureError = utils.HttpSignatureError; var validateAlgorithm = utils.validateAlgorithm; ///--- Exported API module.exports = { /** * Verify RSA/DSA signature against public key. You are expected to pass in * an object that was returned from `parse()`. * * @param {Object} parsedSignature the object you got from `parse`. * @param {String} pubkey RSA/DSA private key PEM. * @return {Boolean} true if valid, false otherwise. * @throws {TypeError} if you pass in bad arguments. * @throws {InvalidAlgorithmError} */ verifySignature: function verifySignature(parsedSignature, pubkey) { assert.object(parsedSignature, 'parsedSignature'); if (typeof (pubkey) === 'string' || Buffer.isBuffer(pubkey)) pubkey = sshpk.parseKey(pubkey); assert.ok(sshpk.Key.isKey(pubkey, [1, 1]), 'pubkey must be a sshpk.Key'); var alg = validateAlgorithm(parsedSignature.algorithm); if (alg[0] === 'hmac' || alg[0] !== pubkey.type) return (false); var v = pubkey.createVerify(alg[1]); v.update(parsedSignature.signingString); return (v.verify(parsedSignature.params.signature, 'base64')); }, /** * Verify HMAC against shared secret. You are expected to pass in an object * that was returned from `parse()`. * * @param {Object} parsedSignature the object you got from `parse`. * @param {String} secret HMAC shared secret. * @return {Boolean} true if valid, false otherwise. * @throws {TypeError} if you pass in bad arguments. * @throws {InvalidAlgorithmError} */ verifyHMAC: function verifyHMAC(parsedSignature, secret) { assert.object(parsedSignature, 'parsedHMAC'); assert.string(secret, 'secret'); var alg = validateAlgorithm(parsedSignature.algorithm); if (alg[0] !== 'hmac') return (false); var hashAlg = alg[1].toUpperCase(); var hmac = crypto.createHmac(hashAlg, secret); hmac.update(parsedSignature.signingString); /* * Now double-hash to avoid leaking timing information - there's * no easy constant-time compare in JS, so we use this approach * instead. See for more info: * https://www.isecpartners.com/blog/2011/february/double-hmac- * verification.aspx */ var h1 = crypto.createHmac(hashAlg, secret); h1.update(hmac.digest()); h1 = h1.digest(); var h2 = crypto.createHmac(hashAlg, secret); h2.update(new Buffer(parsedSignature.params.signature, 'base64')); h2 = h2.digest(); /* Node 0.8 returns strings from .digest(). */ if (typeof (h1) === 'string') return (h1 === h2); /* And node 0.10 lacks the .equals() method on Buffers. */ if (Buffer.isBuffer(h1) && !h1.equals) return (h1.toString('binary') === h2.toString('binary')); return (h1.equals(h2)); } }; /***/ }), /* 429 */, /* 430 */, /* 431 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; result["default"] = mod; return result; }; Object.defineProperty(exports, "__esModule", { value: true }); const os = __importStar(__webpack_require__(87)); const utils_1 = __webpack_require__(82); /** * Commands * * Command Format: * ::name key=value,key=value::message * * Examples: * ::warning::This is the message * ::set-env name=MY_VAR::some value */ function issueCommand(command, properties, message) { const cmd = new Command(command, properties, message); process.stdout.write(cmd.toString() + os.EOL); } exports.issueCommand = issueCommand; function issue(name, message = '') { issueCommand(name, {}, message); } exports.issue = issue; const CMD_STRING = '::'; class Command { constructor(command, properties, message) { if (!command) { command = 'missing.command'; } this.command = command; this.properties = properties; this.message = message; } toString() { let cmdStr = CMD_STRING + this.command; if (this.properties && Object.keys(this.properties).length > 0) { cmdStr += ' '; let first = true; for (const key in this.properties) { if (this.properties.hasOwnProperty(key)) { const val = this.properties[key]; if (val) { if (first) { first = false; } else { cmdStr += ','; } cmdStr += `${key}=${escapeProperty(val)}`; } } } } cmdStr += `${CMD_STRING}${escapeData(this.message)}`; return cmdStr; } } function escapeData(s) { return utils_1.toCommandValue(s) .replace(/%/g, '%25') .replace(/\r/g, '%0D') .replace(/\n/g, '%0A'); } function escapeProperty(s) { return utils_1.toCommandValue(s) .replace(/%/g, '%25') .replace(/\r/g, '%0D') .replace(/\n/g, '%0A') .replace(/:/g, '%3A') .replace(/,/g, '%2C'); } //# sourceMappingURL=command.js.map /***/ }), /* 432 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*! * mime-types * Copyright(c) 2014 Jonathan Ong * Copyright(c) 2015 Douglas Christopher Wilson * MIT Licensed */ /** * Module dependencies. * @private */ var db = __webpack_require__(972) var extname = __webpack_require__(622).extname /** * Module variables. * @private */ var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ var TEXT_TYPE_REGEXP = /^text\//i /** * Module exports. * @public */ exports.charset = charset exports.charsets = { lookup: charset } exports.contentType = contentType exports.extension = extension exports.extensions = Object.create(null) exports.lookup = lookup exports.types = Object.create(null) // Populate the extensions/types maps populateMaps(exports.extensions, exports.types) /** * Get the default charset for a MIME type. * * @param {string} type * @return {boolean|string} */ function charset (type) { if (!type || typeof type !== 'string') { return false } // TODO: use media-typer var match = EXTRACT_TYPE_REGEXP.exec(type) var mime = match && db[match[1].toLowerCase()] if (mime && mime.charset) { return mime.charset } // default text/* to utf-8 if (match && TEXT_TYPE_REGEXP.test(match[1])) { return 'UTF-8' } return false } /** * Create a full Content-Type header given a MIME type or extension. * * @param {string} str * @return {boolean|string} */ function contentType (str) { // TODO: should this even be in this module? if (!str || typeof str !== 'string') { return false } var mime = str.indexOf('/') === -1 ? exports.lookup(str) : str if (!mime) { return false } // TODO: use content-type or other module if (mime.indexOf('charset') === -1) { var charset = exports.charset(mime) if (charset) mime += '; charset=' + charset.toLowerCase() } return mime } /** * Get the default extension for a MIME type. * * @param {string} type * @return {boolean|string} */ function extension (type) { if (!type || typeof type !== 'string') { return false } // TODO: use media-typer var match = EXTRACT_TYPE_REGEXP.exec(type) // get extensions var exts = match && exports.extensions[match[1].toLowerCase()] if (!exts || !exts.length) { return false } return exts[0] } /** * Lookup the MIME type for a file path/extension. * * @param {string} path * @return {boolean|string} */ function lookup (path) { if (!path || typeof path !== 'string') { return false } // get the extension ("ext" or ".ext" or full path) var extension = extname('x.' + path) .toLowerCase() .substr(1) if (!extension) { return false } return exports.types[extension] || false } /** * Populate the extensions and types maps. * @private */ function populateMaps (extensions, types) { // source preference (least -> most) var preference = ['nginx', 'apache', undefined, 'iana'] Object.keys(db).forEach(function forEachMimeType (type) { var mime = db[type] var exts = mime.extensions if (!exts || !exts.length) { return } // mime -> extensions extensions[type] = exts // extension -> mime for (var i = 0; i < exts.length; i++) { var extension = exts[i] if (types[extension]) { var from = preference.indexOf(db[types[extension]].source) var to = preference.indexOf(mime.source) if (types[extension] !== 'application/octet-stream' && (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { // skip the remapping continue } } // set the extension -> mime types[extension] = type } }) } /***/ }), /* 433 */, /* 434 */, /* 435 */ /***/ (function(module) { module.exports = {"$id":"cache.json#","$schema":"http://json-schema.org/draft-06/schema#","properties":{"beforeRequest":{"oneOf":[{"type":"null"},{"$ref":"beforeRequest.json#"}]},"afterRequest":{"oneOf":[{"type":"null"},{"$ref":"afterRequest.json#"}]},"comment":{"type":"string"}}}; /***/ }), /* 436 */, /* 437 */, /* 438 */, /* 439 */, /* 440 */, /* 441 */, /* 442 */, /* 443 */, /* 444 */, /* 445 */, /* 446 */, /* 447 */, /* 448 */, /* 449 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, readPkcs1: readPkcs1, write: write, writePkcs1: writePkcs1 }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var pkcs8 = __webpack_require__(707); var readECDSACurve = pkcs8.readECDSACurve; function read(buf, options) { return (pem.read(buf, options, 'pkcs1')); } function write(key, options) { return (pem.write(key, options, 'pkcs1')); } /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function readPkcs1(alg, type, der) { switch (alg) { case 'RSA': if (type === 'public') return (readPkcs1RSAPublic(der)); else if (type === 'private') return (readPkcs1RSAPrivate(der)); throw (new Error('Unknown key type: ' + type)); case 'DSA': if (type === 'public') return (readPkcs1DSAPublic(der)); else if (type === 'private') return (readPkcs1DSAPrivate(der)); throw (new Error('Unknown key type: ' + type)); case 'EC': case 'ECDSA': if (type === 'private') return (readPkcs1ECDSAPrivate(der)); else if (type === 'public') return (readPkcs1ECDSAPublic(der)); throw (new Error('Unknown key type: ' + type)); case 'EDDSA': case 'EdDSA': if (type === 'private') return (readPkcs1EdDSAPrivate(der)); throw (new Error(type + ' keys not supported with EdDSA')); default: throw (new Error('Unknown key algo: ' + alg)); } } function readPkcs1RSAPublic(der) { // modulus and exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'exponent'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'e', data: e }, { name: 'n', data: n } ] }; return (new Key(key)); } function readPkcs1RSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version[0], 0); // modulus then public exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'public exponent'); var d = readMPInt(der, 'private exponent'); var p = readMPInt(der, 'prime1'); var q = readMPInt(der, 'prime2'); var dmodp = readMPInt(der, 'exponent1'); var dmodq = readMPInt(der, 'exponent2'); var iqmp = readMPInt(der, 'iqmp'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'n', data: n }, { name: 'e', data: e }, { name: 'd', data: d }, { name: 'iqmp', data: iqmp }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'dmodp', data: dmodp }, { name: 'dmodq', data: dmodq } ] }; return (new PrivateKey(key)); } function readPkcs1DSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 0); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); var y = readMPInt(der, 'y'); var x = readMPInt(der, 'x'); // now, make the key var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y }, { name: 'x', data: x } ] }; return (new PrivateKey(key)); } function readPkcs1EdDSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 1); // private key var k = der.readString(asn1.Ber.OctetString, true); der.readSequence(0xa0); var oid = der.readOID(); assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); der.readSequence(0xa1); var A = utils.readBitString(der); var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: k } ] }; return (new PrivateKey(key)); } function readPkcs1DSAPublic(der) { var y = readMPInt(der, 'y'); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); var key = { type: 'dsa', parts: [ { name: 'y', data: y }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g } ] }; return (new Key(key)); } function readPkcs1ECDSAPublic(der) { der.readSequence(); var oid = der.readOID(); assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); var curveOid = der.readOID(); var curve; var curves = Object.keys(algs.curves); for (var j = 0; j < curves.length; ++j) { var c = curves[j]; var cd = algs.curves[c]; if (cd.pkcs8oid === curveOid) { curve = c; break; } } assert.string(curve, 'a known ECDSA named curve'); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curve) }, { name: 'Q', data: Q } ] }; return (new Key(key)); } function readPkcs1ECDSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 1); // private key var d = der.readString(asn1.Ber.OctetString, true); der.readSequence(0xa0); var curve = readECDSACurve(der); assert.string(curve, 'a known elliptic curve'); der.readSequence(0xa1); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curve) }, { name: 'Q', data: Q }, { name: 'd', data: d } ] }; return (new PrivateKey(key)); } function writePkcs1(der, key) { der.startSequence(); switch (key.type) { case 'rsa': if (PrivateKey.isPrivateKey(key)) writePkcs1RSAPrivate(der, key); else writePkcs1RSAPublic(der, key); break; case 'dsa': if (PrivateKey.isPrivateKey(key)) writePkcs1DSAPrivate(der, key); else writePkcs1DSAPublic(der, key); break; case 'ecdsa': if (PrivateKey.isPrivateKey(key)) writePkcs1ECDSAPrivate(der, key); else writePkcs1ECDSAPublic(der, key); break; case 'ed25519': if (PrivateKey.isPrivateKey(key)) writePkcs1EdDSAPrivate(der, key); else writePkcs1EdDSAPublic(der, key); break; default: throw (new Error('Unknown key algo: ' + key.type)); } der.endSequence(); } function writePkcs1RSAPublic(der, key) { der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); } function writePkcs1RSAPrivate(der, key) { var ver = Buffer.from([0]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); if (!key.part.dmodp || !key.part.dmodq) utils.addRSAMissing(key); der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); } function writePkcs1DSAPrivate(der, key) { var ver = Buffer.from([0]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.writeBuffer(key.part.x.data, asn1.Ber.Integer); } function writePkcs1DSAPublic(der, key) { der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); } function writePkcs1ECDSAPublic(der, key) { der.startSequence(); der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ var curve = key.part.curve.data.toString(); var curveOid = algs.curves[curve].pkcs8oid; assert.string(curveOid, 'a known ECDSA named curve'); der.writeOID(curveOid); der.endSequence(); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); } function writePkcs1ECDSAPrivate(der, key) { var ver = Buffer.from([1]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); der.startSequence(0xa0); var curve = key.part.curve.data.toString(); var curveOid = algs.curves[curve].pkcs8oid; assert.string(curveOid, 'a known ECDSA named curve'); der.writeOID(curveOid); der.endSequence(); der.startSequence(0xa1); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); der.endSequence(); } function writePkcs1EdDSAPrivate(der, key) { var ver = Buffer.from([1]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); der.startSequence(0xa0); der.writeOID('1.3.101.112'); der.endSequence(); der.startSequence(0xa1); utils.writeBitString(der, key.part.A.data); der.endSequence(); } function writePkcs1EdDSAPublic(der, key) { throw (new Error('Public keys are not supported for EdDSA PKCS#1')); } /***/ }), /* 450 */, /* 451 */, /* 452 */, /* 453 */, /* 454 */, /* 455 */ /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var http = __webpack_require__(605) var https = __webpack_require__(211) var url = __webpack_require__(835) var util = __webpack_require__(669) var stream = __webpack_require__(413) var zlib = __webpack_require__(761) var aws2 = __webpack_require__(942) var aws4 = __webpack_require__(658) var httpSignature = __webpack_require__(789) var mime = __webpack_require__(432) var caseless = __webpack_require__(7) var ForeverAgent = __webpack_require__(792) var FormData = __webpack_require__(928) var extend = __webpack_require__(374) var isstream = __webpack_require__(382) var isTypedArray = __webpack_require__(944).strict var helpers = __webpack_require__(810) var cookies = __webpack_require__(602) var getProxyFromURI = __webpack_require__(298) var Querystring = __webpack_require__(629).Querystring var Har = __webpack_require__(416).Har var Auth = __webpack_require__(554).Auth var OAuth = __webpack_require__(287).OAuth var hawk = __webpack_require__(964) var Multipart = __webpack_require__(469).Multipart var Redirect = __webpack_require__(552).Redirect var Tunnel = __webpack_require__(461).Tunnel var now = __webpack_require__(742) var Buffer = __webpack_require__(149).Buffer var safeStringify = helpers.safeStringify var isReadStream = helpers.isReadStream var toBase64 = helpers.toBase64 var defer = helpers.defer var copy = helpers.copy var version = helpers.version var globalCookieJar = cookies.jar() var globalPool = {} function filterForNonReserved (reserved, options) { // Filter out properties that are not reserved. // Reserved values are passed in at call site. var object = {} for (var i in options) { var notReserved = (reserved.indexOf(i) === -1) if (notReserved) { object[i] = options[i] } } return object } function filterOutReservedFunctions (reserved, options) { // Filter out properties that are functions and are reserved. // Reserved values are passed in at call site. var object = {} for (var i in options) { var isReserved = !(reserved.indexOf(i) === -1) var isFunction = (typeof options[i] === 'function') if (!(isReserved && isFunction)) { object[i] = options[i] } } return object } // Return a simpler request object to allow serialization function requestToJSON () { var self = this return { uri: self.uri, method: self.method, headers: self.headers } } // Return a simpler response object to allow serialization function responseToJSON () { var self = this return { statusCode: self.statusCode, body: self.body, headers: self.headers, request: requestToJSON.call(self.request) } } function Request (options) { // if given the method property in options, set property explicitMethod to true // extend the Request instance with any non-reserved properties // remove any reserved functions from the options object // set Request instance to be readable and writable // call init var self = this // start with HAR, then override with additional options if (options.har) { self._har = new Har(self) options = self._har.options(options) } stream.Stream.call(self) var reserved = Object.keys(Request.prototype) var nonReserved = filterForNonReserved(reserved, options) extend(self, nonReserved) options = filterOutReservedFunctions(reserved, options) self.readable = true self.writable = true if (options.method) { self.explicitMethod = true } self._qs = new Querystring(self) self._auth = new Auth(self) self._oauth = new OAuth(self) self._multipart = new Multipart(self) self._redirect = new Redirect(self) self._tunnel = new Tunnel(self) self.init(options) } util.inherits(Request, stream.Stream) // Debugging Request.debug = process.env.NODE_DEBUG && /\brequest\b/.test(process.env.NODE_DEBUG) function debug () { if (Request.debug) { console.error('REQUEST %s', util.format.apply(util, arguments)) } } Request.prototype.debug = debug Request.prototype.init = function (options) { // init() contains all the code to setup the request object. // the actual outgoing request is not started until start() is called // this function is called from both the constructor and on redirect. var self = this if (!options) { options = {} } self.headers = self.headers ? copy(self.headers) : {} // Delete headers with value undefined since they break // ClientRequest.OutgoingMessage.setHeader in node 0.12 for (var headerName in self.headers) { if (typeof self.headers[headerName] === 'undefined') { delete self.headers[headerName] } } caseless.httpify(self, self.headers) if (!self.method) { self.method = options.method || 'GET' } if (!self.localAddress) { self.localAddress = options.localAddress } self._qs.init(options) debug(options) if (!self.pool && self.pool !== false) { self.pool = globalPool } self.dests = self.dests || [] self.__isRequestRequest = true // Protect against double callback if (!self._callback && self.callback) { self._callback = self.callback self.callback = function () { if (self._callbackCalled) { return // Print a warning maybe? } self._callbackCalled = true self._callback.apply(self, arguments) } self.on('error', self.callback.bind()) self.on('complete', self.callback.bind(self, null)) } // People use this property instead all the time, so support it if (!self.uri && self.url) { self.uri = self.url delete self.url } // If there's a baseUrl, then use it as the base URL (i.e. uri must be // specified as a relative path and is appended to baseUrl). if (self.baseUrl) { if (typeof self.baseUrl !== 'string') { return self.emit('error', new Error('options.baseUrl must be a string')) } if (typeof self.uri !== 'string') { return self.emit('error', new Error('options.uri must be a string when using options.baseUrl')) } if (self.uri.indexOf('//') === 0 || self.uri.indexOf('://') !== -1) { return self.emit('error', new Error('options.uri must be a path when using options.baseUrl')) } // Handle all cases to make sure that there's only one slash between // baseUrl and uri. var baseUrlEndsWithSlash = self.baseUrl.lastIndexOf('/') === self.baseUrl.length - 1 var uriStartsWithSlash = self.uri.indexOf('/') === 0 if (baseUrlEndsWithSlash && uriStartsWithSlash) { self.uri = self.baseUrl + self.uri.slice(1) } else if (baseUrlEndsWithSlash || uriStartsWithSlash) { self.uri = self.baseUrl + self.uri } else if (self.uri === '') { self.uri = self.baseUrl } else { self.uri = self.baseUrl + '/' + self.uri } delete self.baseUrl } // A URI is needed by this point, emit error if we haven't been able to get one if (!self.uri) { return self.emit('error', new Error('options.uri is a required argument')) } // If a string URI/URL was given, parse it into a URL object if (typeof self.uri === 'string') { self.uri = url.parse(self.uri) } // Some URL objects are not from a URL parsed string and need href added if (!self.uri.href) { self.uri.href = url.format(self.uri) } // DEPRECATED: Warning for users of the old Unix Sockets URL Scheme if (self.uri.protocol === 'unix:') { return self.emit('error', new Error('`unix://` URL scheme is no longer supported. Please use the format `http://unix:SOCKET:PATH`')) } // Support Unix Sockets if (self.uri.host === 'unix') { self.enableUnixSocket() } if (self.strictSSL === false) { self.rejectUnauthorized = false } if (!self.uri.pathname) { self.uri.pathname = '/' } if (!(self.uri.host || (self.uri.hostname && self.uri.port)) && !self.uri.isUnix) { // Invalid URI: it may generate lot of bad errors, like 'TypeError: Cannot call method `indexOf` of undefined' in CookieJar // Detect and reject it as soon as possible var faultyUri = url.format(self.uri) var message = 'Invalid URI "' + faultyUri + '"' if (Object.keys(options).length === 0) { // No option ? This can be the sign of a redirect // As this is a case where the user cannot do anything (they didn't call request directly with this URL) // they should be warned that it can be caused by a redirection (can save some hair) message += '. This can be caused by a crappy redirection.' } // This error was fatal self.abort() return self.emit('error', new Error(message)) } if (!self.hasOwnProperty('proxy')) { self.proxy = getProxyFromURI(self.uri) } self.tunnel = self._tunnel.isEnabled() if (self.proxy) { self._tunnel.setup(options) } self._redirect.onRequest(options) self.setHost = false if (!self.hasHeader('host')) { var hostHeaderName = self.originalHostHeaderName || 'host' self.setHeader(hostHeaderName, self.uri.host) // Drop :port suffix from Host header if known protocol. if (self.uri.port) { if ((self.uri.port === '80' && self.uri.protocol === 'http:') || (self.uri.port === '443' && self.uri.protocol === 'https:')) { self.setHeader(hostHeaderName, self.uri.hostname) } } self.setHost = true } self.jar(self._jar || options.jar) if (!self.uri.port) { if (self.uri.protocol === 'http:') { self.uri.port = 80 } else if (self.uri.protocol === 'https:') { self.uri.port = 443 } } if (self.proxy && !self.tunnel) { self.port = self.proxy.port self.host = self.proxy.hostname } else { self.port = self.uri.port self.host = self.uri.hostname } if (options.form) { self.form(options.form) } if (options.formData) { var formData = options.formData var requestForm = self.form() var appendFormValue = function (key, value) { if (value && value.hasOwnProperty('value') && value.hasOwnProperty('options')) { requestForm.append(key, value.value, value.options) } else { requestForm.append(key, value) } } for (var formKey in formData) { if (formData.hasOwnProperty(formKey)) { var formValue = formData[formKey] if (formValue instanceof Array) { for (var j = 0; j < formValue.length; j++) { appendFormValue(formKey, formValue[j]) } } else { appendFormValue(formKey, formValue) } } } } if (options.qs) { self.qs(options.qs) } if (self.uri.path) { self.path = self.uri.path } else { self.path = self.uri.pathname + (self.uri.search || '') } if (self.path.length === 0) { self.path = '/' } // Auth must happen last in case signing is dependent on other headers if (options.aws) { self.aws(options.aws) } if (options.hawk) { self.hawk(options.hawk) } if (options.httpSignature) { self.httpSignature(options.httpSignature) } if (options.auth) { if (Object.prototype.hasOwnProperty.call(options.auth, 'username')) { options.auth.user = options.auth.username } if (Object.prototype.hasOwnProperty.call(options.auth, 'password')) { options.auth.pass = options.auth.password } self.auth( options.auth.user, options.auth.pass, options.auth.sendImmediately, options.auth.bearer ) } if (self.gzip && !self.hasHeader('accept-encoding')) { self.setHeader('accept-encoding', 'gzip, deflate') } if (self.uri.auth && !self.hasHeader('authorization')) { var uriAuthPieces = self.uri.auth.split(':').map(function (item) { return self._qs.unescape(item) }) self.auth(uriAuthPieces[0], uriAuthPieces.slice(1).join(':'), true) } if (!self.tunnel && self.proxy && self.proxy.auth && !self.hasHeader('proxy-authorization')) { var proxyAuthPieces = self.proxy.auth.split(':').map(function (item) { return self._qs.unescape(item) }) var authHeader = 'Basic ' + toBase64(proxyAuthPieces.join(':')) self.setHeader('proxy-authorization', authHeader) } if (self.proxy && !self.tunnel) { self.path = (self.uri.protocol + '//' + self.uri.host + self.path) } if (options.json) { self.json(options.json) } if (options.multipart) { self.multipart(options.multipart) } if (options.time) { self.timing = true // NOTE: elapsedTime is deprecated in favor of .timings self.elapsedTime = self.elapsedTime || 0 } function setContentLength () { if (isTypedArray(self.body)) { self.body = Buffer.from(self.body) } if (!self.hasHeader('content-length')) { var length if (typeof self.body === 'string') { length = Buffer.byteLength(self.body) } else if (Array.isArray(self.body)) { length = self.body.reduce(function (a, b) { return a + b.length }, 0) } else { length = self.body.length } if (length) { self.setHeader('content-length', length) } else { self.emit('error', new Error('Argument error, options.body.')) } } } if (self.body && !isstream(self.body)) { setContentLength() } if (options.oauth) { self.oauth(options.oauth) } else if (self._oauth.params && self.hasHeader('authorization')) { self.oauth(self._oauth.params) } var protocol = self.proxy && !self.tunnel ? self.proxy.protocol : self.uri.protocol var defaultModules = {'http:': http, 'https:': https} var httpModules = self.httpModules || {} self.httpModule = httpModules[protocol] || defaultModules[protocol] if (!self.httpModule) { return self.emit('error', new Error('Invalid protocol: ' + protocol)) } if (options.ca) { self.ca = options.ca } if (!self.agent) { if (options.agentOptions) { self.agentOptions = options.agentOptions } if (options.agentClass) { self.agentClass = options.agentClass } else if (options.forever) { var v = version() // use ForeverAgent in node 0.10- only if (v.major === 0 && v.minor <= 10) { self.agentClass = protocol === 'http:' ? ForeverAgent : ForeverAgent.SSL } else { self.agentClass = self.httpModule.Agent self.agentOptions = self.agentOptions || {} self.agentOptions.keepAlive = true } } else { self.agentClass = self.httpModule.Agent } } if (self.pool === false) { self.agent = false } else { self.agent = self.agent || self.getNewAgent() } self.on('pipe', function (src) { if (self.ntick && self._started) { self.emit('error', new Error('You cannot pipe to this stream after the outbound request has started.')) } self.src = src if (isReadStream(src)) { if (!self.hasHeader('content-type')) { self.setHeader('content-type', mime.lookup(src.path)) } } else { if (src.headers) { for (var i in src.headers) { if (!self.hasHeader(i)) { self.setHeader(i, src.headers[i]) } } } if (self._json && !self.hasHeader('content-type')) { self.setHeader('content-type', 'application/json') } if (src.method && !self.explicitMethod) { self.method = src.method } } // self.on('pipe', function () { // console.error('You have already piped to this stream. Pipeing twice is likely to break the request.') // }) }) defer(function () { if (self._aborted) { return } var end = function () { if (self._form) { if (!self._auth.hasAuth) { self._form.pipe(self) } else if (self._auth.hasAuth && self._auth.sentAuth) { self._form.pipe(self) } } if (self._multipart && self._multipart.chunked) { self._multipart.body.pipe(self) } if (self.body) { if (isstream(self.body)) { self.body.pipe(self) } else { setContentLength() if (Array.isArray(self.body)) { self.body.forEach(function (part) { self.write(part) }) } else { self.write(self.body) } self.end() } } else if (self.requestBodyStream) { console.warn('options.requestBodyStream is deprecated, please pass the request object to stream.pipe.') self.requestBodyStream.pipe(self) } else if (!self.src) { if (self._auth.hasAuth && !self._auth.sentAuth) { self.end() return } if (self.method !== 'GET' && typeof self.method !== 'undefined') { self.setHeader('content-length', 0) } self.end() } } if (self._form && !self.hasHeader('content-length')) { // Before ending the request, we had to compute the length of the whole form, asyncly self.setHeader(self._form.getHeaders(), true) self._form.getLength(function (err, length) { if (!err && !isNaN(length)) { self.setHeader('content-length', length) } end() }) } else { end() } self.ntick = true }) } Request.prototype.getNewAgent = function () { var self = this var Agent = self.agentClass var options = {} if (self.agentOptions) { for (var i in self.agentOptions) { options[i] = self.agentOptions[i] } } if (self.ca) { options.ca = self.ca } if (self.ciphers) { options.ciphers = self.ciphers } if (self.secureProtocol) { options.secureProtocol = self.secureProtocol } if (self.secureOptions) { options.secureOptions = self.secureOptions } if (typeof self.rejectUnauthorized !== 'undefined') { options.rejectUnauthorized = self.rejectUnauthorized } if (self.cert && self.key) { options.key = self.key options.cert = self.cert } if (self.pfx) { options.pfx = self.pfx } if (self.passphrase) { options.passphrase = self.passphrase } var poolKey = '' // different types of agents are in different pools if (Agent !== self.httpModule.Agent) { poolKey += Agent.name } // ca option is only relevant if proxy or destination are https var proxy = self.proxy if (typeof proxy === 'string') { proxy = url.parse(proxy) } var isHttps = (proxy && proxy.protocol === 'https:') || this.uri.protocol === 'https:' if (isHttps) { if (options.ca) { if (poolKey) { poolKey += ':' } poolKey += options.ca } if (typeof options.rejectUnauthorized !== 'undefined') { if (poolKey) { poolKey += ':' } poolKey += options.rejectUnauthorized } if (options.cert) { if (poolKey) { poolKey += ':' } poolKey += options.cert.toString('ascii') + options.key.toString('ascii') } if (options.pfx) { if (poolKey) { poolKey += ':' } poolKey += options.pfx.toString('ascii') } if (options.ciphers) { if (poolKey) { poolKey += ':' } poolKey += options.ciphers } if (options.secureProtocol) { if (poolKey) { poolKey += ':' } poolKey += options.secureProtocol } if (options.secureOptions) { if (poolKey) { poolKey += ':' } poolKey += options.secureOptions } } if (self.pool === globalPool && !poolKey && Object.keys(options).length === 0 && self.httpModule.globalAgent) { // not doing anything special. Use the globalAgent return self.httpModule.globalAgent } // we're using a stored agent. Make sure it's protocol-specific poolKey = self.uri.protocol + poolKey // generate a new agent for this setting if none yet exists if (!self.pool[poolKey]) { self.pool[poolKey] = new Agent(options) // properly set maxSockets on new agents if (self.pool.maxSockets) { self.pool[poolKey].maxSockets = self.pool.maxSockets } } return self.pool[poolKey] } Request.prototype.start = function () { // start() is called once we are ready to send the outgoing HTTP request. // this is usually called on the first write(), end() or on nextTick() var self = this if (self.timing) { // All timings will be relative to this request's startTime. In order to do this, // we need to capture the wall-clock start time (via Date), immediately followed // by the high-resolution timer (via now()). While these two won't be set // at the _exact_ same time, they should be close enough to be able to calculate // high-resolution, monotonically non-decreasing timestamps relative to startTime. var startTime = new Date().getTime() var startTimeNow = now() } if (self._aborted) { return } self._started = true self.method = self.method || 'GET' self.href = self.uri.href if (self.src && self.src.stat && self.src.stat.size && !self.hasHeader('content-length')) { self.setHeader('content-length', self.src.stat.size) } if (self._aws) { self.aws(self._aws, true) } // We have a method named auth, which is completely different from the http.request // auth option. If we don't remove it, we're gonna have a bad time. var reqOptions = copy(self) delete reqOptions.auth debug('make request', self.uri.href) // node v6.8.0 now supports a `timeout` value in `http.request()`, but we // should delete it for now since we handle timeouts manually for better // consistency with node versions before v6.8.0 delete reqOptions.timeout try { self.req = self.httpModule.request(reqOptions) } catch (err) { self.emit('error', err) return } if (self.timing) { self.startTime = startTime self.startTimeNow = startTimeNow // Timing values will all be relative to startTime (by comparing to startTimeNow // so we have an accurate clock) self.timings = {} } var timeout if (self.timeout && !self.timeoutTimer) { if (self.timeout < 0) { timeout = 0 } else if (typeof self.timeout === 'number' && isFinite(self.timeout)) { timeout = self.timeout } } self.req.on('response', self.onRequestResponse.bind(self)) self.req.on('error', self.onRequestError.bind(self)) self.req.on('drain', function () { self.emit('drain') }) self.req.on('socket', function (socket) { // `._connecting` was the old property which was made public in node v6.1.0 var isConnecting = socket._connecting || socket.connecting if (self.timing) { self.timings.socket = now() - self.startTimeNow if (isConnecting) { var onLookupTiming = function () { self.timings.lookup = now() - self.startTimeNow } var onConnectTiming = function () { self.timings.connect = now() - self.startTimeNow } socket.once('lookup', onLookupTiming) socket.once('connect', onConnectTiming) // clean up timing event listeners if needed on error self.req.once('error', function () { socket.removeListener('lookup', onLookupTiming) socket.removeListener('connect', onConnectTiming) }) } } var setReqTimeout = function () { // This timeout sets the amount of time to wait *between* bytes sent // from the server once connected. // // In particular, it's useful for erroring if the server fails to send // data halfway through streaming a response. self.req.setTimeout(timeout, function () { if (self.req) { self.abort() var e = new Error('ESOCKETTIMEDOUT') e.code = 'ESOCKETTIMEDOUT' e.connect = false self.emit('error', e) } }) } if (timeout !== undefined) { // Only start the connection timer if we're actually connecting a new // socket, otherwise if we're already connected (because this is a // keep-alive connection) do not bother. This is important since we won't // get a 'connect' event for an already connected socket. if (isConnecting) { var onReqSockConnect = function () { socket.removeListener('connect', onReqSockConnect) self.clearTimeout() setReqTimeout() } socket.on('connect', onReqSockConnect) self.req.on('error', function (err) { // eslint-disable-line handle-callback-err socket.removeListener('connect', onReqSockConnect) }) // Set a timeout in memory - this block will throw if the server takes more // than `timeout` to write the HTTP status and headers (corresponding to // the on('response') event on the client). NB: this measures wall-clock // time, not the time between bytes sent by the server. self.timeoutTimer = setTimeout(function () { socket.removeListener('connect', onReqSockConnect) self.abort() var e = new Error('ETIMEDOUT') e.code = 'ETIMEDOUT' e.connect = true self.emit('error', e) }, timeout) } else { // We're already connected setReqTimeout() } } self.emit('socket', socket) }) self.emit('request', self.req) } Request.prototype.onRequestError = function (error) { var self = this if (self._aborted) { return } if (self.req && self.req._reusedSocket && error.code === 'ECONNRESET' && self.agent.addRequestNoreuse) { self.agent = { addRequest: self.agent.addRequestNoreuse.bind(self.agent) } self.start() self.req.end() return } self.clearTimeout() self.emit('error', error) } Request.prototype.onRequestResponse = function (response) { var self = this if (self.timing) { self.timings.response = now() - self.startTimeNow } debug('onRequestResponse', self.uri.href, response.statusCode, response.headers) response.on('end', function () { if (self.timing) { self.timings.end = now() - self.startTimeNow response.timingStart = self.startTime // fill in the blanks for any periods that didn't trigger, such as // no lookup or connect due to keep alive if (!self.timings.socket) { self.timings.socket = 0 } if (!self.timings.lookup) { self.timings.lookup = self.timings.socket } if (!self.timings.connect) { self.timings.connect = self.timings.lookup } if (!self.timings.response) { self.timings.response = self.timings.connect } debug('elapsed time', self.timings.end) // elapsedTime includes all redirects self.elapsedTime += Math.round(self.timings.end) // NOTE: elapsedTime is deprecated in favor of .timings response.elapsedTime = self.elapsedTime // timings is just for the final fetch response.timings = self.timings // pre-calculate phase timings as well response.timingPhases = { wait: self.timings.socket, dns: self.timings.lookup - self.timings.socket, tcp: self.timings.connect - self.timings.lookup, firstByte: self.timings.response - self.timings.connect, download: self.timings.end - self.timings.response, total: self.timings.end } } debug('response end', self.uri.href, response.statusCode, response.headers) }) if (self._aborted) { debug('aborted', self.uri.href) response.resume() return } self.response = response response.request = self response.toJSON = responseToJSON // XXX This is different on 0.10, because SSL is strict by default if (self.httpModule === https && self.strictSSL && (!response.hasOwnProperty('socket') || !response.socket.authorized)) { debug('strict ssl error', self.uri.href) var sslErr = response.hasOwnProperty('socket') ? response.socket.authorizationError : self.uri.href + ' does not support SSL' self.emit('error', new Error('SSL Error: ' + sslErr)) return } // Save the original host before any redirect (if it changes, we need to // remove any authorization headers). Also remember the case of the header // name because lots of broken servers expect Host instead of host and we // want the caller to be able to specify this. self.originalHost = self.getHeader('host') if (!self.originalHostHeaderName) { self.originalHostHeaderName = self.hasHeader('host') } if (self.setHost) { self.removeHeader('host') } self.clearTimeout() var targetCookieJar = (self._jar && self._jar.setCookie) ? self._jar : globalCookieJar var addCookie = function (cookie) { // set the cookie if it's domain in the href's domain. try { targetCookieJar.setCookie(cookie, self.uri.href, {ignoreError: true}) } catch (e) { self.emit('error', e) } } response.caseless = caseless(response.headers) if (response.caseless.has('set-cookie') && (!self._disableCookies)) { var headerName = response.caseless.has('set-cookie') if (Array.isArray(response.headers[headerName])) { response.headers[headerName].forEach(addCookie) } else { addCookie(response.headers[headerName]) } } if (self._redirect.onResponse(response)) { return // Ignore the rest of the response } else { // Be a good stream and emit end when the response is finished. // Hack to emit end on close because of a core bug that never fires end response.on('close', function () { if (!self._ended) { self.response.emit('end') } }) response.once('end', function () { self._ended = true }) var noBody = function (code) { return ( self.method === 'HEAD' || // Informational (code >= 100 && code < 200) || // No Content code === 204 || // Not Modified code === 304 ) } var responseContent if (self.gzip && !noBody(response.statusCode)) { var contentEncoding = response.headers['content-encoding'] || 'identity' contentEncoding = contentEncoding.trim().toLowerCase() // Be more lenient with decoding compressed responses, since (very rarely) // servers send slightly invalid gzip responses that are still accepted // by common browsers. // Always using Z_SYNC_FLUSH is what cURL does. var zlibOptions = { flush: zlib.Z_SYNC_FLUSH, finishFlush: zlib.Z_SYNC_FLUSH } if (contentEncoding === 'gzip') { responseContent = zlib.createGunzip(zlibOptions) response.pipe(responseContent) } else if (contentEncoding === 'deflate') { responseContent = zlib.createInflate(zlibOptions) response.pipe(responseContent) } else { // Since previous versions didn't check for Content-Encoding header, // ignore any invalid values to preserve backwards-compatibility if (contentEncoding !== 'identity') { debug('ignoring unrecognized Content-Encoding ' + contentEncoding) } responseContent = response } } else { responseContent = response } if (self.encoding) { if (self.dests.length !== 0) { console.error('Ignoring encoding parameter as this stream is being piped to another stream which makes the encoding option invalid.') } else { responseContent.setEncoding(self.encoding) } } if (self._paused) { responseContent.pause() } self.responseContent = responseContent self.emit('response', response) self.dests.forEach(function (dest) { self.pipeDest(dest) }) responseContent.on('data', function (chunk) { if (self.timing && !self.responseStarted) { self.responseStartTime = (new Date()).getTime() // NOTE: responseStartTime is deprecated in favor of .timings response.responseStartTime = self.responseStartTime } self._destdata = true self.emit('data', chunk) }) responseContent.once('end', function (chunk) { self.emit('end', chunk) }) responseContent.on('error', function (error) { self.emit('error', error) }) responseContent.on('close', function () { self.emit('close') }) if (self.callback) { self.readResponseBody(response) } else { // if no callback self.on('end', function () { if (self._aborted) { debug('aborted', self.uri.href) return } self.emit('complete', response) }) } } debug('finish init function', self.uri.href) } Request.prototype.readResponseBody = function (response) { var self = this debug("reading response's body") var buffers = [] var bufferLength = 0 var strings = [] self.on('data', function (chunk) { if (!Buffer.isBuffer(chunk)) { strings.push(chunk) } else if (chunk.length) { bufferLength += chunk.length buffers.push(chunk) } }) self.on('end', function () { debug('end event', self.uri.href) if (self._aborted) { debug('aborted', self.uri.href) // `buffer` is defined in the parent scope and used in a closure it exists for the life of the request. // This can lead to leaky behavior if the user retains a reference to the request object. buffers = [] bufferLength = 0 return } if (bufferLength) { debug('has body', self.uri.href, bufferLength) response.body = Buffer.concat(buffers, bufferLength) if (self.encoding !== null) { response.body = response.body.toString(self.encoding) } // `buffer` is defined in the parent scope and used in a closure it exists for the life of the Request. // This can lead to leaky behavior if the user retains a reference to the request object. buffers = [] bufferLength = 0 } else if (strings.length) { // The UTF8 BOM [0xEF,0xBB,0xBF] is converted to [0xFE,0xFF] in the JS UTC16/UCS2 representation. // Strip this value out when the encoding is set to 'utf8', as upstream consumers won't expect it and it breaks JSON.parse(). if (self.encoding === 'utf8' && strings[0].length > 0 && strings[0][0] === '\uFEFF') { strings[0] = strings[0].substring(1) } response.body = strings.join('') } if (self._json) { try { response.body = JSON.parse(response.body, self._jsonReviver) } catch (e) { debug('invalid JSON received', self.uri.href) } } debug('emitting complete', self.uri.href) if (typeof response.body === 'undefined' && !self._json) { response.body = self.encoding === null ? Buffer.alloc(0) : '' } self.emit('complete', response, response.body) }) } Request.prototype.abort = function () { var self = this self._aborted = true if (self.req) { self.req.abort() } else if (self.response) { self.response.destroy() } self.clearTimeout() self.emit('abort') } Request.prototype.pipeDest = function (dest) { var self = this var response = self.response // Called after the response is received if (dest.headers && !dest.headersSent) { if (response.caseless.has('content-type')) { var ctname = response.caseless.has('content-type') if (dest.setHeader) { dest.setHeader(ctname, response.headers[ctname]) } else { dest.headers[ctname] = response.headers[ctname] } } if (response.caseless.has('content-length')) { var clname = response.caseless.has('content-length') if (dest.setHeader) { dest.setHeader(clname, response.headers[clname]) } else { dest.headers[clname] = response.headers[clname] } } } if (dest.setHeader && !dest.headersSent) { for (var i in response.headers) { // If the response content is being decoded, the Content-Encoding header // of the response doesn't represent the piped content, so don't pass it. if (!self.gzip || i !== 'content-encoding') { dest.setHeader(i, response.headers[i]) } } dest.statusCode = response.statusCode } if (self.pipefilter) { self.pipefilter(response, dest) } } Request.prototype.qs = function (q, clobber) { var self = this var base if (!clobber && self.uri.query) { base = self._qs.parse(self.uri.query) } else { base = {} } for (var i in q) { base[i] = q[i] } var qs = self._qs.stringify(base) if (qs === '') { return self } self.uri = url.parse(self.uri.href.split('?')[0] + '?' + qs) self.url = self.uri self.path = self.uri.path if (self.uri.host === 'unix') { self.enableUnixSocket() } return self } Request.prototype.form = function (form) { var self = this if (form) { if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { self.setHeader('content-type', 'application/x-www-form-urlencoded') } self.body = (typeof form === 'string') ? self._qs.rfc3986(form.toString('utf8')) : self._qs.stringify(form).toString('utf8') return self } // create form-data object self._form = new FormData() self._form.on('error', function (err) { err.message = 'form-data: ' + err.message self.emit('error', err) self.abort() }) return self._form } Request.prototype.multipart = function (multipart) { var self = this self._multipart.onRequest(multipart) if (!self._multipart.chunked) { self.body = self._multipart.body } return self } Request.prototype.json = function (val) { var self = this if (!self.hasHeader('accept')) { self.setHeader('accept', 'application/json') } if (typeof self.jsonReplacer === 'function') { self._jsonReplacer = self.jsonReplacer } self._json = true if (typeof val === 'boolean') { if (self.body !== undefined) { if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { self.body = safeStringify(self.body, self._jsonReplacer) } else { self.body = self._qs.rfc3986(self.body) } if (!self.hasHeader('content-type')) { self.setHeader('content-type', 'application/json') } } } else { self.body = safeStringify(val, self._jsonReplacer) if (!self.hasHeader('content-type')) { self.setHeader('content-type', 'application/json') } } if (typeof self.jsonReviver === 'function') { self._jsonReviver = self.jsonReviver } return self } Request.prototype.getHeader = function (name, headers) { var self = this var result, re, match if (!headers) { headers = self.headers } Object.keys(headers).forEach(function (key) { if (key.length !== name.length) { return } re = new RegExp(name, 'i') match = key.match(re) if (match) { result = headers[key] } }) return result } Request.prototype.enableUnixSocket = function () { // Get the socket & request paths from the URL var unixParts = this.uri.path.split(':') var host = unixParts[0] var path = unixParts[1] // Apply unix properties to request this.socketPath = host this.uri.pathname = path this.uri.path = path this.uri.host = host this.uri.hostname = host this.uri.isUnix = true } Request.prototype.auth = function (user, pass, sendImmediately, bearer) { var self = this self._auth.onRequest(user, pass, sendImmediately, bearer) return self } Request.prototype.aws = function (opts, now) { var self = this if (!now) { self._aws = opts return self } if (opts.sign_version === 4 || opts.sign_version === '4') { // use aws4 var options = { host: self.uri.host, path: self.uri.path, method: self.method, headers: self.headers, body: self.body } if (opts.service) { options.service = opts.service } var signRes = aws4.sign(options, { accessKeyId: opts.key, secretAccessKey: opts.secret, sessionToken: opts.session }) self.setHeader('authorization', signRes.headers.Authorization) self.setHeader('x-amz-date', signRes.headers['X-Amz-Date']) if (signRes.headers['X-Amz-Security-Token']) { self.setHeader('x-amz-security-token', signRes.headers['X-Amz-Security-Token']) } } else { // default: use aws-sign2 var date = new Date() self.setHeader('date', date.toUTCString()) var auth = { key: opts.key, secret: opts.secret, verb: self.method.toUpperCase(), date: date, contentType: self.getHeader('content-type') || '', md5: self.getHeader('content-md5') || '', amazonHeaders: aws2.canonicalizeHeaders(self.headers) } var path = self.uri.path if (opts.bucket && path) { auth.resource = '/' + opts.bucket + path } else if (opts.bucket && !path) { auth.resource = '/' + opts.bucket } else if (!opts.bucket && path) { auth.resource = path } else if (!opts.bucket && !path) { auth.resource = '/' } auth.resource = aws2.canonicalizeResource(auth.resource) self.setHeader('authorization', aws2.authorization(auth)) } return self } Request.prototype.httpSignature = function (opts) { var self = this httpSignature.signRequest({ getHeader: function (header) { return self.getHeader(header, self.headers) }, setHeader: function (header, value) { self.setHeader(header, value) }, method: self.method, path: self.path }, opts) debug('httpSignature authorization', self.getHeader('authorization')) return self } Request.prototype.hawk = function (opts) { var self = this self.setHeader('Authorization', hawk.header(self.uri, self.method, opts)) } Request.prototype.oauth = function (_oauth) { var self = this self._oauth.onRequest(_oauth) return self } Request.prototype.jar = function (jar) { var self = this var cookies if (self._redirect.redirectsFollowed === 0) { self.originalCookieHeader = self.getHeader('cookie') } if (!jar) { // disable cookies cookies = false self._disableCookies = true } else { var targetCookieJar = jar.getCookieString ? jar : globalCookieJar var urihref = self.uri.href // fetch cookie in the Specified host if (targetCookieJar) { cookies = targetCookieJar.getCookieString(urihref) } } // if need cookie and cookie is not empty if (cookies && cookies.length) { if (self.originalCookieHeader) { // Don't overwrite existing Cookie header self.setHeader('cookie', self.originalCookieHeader + '; ' + cookies) } else { self.setHeader('cookie', cookies) } } self._jar = jar return self } // Stream API Request.prototype.pipe = function (dest, opts) { var self = this if (self.response) { if (self._destdata) { self.emit('error', new Error('You cannot pipe after data has been emitted from the response.')) } else if (self._ended) { self.emit('error', new Error('You cannot pipe after the response has been ended.')) } else { stream.Stream.prototype.pipe.call(self, dest, opts) self.pipeDest(dest) return dest } } else { self.dests.push(dest) stream.Stream.prototype.pipe.call(self, dest, opts) return dest } } Request.prototype.write = function () { var self = this if (self._aborted) { return } if (!self._started) { self.start() } if (self.req) { return self.req.write.apply(self.req, arguments) } } Request.prototype.end = function (chunk) { var self = this if (self._aborted) { return } if (chunk) { self.write(chunk) } if (!self._started) { self.start() } if (self.req) { self.req.end() } } Request.prototype.pause = function () { var self = this if (!self.responseContent) { self._paused = true } else { self.responseContent.pause.apply(self.responseContent, arguments) } } Request.prototype.resume = function () { var self = this if (!self.responseContent) { self._paused = false } else { self.responseContent.resume.apply(self.responseContent, arguments) } } Request.prototype.destroy = function () { var self = this this.clearTimeout() if (!self._ended) { self.end() } else if (self.response) { self.response.destroy() } } Request.prototype.clearTimeout = function () { if (this.timeoutTimer) { clearTimeout(this.timeoutTimer) this.timeoutTimer = null } } Request.defaultProxyHeaderWhiteList = Tunnel.defaultProxyHeaderWhiteList.slice() Request.defaultProxyHeaderExclusiveList = Tunnel.defaultProxyHeaderExclusiveList.slice() // Exports Request.prototype.toJSON = requestToJSON module.exports = Request /***/ }), /* 456 */ /***/ (function(module) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { return function flow(Promise) { var resolve = Promise.resolve; var reject = Promise.reject; var origCatch = Promise.prototype['catch']; /** * Handle the ultimate fulfillment value or rejection reason, and assume * responsibility for all errors. If an error propagates out of result * or handleFatalError, it will be rethrown to the host, resulting in a * loud stack track on most platforms and a crash on some. * @param {function?} onResult * @param {function?} onError * @returns {undefined} */ Promise.prototype.done = function(onResult, onError) { this._handler.visit(this._handler.receiver, onResult, onError); }; /** * Add Error-type and predicate matching to catch. Examples: * promise.catch(TypeError, handleTypeError) * .catch(predicate, handleMatchedErrors) * .catch(handleRemainingErrors) * @param onRejected * @returns {*} */ Promise.prototype['catch'] = Promise.prototype.otherwise = function(onRejected) { if (arguments.length < 2) { return origCatch.call(this, onRejected); } if(typeof onRejected !== 'function') { return this.ensure(rejectInvalidPredicate); } return origCatch.call(this, createCatchFilter(arguments[1], onRejected)); }; /** * Wraps the provided catch handler, so that it will only be called * if the predicate evaluates truthy * @param {?function} handler * @param {function} predicate * @returns {function} conditional catch handler */ function createCatchFilter(handler, predicate) { return function(e) { return evaluatePredicate(e, predicate) ? handler.call(this, e) : reject(e); }; } /** * Ensures that onFulfilledOrRejected will be called regardless of whether * this promise is fulfilled or rejected. onFulfilledOrRejected WILL NOT * receive the promises' value or reason. Any returned value will be disregarded. * onFulfilledOrRejected may throw or return a rejected promise to signal * an additional error. * @param {function} handler handler to be called regardless of * fulfillment or rejection * @returns {Promise} */ Promise.prototype['finally'] = Promise.prototype.ensure = function(handler) { if(typeof handler !== 'function') { return this; } return this.then(function(x) { return runSideEffect(handler, this, identity, x); }, function(e) { return runSideEffect(handler, this, reject, e); }); }; function runSideEffect (handler, thisArg, propagate, value) { var result = handler.call(thisArg); return maybeThenable(result) ? propagateValue(result, propagate, value) : propagate(value); } function propagateValue (result, propagate, x) { return resolve(result).then(function () { return propagate(x); }); } /** * Recover from a failure by returning a defaultValue. If defaultValue * is a promise, it's fulfillment value will be used. If defaultValue is * a promise that rejects, the returned promise will reject with the * same reason. * @param {*} defaultValue * @returns {Promise} new promise */ Promise.prototype['else'] = Promise.prototype.orElse = function(defaultValue) { return this.then(void 0, function() { return defaultValue; }); }; /** * Shortcut for .then(function() { return value; }) * @param {*} value * @return {Promise} a promise that: * - is fulfilled if value is not a promise, or * - if value is a promise, will fulfill with its value, or reject * with its reason. */ Promise.prototype['yield'] = function(value) { return this.then(function() { return value; }); }; /** * Runs a side effect when this promise fulfills, without changing the * fulfillment value. * @param {function} onFulfilledSideEffect * @returns {Promise} */ Promise.prototype.tap = function(onFulfilledSideEffect) { return this.then(onFulfilledSideEffect)['yield'](this); }; return Promise; }; function rejectInvalidPredicate() { throw new TypeError('catch predicate must be a function'); } function evaluatePredicate(e, predicate) { return isError(predicate) ? e instanceof predicate : predicate(e); } function isError(predicate) { return predicate === Error || (predicate != null && predicate.prototype instanceof Error); } function maybeThenable(x) { return (typeof x === 'object' || typeof x === 'function') && x !== null; } function identity(x) { return x; } }); }(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); /***/ }), /* 457 */, /* 458 */, /* 459 */, /* 460 */, /* 461 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var url = __webpack_require__(835) var tunnel = __webpack_require__(243) var defaultProxyHeaderWhiteList = [ 'accept', 'accept-charset', 'accept-encoding', 'accept-language', 'accept-ranges', 'cache-control', 'content-encoding', 'content-language', 'content-location', 'content-md5', 'content-range', 'content-type', 'connection', 'date', 'expect', 'max-forwards', 'pragma', 'referer', 'te', 'user-agent', 'via' ] var defaultProxyHeaderExclusiveList = [ 'proxy-authorization' ] function constructProxyHost (uriObject) { var port = uriObject.port var protocol = uriObject.protocol var proxyHost = uriObject.hostname + ':' if (port) { proxyHost += port } else if (protocol === 'https:') { proxyHost += '443' } else { proxyHost += '80' } return proxyHost } function constructProxyHeaderWhiteList (headers, proxyHeaderWhiteList) { var whiteList = proxyHeaderWhiteList .reduce(function (set, header) { set[header.toLowerCase()] = true return set }, {}) return Object.keys(headers) .filter(function (header) { return whiteList[header.toLowerCase()] }) .reduce(function (set, header) { set[header] = headers[header] return set }, {}) } function constructTunnelOptions (request, proxyHeaders) { var proxy = request.proxy var tunnelOptions = { proxy: { host: proxy.hostname, port: +proxy.port, proxyAuth: proxy.auth, headers: proxyHeaders }, headers: request.headers, ca: request.ca, cert: request.cert, key: request.key, passphrase: request.passphrase, pfx: request.pfx, ciphers: request.ciphers, rejectUnauthorized: request.rejectUnauthorized, secureOptions: request.secureOptions, secureProtocol: request.secureProtocol } return tunnelOptions } function constructTunnelFnName (uri, proxy) { var uriProtocol = (uri.protocol === 'https:' ? 'https' : 'http') var proxyProtocol = (proxy.protocol === 'https:' ? 'Https' : 'Http') return [uriProtocol, proxyProtocol].join('Over') } function getTunnelFn (request) { var uri = request.uri var proxy = request.proxy var tunnelFnName = constructTunnelFnName(uri, proxy) return tunnel[tunnelFnName] } function Tunnel (request) { this.request = request this.proxyHeaderWhiteList = defaultProxyHeaderWhiteList this.proxyHeaderExclusiveList = [] if (typeof request.tunnel !== 'undefined') { this.tunnelOverride = request.tunnel } } Tunnel.prototype.isEnabled = function () { var self = this var request = self.request // Tunnel HTTPS by default. Allow the user to override this setting. // If self.tunnelOverride is set (the user specified a value), use it. if (typeof self.tunnelOverride !== 'undefined') { return self.tunnelOverride } // If the destination is HTTPS, tunnel. if (request.uri.protocol === 'https:') { return true } // Otherwise, do not use tunnel. return false } Tunnel.prototype.setup = function (options) { var self = this var request = self.request options = options || {} if (typeof request.proxy === 'string') { request.proxy = url.parse(request.proxy) } if (!request.proxy || !request.tunnel) { return false } // Setup Proxy Header Exclusive List and White List if (options.proxyHeaderWhiteList) { self.proxyHeaderWhiteList = options.proxyHeaderWhiteList } if (options.proxyHeaderExclusiveList) { self.proxyHeaderExclusiveList = options.proxyHeaderExclusiveList } var proxyHeaderExclusiveList = self.proxyHeaderExclusiveList.concat(defaultProxyHeaderExclusiveList) var proxyHeaderWhiteList = self.proxyHeaderWhiteList.concat(proxyHeaderExclusiveList) // Setup Proxy Headers and Proxy Headers Host // Only send the Proxy White Listed Header names var proxyHeaders = constructProxyHeaderWhiteList(request.headers, proxyHeaderWhiteList) proxyHeaders.host = constructProxyHost(request.uri) proxyHeaderExclusiveList.forEach(request.removeHeader, request) // Set Agent from Tunnel Data var tunnelFn = getTunnelFn(request) var tunnelOptions = constructTunnelOptions(request, proxyHeaders) request.agent = tunnelFn(tunnelOptions) return true } Tunnel.defaultProxyHeaderWhiteList = defaultProxyHeaderWhiteList Tunnel.defaultProxyHeaderExclusiveList = defaultProxyHeaderExclusiveList exports.Tunnel = Tunnel /***/ }), /* 462 */, /* 463 */, /* 464 */, /* 465 */ /***/ (function(module, __unusedexports, __webpack_require__) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { var env = __webpack_require__(709); var TimeoutError = __webpack_require__(280); function setTimeout(f, ms, x, y) { return env.setTimer(function() { f(x, y, ms); }, ms); } return function timed(Promise) { /** * Return a new promise whose fulfillment value is revealed only * after ms milliseconds * @param {number} ms milliseconds * @returns {Promise} */ Promise.prototype.delay = function(ms) { var p = this._beget(); this._handler.fold(handleDelay, ms, void 0, p._handler); return p; }; function handleDelay(ms, x, h) { setTimeout(resolveDelay, ms, x, h); } function resolveDelay(x, h) { h.resolve(x); } /** * Return a new promise that rejects after ms milliseconds unless * this promise fulfills earlier, in which case the returned promise * fulfills with the same value. * @param {number} ms milliseconds * @param {Error|*=} reason optional rejection reason to use, defaults * to a TimeoutError if not provided * @returns {Promise} */ Promise.prototype.timeout = function(ms, reason) { var p = this._beget(); var h = p._handler; var t = setTimeout(onTimeout, ms, reason, p._handler); this._handler.visit(h, function onFulfill(x) { env.clearTimer(t); this.resolve(x); // this = h }, function onReject(x) { env.clearTimer(t); this.reject(x); // this = h }, h.notify); return p; }; function onTimeout(reason, h, ms) { var e = typeof reason === 'undefined' ? new TimeoutError('timed out after ' + ms + 'ms') : reason; h.reject(e); } return Promise; }; }); }(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(require); })); /***/ }), /* 466 */, /* 467 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*! * Copyright (c) 2015, Salesforce.com, Inc. * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ var pubsuffix = __webpack_require__(847); // Gives the permutation of all possible domainMatch()es of a given domain. The // array is in shortest-to-longest order. Handy for indexing. function permuteDomain (domain) { var pubSuf = pubsuffix.getPublicSuffix(domain); if (!pubSuf) { return null; } if (pubSuf == domain) { return [domain]; } var prefix = domain.slice(0, -(pubSuf.length + 1)); // ".example.com" var parts = prefix.split('.').reverse(); var cur = pubSuf; var permutations = [cur]; while (parts.length) { cur = parts.shift() + '.' + cur; permutations.push(cur); } return permutations; } exports.permuteDomain = permuteDomain; /***/ }), /* 468 */, /* 469 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var uuid = __webpack_require__(826) var CombinedStream = __webpack_require__(547) var isstream = __webpack_require__(382) var Buffer = __webpack_require__(149).Buffer function Multipart (request) { this.request = request this.boundary = uuid() this.chunked = false this.body = null } Multipart.prototype.isChunked = function (options) { var self = this var chunked = false var parts = options.data || options if (!parts.forEach) { self.request.emit('error', new Error('Argument error, options.multipart.')) } if (options.chunked !== undefined) { chunked = options.chunked } if (self.request.getHeader('transfer-encoding') === 'chunked') { chunked = true } if (!chunked) { parts.forEach(function (part) { if (typeof part.body === 'undefined') { self.request.emit('error', new Error('Body attribute missing in multipart.')) } if (isstream(part.body)) { chunked = true } }) } return chunked } Multipart.prototype.setHeaders = function (chunked) { var self = this if (chunked && !self.request.hasHeader('transfer-encoding')) { self.request.setHeader('transfer-encoding', 'chunked') } var header = self.request.getHeader('content-type') if (!header || header.indexOf('multipart') === -1) { self.request.setHeader('content-type', 'multipart/related; boundary=' + self.boundary) } else { if (header.indexOf('boundary') !== -1) { self.boundary = header.replace(/.*boundary=([^\s;]+).*/, '$1') } else { self.request.setHeader('content-type', header + '; boundary=' + self.boundary) } } } Multipart.prototype.build = function (parts, chunked) { var self = this var body = chunked ? new CombinedStream() : [] function add (part) { if (typeof part === 'number') { part = part.toString() } return chunked ? body.append(part) : body.push(Buffer.from(part)) } if (self.request.preambleCRLF) { add('\r\n') } parts.forEach(function (part) { var preamble = '--' + self.boundary + '\r\n' Object.keys(part).forEach(function (key) { if (key === 'body') { return } preamble += key + ': ' + part[key] + '\r\n' }) preamble += '\r\n' add(preamble) add(part.body) add('\r\n') }) add('--' + self.boundary + '--') if (self.request.postambleCRLF) { add('\r\n') } return body } Multipart.prototype.onRequest = function (options) { var self = this var chunked = self.isChunked(options) var parts = options.data || options self.setHeaders(chunked) self.chunked = chunked self.body = self.build(parts, chunked) } exports.Multipart = Multipart /***/ }), /* 470 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; result["default"] = mod; return result; }; Object.defineProperty(exports, "__esModule", { value: true }); const command_1 = __webpack_require__(431); const file_command_1 = __webpack_require__(102); const utils_1 = __webpack_require__(82); const os = __importStar(__webpack_require__(87)); const path = __importStar(__webpack_require__(622)); /** * The code to exit an action */ var ExitCode; (function (ExitCode) { /** * A code indicating that the action was successful */ ExitCode[ExitCode["Success"] = 0] = "Success"; /** * A code indicating that the action was a failure */ ExitCode[ExitCode["Failure"] = 1] = "Failure"; })(ExitCode = exports.ExitCode || (exports.ExitCode = {})); //----------------------------------------------------------------------- // Variables //----------------------------------------------------------------------- /** * Sets env variable for this action and future actions in the job * @param name the name of the variable to set * @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify */ // eslint-disable-next-line @typescript-eslint/no-explicit-any function exportVariable(name, val) { const convertedVal = utils_1.toCommandValue(val); process.env[name] = convertedVal; const filePath = process.env['GITHUB_ENV'] || ''; if (filePath) { const delimiter = '_GitHubActionsFileCommandDelimeter_'; const commandValue = `${name}<<${delimiter}${os.EOL}${convertedVal}${os.EOL}${delimiter}`; file_command_1.issueCommand('ENV', commandValue); } else { command_1.issueCommand('set-env', { name }, convertedVal); } } exports.exportVariable = exportVariable; /** * Registers a secret which will get masked from logs * @param secret value of the secret */ function setSecret(secret) { command_1.issueCommand('add-mask', {}, secret); } exports.setSecret = setSecret; /** * Prepends inputPath to the PATH (for this action and future actions) * @param inputPath */ function addPath(inputPath) { const filePath = process.env['GITHUB_PATH'] || ''; if (filePath) { file_command_1.issueCommand('PATH', inputPath); } else { command_1.issueCommand('add-path', {}, inputPath); } process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; } exports.addPath = addPath; /** * Gets the value of an input. The value is also trimmed. * * @param name name of the input to get * @param options optional. See InputOptions. * @returns string */ function getInput(name, options) { const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; if (options && options.required && !val) { throw new Error(`Input required and not supplied: ${name}`); } return val.trim(); } exports.getInput = getInput; /** * Sets the value of an output. * * @param name name of the output to set * @param value value to store. Non-string values will be converted to a string via JSON.stringify */ // eslint-disable-next-line @typescript-eslint/no-explicit-any function setOutput(name, value) { command_1.issueCommand('set-output', { name }, value); } exports.setOutput = setOutput; /** * Enables or disables the echoing of commands into stdout for the rest of the step. * Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set. * */ function setCommandEcho(enabled) { command_1.issue('echo', enabled ? 'on' : 'off'); } exports.setCommandEcho = setCommandEcho; //----------------------------------------------------------------------- // Results //----------------------------------------------------------------------- /** * Sets the action status to failed. * When the action exits it will be with an exit code of 1 * @param message add error issue message */ function setFailed(message) { process.exitCode = ExitCode.Failure; error(message); } exports.setFailed = setFailed; //----------------------------------------------------------------------- // Logging Commands //----------------------------------------------------------------------- /** * Gets whether Actions Step Debug is on or not */ function isDebug() { return process.env['RUNNER_DEBUG'] === '1'; } exports.isDebug = isDebug; /** * Writes debug message to user log * @param message debug message */ function debug(message) { command_1.issueCommand('debug', {}, message); } exports.debug = debug; /** * Adds an error issue * @param message error issue message. Errors will be converted to string via toString() */ function error(message) { command_1.issue('error', message instanceof Error ? message.toString() : message); } exports.error = error; /** * Adds an warning issue * @param message warning issue message. Errors will be converted to string via toString() */ function warning(message) { command_1.issue('warning', message instanceof Error ? message.toString() : message); } exports.warning = warning; /** * Writes info to log with console.log. * @param message info message */ function info(message) { process.stdout.write(message + os.EOL); } exports.info = info; /** * Begin an output group. * * Output until the next `groupEnd` will be foldable in this group * * @param name The name of the output group */ function startGroup(name) { command_1.issue('group', name); } exports.startGroup = startGroup; /** * End an output group. */ function endGroup() { command_1.issue('endgroup'); } exports.endGroup = endGroup; /** * Wrap an asynchronous function call in a group. * * Returns the same type as the function itself. * * @param name The name of the group * @param fn The function to wrap in the group */ function group(name, fn) { return __awaiter(this, void 0, void 0, function* () { startGroup(name); let result; try { result = yield fn(); } finally { endGroup(); } return result; }); } exports.group = group; //----------------------------------------------------------------------- // Wrapper action state //----------------------------------------------------------------------- /** * Saves state for current action, the state can only be retrieved by this action's post job execution. * * @param name name of the state to store * @param value value to store. Non-string values will be converted to a string via JSON.stringify */ // eslint-disable-next-line @typescript-eslint/no-explicit-any function saveState(name, value) { command_1.issueCommand('save-state', { name }, value); } exports.saveState = saveState; /** * Gets the value of an state set by this action's main execution. * * @param name name of the state to get * @returns string */ function getState(name) { return process.env[`STATE_${name}`] || ''; } exports.getState = getState; //# sourceMappingURL=core.js.map /***/ }), /* 471 */, /* 472 */, /* 473 */, /* 474 */, /* 475 */, /* 476 */, /* 477 */ /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright (c) 2012, Mark Cavage. All rights reserved. // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(357); var Stream = __webpack_require__(413).Stream; var util = __webpack_require__(669); ///--- Globals /* JSSTYLED */ var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; ///--- Internal function _capitalize(str) { return (str.charAt(0).toUpperCase() + str.slice(1)); } function _toss(name, expected, oper, arg, actual) { throw new assert.AssertionError({ message: util.format('%s (%s) is required', name, expected), actual: (actual === undefined) ? typeof (arg) : actual(arg), expected: expected, operator: oper || '===', stackStartFunction: _toss.caller }); } function _getClass(arg) { return (Object.prototype.toString.call(arg).slice(8, -1)); } function noop() { // Why even bother with asserts? } ///--- Exports var types = { bool: { check: function (arg) { return typeof (arg) === 'boolean'; } }, func: { check: function (arg) { return typeof (arg) === 'function'; } }, string: { check: function (arg) { return typeof (arg) === 'string'; } }, object: { check: function (arg) { return typeof (arg) === 'object' && arg !== null; } }, number: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg); } }, finite: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); } }, buffer: { check: function (arg) { return Buffer.isBuffer(arg); }, operator: 'Buffer.isBuffer' }, array: { check: function (arg) { return Array.isArray(arg); }, operator: 'Array.isArray' }, stream: { check: function (arg) { return arg instanceof Stream; }, operator: 'instanceof', actual: _getClass }, date: { check: function (arg) { return arg instanceof Date; }, operator: 'instanceof', actual: _getClass }, regexp: { check: function (arg) { return arg instanceof RegExp; }, operator: 'instanceof', actual: _getClass }, uuid: { check: function (arg) { return typeof (arg) === 'string' && UUID_REGEXP.test(arg); }, operator: 'isUUID' } }; function _setExports(ndebug) { var keys = Object.keys(types); var out; /* re-export standard assert */ if (process.env.NODE_NDEBUG) { out = noop; } else { out = function (arg, msg) { if (!arg) { _toss(msg, 'true', arg); } }; } /* standard checks */ keys.forEach(function (k) { if (ndebug) { out[k] = noop; return; } var type = types[k]; out[k] = function (arg, msg) { if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* optional checks */ keys.forEach(function (k) { var name = 'optional' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* arrayOf checks */ keys.forEach(function (k) { var name = 'arrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* optionalArrayOf checks */ keys.forEach(function (k) { var name = 'optionalArrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* re-export built-in assertions */ Object.keys(assert).forEach(function (k) { if (k === 'AssertionError') { out[k] = assert[k]; return; } if (ndebug) { out[k] = noop; return; } out[k] = assert[k]; }); /* export ourselves (for unit tests _only_) */ out._setExports = _setExports; return out; } module.exports = _setExports(process.env.NODE_NDEBUG); /***/ }), /* 478 */, /* 479 */ /***/ (function(module) { "use strict"; module.exports = function generate_if(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); $it.level++; var $nextValid = 'valid' + $it.level; var $thenSch = it.schema['then'], $elseSch = it.schema['else'], $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? typeof $thenSch == 'object' && Object.keys($thenSch).length > 0 : it.util.schemaHasRules($thenSch, it.RULES.all)), $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? typeof $elseSch == 'object' && Object.keys($elseSch).length > 0 : it.util.schemaHasRules($elseSch, it.RULES.all)), $currentBaseId = $it.baseId; if ($thenPresent || $elsePresent) { var $ifClause; $it.createErrors = false; $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; $it.createErrors = true; out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; it.compositeRule = $it.compositeRule = $wasComposite; if ($thenPresent) { out += ' if (' + ($nextValid) + ') { '; $it.schema = it.schema['then']; $it.schemaPath = it.schemaPath + '.then'; $it.errSchemaPath = it.errSchemaPath + '/then'; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; if ($thenPresent && $elsePresent) { $ifClause = 'ifClause' + $lvl; out += ' var ' + ($ifClause) + ' = \'then\'; '; } else { $ifClause = '\'then\''; } out += ' } '; if ($elsePresent) { out += ' else { '; } } else { out += ' if (!' + ($nextValid) + ') { '; } if ($elsePresent) { $it.schema = it.schema['else']; $it.schemaPath = it.schemaPath + '.else'; $it.errSchemaPath = it.errSchemaPath + '/else'; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; if ($thenPresent && $elsePresent) { $ifClause = 'ifClause' + $lvl; out += ' var ' + ($ifClause) + ' = \'else\'; '; } else { $ifClause = '\'else\''; } out += ' } '; } out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError(vErrors); '; } else { out += ' validate.errors = vErrors; return false; '; } } out += ' } '; if ($breakOnError) { out += ' else { '; } out = it.util.cleanUpCode(out); } else { if ($breakOnError) { out += ' if (true) { '; } } return out; } /***/ }), /* 480 */, /* 481 */, /* 482 */, /* 483 */ /***/ (function(module) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { // Credit to Twisol (https://github.com/Twisol) for suggesting // this type of extensible queue + trampoline approach for next-tick conflation. /** * Async task scheduler * @param {function} async function to schedule a single async function * @constructor */ function Scheduler(async) { this._async = async; this._running = false; this._queue = this; this._queueLen = 0; this._afterQueue = {}; this._afterQueueLen = 0; var self = this; this.drain = function() { self._drain(); }; } /** * Enqueue a task * @param {{ run:function }} task */ Scheduler.prototype.enqueue = function(task) { this._queue[this._queueLen++] = task; this.run(); }; /** * Enqueue a task to run after the main task queue * @param {{ run:function }} task */ Scheduler.prototype.afterQueue = function(task) { this._afterQueue[this._afterQueueLen++] = task; this.run(); }; Scheduler.prototype.run = function() { if (!this._running) { this._running = true; this._async(this.drain); } }; /** * Drain the handler queue entirely, and then the after queue */ Scheduler.prototype._drain = function() { var i = 0; for (; i < this._queueLen; ++i) { this._queue[i].run(); this._queue[i] = void 0; } this._queueLen = 0; this._running = false; for (i = 0; i < this._afterQueueLen; ++i) { this._afterQueue[i].run(); this._afterQueue[i] = void 0; } this._afterQueueLen = 0; }; return Scheduler; }); }(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); /***/ }), /* 484 */, /* 485 */, /* 486 */, /* 487 */, /* 488 */, /* 489 */, /* 490 */, /* 491 */, /* 492 */, /* 493 */ /***/ (function(module, __unusedexports, __webpack_require__) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** * Promises/A+ and when() implementation * when is part of the cujoJS family of libraries (http://cujojs.com/) * @author Brian Cavalier * @author John Hann */ (function(define) { 'use strict'; define(function () { var timed = __webpack_require__(465); var array = __webpack_require__(993); var flow = __webpack_require__(456); var fold = __webpack_require__(779); var inspect = __webpack_require__(515); var generate = __webpack_require__(748); var progress = __webpack_require__(548); var withThis = __webpack_require__(713); var unhandledRejection = __webpack_require__(721); var TimeoutError = __webpack_require__(280); var Promise = [array, flow, fold, generate, progress, inspect, withThis, timed, unhandledRejection] .reduce(function(Promise, feature) { return feature(Promise); }, __webpack_require__(254)); var apply = __webpack_require__(572)(Promise); // Public API when.promise = promise; // Create a pending promise when.resolve = Promise.resolve; // Create a resolved promise when.reject = Promise.reject; // Create a rejected promise when.lift = lift; // lift a function to return promises when['try'] = attempt; // call a function and return a promise when.attempt = attempt; // alias for when.try when.iterate = Promise.iterate; // DEPRECATED (use cujojs/most streams) Generate a stream of promises when.unfold = Promise.unfold; // DEPRECATED (use cujojs/most streams) Generate a stream of promises when.join = join; // Join 2 or more promises when.all = all; // Resolve a list of promises when.settle = settle; // Settle a list of promises when.any = lift(Promise.any); // One-winner race when.some = lift(Promise.some); // Multi-winner race when.race = lift(Promise.race); // First-to-settle race when.map = map; // Array.map() for promises when.filter = filter; // Array.filter() for promises when.reduce = lift(Promise.reduce); // Array.reduce() for promises when.reduceRight = lift(Promise.reduceRight); // Array.reduceRight() for promises when.isPromiseLike = isPromiseLike; // Is something promise-like, aka thenable when.Promise = Promise; // Promise constructor when.defer = defer; // Create a {promise, resolve, reject} tuple // Error types when.TimeoutError = TimeoutError; /** * Get a trusted promise for x, or by transforming x with onFulfilled * * @param {*} x * @param {function?} onFulfilled callback to be called when x is * successfully fulfilled. If promiseOrValue is an immediate value, callback * will be invoked immediately. * @param {function?} onRejected callback to be called when x is * rejected. * @param {function?} onProgress callback to be called when progress updates * are issued for x. @deprecated * @returns {Promise} a new promise that will fulfill with the return * value of callback or errback or the completion value of promiseOrValue if * callback and/or errback is not supplied. */ function when(x, onFulfilled, onRejected, onProgress) { var p = Promise.resolve(x); if (arguments.length < 2) { return p; } return p.then(onFulfilled, onRejected, onProgress); } /** * Creates a new promise whose fate is determined by resolver. * @param {function} resolver function(resolve, reject, notify) * @returns {Promise} promise whose fate is determine by resolver */ function promise(resolver) { return new Promise(resolver); } /** * Lift the supplied function, creating a version of f that returns * promises, and accepts promises as arguments. * @param {function} f * @returns {Function} version of f that returns promises */ function lift(f) { return function() { for(var i=0, l=arguments.length, a=new Array(l); i} errors optional array of validation errors, if not passed errors from the instance are used. * @param {Object} options optional options with properties `separator` and `dataVar`. * @return {String} human readable string with all errors descriptions */ function errorsText(errors, options) { errors = errors || this.errors; if (!errors) return 'No errors'; options = options || {}; var separator = options.separator === undefined ? ', ' : options.separator; var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; var text = ''; for (var i=0; i= 1, 'key must have at least one part'); assert.ok(partial || sshbuf.atEnd(), 'leftover bytes at end of key'); var Constructor = Key; var algInfo = algs.info[key.type]; if (type === 'private' || algInfo.parts.length !== parts.length) { algInfo = algs.privInfo[key.type]; Constructor = PrivateKey; } assert.strictEqual(algInfo.parts.length, parts.length); if (key.type === 'ecdsa') { var res = /^ecdsa-sha2-(.+)$/.exec(alg); assert.ok(res !== null); assert.strictEqual(res[1], parts[0].data.toString()); } var normalized = true; for (var i = 0; i < algInfo.parts.length; ++i) { var p = parts[i]; p.name = algInfo.parts[i]; /* * OpenSSH stores ed25519 "private" keys as seed + public key * concat'd together (k followed by A). We want to keep them * separate for other formats that don't do this. */ if (key.type === 'ed25519' && p.name === 'k') p.data = p.data.slice(0, 32); if (p.name !== 'curve' && algInfo.normalize !== false) { var nd; if (key.type === 'ed25519') { nd = utils.zeroPadToLength(p.data, 32); } else { nd = utils.mpNormalize(p.data); } if (nd.toString('binary') !== p.data.toString('binary')) { p.data = nd; normalized = false; } } } if (normalized) key._rfc4253Cache = sshbuf.toBuffer(); if (partial && typeof (partial) === 'object') { partial.remainder = sshbuf.remainder(); partial.consumed = sshbuf._offset; } return (new Constructor(key)); } function write(key, options) { assert.object(key); var alg = keyTypeToAlg(key); var i; var algInfo = algs.info[key.type]; if (PrivateKey.isPrivateKey(key)) algInfo = algs.privInfo[key.type]; var parts = algInfo.parts; var buf = new SSHBuffer({}); buf.writeString(alg); for (i = 0; i < parts.length; ++i) { var data = key.part[parts[i]].data; if (algInfo.normalize !== false) { if (key.type === 'ed25519') data = utils.zeroPadToLength(data, 32); else data = utils.mpNormalize(data); } if (key.type === 'ed25519' && parts[i] === 'k') data = Buffer.concat([data, key.part.A.data]); buf.writeBuffer(data); } return (buf.toBuffer()); } /***/ }), /* 539 */, /* 540 */, /* 541 */, /* 542 */ /***/ (function(__unusedmodule, exports) { "use strict"; /*! * Copyright (c) 2015, Salesforce.com, Inc. * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ /* * "A request-path path-matches a given cookie-path if at least one of the * following conditions holds:" */ function pathMatch (reqPath, cookiePath) { // "o The cookie-path and the request-path are identical." if (cookiePath === reqPath) { return true; } var idx = reqPath.indexOf(cookiePath); if (idx === 0) { // "o The cookie-path is a prefix of the request-path, and the last // character of the cookie-path is %x2F ("/")." if (cookiePath.substr(-1) === "/") { return true; } // " o The cookie-path is a prefix of the request-path, and the first // character of the request-path that is not included in the cookie- path // is a %x2F ("/") character." if (reqPath.substr(cookiePath.length, 1) === "/") { return true; } } return false; } exports.pathMatch = pathMatch; /***/ }), /* 543 */, /* 544 */, /* 545 */, /* 546 */, /* 547 */ /***/ (function(module, __unusedexports, __webpack_require__) { var util = __webpack_require__(669); var Stream = __webpack_require__(413).Stream; var DelayedStream = __webpack_require__(152); module.exports = CombinedStream; function CombinedStream() { this.writable = false; this.readable = true; this.dataSize = 0; this.maxDataSize = 2 * 1024 * 1024; this.pauseStreams = true; this._released = false; this._streams = []; this._currentStream = null; this._insideLoop = false; this._pendingNext = false; } util.inherits(CombinedStream, Stream); CombinedStream.create = function(options) { var combinedStream = new this(); options = options || {}; for (var option in options) { combinedStream[option] = options[option]; } return combinedStream; }; CombinedStream.isStreamLike = function(stream) { return (typeof stream !== 'function') && (typeof stream !== 'string') && (typeof stream !== 'boolean') && (typeof stream !== 'number') && (!Buffer.isBuffer(stream)); }; CombinedStream.prototype.append = function(stream) { var isStreamLike = CombinedStream.isStreamLike(stream); if (isStreamLike) { if (!(stream instanceof DelayedStream)) { var newStream = DelayedStream.create(stream, { maxDataSize: Infinity, pauseStream: this.pauseStreams, }); stream.on('data', this._checkDataSize.bind(this)); stream = newStream; } this._handleErrors(stream); if (this.pauseStreams) { stream.pause(); } } this._streams.push(stream); return this; }; CombinedStream.prototype.pipe = function(dest, options) { Stream.prototype.pipe.call(this, dest, options); this.resume(); return dest; }; CombinedStream.prototype._getNext = function() { this._currentStream = null; if (this._insideLoop) { this._pendingNext = true; return; // defer call } this._insideLoop = true; try { do { this._pendingNext = false; this._realGetNext(); } while (this._pendingNext); } finally { this._insideLoop = false; } }; CombinedStream.prototype._realGetNext = function() { var stream = this._streams.shift(); if (typeof stream == 'undefined') { this.end(); return; } if (typeof stream !== 'function') { this._pipeNext(stream); return; } var getStream = stream; getStream(function(stream) { var isStreamLike = CombinedStream.isStreamLike(stream); if (isStreamLike) { stream.on('data', this._checkDataSize.bind(this)); this._handleErrors(stream); } this._pipeNext(stream); }.bind(this)); }; CombinedStream.prototype._pipeNext = function(stream) { this._currentStream = stream; var isStreamLike = CombinedStream.isStreamLike(stream); if (isStreamLike) { stream.on('end', this._getNext.bind(this)); stream.pipe(this, {end: false}); return; } var value = stream; this.write(value); this._getNext(); }; CombinedStream.prototype._handleErrors = function(stream) { var self = this; stream.on('error', function(err) { self._emitError(err); }); }; CombinedStream.prototype.write = function(data) { this.emit('data', data); }; CombinedStream.prototype.pause = function() { if (!this.pauseStreams) { return; } if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); this.emit('pause'); }; CombinedStream.prototype.resume = function() { if (!this._released) { this._released = true; this.writable = true; this._getNext(); } if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); this.emit('resume'); }; CombinedStream.prototype.end = function() { this._reset(); this.emit('end'); }; CombinedStream.prototype.destroy = function() { this._reset(); this.emit('close'); }; CombinedStream.prototype._reset = function() { this.writable = false; this._streams = []; this._currentStream = null; }; CombinedStream.prototype._checkDataSize = function() { this._updateDataSize(); if (this.dataSize <= this.maxDataSize) { return; } var message = 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; this._emitError(new Error(message)); }; CombinedStream.prototype._updateDataSize = function() { this.dataSize = 0; var self = this; this._streams.forEach(function(stream) { if (!stream.dataSize) { return; } self.dataSize += stream.dataSize; }); if (this._currentStream && this._currentStream.dataSize) { this.dataSize += this._currentStream.dataSize; } }; CombinedStream.prototype._emitError = function(err) { this._reset(); this.emit('error', err); }; /***/ }), /* 548 */ /***/ (function(module) { /** @license MIT License (c) copyright 2010-2014 original author or authors */ /** @author Brian Cavalier */ /** @author John Hann */ (function(define) { 'use strict'; define(function() { return function progress(Promise) { /** * @deprecated * Register a progress handler for this promise * @param {function} onProgress * @returns {Promise} */ Promise.prototype.progress = function(onProgress) { return this.then(void 0, void 0, onProgress); }; return Promise; }; }); }(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); /***/ }), /* 549 */, /* 550 */, /* 551 */, /* 552 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var url = __webpack_require__(835) var isUrl = /^https?:/ function Redirect (request) { this.request = request this.followRedirect = true this.followRedirects = true this.followAllRedirects = false this.followOriginalHttpMethod = false this.allowRedirect = function () { return true } this.maxRedirects = 10 this.redirects = [] this.redirectsFollowed = 0 this.removeRefererHeader = false } Redirect.prototype.onRequest = function (options) { var self = this if (options.maxRedirects !== undefined) { self.maxRedirects = options.maxRedirects } if (typeof options.followRedirect === 'function') { self.allowRedirect = options.followRedirect } if (options.followRedirect !== undefined) { self.followRedirects = !!options.followRedirect } if (options.followAllRedirects !== undefined) { self.followAllRedirects = options.followAllRedirects } if (self.followRedirects || self.followAllRedirects) { self.redirects = self.redirects || [] } if (options.removeRefererHeader !== undefined) { self.removeRefererHeader = options.removeRefererHeader } if (options.followOriginalHttpMethod !== undefined) { self.followOriginalHttpMethod = options.followOriginalHttpMethod } } Redirect.prototype.redirectTo = function (response) { var self = this var request = self.request var redirectTo = null if (response.statusCode >= 300 && response.statusCode < 400 && response.caseless.has('location')) { var location = response.caseless.get('location') request.debug('redirect', location) if (self.followAllRedirects) { redirectTo = location } else if (self.followRedirects) { switch (request.method) { case 'PATCH': case 'PUT': case 'POST': case 'DELETE': // Do not follow redirects break default: redirectTo = location break } } } else if (response.statusCode === 401) { var authHeader = request._auth.onResponse(response) if (authHeader) { request.setHeader('authorization', authHeader) redirectTo = request.uri } } return redirectTo } Redirect.prototype.onResponse = function (response) { var self = this var request = self.request var redirectTo = self.redirectTo(response) if (!redirectTo || !self.allowRedirect.call(request, response)) { return false } request.debug('redirect to', redirectTo) // ignore any potential response body. it cannot possibly be useful // to us at this point. // response.resume should be defined, but check anyway before calling. Workaround for browserify. if (response.resume) { response.resume() } if (self.redirectsFollowed >= self.maxRedirects) { request.emit('error', new Error('Exceeded maxRedirects. Probably stuck in a redirect loop ' + request.uri.href)) return false } self.redirectsFollowed += 1 if (!isUrl.test(redirectTo)) { redirectTo = url.resolve(request.uri.href, redirectTo) } var uriPrev = request.uri request.uri = url.parse(redirectTo) // handle the case where we change protocol from https to http or vice versa if (request.uri.protocol !== uriPrev.protocol) { delete request.agent } self.redirects.push({ statusCode: response.statusCode, redirectUri: redirectTo }) if (self.followAllRedirects && request.method !== 'HEAD' && response.statusCode !== 401 && response.statusCode !== 307) { request.method = self.followOriginalHttpMethod ? request.method : 'GET' } // request.method = 'GET' // Force all redirects to use GET || commented out fixes #215 delete request.src delete request.req delete request._started if (response.statusCode !== 401 && response.statusCode !== 307) { // Remove parameters from the previous response, unless this is the second request // for a server that requires digest authentication. delete request.body delete request._form if (request.headers) { request.removeHeader('host') request.removeHeader('content-type') request.removeHeader('content-length') if (request.uri.hostname !== request.originalHost.split(':')[0]) { // Remove authorization if changing hostnames (but not if just // changing ports or protocols). This matches the behavior of curl: // https://github.com/bagder/curl/blob/6beb0eee/lib/http.c#L710 request.removeHeader('authorization') } } } if (!self.removeRefererHeader) { request.setHeader('referer', uriPrev.href) } request.emit('redirect') request.init() return true } exports.Redirect = Redirect /***/ }), /* 553 */, /* 554 */ /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var caseless = __webpack_require__(7) var uuid = __webpack_require__(826) var helpers = __webpack_require__(810) var md5 = helpers.md5 var toBase64 = helpers.toBase64 function Auth (request) { // define all public properties here this.request = request this.hasAuth = false this.sentAuth = false this.bearerToken = null this.user = null this.pass = null } Auth.prototype.basic = function (user, pass, sendImmediately) { var self = this if (typeof user !== 'string' || (pass !== undefined && typeof pass !== 'string')) { self.request.emit('error', new Error('auth() received invalid user or password')) } self.user = user self.pass = pass self.hasAuth = true var header = user + ':' + (pass || '') if (sendImmediately || typeof sendImmediately === 'undefined') { var authHeader = 'Basic ' + toBase64(header) self.sentAuth = true return authHeader } } Auth.prototype.bearer = function (bearer, sendImmediately) { var self = this self.bearerToken = bearer self.hasAuth = true if (sendImmediately || typeof sendImmediately === 'undefined') { if (typeof bearer === 'function') { bearer = bearer() } var authHeader = 'Bearer ' + (bearer || '') self.sentAuth = true return authHeader } } Auth.prototype.digest = function (method, path, authHeader) { // TODO: More complete implementation of RFC 2617. // - handle challenge.domain // - support qop="auth-int" only // - handle Authentication-Info (not necessarily?) // - check challenge.stale (not necessarily?) // - increase nc (not necessarily?) // For reference: // http://tools.ietf.org/html/rfc2617#section-3 // https://github.com/bagder/curl/blob/master/lib/http_digest.c var self = this var challenge = {} var re = /([a-z0-9_-]+)=(?:"([^"]+)"|([a-z0-9_-]+))/gi while (true) { var match = re.exec(authHeader) if (!match) { break } challenge[match[1]] = match[2] || match[3] } /** * RFC 2617: handle both MD5 and MD5-sess algorithms. * * If the algorithm directive's value is "MD5" or unspecified, then HA1 is * HA1=MD5(username:realm:password) * If the algorithm directive's value is "MD5-sess", then HA1 is * HA1=MD5(MD5(username:realm:password):nonce:cnonce) */ var ha1Compute = function (algorithm, user, realm, pass, nonce, cnonce) { var ha1 = md5(user + ':' + realm + ':' + pass) if (algorithm && algorithm.toLowerCase() === 'md5-sess') { return md5(ha1 + ':' + nonce + ':' + cnonce) } else { return ha1 } } var qop = /(^|,)\s*auth\s*($|,)/.test(challenge.qop) && 'auth' var nc = qop && '00000001' var cnonce = qop && uuid().replace(/-/g, '') var ha1 = ha1Compute(challenge.algorithm, self.user, challenge.realm, self.pass, challenge.nonce, cnonce) var ha2 = md5(method + ':' + path) var digestResponse = qop ? md5(ha1 + ':' + challenge.nonce + ':' + nc + ':' + cnonce + ':' + qop + ':' + ha2) : md5(ha1 + ':' + challenge.nonce + ':' + ha2) var authValues = { username: self.user, realm: challenge.realm, nonce: challenge.nonce, uri: path, qop: qop, response: digestResponse, nc: nc, cnonce: cnonce, algorithm: challenge.algorithm, opaque: challenge.opaque } authHeader = [] for (var k in authValues) { if (authValues[k]) { if (k === 'qop' || k === 'nc' || k === 'algorithm') { authHeader.push(k + '=' + authValues[k]) } else { authHeader.push(k + '="' + authValues[k] + '"') } } } authHeader = 'Digest ' + authHeader.join(', ') self.sentAuth = true return authHeader } Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) { var self = this var request = self.request var authHeader if (bearer === undefined && user === undefined) { self.request.emit('error', new Error('no auth mechanism defined')) } else if (bearer !== undefined) { authHeader = self.bearer(bearer, sendImmediately) } else { authHeader = self.basic(user, pass, sendImmediately) } if (authHeader) { request.setHeader('authorization', authHeader) } } Auth.prototype.onResponse = function (response) { var self = this var request = self.request if (!self.hasAuth || self.sentAuth) { return null } var c = caseless(response.headers) var authHeader = c.get('www-authenticate') var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase() request.debug('reauth', authVerb) switch (authVerb) { case 'basic': return self.basic(self.user, self.pass, true) case 'bearer': return self.bearer(self.bearerToken, true) case 'digest': return self.digest(request.method, request.path, authHeader) } } exports.Auth = Auth /***/ }), /* 555 */, /* 556 */, /* 557 */ /***/ (function(module, exports, __webpack_require__) { /* module decorator */ module = __webpack_require__.nmd(module); /** * @license * Lodash * Copyright OpenJS Foundation and other contributors * Released under MIT license * Based on Underscore.js 1.8.3 * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors */ ;(function() { /** Used as a safe reference for `undefined` in pre-ES5 environments. */ var undefined; /** Used as the semantic version number. */ var VERSION = '4.17.19'; /** Used as the size to enable large array optimizations. */ var LARGE_ARRAY_SIZE = 200; /** Error message constants. */ var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', FUNC_ERROR_TEXT = 'Expected a function'; /** Used to stand-in for `undefined` hash values. */ var HASH_UNDEFINED = '__lodash_hash_undefined__'; /** Used as the maximum memoize cache size. */ var MAX_MEMOIZE_SIZE = 500; /** Used as the internal argument placeholder. */ var PLACEHOLDER = '__lodash_placeholder__'; /** Used to compose bitmasks for cloning. */ var CLONE_DEEP_FLAG = 1, CLONE_FLAT_FLAG = 2, CLONE_SYMBOLS_FLAG = 4; /** Used to compose bitmasks for value comparisons. */ var COMPARE_PARTIAL_FLAG = 1, COMPARE_UNORDERED_FLAG = 2; /** Used to compose bitmasks for function metadata. */ var WRAP_BIND_FLAG = 1, WRAP_BIND_KEY_FLAG = 2, WRAP_CURRY_BOUND_FLAG = 4, WRAP_CURRY_FLAG = 8, WRAP_CURRY_RIGHT_FLAG = 16, WRAP_PARTIAL_FLAG = 32, WRAP_PARTIAL_RIGHT_FLAG = 64, WRAP_ARY_FLAG = 128, WRAP_REARG_FLAG = 256, WRAP_FLIP_FLAG = 512; /** Used as default options for `_.truncate`. */ var DEFAULT_TRUNC_LENGTH = 30, DEFAULT_TRUNC_OMISSION = '...'; /** Used to detect hot functions by number of calls within a span of milliseconds. */ var HOT_COUNT = 800, HOT_SPAN = 16; /** Used to indicate the type of lazy iteratees. */ var LAZY_FILTER_FLAG = 1, LAZY_MAP_FLAG = 2, LAZY_WHILE_FLAG = 3; /** Used as references for various `Number` constants. */ var INFINITY = 1 / 0, MAX_SAFE_INTEGER = 9007199254740991, MAX_INTEGER = 1.7976931348623157e+308, NAN = 0 / 0; /** Used as references for the maximum length and index of an array. */ var MAX_ARRAY_LENGTH = 4294967295, MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; /** Used to associate wrap methods with their bit flags. */ var wrapFlags = [ ['ary', WRAP_ARY_FLAG], ['bind', WRAP_BIND_FLAG], ['bindKey', WRAP_BIND_KEY_FLAG], ['curry', WRAP_CURRY_FLAG], ['curryRight', WRAP_CURRY_RIGHT_FLAG], ['flip', WRAP_FLIP_FLAG], ['partial', WRAP_PARTIAL_FLAG], ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], ['rearg', WRAP_REARG_FLAG] ]; /** `Object#toString` result references. */ var argsTag = '[object Arguments]', arrayTag = '[object Array]', asyncTag = '[object AsyncFunction]', boolTag = '[object Boolean]', dateTag = '[object Date]', domExcTag = '[object DOMException]', errorTag = '[object Error]', funcTag = '[object Function]', genTag = '[object GeneratorFunction]', mapTag = '[object Map]', numberTag = '[object Number]', nullTag = '[object Null]', objectTag = '[object Object]', promiseTag = '[object Promise]', proxyTag = '[object Proxy]', regexpTag = '[object RegExp]', setTag = '[object Set]', stringTag = '[object String]', symbolTag = '[object Symbol]', undefinedTag = '[object Undefined]', weakMapTag = '[object WeakMap]', weakSetTag = '[object WeakSet]'; var arrayBufferTag = '[object ArrayBuffer]', dataViewTag = '[object DataView]', float32Tag = '[object Float32Array]', float64Tag = '[object Float64Array]', int8Tag = '[object Int8Array]', int16Tag = '[object Int16Array]', int32Tag = '[object Int32Array]', uint8Tag = '[object Uint8Array]', uint8ClampedTag = '[object Uint8ClampedArray]', uint16Tag = '[object Uint16Array]', uint32Tag = '[object Uint32Array]'; /** Used to match empty string literals in compiled template source. */ var reEmptyStringLeading = /\b__p \+= '';/g, reEmptyStringMiddle = /\b(__p \+=) '' \+/g, reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; /** Used to match HTML entities and HTML characters. */ var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, reUnescapedHtml = /[&<>"']/g, reHasEscapedHtml = RegExp(reEscapedHtml.source), reHasUnescapedHtml = RegExp(reUnescapedHtml.source); /** Used to match template delimiters. */ var reEscape = /<%-([\s\S]+?)%>/g, reEvaluate = /<%([\s\S]+?)%>/g, reInterpolate = /<%=([\s\S]+?)%>/g; /** Used to match property names within property paths. */ var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/, rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; /** * Used to match `RegExp` * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). */ var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, reHasRegExpChar = RegExp(reRegExpChar.source); /** Used to match leading and trailing whitespace. */ var reTrim = /^\s+|\s+$/g, reTrimStart = /^\s+/, reTrimEnd = /\s+$/; /** Used to match wrap detail comments. */ var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, reSplitDetails = /,? & /; /** Used to match words composed of alphanumeric characters. */ var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; /** Used to match backslashes in property paths. */ var reEscapeChar = /\\(\\)?/g; /** * Used to match * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). */ var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; /** Used to match `RegExp` flags from their coerced string values. */ var reFlags = /\w*$/; /** Used to detect bad signed hexadecimal string values. */ var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; /** Used to detect binary string values. */ var reIsBinary = /^0b[01]+$/i; /** Used to detect host constructors (Safari). */ var reIsHostCtor = /^\[object .+?Constructor\]$/; /** Used to detect octal string values. */ var reIsOctal = /^0o[0-7]+$/i; /** Used to detect unsigned integer values. */ var reIsUint = /^(?:0|[1-9]\d*)$/; /** Used to match Latin Unicode letters (excluding mathematical operators). */ var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; /** Used to ensure capturing order of template delimiters. */ var reNoMatch = /($^)/; /** Used to match unescaped characters in compiled string literals. */ var reUnescapedString = /['\n\r\u2028\u2029\\]/g; /** Used to compose unicode character classes. */ var rsAstralRange = '\\ud800-\\udfff', rsComboMarksRange = '\\u0300-\\u036f', reComboHalfMarksRange = '\\ufe20-\\ufe2f', rsComboSymbolsRange = '\\u20d0-\\u20ff', rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, rsDingbatRange = '\\u2700-\\u27bf', rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', rsPunctuationRange = '\\u2000-\\u206f', rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', rsVarRange = '\\ufe0e\\ufe0f', rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; /** Used to compose unicode capture groups. */ var rsApos = "['\u2019]", rsAstral = '[' + rsAstralRange + ']', rsBreak = '[' + rsBreakRange + ']', rsCombo = '[' + rsComboRange + ']', rsDigits = '\\d+', rsDingbat = '[' + rsDingbatRange + ']', rsLower = '[' + rsLowerRange + ']', rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', rsFitz = '\\ud83c[\\udffb-\\udfff]', rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', rsNonAstral = '[^' + rsAstralRange + ']', rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', rsUpper = '[' + rsUpperRange + ']', rsZWJ = '\\u200d'; /** Used to compose unicode regexes. */ var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', reOptMod = rsModifier + '?', rsOptVar = '[' + rsVarRange + ']?', rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', rsSeq = rsOptVar + reOptMod + rsOptJoin, rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; /** Used to match apostrophes. */ var reApos = RegExp(rsApos, 'g'); /** * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). */ var reComboMark = RegExp(rsCombo, 'g'); /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); /** Used to match complex or compound words. */ var reUnicodeWord = RegExp([ rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, rsUpper + '+' + rsOptContrUpper, rsOrdUpper, rsOrdLower, rsDigits, rsEmoji ].join('|'), 'g'); /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); /** Used to detect strings that need a more robust regexp to match words. */ var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; /** Used to assign default `context` object properties. */ var contextProps = [ 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' ]; /** Used to make template sourceURLs easier to identify. */ var templateCounter = -1; /** Used to identify `toStringTag` values of typed arrays. */ var typedArrayTags = {}; typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = typedArrayTags[uint32Tag] = true; typedArrayTags[argsTag] = typedArrayTags[arrayTag] = typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = typedArrayTags[errorTag] = typedArrayTags[funcTag] = typedArrayTags[mapTag] = typedArrayTags[numberTag] = typedArrayTags[objectTag] = typedArrayTags[regexpTag] = typedArrayTags[setTag] = typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false; /** Used to identify `toStringTag` values supported by `_.clone`. */ var cloneableTags = {}; cloneableTags[argsTag] = cloneableTags[arrayTag] = cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = cloneableTags[boolTag] = cloneableTags[dateTag] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag] = cloneableTags[numberTag] = cloneableTags[objectTag] = cloneableTags[regexpTag] = cloneableTags[setTag] = cloneableTags[stringTag] = cloneableTags[symbolTag] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; cloneableTags[errorTag] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = false; /** Used to map Latin Unicode letters to basic Latin letters. */ var deburredLetters = { // Latin-1 Supplement block. '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', '\xc7': 'C', '\xe7': 'c', '\xd0': 'D', '\xf0': 'd', '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', '\xd1': 'N', '\xf1': 'n', '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', '\xc6': 'Ae', '\xe6': 'ae', '\xde': 'Th', '\xfe': 'th', '\xdf': 'ss', // Latin Extended-A block. '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', '\u0134': 'J', '\u0135': 'j', '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', '\u0163': 't', '\u0165': 't', '\u0167': 't', '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', '\u0174': 'W', '\u0175': 'w', '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', '\u0132': 'IJ', '\u0133': 'ij', '\u0152': 'Oe', '\u0153': 'oe', '\u0149': "'n", '\u017f': 's' }; /** Used to map characters to HTML entities. */ var htmlEscapes = { '&': '&', '<': '<', '>': '>', '"': '"', "'": ''' }; /** Used to map HTML entities to characters. */ var htmlUnescapes = { '&': '&', '<': '<', '>': '>', '"': '"', ''': "'" }; /** Used to escape characters for inclusion in compiled string literals. */ var stringEscapes = { '\\': '\\', "'": "'", '\n': 'n', '\r': 'r', '\u2028': 'u2028', '\u2029': 'u2029' }; /** Built-in method references without a dependency on `root`. */ var freeParseFloat = parseFloat, freeParseInt = parseInt; /** Detect free variable `global` from Node.js. */ var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; /** Detect free variable `self`. */ var freeSelf = typeof self == 'object' && self && self.Object === Object && self; /** Used as a reference to the global object. */ var root = freeGlobal || freeSelf || Function('return this')(); /** Detect free variable `exports`. */ var freeExports = true && exports && !exports.nodeType && exports; /** Detect free variable `module`. */ var freeModule = freeExports && "object" == 'object' && module && !module.nodeType && module; /** Detect the popular CommonJS extension `module.exports`. */ var moduleExports = freeModule && freeModule.exports === freeExports; /** Detect free variable `process` from Node.js. */ var freeProcess = moduleExports && freeGlobal.process; /** Used to access faster Node.js helpers. */ var nodeUtil = (function() { try { // Use `util.types` for Node.js 10+. var types = freeModule && freeModule.require && freeModule.require('util').types; if (types) { return types; } // Legacy `process.binding('util')` for Node.js < 10. return freeProcess && freeProcess.binding && freeProcess.binding('util'); } catch (e) {} }()); /* Node.js helper references. */ var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, nodeIsDate = nodeUtil && nodeUtil.isDate, nodeIsMap = nodeUtil && nodeUtil.isMap, nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, nodeIsSet = nodeUtil && nodeUtil.isSet, nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; /*--------------------------------------------------------------------------*/ /** * A faster alternative to `Function#apply`, this function invokes `func` * with the `this` binding of `thisArg` and the arguments of `args`. * * @private * @param {Function} func The function to invoke. * @param {*} thisArg The `this` binding of `func`. * @param {Array} args The arguments to invoke `func` with. * @returns {*} Returns the result of `func`. */ function apply(func, thisArg, args) { switch (args.length) { case 0: return func.call(thisArg); case 1: return func.call(thisArg, args[0]); case 2: return func.call(thisArg, args[0], args[1]); case 3: return func.call(thisArg, args[0], args[1], args[2]); } return func.apply(thisArg, args); } /** * A specialized version of `baseAggregator` for arrays. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform keys. * @param {Object} accumulator The initial aggregated object. * @returns {Function} Returns `accumulator`. */ function arrayAggregator(array, setter, iteratee, accumulator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { var value = array[index]; setter(accumulator, value, iteratee(value), array); } return accumulator; } /** * A specialized version of `_.forEach` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns `array`. */ function arrayEach(array, iteratee) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (iteratee(array[index], index, array) === false) { break; } } return array; } /** * A specialized version of `_.forEachRight` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns `array`. */ function arrayEachRight(array, iteratee) { var length = array == null ? 0 : array.length; while (length--) { if (iteratee(array[length], length, array) === false) { break; } } return array; } /** * A specialized version of `_.every` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false`. */ function arrayEvery(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (!predicate(array[index], index, array)) { return false; } } return true; } /** * A specialized version of `_.filter` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {Array} Returns the new filtered array. */ function arrayFilter(array, predicate) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result[resIndex++] = value; } } return result; } /** * A specialized version of `_.includes` for arrays without support for * specifying an index to search from. * * @private * @param {Array} [array] The array to inspect. * @param {*} target The value to search for. * @returns {boolean} Returns `true` if `target` is found, else `false`. */ function arrayIncludes(array, value) { var length = array == null ? 0 : array.length; return !!length && baseIndexOf(array, value, 0) > -1; } /** * This function is like `arrayIncludes` except that it accepts a comparator. * * @private * @param {Array} [array] The array to inspect. * @param {*} target The value to search for. * @param {Function} comparator The comparator invoked per element. * @returns {boolean} Returns `true` if `target` is found, else `false`. */ function arrayIncludesWith(array, value, comparator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (comparator(value, array[index])) { return true; } } return false; } /** * A specialized version of `_.map` for arrays without support for iteratee * shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the new mapped array. */ function arrayMap(array, iteratee) { var index = -1, length = array == null ? 0 : array.length, result = Array(length); while (++index < length) { result[index] = iteratee(array[index], index, array); } return result; } /** * Appends the elements of `values` to `array`. * * @private * @param {Array} array The array to modify. * @param {Array} values The values to append. * @returns {Array} Returns `array`. */ function arrayPush(array, values) { var index = -1, length = values.length, offset = array.length; while (++index < length) { array[offset + index] = values[index]; } return array; } /** * A specialized version of `_.reduce` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} [accumulator] The initial value. * @param {boolean} [initAccum] Specify using the first element of `array` as * the initial value. * @returns {*} Returns the accumulated value. */ function arrayReduce(array, iteratee, accumulator, initAccum) { var index = -1, length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[++index]; } while (++index < length) { accumulator = iteratee(accumulator, array[index], index, array); } return accumulator; } /** * A specialized version of `_.reduceRight` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} [accumulator] The initial value. * @param {boolean} [initAccum] Specify using the last element of `array` as * the initial value. * @returns {*} Returns the accumulated value. */ function arrayReduceRight(array, iteratee, accumulator, initAccum) { var length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[--length]; } while (length--) { accumulator = iteratee(accumulator, array[length], length, array); } return accumulator; } /** * A specialized version of `_.some` for arrays without support for iteratee * shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. */ function arraySome(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (predicate(array[index], index, array)) { return true; } } return false; } /** * Gets the size of an ASCII `string`. * * @private * @param {string} string The string inspect. * @returns {number} Returns the string size. */ var asciiSize = baseProperty('length'); /** * Converts an ASCII `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function asciiToArray(string) { return string.split(''); } /** * Splits an ASCII `string` into an array of its words. * * @private * @param {string} The string to inspect. * @returns {Array} Returns the words of `string`. */ function asciiWords(string) { return string.match(reAsciiWord) || []; } /** * The base implementation of methods like `_.findKey` and `_.findLastKey`, * without support for iteratee shorthands, which iterates over `collection` * using `eachFunc`. * * @private * @param {Array|Object} collection The collection to inspect. * @param {Function} predicate The function invoked per iteration. * @param {Function} eachFunc The function to iterate over `collection`. * @returns {*} Returns the found element or its key, else `undefined`. */ function baseFindKey(collection, predicate, eachFunc) { var result; eachFunc(collection, function(value, key, collection) { if (predicate(value, key, collection)) { result = key; return false; } }); return result; } /** * The base implementation of `_.findIndex` and `_.findLastIndex` without * support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} predicate The function invoked per iteration. * @param {number} fromIndex The index to search from. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseFindIndex(array, predicate, fromIndex, fromRight) { var length = array.length, index = fromIndex + (fromRight ? 1 : -1); while ((fromRight ? index-- : ++index < length)) { if (predicate(array[index], index, array)) { return index; } } return -1; } /** * The base implementation of `_.indexOf` without `fromIndex` bounds checks. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseIndexOf(array, value, fromIndex) { return value === value ? strictIndexOf(array, value, fromIndex) : baseFindIndex(array, baseIsNaN, fromIndex); } /** * This function is like `baseIndexOf` except that it accepts a comparator. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @param {Function} comparator The comparator invoked per element. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseIndexOfWith(array, value, fromIndex, comparator) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (comparator(array[index], value)) { return index; } } return -1; } /** * The base implementation of `_.isNaN` without support for number objects. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. */ function baseIsNaN(value) { return value !== value; } /** * The base implementation of `_.mean` and `_.meanBy` without support for * iteratee shorthands. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {number} Returns the mean. */ function baseMean(array, iteratee) { var length = array == null ? 0 : array.length; return length ? (baseSum(array, iteratee) / length) : NAN; } /** * The base implementation of `_.property` without support for deep paths. * * @private * @param {string} key The key of the property to get. * @returns {Function} Returns the new accessor function. */ function baseProperty(key) { return function(object) { return object == null ? undefined : object[key]; }; } /** * The base implementation of `_.propertyOf` without support for deep paths. * * @private * @param {Object} object The object to query. * @returns {Function} Returns the new accessor function. */ function basePropertyOf(object) { return function(key) { return object == null ? undefined : object[key]; }; } /** * The base implementation of `_.reduce` and `_.reduceRight`, without support * for iteratee shorthands, which iterates over `collection` using `eachFunc`. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} accumulator The initial value. * @param {boolean} initAccum Specify using the first or last element of * `collection` as the initial value. * @param {Function} eachFunc The function to iterate over `collection`. * @returns {*} Returns the accumulated value. */ function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { eachFunc(collection, function(value, index, collection) { accumulator = initAccum ? (initAccum = false, value) : iteratee(accumulator, value, index, collection); }); return accumulator; } /** * The base implementation of `_.sortBy` which uses `comparer` to define the * sort order of `array` and replaces criteria objects with their corresponding * values. * * @private * @param {Array} array The array to sort. * @param {Function} comparer The function to define sort order. * @returns {Array} Returns `array`. */ function baseSortBy(array, comparer) { var length = array.length; array.sort(comparer); while (length--) { array[length] = array[length].value; } return array; } /** * The base implementation of `_.sum` and `_.sumBy` without support for * iteratee shorthands. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {number} Returns the sum. */ function baseSum(array, iteratee) { var result, index = -1, length = array.length; while (++index < length) { var current = iteratee(array[index]); if (current !== undefined) { result = result === undefined ? current : (result + current); } } return result; } /** * The base implementation of `_.times` without support for iteratee shorthands * or max array length checks. * * @private * @param {number} n The number of times to invoke `iteratee`. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the array of results. */ function baseTimes(n, iteratee) { var index = -1, result = Array(n); while (++index < n) { result[index] = iteratee(index); } return result; } /** * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array * of key-value pairs for `object` corresponding to the property names of `props`. * * @private * @param {Object} object The object to query. * @param {Array} props The property names to get values for. * @returns {Object} Returns the key-value pairs. */ function baseToPairs(object, props) { return arrayMap(props, function(key) { return [key, object[key]]; }); } /** * The base implementation of `_.unary` without support for storing metadata. * * @private * @param {Function} func The function to cap arguments for. * @returns {Function} Returns the new capped function. */ function baseUnary(func) { return function(value) { return func(value); }; } /** * The base implementation of `_.values` and `_.valuesIn` which creates an * array of `object` property values corresponding to the property names * of `props`. * * @private * @param {Object} object The object to query. * @param {Array} props The property names to get values for. * @returns {Object} Returns the array of property values. */ function baseValues(object, props) { return arrayMap(props, function(key) { return object[key]; }); } /** * Checks if a `cache` value for `key` exists. * * @private * @param {Object} cache The cache to query. * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function cacheHas(cache, key) { return cache.has(key); } /** * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol * that is not found in the character symbols. * * @private * @param {Array} strSymbols The string symbols to inspect. * @param {Array} chrSymbols The character symbols to find. * @returns {number} Returns the index of the first unmatched string symbol. */ function charsStartIndex(strSymbols, chrSymbols) { var index = -1, length = strSymbols.length; while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} return index; } /** * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol * that is not found in the character symbols. * * @private * @param {Array} strSymbols The string symbols to inspect. * @param {Array} chrSymbols The character symbols to find. * @returns {number} Returns the index of the last unmatched string symbol. */ function charsEndIndex(strSymbols, chrSymbols) { var index = strSymbols.length; while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} return index; } /** * Gets the number of `placeholder` occurrences in `array`. * * @private * @param {Array} array The array to inspect. * @param {*} placeholder The placeholder to search for. * @returns {number} Returns the placeholder count. */ function countHolders(array, placeholder) { var length = array.length, result = 0; while (length--) { if (array[length] === placeholder) { ++result; } } return result; } /** * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A * letters to basic Latin letters. * * @private * @param {string} letter The matched letter to deburr. * @returns {string} Returns the deburred letter. */ var deburrLetter = basePropertyOf(deburredLetters); /** * Used by `_.escape` to convert characters to HTML entities. * * @private * @param {string} chr The matched character to escape. * @returns {string} Returns the escaped character. */ var escapeHtmlChar = basePropertyOf(htmlEscapes); /** * Used by `_.template` to escape characters for inclusion in compiled string literals. * * @private * @param {string} chr The matched character to escape. * @returns {string} Returns the escaped character. */ function escapeStringChar(chr) { return '\\' + stringEscapes[chr]; } /** * Gets the value at `key` of `object`. * * @private * @param {Object} [object] The object to query. * @param {string} key The key of the property to get. * @returns {*} Returns the property value. */ function getValue(object, key) { return object == null ? undefined : object[key]; } /** * Checks if `string` contains Unicode symbols. * * @private * @param {string} string The string to inspect. * @returns {boolean} Returns `true` if a symbol is found, else `false`. */ function hasUnicode(string) { return reHasUnicode.test(string); } /** * Checks if `string` contains a word composed of Unicode symbols. * * @private * @param {string} string The string to inspect. * @returns {boolean} Returns `true` if a word is found, else `false`. */ function hasUnicodeWord(string) { return reHasUnicodeWord.test(string); } /** * Converts `iterator` to an array. * * @private * @param {Object} iterator The iterator to convert. * @returns {Array} Returns the converted array. */ function iteratorToArray(iterator) { var data, result = []; while (!(data = iterator.next()).done) { result.push(data.value); } return result; } /** * Converts `map` to its key-value pairs. * * @private * @param {Object} map The map to convert. * @returns {Array} Returns the key-value pairs. */ function mapToArray(map) { var index = -1, result = Array(map.size); map.forEach(function(value, key) { result[++index] = [key, value]; }); return result; } /** * Creates a unary function that invokes `func` with its argument transformed. * * @private * @param {Function} func The function to wrap. * @param {Function} transform The argument transform. * @returns {Function} Returns the new function. */ function overArg(func, transform) { return function(arg) { return func(transform(arg)); }; } /** * Replaces all `placeholder` elements in `array` with an internal placeholder * and returns an array of their indexes. * * @private * @param {Array} array The array to modify. * @param {*} placeholder The placeholder to replace. * @returns {Array} Returns the new array of placeholder indexes. */ function replaceHolders(array, placeholder) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value === placeholder || value === PLACEHOLDER) { array[index] = PLACEHOLDER; result[resIndex++] = index; } } return result; } /** * Converts `set` to an array of its values. * * @private * @param {Object} set The set to convert. * @returns {Array} Returns the values. */ function setToArray(set) { var index = -1, result = Array(set.size); set.forEach(function(value) { result[++index] = value; }); return result; } /** * Converts `set` to its value-value pairs. * * @private * @param {Object} set The set to convert. * @returns {Array} Returns the value-value pairs. */ function setToPairs(set) { var index = -1, result = Array(set.size); set.forEach(function(value) { result[++index] = [value, value]; }); return result; } /** * A specialized version of `_.indexOf` which performs strict equality * comparisons of values, i.e. `===`. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function strictIndexOf(array, value, fromIndex) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (array[index] === value) { return index; } } return -1; } /** * A specialized version of `_.lastIndexOf` which performs strict equality * comparisons of values, i.e. `===`. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function strictLastIndexOf(array, value, fromIndex) { var index = fromIndex + 1; while (index--) { if (array[index] === value) { return index; } } return index; } /** * Gets the number of symbols in `string`. * * @private * @param {string} string The string to inspect. * @returns {number} Returns the string size. */ function stringSize(string) { return hasUnicode(string) ? unicodeSize(string) : asciiSize(string); } /** * Converts `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function stringToArray(string) { return hasUnicode(string) ? unicodeToArray(string) : asciiToArray(string); } /** * Used by `_.unescape` to convert HTML entities to characters. * * @private * @param {string} chr The matched character to unescape. * @returns {string} Returns the unescaped character. */ var unescapeHtmlChar = basePropertyOf(htmlUnescapes); /** * Gets the size of a Unicode `string`. * * @private * @param {string} string The string inspect. * @returns {number} Returns the string size. */ function unicodeSize(string) { var result = reUnicode.lastIndex = 0; while (reUnicode.test(string)) { ++result; } return result; } /** * Converts a Unicode `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function unicodeToArray(string) { return string.match(reUnicode) || []; } /** * Splits a Unicode `string` into an array of its words. * * @private * @param {string} The string to inspect. * @returns {Array} Returns the words of `string`. */ function unicodeWords(string) { return string.match(reUnicodeWord) || []; } /*--------------------------------------------------------------------------*/ /** * Create a new pristine `lodash` function using the `context` object. * * @static * @memberOf _ * @since 1.1.0 * @category Util * @param {Object} [context=root] The context object. * @returns {Function} Returns a new `lodash` function. * @example * * _.mixin({ 'foo': _.constant('foo') }); * * var lodash = _.runInContext(); * lodash.mixin({ 'bar': lodash.constant('bar') }); * * _.isFunction(_.foo); * // => true * _.isFunction(_.bar); * // => false * * lodash.isFunction(lodash.foo); * // => false * lodash.isFunction(lodash.bar); * // => true * * // Create a suped-up `defer` in Node.js. * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; */ var runInContext = (function runInContext(context) { context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); /** Built-in constructor references. */ var Array = context.Array, Date = context.Date, Error = context.Error, Function = context.Function, Math = context.Math, Object = context.Object, RegExp = context.RegExp, String = context.String, TypeError = context.TypeError; /** Used for built-in method references. */ var arrayProto = Array.prototype, funcProto = Function.prototype, objectProto = Object.prototype; /** Used to detect overreaching core-js shims. */ var coreJsData = context['__core-js_shared__']; /** Used to resolve the decompiled source of functions. */ var funcToString = funcProto.toString; /** Used to check objects for own properties. */ var hasOwnProperty = objectProto.hasOwnProperty; /** Used to generate unique IDs. */ var idCounter = 0; /** Used to detect methods masquerading as native. */ var maskSrcKey = (function() { var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); return uid ? ('Symbol(src)_1.' + uid) : ''; }()); /** * Used to resolve the * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) * of values. */ var nativeObjectToString = objectProto.toString; /** Used to infer the `Object` constructor. */ var objectCtorString = funcToString.call(Object); /** Used to restore the original `_` reference in `_.noConflict`. */ var oldDash = root._; /** Used to detect if a method is native. */ var reIsNative = RegExp('^' + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' ); /** Built-in value references. */ var Buffer = moduleExports ? context.Buffer : undefined, Symbol = context.Symbol, Uint8Array = context.Uint8Array, allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, getPrototype = overArg(Object.getPrototypeOf, Object), objectCreate = Object.create, propertyIsEnumerable = objectProto.propertyIsEnumerable, splice = arrayProto.splice, spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, symIterator = Symbol ? Symbol.iterator : undefined, symToStringTag = Symbol ? Symbol.toStringTag : undefined; var defineProperty = (function() { try { var func = getNative(Object, 'defineProperty'); func({}, '', {}); return func; } catch (e) {} }()); /** Mocked built-ins. */ var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, ctxNow = Date && Date.now !== root.Date.now && Date.now, ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; /* Built-in method references for those with the same name as other `lodash` methods. */ var nativeCeil = Math.ceil, nativeFloor = Math.floor, nativeGetSymbols = Object.getOwnPropertySymbols, nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, nativeIsFinite = context.isFinite, nativeJoin = arrayProto.join, nativeKeys = overArg(Object.keys, Object), nativeMax = Math.max, nativeMin = Math.min, nativeNow = Date.now, nativeParseInt = context.parseInt, nativeRandom = Math.random, nativeReverse = arrayProto.reverse; /* Built-in method references that are verified to be native. */ var DataView = getNative(context, 'DataView'), Map = getNative(context, 'Map'), Promise = getNative(context, 'Promise'), Set = getNative(context, 'Set'), WeakMap = getNative(context, 'WeakMap'), nativeCreate = getNative(Object, 'create'); /** Used to store function metadata. */ var metaMap = WeakMap && new WeakMap; /** Used to lookup unminified function names. */ var realNames = {}; /** Used to detect maps, sets, and weakmaps. */ var dataViewCtorString = toSource(DataView), mapCtorString = toSource(Map), promiseCtorString = toSource(Promise), setCtorString = toSource(Set), weakMapCtorString = toSource(WeakMap); /** Used to convert symbols to primitives and strings. */ var symbolProto = Symbol ? Symbol.prototype : undefined, symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, symbolToString = symbolProto ? symbolProto.toString : undefined; /*------------------------------------------------------------------------*/ /** * Creates a `lodash` object which wraps `value` to enable implicit method * chain sequences. Methods that operate on and return arrays, collections, * and functions can be chained together. Methods that retrieve a single value * or may return a primitive value will automatically end the chain sequence * and return the unwrapped value. Otherwise, the value must be unwrapped * with `_#value`. * * Explicit chain sequences, which must be unwrapped with `_#value`, may be * enabled using `_.chain`. * * The execution of chained methods is lazy, that is, it's deferred until * `_#value` is implicitly or explicitly called. * * Lazy evaluation allows several methods to support shortcut fusion. * Shortcut fusion is an optimization to merge iteratee calls; this avoids * the creation of intermediate arrays and can greatly reduce the number of * iteratee executions. Sections of a chain sequence qualify for shortcut * fusion if the section is applied to an array and iteratees accept only * one argument. The heuristic for whether a section qualifies for shortcut * fusion is subject to change. * * Chaining is supported in custom builds as long as the `_#value` method is * directly or indirectly included in the build. * * In addition to lodash methods, wrappers have `Array` and `String` methods. * * The wrapper `Array` methods are: * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` * * The wrapper `String` methods are: * `replace` and `split` * * The wrapper methods that support shortcut fusion are: * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` * * The chainable wrapper methods are: * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, * `zipObject`, `zipObjectDeep`, and `zipWith` * * The wrapper methods that are **not** chainable by default are: * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, * `upperFirst`, `value`, and `words` * * @name _ * @constructor * @category Seq * @param {*} value The value to wrap in a `lodash` instance. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * function square(n) { * return n * n; * } * * var wrapped = _([1, 2, 3]); * * // Returns an unwrapped value. * wrapped.reduce(_.add); * // => 6 * * // Returns a wrapped value. * var squares = wrapped.map(square); * * _.isArray(squares); * // => false * * _.isArray(squares.value()); * // => true */ function lodash(value) { if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { if (value instanceof LodashWrapper) { return value; } if (hasOwnProperty.call(value, '__wrapped__')) { return wrapperClone(value); } } return new LodashWrapper(value); } /** * The base implementation of `_.create` without support for assigning * properties to the created object. * * @private * @param {Object} proto The object to inherit from. * @returns {Object} Returns the new object. */ var baseCreate = (function() { function object() {} return function(proto) { if (!isObject(proto)) { return {}; } if (objectCreate) { return objectCreate(proto); } object.prototype = proto; var result = new object; object.prototype = undefined; return result; }; }()); /** * The function whose prototype chain sequence wrappers inherit from. * * @private */ function baseLodash() { // No operation performed. } /** * The base constructor for creating `lodash` wrapper objects. * * @private * @param {*} value The value to wrap. * @param {boolean} [chainAll] Enable explicit method chain sequences. */ function LodashWrapper(value, chainAll) { this.__wrapped__ = value; this.__actions__ = []; this.__chain__ = !!chainAll; this.__index__ = 0; this.__values__ = undefined; } /** * By default, the template delimiters used by lodash are like those in * embedded Ruby (ERB) as well as ES2015 template strings. Change the * following template settings to use alternative delimiters. * * @static * @memberOf _ * @type {Object} */ lodash.templateSettings = { /** * Used to detect `data` property values to be HTML-escaped. * * @memberOf _.templateSettings * @type {RegExp} */ 'escape': reEscape, /** * Used to detect code to be evaluated. * * @memberOf _.templateSettings * @type {RegExp} */ 'evaluate': reEvaluate, /** * Used to detect `data` property values to inject. * * @memberOf _.templateSettings * @type {RegExp} */ 'interpolate': reInterpolate, /** * Used to reference the data object in the template text. * * @memberOf _.templateSettings * @type {string} */ 'variable': '', /** * Used to import variables into the compiled template. * * @memberOf _.templateSettings * @type {Object} */ 'imports': { /** * A reference to the `lodash` function. * * @memberOf _.templateSettings.imports * @type {Function} */ '_': lodash } }; // Ensure wrappers are instances of `baseLodash`. lodash.prototype = baseLodash.prototype; lodash.prototype.constructor = lodash; LodashWrapper.prototype = baseCreate(baseLodash.prototype); LodashWrapper.prototype.constructor = LodashWrapper; /*------------------------------------------------------------------------*/ /** * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. * * @private * @constructor * @param {*} value The value to wrap. */ function LazyWrapper(value) { this.__wrapped__ = value; this.__actions__ = []; this.__dir__ = 1; this.__filtered__ = false; this.__iteratees__ = []; this.__takeCount__ = MAX_ARRAY_LENGTH; this.__views__ = []; } /** * Creates a clone of the lazy wrapper object. * * @private * @name clone * @memberOf LazyWrapper * @returns {Object} Returns the cloned `LazyWrapper` object. */ function lazyClone() { var result = new LazyWrapper(this.__wrapped__); result.__actions__ = copyArray(this.__actions__); result.__dir__ = this.__dir__; result.__filtered__ = this.__filtered__; result.__iteratees__ = copyArray(this.__iteratees__); result.__takeCount__ = this.__takeCount__; result.__views__ = copyArray(this.__views__); return result; } /** * Reverses the direction of lazy iteration. * * @private * @name reverse * @memberOf LazyWrapper * @returns {Object} Returns the new reversed `LazyWrapper` object. */ function lazyReverse() { if (this.__filtered__) { var result = new LazyWrapper(this); result.__dir__ = -1; result.__filtered__ = true; } else { result = this.clone(); result.__dir__ *= -1; } return result; } /** * Extracts the unwrapped value from its lazy wrapper. * * @private * @name value * @memberOf LazyWrapper * @returns {*} Returns the unwrapped value. */ function lazyValue() { var array = this.__wrapped__.value(), dir = this.__dir__, isArr = isArray(array), isRight = dir < 0, arrLength = isArr ? array.length : 0, view = getView(0, arrLength, this.__views__), start = view.start, end = view.end, length = end - start, index = isRight ? end : (start - 1), iteratees = this.__iteratees__, iterLength = iteratees.length, resIndex = 0, takeCount = nativeMin(length, this.__takeCount__); if (!isArr || (!isRight && arrLength == length && takeCount == length)) { return baseWrapperValue(array, this.__actions__); } var result = []; outer: while (length-- && resIndex < takeCount) { index += dir; var iterIndex = -1, value = array[index]; while (++iterIndex < iterLength) { var data = iteratees[iterIndex], iteratee = data.iteratee, type = data.type, computed = iteratee(value); if (type == LAZY_MAP_FLAG) { value = computed; } else if (!computed) { if (type == LAZY_FILTER_FLAG) { continue outer; } else { break outer; } } } result[resIndex++] = value; } return result; } // Ensure `LazyWrapper` is an instance of `baseLodash`. LazyWrapper.prototype = baseCreate(baseLodash.prototype); LazyWrapper.prototype.constructor = LazyWrapper; /*------------------------------------------------------------------------*/ /** * Creates a hash object. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function Hash(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the hash. * * @private * @name clear * @memberOf Hash */ function hashClear() { this.__data__ = nativeCreate ? nativeCreate(null) : {}; this.size = 0; } /** * Removes `key` and its value from the hash. * * @private * @name delete * @memberOf Hash * @param {Object} hash The hash to modify. * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function hashDelete(key) { var result = this.has(key) && delete this.__data__[key]; this.size -= result ? 1 : 0; return result; } /** * Gets the hash value for `key`. * * @private * @name get * @memberOf Hash * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function hashGet(key) { var data = this.__data__; if (nativeCreate) { var result = data[key]; return result === HASH_UNDEFINED ? undefined : result; } return hasOwnProperty.call(data, key) ? data[key] : undefined; } /** * Checks if a hash value for `key` exists. * * @private * @name has * @memberOf Hash * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function hashHas(key) { var data = this.__data__; return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); } /** * Sets the hash `key` to `value`. * * @private * @name set * @memberOf Hash * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the hash instance. */ function hashSet(key, value) { var data = this.__data__; this.size += this.has(key) ? 0 : 1; data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; return this; } // Add methods to `Hash`. Hash.prototype.clear = hashClear; Hash.prototype['delete'] = hashDelete; Hash.prototype.get = hashGet; Hash.prototype.has = hashHas; Hash.prototype.set = hashSet; /*------------------------------------------------------------------------*/ /** * Creates an list cache object. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function ListCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the list cache. * * @private * @name clear * @memberOf ListCache */ function listCacheClear() { this.__data__ = []; this.size = 0; } /** * Removes `key` and its value from the list cache. * * @private * @name delete * @memberOf ListCache * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function listCacheDelete(key) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { return false; } var lastIndex = data.length - 1; if (index == lastIndex) { data.pop(); } else { splice.call(data, index, 1); } --this.size; return true; } /** * Gets the list cache value for `key`. * * @private * @name get * @memberOf ListCache * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function listCacheGet(key) { var data = this.__data__, index = assocIndexOf(data, key); return index < 0 ? undefined : data[index][1]; } /** * Checks if a list cache value for `key` exists. * * @private * @name has * @memberOf ListCache * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function listCacheHas(key) { return assocIndexOf(this.__data__, key) > -1; } /** * Sets the list cache `key` to `value`. * * @private * @name set * @memberOf ListCache * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the list cache instance. */ function listCacheSet(key, value) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { ++this.size; data.push([key, value]); } else { data[index][1] = value; } return this; } // Add methods to `ListCache`. ListCache.prototype.clear = listCacheClear; ListCache.prototype['delete'] = listCacheDelete; ListCache.prototype.get = listCacheGet; ListCache.prototype.has = listCacheHas; ListCache.prototype.set = listCacheSet; /*------------------------------------------------------------------------*/ /** * Creates a map cache object to store key-value pairs. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function MapCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the map. * * @private * @name clear * @memberOf MapCache */ function mapCacheClear() { this.size = 0; this.__data__ = { 'hash': new Hash, 'map': new (Map || ListCache), 'string': new Hash }; } /** * Removes `key` and its value from the map. * * @private * @name delete * @memberOf MapCache * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function mapCacheDelete(key) { var result = getMapData(this, key)['delete'](key); this.size -= result ? 1 : 0; return result; } /** * Gets the map value for `key`. * * @private * @name get * @memberOf MapCache * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function mapCacheGet(key) { return getMapData(this, key).get(key); } /** * Checks if a map value for `key` exists. * * @private * @name has * @memberOf MapCache * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function mapCacheHas(key) { return getMapData(this, key).has(key); } /** * Sets the map `key` to `value`. * * @private * @name set * @memberOf MapCache * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the map cache instance. */ function mapCacheSet(key, value) { var data = getMapData(this, key), size = data.size; data.set(key, value); this.size += data.size == size ? 0 : 1; return this; } // Add methods to `MapCache`. MapCache.prototype.clear = mapCacheClear; MapCache.prototype['delete'] = mapCacheDelete; MapCache.prototype.get = mapCacheGet; MapCache.prototype.has = mapCacheHas; MapCache.prototype.set = mapCacheSet; /*------------------------------------------------------------------------*/ /** * * Creates an array cache object to store unique values. * * @private * @constructor * @param {Array} [values] The values to cache. */ function SetCache(values) { var index = -1, length = values == null ? 0 : values.length; this.__data__ = new MapCache; while (++index < length) { this.add(values[index]); } } /** * Adds `value` to the array cache. * * @private * @name add * @memberOf SetCache * @alias push * @param {*} value The value to cache. * @returns {Object} Returns the cache instance. */ function setCacheAdd(value) { this.__data__.set(value, HASH_UNDEFINED); return this; } /** * Checks if `value` is in the array cache. * * @private * @name has * @memberOf SetCache * @param {*} value The value to search for. * @returns {number} Returns `true` if `value` is found, else `false`. */ function setCacheHas(value) { return this.__data__.has(value); } // Add methods to `SetCache`. SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; SetCache.prototype.has = setCacheHas; /*------------------------------------------------------------------------*/ /** * Creates a stack cache object to store key-value pairs. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function Stack(entries) { var data = this.__data__ = new ListCache(entries); this.size = data.size; } /** * Removes all key-value entries from the stack. * * @private * @name clear * @memberOf Stack */ function stackClear() { this.__data__ = new ListCache; this.size = 0; } /** * Removes `key` and its value from the stack. * * @private * @name delete * @memberOf Stack * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function stackDelete(key) { var data = this.__data__, result = data['delete'](key); this.size = data.size; return result; } /** * Gets the stack value for `key`. * * @private * @name get * @memberOf Stack * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function stackGet(key) { return this.__data__.get(key); } /** * Checks if a stack value for `key` exists. * * @private * @name has * @memberOf Stack * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function stackHas(key) { return this.__data__.has(key); } /** * Sets the stack `key` to `value`. * * @private * @name set * @memberOf Stack * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the stack cache instance. */ function stackSet(key, value) { var data = this.__data__; if (data instanceof ListCache) { var pairs = data.__data__; if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { pairs.push([key, value]); this.size = ++data.size; return this; } data = this.__data__ = new MapCache(pairs); } data.set(key, value); this.size = data.size; return this; } // Add methods to `Stack`. Stack.prototype.clear = stackClear; Stack.prototype['delete'] = stackDelete; Stack.prototype.get = stackGet; Stack.prototype.has = stackHas; Stack.prototype.set = stackSet; /*------------------------------------------------------------------------*/ /** * Creates an array of the enumerable property names of the array-like `value`. * * @private * @param {*} value The value to query. * @param {boolean} inherited Specify returning inherited property names. * @returns {Array} Returns the array of property names. */ function arrayLikeKeys(value, inherited) { var isArr = isArray(value), isArg = !isArr && isArguments(value), isBuff = !isArr && !isArg && isBuffer(value), isType = !isArr && !isArg && !isBuff && isTypedArray(value), skipIndexes = isArr || isArg || isBuff || isType, result = skipIndexes ? baseTimes(value.length, String) : [], length = result.length; for (var key in value) { if ((inherited || hasOwnProperty.call(value, key)) && !(skipIndexes && ( // Safari 9 has enumerable `arguments.length` in strict mode. key == 'length' || // Node.js 0.10 has enumerable non-index properties on buffers. (isBuff && (key == 'offset' || key == 'parent')) || // PhantomJS 2 has enumerable non-index properties on typed arrays. (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || // Skip index properties. isIndex(key, length) ))) { result.push(key); } } return result; } /** * A specialized version of `_.sample` for arrays. * * @private * @param {Array} array The array to sample. * @returns {*} Returns the random element. */ function arraySample(array) { var length = array.length; return length ? array[baseRandom(0, length - 1)] : undefined; } /** * A specialized version of `_.sampleSize` for arrays. * * @private * @param {Array} array The array to sample. * @param {number} n The number of elements to sample. * @returns {Array} Returns the random elements. */ function arraySampleSize(array, n) { return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); } /** * A specialized version of `_.shuffle` for arrays. * * @private * @param {Array} array The array to shuffle. * @returns {Array} Returns the new shuffled array. */ function arrayShuffle(array) { return shuffleSelf(copyArray(array)); } /** * This function is like `assignValue` except that it doesn't assign * `undefined` values. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function assignMergeValue(object, key, value) { if ((value !== undefined && !eq(object[key], value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } /** * Assigns `value` to `key` of `object` if the existing value is not equivalent * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function assignValue(object, key, value) { var objValue = object[key]; if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } /** * Gets the index at which the `key` is found in `array` of key-value pairs. * * @private * @param {Array} array The array to inspect. * @param {*} key The key to search for. * @returns {number} Returns the index of the matched value, else `-1`. */ function assocIndexOf(array, key) { var length = array.length; while (length--) { if (eq(array[length][0], key)) { return length; } } return -1; } /** * Aggregates elements of `collection` on `accumulator` with keys transformed * by `iteratee` and values set by `setter`. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform keys. * @param {Object} accumulator The initial aggregated object. * @returns {Function} Returns `accumulator`. */ function baseAggregator(collection, setter, iteratee, accumulator) { baseEach(collection, function(value, key, collection) { setter(accumulator, value, iteratee(value), collection); }); return accumulator; } /** * The base implementation of `_.assign` without support for multiple sources * or `customizer` functions. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @returns {Object} Returns `object`. */ function baseAssign(object, source) { return object && copyObject(source, keys(source), object); } /** * The base implementation of `_.assignIn` without support for multiple sources * or `customizer` functions. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @returns {Object} Returns `object`. */ function baseAssignIn(object, source) { return object && copyObject(source, keysIn(source), object); } /** * The base implementation of `assignValue` and `assignMergeValue` without * value checks. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function baseAssignValue(object, key, value) { if (key == '__proto__' && defineProperty) { defineProperty(object, key, { 'configurable': true, 'enumerable': true, 'value': value, 'writable': true }); } else { object[key] = value; } } /** * The base implementation of `_.at` without support for individual paths. * * @private * @param {Object} object The object to iterate over. * @param {string[]} paths The property paths to pick. * @returns {Array} Returns the picked elements. */ function baseAt(object, paths) { var index = -1, length = paths.length, result = Array(length), skip = object == null; while (++index < length) { result[index] = skip ? undefined : get(object, paths[index]); } return result; } /** * The base implementation of `_.clamp` which doesn't coerce arguments. * * @private * @param {number} number The number to clamp. * @param {number} [lower] The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the clamped number. */ function baseClamp(number, lower, upper) { if (number === number) { if (upper !== undefined) { number = number <= upper ? number : upper; } if (lower !== undefined) { number = number >= lower ? number : lower; } } return number; } /** * The base implementation of `_.clone` and `_.cloneDeep` which tracks * traversed objects. * * @private * @param {*} value The value to clone. * @param {boolean} bitmask The bitmask flags. * 1 - Deep clone * 2 - Flatten inherited properties * 4 - Clone symbols * @param {Function} [customizer] The function to customize cloning. * @param {string} [key] The key of `value`. * @param {Object} [object] The parent object of `value`. * @param {Object} [stack] Tracks traversed objects and their clone counterparts. * @returns {*} Returns the cloned value. */ function baseClone(value, bitmask, customizer, key, object, stack) { var result, isDeep = bitmask & CLONE_DEEP_FLAG, isFlat = bitmask & CLONE_FLAT_FLAG, isFull = bitmask & CLONE_SYMBOLS_FLAG; if (customizer) { result = object ? customizer(value, key, object, stack) : customizer(value); } if (result !== undefined) { return result; } if (!isObject(value)) { return value; } var isArr = isArray(value); if (isArr) { result = initCloneArray(value); if (!isDeep) { return copyArray(value, result); } } else { var tag = getTag(value), isFunc = tag == funcTag || tag == genTag; if (isBuffer(value)) { return cloneBuffer(value, isDeep); } if (tag == objectTag || tag == argsTag || (isFunc && !object)) { result = (isFlat || isFunc) ? {} : initCloneObject(value); if (!isDeep) { return isFlat ? copySymbolsIn(value, baseAssignIn(result, value)) : copySymbols(value, baseAssign(result, value)); } } else { if (!cloneableTags[tag]) { return object ? value : {}; } result = initCloneByTag(value, tag, isDeep); } } // Check for circular references and return its corresponding clone. stack || (stack = new Stack); var stacked = stack.get(value); if (stacked) { return stacked; } stack.set(value, result); if (isSet(value)) { value.forEach(function(subValue) { result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); }); } else if (isMap(value)) { value.forEach(function(subValue, key) { result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); } var keysFunc = isFull ? (isFlat ? getAllKeysIn : getAllKeys) : (isFlat ? keysIn : keys); var props = isArr ? undefined : keysFunc(value); arrayEach(props || value, function(subValue, key) { if (props) { key = subValue; subValue = value[key]; } // Recursively populate clone (susceptible to call stack limits). assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); return result; } /** * The base implementation of `_.conforms` which doesn't clone `source`. * * @private * @param {Object} source The object of property predicates to conform to. * @returns {Function} Returns the new spec function. */ function baseConforms(source) { var props = keys(source); return function(object) { return baseConformsTo(object, source, props); }; } /** * The base implementation of `_.conformsTo` which accepts `props` to check. * * @private * @param {Object} object The object to inspect. * @param {Object} source The object of property predicates to conform to. * @returns {boolean} Returns `true` if `object` conforms, else `false`. */ function baseConformsTo(object, source, props) { var length = props.length; if (object == null) { return !length; } object = Object(object); while (length--) { var key = props[length], predicate = source[key], value = object[key]; if ((value === undefined && !(key in object)) || !predicate(value)) { return false; } } return true; } /** * The base implementation of `_.delay` and `_.defer` which accepts `args` * to provide to `func`. * * @private * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @param {Array} args The arguments to provide to `func`. * @returns {number|Object} Returns the timer id or timeout object. */ function baseDelay(func, wait, args) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return setTimeout(function() { func.apply(undefined, args); }, wait); } /** * The base implementation of methods like `_.difference` without support * for excluding multiple arrays or iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Array} values The values to exclude. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. */ function baseDifference(array, values, iteratee, comparator) { var index = -1, includes = arrayIncludes, isCommon = true, length = array.length, result = [], valuesLength = values.length; if (!length) { return result; } if (iteratee) { values = arrayMap(values, baseUnary(iteratee)); } if (comparator) { includes = arrayIncludesWith; isCommon = false; } else if (values.length >= LARGE_ARRAY_SIZE) { includes = cacheHas; isCommon = false; values = new SetCache(values); } outer: while (++index < length) { var value = array[index], computed = iteratee == null ? value : iteratee(value); value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var valuesIndex = valuesLength; while (valuesIndex--) { if (values[valuesIndex] === computed) { continue outer; } } result.push(value); } else if (!includes(values, computed, comparator)) { result.push(value); } } return result; } /** * The base implementation of `_.forEach` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array|Object} Returns `collection`. */ var baseEach = createBaseEach(baseForOwn); /** * The base implementation of `_.forEachRight` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array|Object} Returns `collection`. */ var baseEachRight = createBaseEach(baseForOwnRight, true); /** * The base implementation of `_.every` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false` */ function baseEvery(collection, predicate) { var result = true; baseEach(collection, function(value, index, collection) { result = !!predicate(value, index, collection); return result; }); return result; } /** * The base implementation of methods like `_.max` and `_.min` which accepts a * `comparator` to determine the extremum value. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The iteratee invoked per iteration. * @param {Function} comparator The comparator used to compare values. * @returns {*} Returns the extremum value. */ function baseExtremum(array, iteratee, comparator) { var index = -1, length = array.length; while (++index < length) { var value = array[index], current = iteratee(value); if (current != null && (computed === undefined ? (current === current && !isSymbol(current)) : comparator(current, computed) )) { var computed = current, result = value; } } return result; } /** * The base implementation of `_.fill` without an iteratee call guard. * * @private * @param {Array} array The array to fill. * @param {*} value The value to fill `array` with. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns `array`. */ function baseFill(array, value, start, end) { var length = array.length; start = toInteger(start); if (start < 0) { start = -start > length ? 0 : (length + start); } end = (end === undefined || end > length) ? length : toInteger(end); if (end < 0) { end += length; } end = start > end ? 0 : toLength(end); while (start < end) { array[start++] = value; } return array; } /** * The base implementation of `_.filter` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {Array} Returns the new filtered array. */ function baseFilter(collection, predicate) { var result = []; baseEach(collection, function(value, index, collection) { if (predicate(value, index, collection)) { result.push(value); } }); return result; } /** * The base implementation of `_.flatten` with support for restricting flattening. * * @private * @param {Array} array The array to flatten. * @param {number} depth The maximum recursion depth. * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. * @param {Array} [result=[]] The initial result value. * @returns {Array} Returns the new flattened array. */ function baseFlatten(array, depth, predicate, isStrict, result) { var index = -1, length = array.length; predicate || (predicate = isFlattenable); result || (result = []); while (++index < length) { var value = array[index]; if (depth > 0 && predicate(value)) { if (depth > 1) { // Recursively flatten arrays (susceptible to call stack limits). baseFlatten(value, depth - 1, predicate, isStrict, result); } else { arrayPush(result, value); } } else if (!isStrict) { result[result.length] = value; } } return result; } /** * The base implementation of `baseForOwn` which iterates over `object` * properties returned by `keysFunc` and invokes `iteratee` for each property. * Iteratee functions may exit iteration early by explicitly returning `false`. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {Function} keysFunc The function to get the keys of `object`. * @returns {Object} Returns `object`. */ var baseFor = createBaseFor(); /** * This function is like `baseFor` except that it iterates over properties * in the opposite order. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {Function} keysFunc The function to get the keys of `object`. * @returns {Object} Returns `object`. */ var baseForRight = createBaseFor(true); /** * The base implementation of `_.forOwn` without support for iteratee shorthands. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Object} Returns `object`. */ function baseForOwn(object, iteratee) { return object && baseFor(object, iteratee, keys); } /** * The base implementation of `_.forOwnRight` without support for iteratee shorthands. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Object} Returns `object`. */ function baseForOwnRight(object, iteratee) { return object && baseForRight(object, iteratee, keys); } /** * The base implementation of `_.functions` which creates an array of * `object` function property names filtered from `props`. * * @private * @param {Object} object The object to inspect. * @param {Array} props The property names to filter. * @returns {Array} Returns the function names. */ function baseFunctions(object, props) { return arrayFilter(props, function(key) { return isFunction(object[key]); }); } /** * The base implementation of `_.get` without support for default values. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path of the property to get. * @returns {*} Returns the resolved value. */ function baseGet(object, path) { path = castPath(path, object); var index = 0, length = path.length; while (object != null && index < length) { object = object[toKey(path[index++])]; } return (index && index == length) ? object : undefined; } /** * The base implementation of `getAllKeys` and `getAllKeysIn` which uses * `keysFunc` and `symbolsFunc` to get the enumerable property names and * symbols of `object`. * * @private * @param {Object} object The object to query. * @param {Function} keysFunc The function to get the keys of `object`. * @param {Function} symbolsFunc The function to get the symbols of `object`. * @returns {Array} Returns the array of property names and symbols. */ function baseGetAllKeys(object, keysFunc, symbolsFunc) { var result = keysFunc(object); return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); } /** * The base implementation of `getTag` without fallbacks for buggy environments. * * @private * @param {*} value The value to query. * @returns {string} Returns the `toStringTag`. */ function baseGetTag(value) { if (value == null) { return value === undefined ? undefinedTag : nullTag; } return (symToStringTag && symToStringTag in Object(value)) ? getRawTag(value) : objectToString(value); } /** * The base implementation of `_.gt` which doesn't coerce arguments. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than `other`, * else `false`. */ function baseGt(value, other) { return value > other; } /** * The base implementation of `_.has` without support for deep paths. * * @private * @param {Object} [object] The object to query. * @param {Array|string} key The key to check. * @returns {boolean} Returns `true` if `key` exists, else `false`. */ function baseHas(object, key) { return object != null && hasOwnProperty.call(object, key); } /** * The base implementation of `_.hasIn` without support for deep paths. * * @private * @param {Object} [object] The object to query. * @param {Array|string} key The key to check. * @returns {boolean} Returns `true` if `key` exists, else `false`. */ function baseHasIn(object, key) { return object != null && key in Object(object); } /** * The base implementation of `_.inRange` which doesn't coerce arguments. * * @private * @param {number} number The number to check. * @param {number} start The start of the range. * @param {number} end The end of the range. * @returns {boolean} Returns `true` if `number` is in the range, else `false`. */ function baseInRange(number, start, end) { return number >= nativeMin(start, end) && number < nativeMax(start, end); } /** * The base implementation of methods like `_.intersection`, without support * for iteratee shorthands, that accepts an array of arrays to inspect. * * @private * @param {Array} arrays The arrays to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of shared values. */ function baseIntersection(arrays, iteratee, comparator) { var includes = comparator ? arrayIncludesWith : arrayIncludes, length = arrays[0].length, othLength = arrays.length, othIndex = othLength, caches = Array(othLength), maxLength = Infinity, result = []; while (othIndex--) { var array = arrays[othIndex]; if (othIndex && iteratee) { array = arrayMap(array, baseUnary(iteratee)); } maxLength = nativeMin(array.length, maxLength); caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) ? new SetCache(othIndex && array) : undefined; } array = arrays[0]; var index = -1, seen = caches[0]; outer: while (++index < length && result.length < maxLength) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (!(seen ? cacheHas(seen, computed) : includes(result, computed, comparator) )) { othIndex = othLength; while (--othIndex) { var cache = caches[othIndex]; if (!(cache ? cacheHas(cache, computed) : includes(arrays[othIndex], computed, comparator)) ) { continue outer; } } if (seen) { seen.push(computed); } result.push(value); } } return result; } /** * The base implementation of `_.invert` and `_.invertBy` which inverts * `object` with values transformed by `iteratee` and set by `setter`. * * @private * @param {Object} object The object to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform values. * @param {Object} accumulator The initial inverted object. * @returns {Function} Returns `accumulator`. */ function baseInverter(object, setter, iteratee, accumulator) { baseForOwn(object, function(value, key, object) { setter(accumulator, iteratee(value), key, object); }); return accumulator; } /** * The base implementation of `_.invoke` without support for individual * method arguments. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path of the method to invoke. * @param {Array} args The arguments to invoke the method with. * @returns {*} Returns the result of the invoked method. */ function baseInvoke(object, path, args) { path = castPath(path, object); object = parent(object, path); var func = object == null ? object : object[toKey(last(path))]; return func == null ? undefined : apply(func, object, args); } /** * The base implementation of `_.isArguments`. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an `arguments` object, */ function baseIsArguments(value) { return isObjectLike(value) && baseGetTag(value) == argsTag; } /** * The base implementation of `_.isArrayBuffer` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. */ function baseIsArrayBuffer(value) { return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; } /** * The base implementation of `_.isDate` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a date object, else `false`. */ function baseIsDate(value) { return isObjectLike(value) && baseGetTag(value) == dateTag; } /** * The base implementation of `_.isEqual` which supports partial comparisons * and tracks traversed objects. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @param {boolean} bitmask The bitmask flags. * 1 - Unordered comparison * 2 - Partial comparison * @param {Function} [customizer] The function to customize comparisons. * @param {Object} [stack] Tracks traversed `value` and `other` objects. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. */ function baseIsEqual(value, other, bitmask, customizer, stack) { if (value === other) { return true; } if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { return value !== value && other !== other; } return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); } /** * A specialized version of `baseIsEqual` for arrays and objects which performs * deep comparisons and tracks traversed objects enabling objects with circular * references to be compared. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} [stack] Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { var objIsArr = isArray(object), othIsArr = isArray(other), objTag = objIsArr ? arrayTag : getTag(object), othTag = othIsArr ? arrayTag : getTag(other); objTag = objTag == argsTag ? objectTag : objTag; othTag = othTag == argsTag ? objectTag : othTag; var objIsObj = objTag == objectTag, othIsObj = othTag == objectTag, isSameTag = objTag == othTag; if (isSameTag && isBuffer(object)) { if (!isBuffer(other)) { return false; } objIsArr = true; objIsObj = false; } if (isSameTag && !objIsObj) { stack || (stack = new Stack); return (objIsArr || isTypedArray(object)) ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); } if (!(bitmask & COMPARE_PARTIAL_FLAG)) { var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); if (objIsWrapped || othIsWrapped) { var objUnwrapped = objIsWrapped ? object.value() : object, othUnwrapped = othIsWrapped ? other.value() : other; stack || (stack = new Stack); return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); } } if (!isSameTag) { return false; } stack || (stack = new Stack); return equalObjects(object, other, bitmask, customizer, equalFunc, stack); } /** * The base implementation of `_.isMap` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a map, else `false`. */ function baseIsMap(value) { return isObjectLike(value) && getTag(value) == mapTag; } /** * The base implementation of `_.isMatch` without support for iteratee shorthands. * * @private * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @param {Array} matchData The property names, values, and compare flags to match. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if `object` is a match, else `false`. */ function baseIsMatch(object, source, matchData, customizer) { var index = matchData.length, length = index, noCustomizer = !customizer; if (object == null) { return !length; } object = Object(object); while (index--) { var data = matchData[index]; if ((noCustomizer && data[2]) ? data[1] !== object[data[0]] : !(data[0] in object) ) { return false; } } while (++index < length) { data = matchData[index]; var key = data[0], objValue = object[key], srcValue = data[1]; if (noCustomizer && data[2]) { if (objValue === undefined && !(key in object)) { return false; } } else { var stack = new Stack; if (customizer) { var result = customizer(objValue, srcValue, key, object, source, stack); } if (!(result === undefined ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) : result )) { return false; } } } return true; } /** * The base implementation of `_.isNative` without bad shim checks. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a native function, * else `false`. */ function baseIsNative(value) { if (!isObject(value) || isMasked(value)) { return false; } var pattern = isFunction(value) ? reIsNative : reIsHostCtor; return pattern.test(toSource(value)); } /** * The base implementation of `_.isRegExp` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. */ function baseIsRegExp(value) { return isObjectLike(value) && baseGetTag(value) == regexpTag; } /** * The base implementation of `_.isSet` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a set, else `false`. */ function baseIsSet(value) { return isObjectLike(value) && getTag(value) == setTag; } /** * The base implementation of `_.isTypedArray` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. */ function baseIsTypedArray(value) { return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; } /** * The base implementation of `_.iteratee`. * * @private * @param {*} [value=_.identity] The value to convert to an iteratee. * @returns {Function} Returns the iteratee. */ function baseIteratee(value) { // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. if (typeof value == 'function') { return value; } if (value == null) { return identity; } if (typeof value == 'object') { return isArray(value) ? baseMatchesProperty(value[0], value[1]) : baseMatches(value); } return property(value); } /** * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function baseKeys(object) { if (!isPrototype(object)) { return nativeKeys(object); } var result = []; for (var key in Object(object)) { if (hasOwnProperty.call(object, key) && key != 'constructor') { result.push(key); } } return result; } /** * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function baseKeysIn(object) { if (!isObject(object)) { return nativeKeysIn(object); } var isProto = isPrototype(object), result = []; for (var key in object) { if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { result.push(key); } } return result; } /** * The base implementation of `_.lt` which doesn't coerce arguments. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than `other`, * else `false`. */ function baseLt(value, other) { return value < other; } /** * The base implementation of `_.map` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the new mapped array. */ function baseMap(collection, iteratee) { var index = -1, result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function(value, key, collection) { result[++index] = iteratee(value, key, collection); }); return result; } /** * The base implementation of `_.matches` which doesn't clone `source`. * * @private * @param {Object} source The object of property values to match. * @returns {Function} Returns the new spec function. */ function baseMatches(source) { var matchData = getMatchData(source); if (matchData.length == 1 && matchData[0][2]) { return matchesStrictComparable(matchData[0][0], matchData[0][1]); } return function(object) { return object === source || baseIsMatch(object, source, matchData); }; } /** * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. * * @private * @param {string} path The path of the property to get. * @param {*} srcValue The value to match. * @returns {Function} Returns the new spec function. */ function baseMatchesProperty(path, srcValue) { if (isKey(path) && isStrictComparable(srcValue)) { return matchesStrictComparable(toKey(path), srcValue); } return function(object) { var objValue = get(object, path); return (objValue === undefined && objValue === srcValue) ? hasIn(object, path) : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); }; } /** * The base implementation of `_.merge` without support for multiple sources. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @param {number} srcIndex The index of `source`. * @param {Function} [customizer] The function to customize merged values. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. */ function baseMerge(object, source, srcIndex, customizer, stack) { if (object === source) { return; } baseFor(source, function(srcValue, key) { stack || (stack = new Stack); if (isObject(srcValue)) { baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); } else { var newValue = customizer ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) : undefined; if (newValue === undefined) { newValue = srcValue; } assignMergeValue(object, key, newValue); } }, keysIn); } /** * A specialized version of `baseMerge` for arrays and objects which performs * deep merges and tracks traversed objects enabling objects with circular * references to be merged. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @param {string} key The key of the value to merge. * @param {number} srcIndex The index of `source`. * @param {Function} mergeFunc The function to merge values. * @param {Function} [customizer] The function to customize assigned values. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. */ function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { var objValue = safeGet(object, key), srcValue = safeGet(source, key), stacked = stack.get(srcValue); if (stacked) { assignMergeValue(object, key, stacked); return; } var newValue = customizer ? customizer(objValue, srcValue, (key + ''), object, source, stack) : undefined; var isCommon = newValue === undefined; if (isCommon) { var isArr = isArray(srcValue), isBuff = !isArr && isBuffer(srcValue), isTyped = !isArr && !isBuff && isTypedArray(srcValue); newValue = srcValue; if (isArr || isBuff || isTyped) { if (isArray(objValue)) { newValue = objValue; } else if (isArrayLikeObject(objValue)) { newValue = copyArray(objValue); } else if (isBuff) { isCommon = false; newValue = cloneBuffer(srcValue, true); } else if (isTyped) { isCommon = false; newValue = cloneTypedArray(srcValue, true); } else { newValue = []; } } else if (isPlainObject(srcValue) || isArguments(srcValue)) { newValue = objValue; if (isArguments(objValue)) { newValue = toPlainObject(objValue); } else if (!isObject(objValue) || isFunction(objValue)) { newValue = initCloneObject(srcValue); } } else { isCommon = false; } } if (isCommon) { // Recursively merge objects and arrays (susceptible to call stack limits). stack.set(srcValue, newValue); mergeFunc(newValue, srcValue, srcIndex, customizer, stack); stack['delete'](srcValue); } assignMergeValue(object, key, newValue); } /** * The base implementation of `_.nth` which doesn't coerce arguments. * * @private * @param {Array} array The array to query. * @param {number} n The index of the element to return. * @returns {*} Returns the nth element of `array`. */ function baseNth(array, n) { var length = array.length; if (!length) { return; } n += n < 0 ? length : 0; return isIndex(n, length) ? array[n] : undefined; } /** * The base implementation of `_.orderBy` without param guards. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. * @param {string[]} orders The sort orders of `iteratees`. * @returns {Array} Returns the new sorted array. */ function baseOrderBy(collection, iteratees, orders) { if (iteratees.length) { iteratees = arrayMap(iteratees, function(iteratee) { if (isArray(iteratee)) { return function(value) { return baseGet(value, iteratee.length === 1 ? iteratee[0] : iteratee); } } return iteratee; }); } else { iteratees = [identity]; } var index = -1; iteratees = arrayMap(iteratees, baseUnary(getIteratee())); var result = baseMap(collection, function(value, key, collection) { var criteria = arrayMap(iteratees, function(iteratee) { return iteratee(value); }); return { 'criteria': criteria, 'index': ++index, 'value': value }; }); return baseSortBy(result, function(object, other) { return compareMultiple(object, other, orders); }); } /** * The base implementation of `_.pick` without support for individual * property identifiers. * * @private * @param {Object} object The source object. * @param {string[]} paths The property paths to pick. * @returns {Object} Returns the new object. */ function basePick(object, paths) { return basePickBy(object, paths, function(value, path) { return hasIn(object, path); }); } /** * The base implementation of `_.pickBy` without support for iteratee shorthands. * * @private * @param {Object} object The source object. * @param {string[]} paths The property paths to pick. * @param {Function} predicate The function invoked per property. * @returns {Object} Returns the new object. */ function basePickBy(object, paths, predicate) { var index = -1, length = paths.length, result = {}; while (++index < length) { var path = paths[index], value = baseGet(object, path); if (predicate(value, path)) { baseSet(result, castPath(path, object), value); } } return result; } /** * A specialized version of `baseProperty` which supports deep paths. * * @private * @param {Array|string} path The path of the property to get. * @returns {Function} Returns the new accessor function. */ function basePropertyDeep(path) { return function(object) { return baseGet(object, path); }; } /** * The base implementation of `_.pullAllBy` without support for iteratee * shorthands. * * @private * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns `array`. */ function basePullAll(array, values, iteratee, comparator) { var indexOf = comparator ? baseIndexOfWith : baseIndexOf, index = -1, length = values.length, seen = array; if (array === values) { values = copyArray(values); } if (iteratee) { seen = arrayMap(array, baseUnary(iteratee)); } while (++index < length) { var fromIndex = 0, value = values[index], computed = iteratee ? iteratee(value) : value; while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { if (seen !== array) { splice.call(seen, fromIndex, 1); } splice.call(array, fromIndex, 1); } } return array; } /** * The base implementation of `_.pullAt` without support for individual * indexes or capturing the removed elements. * * @private * @param {Array} array The array to modify. * @param {number[]} indexes The indexes of elements to remove. * @returns {Array} Returns `array`. */ function basePullAt(array, indexes) { var length = array ? indexes.length : 0, lastIndex = length - 1; while (length--) { var index = indexes[length]; if (length == lastIndex || index !== previous) { var previous = index; if (isIndex(index)) { splice.call(array, index, 1); } else { baseUnset(array, index); } } } return array; } /** * The base implementation of `_.random` without support for returning * floating-point numbers. * * @private * @param {number} lower The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the random number. */ function baseRandom(lower, upper) { return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); } /** * The base implementation of `_.range` and `_.rangeRight` which doesn't * coerce arguments. * * @private * @param {number} start The start of the range. * @param {number} end The end of the range. * @param {number} step The value to increment or decrement by. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Array} Returns the range of numbers. */ function baseRange(start, end, step, fromRight) { var index = -1, length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), result = Array(length); while (length--) { result[fromRight ? length : ++index] = start; start += step; } return result; } /** * The base implementation of `_.repeat` which doesn't coerce arguments. * * @private * @param {string} string The string to repeat. * @param {number} n The number of times to repeat the string. * @returns {string} Returns the repeated string. */ function baseRepeat(string, n) { var result = ''; if (!string || n < 1 || n > MAX_SAFE_INTEGER) { return result; } // Leverage the exponentiation by squaring algorithm for a faster repeat. // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. do { if (n % 2) { result += string; } n = nativeFloor(n / 2); if (n) { string += string; } } while (n); return result; } /** * The base implementation of `_.rest` which doesn't validate or coerce arguments. * * @private * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @returns {Function} Returns the new function. */ function baseRest(func, start) { return setToString(overRest(func, start, identity), func + ''); } /** * The base implementation of `_.sample`. * * @private * @param {Array|Object} collection The collection to sample. * @returns {*} Returns the random element. */ function baseSample(collection) { return arraySample(values(collection)); } /** * The base implementation of `_.sampleSize` without param guards. * * @private * @param {Array|Object} collection The collection to sample. * @param {number} n The number of elements to sample. * @returns {Array} Returns the random elements. */ function baseSampleSize(collection, n) { var array = values(collection); return shuffleSelf(array, baseClamp(n, 0, array.length)); } /** * The base implementation of `_.set`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @param {Function} [customizer] The function to customize path creation. * @returns {Object} Returns `object`. */ function baseSet(object, path, value, customizer) { if (!isObject(object)) { return object; } path = castPath(path, object); var index = -1, length = path.length, lastIndex = length - 1, nested = object; while (nested != null && ++index < length) { var key = toKey(path[index]), newValue = value; if (key === '__proto__' || key === 'constructor' || key === 'prototype') { return object; } if (index != lastIndex) { var objValue = nested[key]; newValue = customizer ? customizer(objValue, key, nested) : undefined; if (newValue === undefined) { newValue = isObject(objValue) ? objValue : (isIndex(path[index + 1]) ? [] : {}); } } assignValue(nested, key, newValue); nested = nested[key]; } return object; } /** * The base implementation of `setData` without support for hot loop shorting. * * @private * @param {Function} func The function to associate metadata with. * @param {*} data The metadata. * @returns {Function} Returns `func`. */ var baseSetData = !metaMap ? identity : function(func, data) { metaMap.set(func, data); return func; }; /** * The base implementation of `setToString` without support for hot loop shorting. * * @private * @param {Function} func The function to modify. * @param {Function} string The `toString` result. * @returns {Function} Returns `func`. */ var baseSetToString = !defineProperty ? identity : function(func, string) { return defineProperty(func, 'toString', { 'configurable': true, 'enumerable': false, 'value': constant(string), 'writable': true }); }; /** * The base implementation of `_.shuffle`. * * @private * @param {Array|Object} collection The collection to shuffle. * @returns {Array} Returns the new shuffled array. */ function baseShuffle(collection) { return shuffleSelf(values(collection)); } /** * The base implementation of `_.slice` without an iteratee call guard. * * @private * @param {Array} array The array to slice. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the slice of `array`. */ function baseSlice(array, start, end) { var index = -1, length = array.length; if (start < 0) { start = -start > length ? 0 : (length + start); } end = end > length ? length : end; if (end < 0) { end += length; } length = start > end ? 0 : ((end - start) >>> 0); start >>>= 0; var result = Array(length); while (++index < length) { result[index] = array[index + start]; } return result; } /** * The base implementation of `_.some` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. */ function baseSome(collection, predicate) { var result; baseEach(collection, function(value, index, collection) { result = predicate(value, index, collection); return !result; }); return !!result; } /** * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which * performs a binary search of `array` to determine the index at which `value` * should be inserted into `array` in order to maintain its sort order. * * @private * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {boolean} [retHighest] Specify returning the highest qualified index. * @returns {number} Returns the index at which `value` should be inserted * into `array`. */ function baseSortedIndex(array, value, retHighest) { var low = 0, high = array == null ? low : array.length; if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { while (low < high) { var mid = (low + high) >>> 1, computed = array[mid]; if (computed !== null && !isSymbol(computed) && (retHighest ? (computed <= value) : (computed < value))) { low = mid + 1; } else { high = mid; } } return high; } return baseSortedIndexBy(array, value, identity, retHighest); } /** * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` * which invokes `iteratee` for `value` and each element of `array` to compute * their sort ranking. The iteratee is invoked with one argument; (value). * * @private * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} iteratee The iteratee invoked per element. * @param {boolean} [retHighest] Specify returning the highest qualified index. * @returns {number} Returns the index at which `value` should be inserted * into `array`. */ function baseSortedIndexBy(array, value, iteratee, retHighest) { var low = 0, high = array == null ? 0 : array.length; if (high === 0) { return 0; } value = iteratee(value); var valIsNaN = value !== value, valIsNull = value === null, valIsSymbol = isSymbol(value), valIsUndefined = value === undefined; while (low < high) { var mid = nativeFloor((low + high) / 2), computed = iteratee(array[mid]), othIsDefined = computed !== undefined, othIsNull = computed === null, othIsReflexive = computed === computed, othIsSymbol = isSymbol(computed); if (valIsNaN) { var setLow = retHighest || othIsReflexive; } else if (valIsUndefined) { setLow = othIsReflexive && (retHighest || othIsDefined); } else if (valIsNull) { setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); } else if (valIsSymbol) { setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); } else if (othIsNull || othIsSymbol) { setLow = false; } else { setLow = retHighest ? (computed <= value) : (computed < value); } if (setLow) { low = mid + 1; } else { high = mid; } } return nativeMin(high, MAX_ARRAY_INDEX); } /** * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without * support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. */ function baseSortedUniq(array, iteratee) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; if (!index || !eq(computed, seen)) { var seen = computed; result[resIndex++] = value === 0 ? 0 : value; } } return result; } /** * The base implementation of `_.toNumber` which doesn't ensure correct * conversions of binary, hexadecimal, or octal string values. * * @private * @param {*} value The value to process. * @returns {number} Returns the number. */ function baseToNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } return +value; } /** * The base implementation of `_.toString` which doesn't convert nullish * values to empty strings. * * @private * @param {*} value The value to process. * @returns {string} Returns the string. */ function baseToString(value) { // Exit early for strings to avoid a performance hit in some environments. if (typeof value == 'string') { return value; } if (isArray(value)) { // Recursively convert values (susceptible to call stack limits). return arrayMap(value, baseToString) + ''; } if (isSymbol(value)) { return symbolToString ? symbolToString.call(value) : ''; } var result = (value + ''); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** * The base implementation of `_.uniqBy` without support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new duplicate free array. */ function baseUniq(array, iteratee, comparator) { var index = -1, includes = arrayIncludes, length = array.length, isCommon = true, result = [], seen = result; if (comparator) { isCommon = false; includes = arrayIncludesWith; } else if (length >= LARGE_ARRAY_SIZE) { var set = iteratee ? null : createSet(array); if (set) { return setToArray(set); } isCommon = false; includes = cacheHas; seen = new SetCache; } else { seen = iteratee ? [] : result; } outer: while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var seenIndex = seen.length; while (seenIndex--) { if (seen[seenIndex] === computed) { continue outer; } } if (iteratee) { seen.push(computed); } result.push(value); } else if (!includes(seen, computed, comparator)) { if (seen !== result) { seen.push(computed); } result.push(value); } } return result; } /** * The base implementation of `_.unset`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The property path to unset. * @returns {boolean} Returns `true` if the property is deleted, else `false`. */ function baseUnset(object, path) { path = castPath(path, object); object = parent(object, path); return object == null || delete object[toKey(last(path))]; } /** * The base implementation of `_.update`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to update. * @param {Function} updater The function to produce the updated value. * @param {Function} [customizer] The function to customize path creation. * @returns {Object} Returns `object`. */ function baseUpdate(object, path, updater, customizer) { return baseSet(object, path, updater(baseGet(object, path)), customizer); } /** * The base implementation of methods like `_.dropWhile` and `_.takeWhile` * without support for iteratee shorthands. * * @private * @param {Array} array The array to query. * @param {Function} predicate The function invoked per iteration. * @param {boolean} [isDrop] Specify dropping elements instead of taking them. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Array} Returns the slice of `array`. */ function baseWhile(array, predicate, isDrop, fromRight) { var length = array.length, index = fromRight ? length : -1; while ((fromRight ? index-- : ++index < length) && predicate(array[index], index, array)) {} return isDrop ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); } /** * The base implementation of `wrapperValue` which returns the result of * performing a sequence of actions on the unwrapped `value`, where each * successive action is supplied the return value of the previous. * * @private * @param {*} value The unwrapped value. * @param {Array} actions Actions to perform to resolve the unwrapped value. * @returns {*} Returns the resolved value. */ function baseWrapperValue(value, actions) { var result = value; if (result instanceof LazyWrapper) { result = result.value(); } return arrayReduce(actions, function(result, action) { return action.func.apply(action.thisArg, arrayPush([result], action.args)); }, result); } /** * The base implementation of methods like `_.xor`, without support for * iteratee shorthands, that accepts an array of arrays to inspect. * * @private * @param {Array} arrays The arrays to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of values. */ function baseXor(arrays, iteratee, comparator) { var length = arrays.length; if (length < 2) { return length ? baseUniq(arrays[0]) : []; } var index = -1, result = Array(length); while (++index < length) { var array = arrays[index], othIndex = -1; while (++othIndex < length) { if (othIndex != index) { result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); } } } return baseUniq(baseFlatten(result, 1), iteratee, comparator); } /** * This base implementation of `_.zipObject` which assigns values using `assignFunc`. * * @private * @param {Array} props The property identifiers. * @param {Array} values The property values. * @param {Function} assignFunc The function to assign values. * @returns {Object} Returns the new object. */ function baseZipObject(props, values, assignFunc) { var index = -1, length = props.length, valsLength = values.length, result = {}; while (++index < length) { var value = index < valsLength ? values[index] : undefined; assignFunc(result, props[index], value); } return result; } /** * Casts `value` to an empty array if it's not an array like object. * * @private * @param {*} value The value to inspect. * @returns {Array|Object} Returns the cast array-like object. */ function castArrayLikeObject(value) { return isArrayLikeObject(value) ? value : []; } /** * Casts `value` to `identity` if it's not a function. * * @private * @param {*} value The value to inspect. * @returns {Function} Returns cast function. */ function castFunction(value) { return typeof value == 'function' ? value : identity; } /** * Casts `value` to a path array if it's not one. * * @private * @param {*} value The value to inspect. * @param {Object} [object] The object to query keys on. * @returns {Array} Returns the cast property path array. */ function castPath(value, object) { if (isArray(value)) { return value; } return isKey(value, object) ? [value] : stringToPath(toString(value)); } /** * A `baseRest` alias which can be replaced with `identity` by module * replacement plugins. * * @private * @type {Function} * @param {Function} func The function to apply a rest parameter to. * @returns {Function} Returns the new function. */ var castRest = baseRest; /** * Casts `array` to a slice if it's needed. * * @private * @param {Array} array The array to inspect. * @param {number} start The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the cast slice. */ function castSlice(array, start, end) { var length = array.length; end = end === undefined ? length : end; return (!start && end >= length) ? array : baseSlice(array, start, end); } /** * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). * * @private * @param {number|Object} id The timer id or timeout object of the timer to clear. */ var clearTimeout = ctxClearTimeout || function(id) { return root.clearTimeout(id); }; /** * Creates a clone of `buffer`. * * @private * @param {Buffer} buffer The buffer to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Buffer} Returns the cloned buffer. */ function cloneBuffer(buffer, isDeep) { if (isDeep) { return buffer.slice(); } var length = buffer.length, result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); buffer.copy(result); return result; } /** * Creates a clone of `arrayBuffer`. * * @private * @param {ArrayBuffer} arrayBuffer The array buffer to clone. * @returns {ArrayBuffer} Returns the cloned array buffer. */ function cloneArrayBuffer(arrayBuffer) { var result = new arrayBuffer.constructor(arrayBuffer.byteLength); new Uint8Array(result).set(new Uint8Array(arrayBuffer)); return result; } /** * Creates a clone of `dataView`. * * @private * @param {Object} dataView The data view to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the cloned data view. */ function cloneDataView(dataView, isDeep) { var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); } /** * Creates a clone of `regexp`. * * @private * @param {Object} regexp The regexp to clone. * @returns {Object} Returns the cloned regexp. */ function cloneRegExp(regexp) { var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); result.lastIndex = regexp.lastIndex; return result; } /** * Creates a clone of the `symbol` object. * * @private * @param {Object} symbol The symbol object to clone. * @returns {Object} Returns the cloned symbol object. */ function cloneSymbol(symbol) { return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; } /** * Creates a clone of `typedArray`. * * @private * @param {Object} typedArray The typed array to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the cloned typed array. */ function cloneTypedArray(typedArray, isDeep) { var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); } /** * Compares values to sort them in ascending order. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {number} Returns the sort order indicator for `value`. */ function compareAscending(value, other) { if (value !== other) { var valIsDefined = value !== undefined, valIsNull = value === null, valIsReflexive = value === value, valIsSymbol = isSymbol(value); var othIsDefined = other !== undefined, othIsNull = other === null, othIsReflexive = other === other, othIsSymbol = isSymbol(other); if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || (valIsNull && othIsDefined && othIsReflexive) || (!valIsDefined && othIsReflexive) || !valIsReflexive) { return 1; } if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || (othIsNull && valIsDefined && valIsReflexive) || (!othIsDefined && valIsReflexive) || !othIsReflexive) { return -1; } } return 0; } /** * Used by `_.orderBy` to compare multiple properties of a value to another * and stable sort them. * * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, * specify an order of "desc" for descending or "asc" for ascending sort order * of corresponding values. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {boolean[]|string[]} orders The order to sort by for each property. * @returns {number} Returns the sort order indicator for `object`. */ function compareMultiple(object, other, orders) { var index = -1, objCriteria = object.criteria, othCriteria = other.criteria, length = objCriteria.length, ordersLength = orders.length; while (++index < length) { var result = compareAscending(objCriteria[index], othCriteria[index]); if (result) { if (index >= ordersLength) { return result; } var order = orders[index]; return result * (order == 'desc' ? -1 : 1); } } // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications // that causes it, under certain circumstances, to provide the same value for // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 // for more details. // // This also ensures a stable sort in V8 and other engines. // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. return object.index - other.index; } /** * Creates an array that is the composition of partially applied arguments, * placeholders, and provided arguments into a single array of arguments. * * @private * @param {Array} args The provided arguments. * @param {Array} partials The arguments to prepend to those provided. * @param {Array} holders The `partials` placeholder indexes. * @params {boolean} [isCurried] Specify composing for a curried function. * @returns {Array} Returns the new array of composed arguments. */ function composeArgs(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersLength = holders.length, leftIndex = -1, leftLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(leftLength + rangeLength), isUncurried = !isCurried; while (++leftIndex < leftLength) { result[leftIndex] = partials[leftIndex]; } while (++argsIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[holders[argsIndex]] = args[argsIndex]; } } while (rangeLength--) { result[leftIndex++] = args[argsIndex++]; } return result; } /** * This function is like `composeArgs` except that the arguments composition * is tailored for `_.partialRight`. * * @private * @param {Array} args The provided arguments. * @param {Array} partials The arguments to append to those provided. * @param {Array} holders The `partials` placeholder indexes. * @params {boolean} [isCurried] Specify composing for a curried function. * @returns {Array} Returns the new array of composed arguments. */ function composeArgsRight(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersIndex = -1, holdersLength = holders.length, rightIndex = -1, rightLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(rangeLength + rightLength), isUncurried = !isCurried; while (++argsIndex < rangeLength) { result[argsIndex] = args[argsIndex]; } var offset = argsIndex; while (++rightIndex < rightLength) { result[offset + rightIndex] = partials[rightIndex]; } while (++holdersIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[offset + holders[holdersIndex]] = args[argsIndex++]; } } return result; } /** * Copies the values of `source` to `array`. * * @private * @param {Array} source The array to copy values from. * @param {Array} [array=[]] The array to copy values to. * @returns {Array} Returns `array`. */ function copyArray(source, array) { var index = -1, length = source.length; array || (array = Array(length)); while (++index < length) { array[index] = source[index]; } return array; } /** * Copies properties of `source` to `object`. * * @private * @param {Object} source The object to copy properties from. * @param {Array} props The property identifiers to copy. * @param {Object} [object={}] The object to copy properties to. * @param {Function} [customizer] The function to customize copied values. * @returns {Object} Returns `object`. */ function copyObject(source, props, object, customizer) { var isNew = !object; object || (object = {}); var index = -1, length = props.length; while (++index < length) { var key = props[index]; var newValue = customizer ? customizer(object[key], source[key], key, object, source) : undefined; if (newValue === undefined) { newValue = source[key]; } if (isNew) { baseAssignValue(object, key, newValue); } else { assignValue(object, key, newValue); } } return object; } /** * Copies own symbols of `source` to `object`. * * @private * @param {Object} source The object to copy symbols from. * @param {Object} [object={}] The object to copy symbols to. * @returns {Object} Returns `object`. */ function copySymbols(source, object) { return copyObject(source, getSymbols(source), object); } /** * Copies own and inherited symbols of `source` to `object`. * * @private * @param {Object} source The object to copy symbols from. * @param {Object} [object={}] The object to copy symbols to. * @returns {Object} Returns `object`. */ function copySymbolsIn(source, object) { return copyObject(source, getSymbolsIn(source), object); } /** * Creates a function like `_.groupBy`. * * @private * @param {Function} setter The function to set accumulator values. * @param {Function} [initializer] The accumulator object initializer. * @returns {Function} Returns the new aggregator function. */ function createAggregator(setter, initializer) { return function(collection, iteratee) { var func = isArray(collection) ? arrayAggregator : baseAggregator, accumulator = initializer ? initializer() : {}; return func(collection, setter, getIteratee(iteratee, 2), accumulator); }; } /** * Creates a function like `_.assign`. * * @private * @param {Function} assigner The function to assign values. * @returns {Function} Returns the new assigner function. */ function createAssigner(assigner) { return baseRest(function(object, sources) { var index = -1, length = sources.length, customizer = length > 1 ? sources[length - 1] : undefined, guard = length > 2 ? sources[2] : undefined; customizer = (assigner.length > 3 && typeof customizer == 'function') ? (length--, customizer) : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { customizer = length < 3 ? undefined : customizer; length = 1; } object = Object(object); while (++index < length) { var source = sources[index]; if (source) { assigner(object, source, index, customizer); } } return object; }); } /** * Creates a `baseEach` or `baseEachRight` function. * * @private * @param {Function} eachFunc The function to iterate over a collection. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new base function. */ function createBaseEach(eachFunc, fromRight) { return function(collection, iteratee) { if (collection == null) { return collection; } if (!isArrayLike(collection)) { return eachFunc(collection, iteratee); } var length = collection.length, index = fromRight ? length : -1, iterable = Object(collection); while ((fromRight ? index-- : ++index < length)) { if (iteratee(iterable[index], index, iterable) === false) { break; } } return collection; }; } /** * Creates a base function for methods like `_.forIn` and `_.forOwn`. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new base function. */ function createBaseFor(fromRight) { return function(object, iteratee, keysFunc) { var index = -1, iterable = Object(object), props = keysFunc(object), length = props.length; while (length--) { var key = props[fromRight ? length : ++index]; if (iteratee(iterable[key], key, iterable) === false) { break; } } return object; }; } /** * Creates a function that wraps `func` to invoke it with the optional `this` * binding of `thisArg`. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} [thisArg] The `this` binding of `func`. * @returns {Function} Returns the new wrapped function. */ function createBind(func, bitmask, thisArg) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return fn.apply(isBind ? thisArg : this, arguments); } return wrapper; } /** * Creates a function like `_.lowerFirst`. * * @private * @param {string} methodName The name of the `String` case method to use. * @returns {Function} Returns the new case function. */ function createCaseFirst(methodName) { return function(string) { string = toString(string); var strSymbols = hasUnicode(string) ? stringToArray(string) : undefined; var chr = strSymbols ? strSymbols[0] : string.charAt(0); var trailing = strSymbols ? castSlice(strSymbols, 1).join('') : string.slice(1); return chr[methodName]() + trailing; }; } /** * Creates a function like `_.camelCase`. * * @private * @param {Function} callback The function to combine each word. * @returns {Function} Returns the new compounder function. */ function createCompounder(callback) { return function(string) { return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); }; } /** * Creates a function that produces an instance of `Ctor` regardless of * whether it was invoked as part of a `new` expression or by `call` or `apply`. * * @private * @param {Function} Ctor The constructor to wrap. * @returns {Function} Returns the new wrapped function. */ function createCtor(Ctor) { return function() { // Use a `switch` statement to work with class constructors. See // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist // for more details. var args = arguments; switch (args.length) { case 0: return new Ctor; case 1: return new Ctor(args[0]); case 2: return new Ctor(args[0], args[1]); case 3: return new Ctor(args[0], args[1], args[2]); case 4: return new Ctor(args[0], args[1], args[2], args[3]); case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); } var thisBinding = baseCreate(Ctor.prototype), result = Ctor.apply(thisBinding, args); // Mimic the constructor's `return` behavior. // See https://es5.github.io/#x13.2.2 for more details. return isObject(result) ? result : thisBinding; }; } /** * Creates a function that wraps `func` to enable currying. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {number} arity The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createCurry(func, bitmask, arity) { var Ctor = createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length, placeholder = getHolder(wrapper); while (index--) { args[index] = arguments[index]; } var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) ? [] : replaceHolders(args, placeholder); length -= holders.length; if (length < arity) { return createRecurry( func, bitmask, createHybrid, wrapper.placeholder, undefined, args, holders, undefined, undefined, arity - length); } var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return apply(fn, this, args); } return wrapper; } /** * Creates a `_.find` or `_.findLast` function. * * @private * @param {Function} findIndexFunc The function to find the collection index. * @returns {Function} Returns the new find function. */ function createFind(findIndexFunc) { return function(collection, predicate, fromIndex) { var iterable = Object(collection); if (!isArrayLike(collection)) { var iteratee = getIteratee(predicate, 3); collection = keys(collection); predicate = function(key) { return iteratee(iterable[key], key, iterable); }; } var index = findIndexFunc(collection, predicate, fromIndex); return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; }; } /** * Creates a `_.flow` or `_.flowRight` function. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new flow function. */ function createFlow(fromRight) { return flatRest(function(funcs) { var length = funcs.length, index = length, prereq = LodashWrapper.prototype.thru; if (fromRight) { funcs.reverse(); } while (index--) { var func = funcs[index]; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (prereq && !wrapper && getFuncName(func) == 'wrapper') { var wrapper = new LodashWrapper([], true); } } index = wrapper ? index : length; while (++index < length) { func = funcs[index]; var funcName = getFuncName(func), data = funcName == 'wrapper' ? getData(func) : undefined; if (data && isLaziable(data[0]) && data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && !data[4].length && data[9] == 1 ) { wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); } else { wrapper = (func.length == 1 && isLaziable(func)) ? wrapper[funcName]() : wrapper.thru(func); } } return function() { var args = arguments, value = args[0]; if (wrapper && args.length == 1 && isArray(value)) { return wrapper.plant(value).value(); } var index = 0, result = length ? funcs[index].apply(this, args) : value; while (++index < length) { result = funcs[index].call(this, result); } return result; }; }); } /** * Creates a function that wraps `func` to invoke it with optional `this` * binding of `thisArg`, partial application, and currying. * * @private * @param {Function|string} func The function or method name to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to prepend to those provided to * the new function. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [partialsRight] The arguments to append to those provided * to the new function. * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { var isAry = bitmask & WRAP_ARY_FLAG, isBind = bitmask & WRAP_BIND_FLAG, isBindKey = bitmask & WRAP_BIND_KEY_FLAG, isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), isFlip = bitmask & WRAP_FLIP_FLAG, Ctor = isBindKey ? undefined : createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length; while (index--) { args[index] = arguments[index]; } if (isCurried) { var placeholder = getHolder(wrapper), holdersCount = countHolders(args, placeholder); } if (partials) { args = composeArgs(args, partials, holders, isCurried); } if (partialsRight) { args = composeArgsRight(args, partialsRight, holdersRight, isCurried); } length -= holdersCount; if (isCurried && length < arity) { var newHolders = replaceHolders(args, placeholder); return createRecurry( func, bitmask, createHybrid, wrapper.placeholder, thisArg, args, newHolders, argPos, ary, arity - length ); } var thisBinding = isBind ? thisArg : this, fn = isBindKey ? thisBinding[func] : func; length = args.length; if (argPos) { args = reorder(args, argPos); } else if (isFlip && length > 1) { args.reverse(); } if (isAry && ary < length) { args.length = ary; } if (this && this !== root && this instanceof wrapper) { fn = Ctor || createCtor(fn); } return fn.apply(thisBinding, args); } return wrapper; } /** * Creates a function like `_.invertBy`. * * @private * @param {Function} setter The function to set accumulator values. * @param {Function} toIteratee The function to resolve iteratees. * @returns {Function} Returns the new inverter function. */ function createInverter(setter, toIteratee) { return function(object, iteratee) { return baseInverter(object, setter, toIteratee(iteratee), {}); }; } /** * Creates a function that performs a mathematical operation on two values. * * @private * @param {Function} operator The function to perform the operation. * @param {number} [defaultValue] The value used for `undefined` arguments. * @returns {Function} Returns the new mathematical operation function. */ function createMathOperation(operator, defaultValue) { return function(value, other) { var result; if (value === undefined && other === undefined) { return defaultValue; } if (value !== undefined) { result = value; } if (other !== undefined) { if (result === undefined) { return other; } if (typeof value == 'string' || typeof other == 'string') { value = baseToString(value); other = baseToString(other); } else { value = baseToNumber(value); other = baseToNumber(other); } result = operator(value, other); } return result; }; } /** * Creates a function like `_.over`. * * @private * @param {Function} arrayFunc The function to iterate over iteratees. * @returns {Function} Returns the new over function. */ function createOver(arrayFunc) { return flatRest(function(iteratees) { iteratees = arrayMap(iteratees, baseUnary(getIteratee())); return baseRest(function(args) { var thisArg = this; return arrayFunc(iteratees, function(iteratee) { return apply(iteratee, thisArg, args); }); }); }); } /** * Creates the padding for `string` based on `length`. The `chars` string * is truncated if the number of characters exceeds `length`. * * @private * @param {number} length The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padding for `string`. */ function createPadding(length, chars) { chars = chars === undefined ? ' ' : baseToString(chars); var charsLength = chars.length; if (charsLength < 2) { return charsLength ? baseRepeat(chars, length) : chars; } var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); return hasUnicode(chars) ? castSlice(stringToArray(result), 0, length).join('') : result.slice(0, length); } /** * Creates a function that wraps `func` to invoke it with the `this` binding * of `thisArg` and `partials` prepended to the arguments it receives. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} thisArg The `this` binding of `func`. * @param {Array} partials The arguments to prepend to those provided to * the new function. * @returns {Function} Returns the new wrapped function. */ function createPartial(func, bitmask, thisArg, partials) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var argsIndex = -1, argsLength = arguments.length, leftIndex = -1, leftLength = partials.length, args = Array(leftLength + argsLength), fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; while (++leftIndex < leftLength) { args[leftIndex] = partials[leftIndex]; } while (argsLength--) { args[leftIndex++] = arguments[++argsIndex]; } return apply(fn, isBind ? thisArg : this, args); } return wrapper; } /** * Creates a `_.range` or `_.rangeRight` function. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new range function. */ function createRange(fromRight) { return function(start, end, step) { if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { end = step = undefined; } // Ensure the sign of `-0` is preserved. start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); return baseRange(start, end, step, fromRight); }; } /** * Creates a function that performs a relational operation on two values. * * @private * @param {Function} operator The function to perform the operation. * @returns {Function} Returns the new relational operation function. */ function createRelationalOperation(operator) { return function(value, other) { if (!(typeof value == 'string' && typeof other == 'string')) { value = toNumber(value); other = toNumber(other); } return operator(value, other); }; } /** * Creates a function that wraps `func` to continue currying. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {Function} wrapFunc The function to create the `func` wrapper. * @param {*} placeholder The placeholder value. * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to prepend to those provided to * the new function. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { var isCurry = bitmask & WRAP_CURRY_FLAG, newHolders = isCurry ? holders : undefined, newHoldersRight = isCurry ? undefined : holders, newPartials = isCurry ? partials : undefined, newPartialsRight = isCurry ? undefined : partials; bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); } var newData = [ func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, newHoldersRight, argPos, ary, arity ]; var result = wrapFunc.apply(undefined, newData); if (isLaziable(func)) { setData(result, newData); } result.placeholder = placeholder; return setWrapToString(result, func, bitmask); } /** * Creates a function like `_.round`. * * @private * @param {string} methodName The name of the `Math` method to use when rounding. * @returns {Function} Returns the new round function. */ function createRound(methodName) { var func = Math[methodName]; return function(number, precision) { number = toNumber(number); precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); if (precision && nativeIsFinite(number)) { // Shift with exponential notation to avoid floating-point issues. // See [MDN](https://mdn.io/round#Examples) for more details. var pair = (toString(number) + 'e').split('e'), value = func(pair[0] + 'e' + (+pair[1] + precision)); pair = (toString(value) + 'e').split('e'); return +(pair[0] + 'e' + (+pair[1] - precision)); } return func(number); }; } /** * Creates a set object of `values`. * * @private * @param {Array} values The values to add to the set. * @returns {Object} Returns the new set. */ var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { return new Set(values); }; /** * Creates a `_.toPairs` or `_.toPairsIn` function. * * @private * @param {Function} keysFunc The function to get the keys of a given object. * @returns {Function} Returns the new pairs function. */ function createToPairs(keysFunc) { return function(object) { var tag = getTag(object); if (tag == mapTag) { return mapToArray(object); } if (tag == setTag) { return setToPairs(object); } return baseToPairs(object, keysFunc(object)); }; } /** * Creates a function that either curries or invokes `func` with optional * `this` binding and partially applied arguments. * * @private * @param {Function|string} func The function or method name to wrap. * @param {number} bitmask The bitmask flags. * 1 - `_.bind` * 2 - `_.bindKey` * 4 - `_.curry` or `_.curryRight` of a bound function * 8 - `_.curry` * 16 - `_.curryRight` * 32 - `_.partial` * 64 - `_.partialRight` * 128 - `_.rearg` * 256 - `_.ary` * 512 - `_.flip` * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to be partially applied. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; if (!isBindKey && typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } var length = partials ? partials.length : 0; if (!length) { bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); partials = holders = undefined; } ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); arity = arity === undefined ? arity : toInteger(arity); length -= holders ? holders.length : 0; if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { var partialsRight = partials, holdersRight = holders; partials = holders = undefined; } var data = isBindKey ? undefined : getData(func); var newData = [ func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity ]; if (data) { mergeData(newData, data); } func = newData[0]; bitmask = newData[1]; thisArg = newData[2]; partials = newData[3]; holders = newData[4]; arity = newData[9] = newData[9] === undefined ? (isBindKey ? 0 : func.length) : nativeMax(newData[9] - length, 0); if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); } if (!bitmask || bitmask == WRAP_BIND_FLAG) { var result = createBind(func, bitmask, thisArg); } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { result = createCurry(func, bitmask, arity); } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { result = createPartial(func, bitmask, thisArg, partials); } else { result = createHybrid.apply(undefined, newData); } var setter = data ? baseSetData : setData; return setWrapToString(setter(result, newData), func, bitmask); } /** * Used by `_.defaults` to customize its `_.assignIn` use to assign properties * of source objects to the destination object for all destination properties * that resolve to `undefined`. * * @private * @param {*} objValue The destination value. * @param {*} srcValue The source value. * @param {string} key The key of the property to assign. * @param {Object} object The parent object of `objValue`. * @returns {*} Returns the value to assign. */ function customDefaultsAssignIn(objValue, srcValue, key, object) { if (objValue === undefined || (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { return srcValue; } return objValue; } /** * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source * objects into destination objects that are passed thru. * * @private * @param {*} objValue The destination value. * @param {*} srcValue The source value. * @param {string} key The key of the property to merge. * @param {Object} object The parent object of `objValue`. * @param {Object} source The parent object of `srcValue`. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. * @returns {*} Returns the value to assign. */ function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { if (isObject(objValue) && isObject(srcValue)) { // Recursively merge objects and arrays (susceptible to call stack limits). stack.set(srcValue, objValue); baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); stack['delete'](srcValue); } return objValue; } /** * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain * objects. * * @private * @param {*} value The value to inspect. * @param {string} key The key of the property to inspect. * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. */ function customOmitClone(value) { return isPlainObject(value) ? undefined : value; } /** * A specialized version of `baseIsEqualDeep` for arrays with support for * partial deep comparisons. * * @private * @param {Array} array The array to compare. * @param {Array} other The other array to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `array` and `other` objects. * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. */ function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, arrLength = array.length, othLength = other.length; if (arrLength != othLength && !(isPartial && othLength > arrLength)) { return false; } // Check that cyclic values are equal. var arrStacked = stack.get(array); var othStacked = stack.get(other); if (arrStacked && othStacked) { return arrStacked == other && othStacked == array; } var index = -1, result = true, seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; stack.set(array, other); stack.set(other, array); // Ignore non-index properties. while (++index < arrLength) { var arrValue = array[index], othValue = other[index]; if (customizer) { var compared = isPartial ? customizer(othValue, arrValue, index, other, array, stack) : customizer(arrValue, othValue, index, array, other, stack); } if (compared !== undefined) { if (compared) { continue; } result = false; break; } // Recursively compare arrays (susceptible to call stack limits). if (seen) { if (!arraySome(other, function(othValue, othIndex) { if (!cacheHas(seen, othIndex) && (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { return seen.push(othIndex); } })) { result = false; break; } } else if (!( arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack) )) { result = false; break; } } stack['delete'](array); stack['delete'](other); return result; } /** * A specialized version of `baseIsEqualDeep` for comparing objects of * the same `toStringTag`. * * **Note:** This function only supports comparing values with tags of * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {string} tag The `toStringTag` of the objects to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { switch (tag) { case dataViewTag: if ((object.byteLength != other.byteLength) || (object.byteOffset != other.byteOffset)) { return false; } object = object.buffer; other = other.buffer; case arrayBufferTag: if ((object.byteLength != other.byteLength) || !equalFunc(new Uint8Array(object), new Uint8Array(other))) { return false; } return true; case boolTag: case dateTag: case numberTag: // Coerce booleans to `1` or `0` and dates to milliseconds. // Invalid dates are coerced to `NaN`. return eq(+object, +other); case errorTag: return object.name == other.name && object.message == other.message; case regexpTag: case stringTag: // Coerce regexes to strings and treat strings, primitives and objects, // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring // for more details. return object == (other + ''); case mapTag: var convert = mapToArray; case setTag: var isPartial = bitmask & COMPARE_PARTIAL_FLAG; convert || (convert = setToArray); if (object.size != other.size && !isPartial) { return false; } // Assume cyclic values are equal. var stacked = stack.get(object); if (stacked) { return stacked == other; } bitmask |= COMPARE_UNORDERED_FLAG; // Recursively compare objects (susceptible to call stack limits). stack.set(object, other); var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); stack['delete'](object); return result; case symbolTag: if (symbolValueOf) { return symbolValueOf.call(object) == symbolValueOf.call(other); } } return false; } /** * A specialized version of `baseIsEqualDeep` for objects with support for * partial deep comparisons. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, objProps = getAllKeys(object), objLength = objProps.length, othProps = getAllKeys(other), othLength = othProps.length; if (objLength != othLength && !isPartial) { return false; } var index = objLength; while (index--) { var key = objProps[index]; if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { return false; } } // Check that cyclic values are equal. var objStacked = stack.get(object); var othStacked = stack.get(other); if (objStacked && othStacked) { return objStacked == other && othStacked == object; } var result = true; stack.set(object, other); stack.set(other, object); var skipCtor = isPartial; while (++index < objLength) { key = objProps[index]; var objValue = object[key], othValue = other[key]; if (customizer) { var compared = isPartial ? customizer(othValue, objValue, key, other, object, stack) : customizer(objValue, othValue, key, object, other, stack); } // Recursively compare objects (susceptible to call stack limits). if (!(compared === undefined ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) : compared )) { result = false; break; } skipCtor || (skipCtor = key == 'constructor'); } if (result && !skipCtor) { var objCtor = object.constructor, othCtor = other.constructor; // Non `Object` object instances with different constructors are not equal. if (objCtor != othCtor && ('constructor' in object && 'constructor' in other) && !(typeof objCtor == 'function' && objCtor instanceof objCtor && typeof othCtor == 'function' && othCtor instanceof othCtor)) { result = false; } } stack['delete'](object); stack['delete'](other); return result; } /** * A specialized version of `baseRest` which flattens the rest array. * * @private * @param {Function} func The function to apply a rest parameter to. * @returns {Function} Returns the new function. */ function flatRest(func) { return setToString(overRest(func, undefined, flatten), func + ''); } /** * Creates an array of own enumerable property names and symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names and symbols. */ function getAllKeys(object) { return baseGetAllKeys(object, keys, getSymbols); } /** * Creates an array of own and inherited enumerable property names and * symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names and symbols. */ function getAllKeysIn(object) { return baseGetAllKeys(object, keysIn, getSymbolsIn); } /** * Gets metadata for `func`. * * @private * @param {Function} func The function to query. * @returns {*} Returns the metadata for `func`. */ var getData = !metaMap ? noop : function(func) { return metaMap.get(func); }; /** * Gets the name of `func`. * * @private * @param {Function} func The function to query. * @returns {string} Returns the function name. */ function getFuncName(func) { var result = (func.name + ''), array = realNames[result], length = hasOwnProperty.call(realNames, result) ? array.length : 0; while (length--) { var data = array[length], otherFunc = data.func; if (otherFunc == null || otherFunc == func) { return data.name; } } return result; } /** * Gets the argument placeholder value for `func`. * * @private * @param {Function} func The function to inspect. * @returns {*} Returns the placeholder value. */ function getHolder(func) { var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; return object.placeholder; } /** * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, * this function returns the custom method, otherwise it returns `baseIteratee`. * If arguments are provided, the chosen function is invoked with them and * its result is returned. * * @private * @param {*} [value] The value to convert to an iteratee. * @param {number} [arity] The arity of the created iteratee. * @returns {Function} Returns the chosen function or its result. */ function getIteratee() { var result = lodash.iteratee || iteratee; result = result === iteratee ? baseIteratee : result; return arguments.length ? result(arguments[0], arguments[1]) : result; } /** * Gets the data for `map`. * * @private * @param {Object} map The map to query. * @param {string} key The reference key. * @returns {*} Returns the map data. */ function getMapData(map, key) { var data = map.__data__; return isKeyable(key) ? data[typeof key == 'string' ? 'string' : 'hash'] : data.map; } /** * Gets the property names, values, and compare flags of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the match data of `object`. */ function getMatchData(object) { var result = keys(object), length = result.length; while (length--) { var key = result[length], value = object[key]; result[length] = [key, value, isStrictComparable(value)]; } return result; } /** * Gets the native function at `key` of `object`. * * @private * @param {Object} object The object to query. * @param {string} key The key of the method to get. * @returns {*} Returns the function if it's native, else `undefined`. */ function getNative(object, key) { var value = getValue(object, key); return baseIsNative(value) ? value : undefined; } /** * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. * * @private * @param {*} value The value to query. * @returns {string} Returns the raw `toStringTag`. */ function getRawTag(value) { var isOwn = hasOwnProperty.call(value, symToStringTag), tag = value[symToStringTag]; try { value[symToStringTag] = undefined; var unmasked = true; } catch (e) {} var result = nativeObjectToString.call(value); if (unmasked) { if (isOwn) { value[symToStringTag] = tag; } else { delete value[symToStringTag]; } } return result; } /** * Creates an array of the own enumerable symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of symbols. */ var getSymbols = !nativeGetSymbols ? stubArray : function(object) { if (object == null) { return []; } object = Object(object); return arrayFilter(nativeGetSymbols(object), function(symbol) { return propertyIsEnumerable.call(object, symbol); }); }; /** * Creates an array of the own and inherited enumerable symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of symbols. */ var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { var result = []; while (object) { arrayPush(result, getSymbols(object)); object = getPrototype(object); } return result; }; /** * Gets the `toStringTag` of `value`. * * @private * @param {*} value The value to query. * @returns {string} Returns the `toStringTag`. */ var getTag = baseGetTag; // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || (Map && getTag(new Map) != mapTag) || (Promise && getTag(Promise.resolve()) != promiseTag) || (Set && getTag(new Set) != setTag) || (WeakMap && getTag(new WeakMap) != weakMapTag)) { getTag = function(value) { var result = baseGetTag(value), Ctor = result == objectTag ? value.constructor : undefined, ctorString = Ctor ? toSource(Ctor) : ''; if (ctorString) { switch (ctorString) { case dataViewCtorString: return dataViewTag; case mapCtorString: return mapTag; case promiseCtorString: return promiseTag; case setCtorString: return setTag; case weakMapCtorString: return weakMapTag; } } return result; }; } /** * Gets the view, applying any `transforms` to the `start` and `end` positions. * * @private * @param {number} start The start of the view. * @param {number} end The end of the view. * @param {Array} transforms The transformations to apply to the view. * @returns {Object} Returns an object containing the `start` and `end` * positions of the view. */ function getView(start, end, transforms) { var index = -1, length = transforms.length; while (++index < length) { var data = transforms[index], size = data.size; switch (data.type) { case 'drop': start += size; break; case 'dropRight': end -= size; break; case 'take': end = nativeMin(end, start + size); break; case 'takeRight': start = nativeMax(start, end - size); break; } } return { 'start': start, 'end': end }; } /** * Extracts wrapper details from the `source` body comment. * * @private * @param {string} source The source to inspect. * @returns {Array} Returns the wrapper details. */ function getWrapDetails(source) { var match = source.match(reWrapDetails); return match ? match[1].split(reSplitDetails) : []; } /** * Checks if `path` exists on `object`. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @param {Function} hasFunc The function to check properties. * @returns {boolean} Returns `true` if `path` exists, else `false`. */ function hasPath(object, path, hasFunc) { path = castPath(path, object); var index = -1, length = path.length, result = false; while (++index < length) { var key = toKey(path[index]); if (!(result = object != null && hasFunc(object, key))) { break; } object = object[key]; } if (result || ++index != length) { return result; } length = object == null ? 0 : object.length; return !!length && isLength(length) && isIndex(key, length) && (isArray(object) || isArguments(object)); } /** * Initializes an array clone. * * @private * @param {Array} array The array to clone. * @returns {Array} Returns the initialized clone. */ function initCloneArray(array) { var length = array.length, result = new array.constructor(length); // Add properties assigned by `RegExp#exec`. if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { result.index = array.index; result.input = array.input; } return result; } /** * Initializes an object clone. * * @private * @param {Object} object The object to clone. * @returns {Object} Returns the initialized clone. */ function initCloneObject(object) { return (typeof object.constructor == 'function' && !isPrototype(object)) ? baseCreate(getPrototype(object)) : {}; } /** * Initializes an object clone based on its `toStringTag`. * * **Note:** This function only supports cloning values with tags of * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. * * @private * @param {Object} object The object to clone. * @param {string} tag The `toStringTag` of the object to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the initialized clone. */ function initCloneByTag(object, tag, isDeep) { var Ctor = object.constructor; switch (tag) { case arrayBufferTag: return cloneArrayBuffer(object); case boolTag: case dateTag: return new Ctor(+object); case dataViewTag: return cloneDataView(object, isDeep); case float32Tag: case float64Tag: case int8Tag: case int16Tag: case int32Tag: case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: return cloneTypedArray(object, isDeep); case mapTag: return new Ctor; case numberTag: case stringTag: return new Ctor(object); case regexpTag: return cloneRegExp(object); case setTag: return new Ctor; case symbolTag: return cloneSymbol(object); } } /** * Inserts wrapper `details` in a comment at the top of the `source` body. * * @private * @param {string} source The source to modify. * @returns {Array} details The details to insert. * @returns {string} Returns the modified source. */ function insertWrapDetails(source, details) { var length = details.length; if (!length) { return source; } var lastIndex = length - 1; details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; details = details.join(length > 2 ? ', ' : ' '); return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); } /** * Checks if `value` is a flattenable `arguments` object or array. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. */ function isFlattenable(value) { return isArray(value) || isArguments(value) || !!(spreadableSymbol && value && value[spreadableSymbol]); } /** * Checks if `value` is a valid array-like index. * * @private * @param {*} value The value to check. * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. */ function isIndex(value, length) { var type = typeof value; length = length == null ? MAX_SAFE_INTEGER : length; return !!length && (type == 'number' || (type != 'symbol' && reIsUint.test(value))) && (value > -1 && value % 1 == 0 && value < length); } /** * Checks if the given arguments are from an iteratee call. * * @private * @param {*} value The potential iteratee value argument. * @param {*} index The potential iteratee index or key argument. * @param {*} object The potential iteratee object argument. * @returns {boolean} Returns `true` if the arguments are from an iteratee call, * else `false`. */ function isIterateeCall(value, index, object) { if (!isObject(object)) { return false; } var type = typeof index; if (type == 'number' ? (isArrayLike(object) && isIndex(index, object.length)) : (type == 'string' && index in object) ) { return eq(object[index], value); } return false; } /** * Checks if `value` is a property name and not a property path. * * @private * @param {*} value The value to check. * @param {Object} [object] The object to query keys on. * @returns {boolean} Returns `true` if `value` is a property name, else `false`. */ function isKey(value, object) { if (isArray(value)) { return false; } var type = typeof value; if (type == 'number' || type == 'symbol' || type == 'boolean' || value == null || isSymbol(value)) { return true; } return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || (object != null && value in Object(object)); } /** * Checks if `value` is suitable for use as unique object key. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is suitable, else `false`. */ function isKeyable(value) { var type = typeof value; return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') ? (value !== '__proto__') : (value === null); } /** * Checks if `func` has a lazy counterpart. * * @private * @param {Function} func The function to check. * @returns {boolean} Returns `true` if `func` has a lazy counterpart, * else `false`. */ function isLaziable(func) { var funcName = getFuncName(func), other = lodash[funcName]; if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { return false; } if (func === other) { return true; } var data = getData(other); return !!data && func === data[0]; } /** * Checks if `func` has its source masked. * * @private * @param {Function} func The function to check. * @returns {boolean} Returns `true` if `func` is masked, else `false`. */ function isMasked(func) { return !!maskSrcKey && (maskSrcKey in func); } /** * Checks if `func` is capable of being masked. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `func` is maskable, else `false`. */ var isMaskable = coreJsData ? isFunction : stubFalse; /** * Checks if `value` is likely a prototype object. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. */ function isPrototype(value) { var Ctor = value && value.constructor, proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; return value === proto; } /** * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` if suitable for strict * equality comparisons, else `false`. */ function isStrictComparable(value) { return value === value && !isObject(value); } /** * A specialized version of `matchesProperty` for source values suitable * for strict equality comparisons, i.e. `===`. * * @private * @param {string} key The key of the property to get. * @param {*} srcValue The value to match. * @returns {Function} Returns the new spec function. */ function matchesStrictComparable(key, srcValue) { return function(object) { if (object == null) { return false; } return object[key] === srcValue && (srcValue !== undefined || (key in Object(object))); }; } /** * A specialized version of `_.memoize` which clears the memoized function's * cache when it exceeds `MAX_MEMOIZE_SIZE`. * * @private * @param {Function} func The function to have its output memoized. * @returns {Function} Returns the new memoized function. */ function memoizeCapped(func) { var result = memoize(func, function(key) { if (cache.size === MAX_MEMOIZE_SIZE) { cache.clear(); } return key; }); var cache = result.cache; return result; } /** * Merges the function metadata of `source` into `data`. * * Merging metadata reduces the number of wrappers used to invoke a function. * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` * may be applied regardless of execution order. Methods like `_.ary` and * `_.rearg` modify function arguments, making the order in which they are * executed important, preventing the merging of metadata. However, we make * an exception for a safe combined case where curried functions have `_.ary` * and or `_.rearg` applied. * * @private * @param {Array} data The destination metadata. * @param {Array} source The source metadata. * @returns {Array} Returns `data`. */ function mergeData(data, source) { var bitmask = data[1], srcBitmask = source[1], newBitmask = bitmask | srcBitmask, isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); var isCombo = ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); // Exit early if metadata can't be merged. if (!(isCommon || isCombo)) { return data; } // Use source `thisArg` if available. if (srcBitmask & WRAP_BIND_FLAG) { data[2] = source[2]; // Set when currying a bound function. newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; } // Compose partial arguments. var value = source[3]; if (value) { var partials = data[3]; data[3] = partials ? composeArgs(partials, value, source[4]) : value; data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; } // Compose partial right arguments. value = source[5]; if (value) { partials = data[5]; data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; } // Use source `argPos` if available. value = source[7]; if (value) { data[7] = value; } // Use source `ary` if it's smaller. if (srcBitmask & WRAP_ARY_FLAG) { data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); } // Use source `arity` if one is not provided. if (data[9] == null) { data[9] = source[9]; } // Use source `func` and merge bitmasks. data[0] = source[0]; data[1] = newBitmask; return data; } /** * This function is like * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) * except that it includes inherited enumerable properties. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function nativeKeysIn(object) { var result = []; if (object != null) { for (var key in Object(object)) { result.push(key); } } return result; } /** * Converts `value` to a string using `Object.prototype.toString`. * * @private * @param {*} value The value to convert. * @returns {string} Returns the converted string. */ function objectToString(value) { return nativeObjectToString.call(value); } /** * A specialized version of `baseRest` which transforms the rest array. * * @private * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @param {Function} transform The rest array transform. * @returns {Function} Returns the new function. */ function overRest(func, start, transform) { start = nativeMax(start === undefined ? (func.length - 1) : start, 0); return function() { var args = arguments, index = -1, length = nativeMax(args.length - start, 0), array = Array(length); while (++index < length) { array[index] = args[start + index]; } index = -1; var otherArgs = Array(start + 1); while (++index < start) { otherArgs[index] = args[index]; } otherArgs[start] = transform(array); return apply(func, this, otherArgs); }; } /** * Gets the parent value at `path` of `object`. * * @private * @param {Object} object The object to query. * @param {Array} path The path to get the parent value of. * @returns {*} Returns the parent value. */ function parent(object, path) { return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); } /** * Reorder `array` according to the specified indexes where the element at * the first index is assigned as the first element, the element at * the second index is assigned as the second element, and so on. * * @private * @param {Array} array The array to reorder. * @param {Array} indexes The arranged array indexes. * @returns {Array} Returns `array`. */ function reorder(array, indexes) { var arrLength = array.length, length = nativeMin(indexes.length, arrLength), oldArray = copyArray(array); while (length--) { var index = indexes[length]; array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; } return array; } /** * Gets the value at `key`, unless `key` is "__proto__" or "constructor". * * @private * @param {Object} object The object to query. * @param {string} key The key of the property to get. * @returns {*} Returns the property value. */ function safeGet(object, key) { if (key === 'constructor' && typeof object[key] === 'function') { return; } if (key == '__proto__') { return; } return object[key]; } /** * Sets metadata for `func`. * * **Note:** If this function becomes hot, i.e. is invoked a lot in a short * period of time, it will trip its breaker and transition to an identity * function to avoid garbage collection pauses in V8. See * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) * for more details. * * @private * @param {Function} func The function to associate metadata with. * @param {*} data The metadata. * @returns {Function} Returns `func`. */ var setData = shortOut(baseSetData); /** * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). * * @private * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @returns {number|Object} Returns the timer id or timeout object. */ var setTimeout = ctxSetTimeout || function(func, wait) { return root.setTimeout(func, wait); }; /** * Sets the `toString` method of `func` to return `string`. * * @private * @param {Function} func The function to modify. * @param {Function} string The `toString` result. * @returns {Function} Returns `func`. */ var setToString = shortOut(baseSetToString); /** * Sets the `toString` method of `wrapper` to mimic the source of `reference` * with wrapper details in a comment at the top of the source body. * * @private * @param {Function} wrapper The function to modify. * @param {Function} reference The reference function. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @returns {Function} Returns `wrapper`. */ function setWrapToString(wrapper, reference, bitmask) { var source = (reference + ''); return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); } /** * Creates a function that'll short out and invoke `identity` instead * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` * milliseconds. * * @private * @param {Function} func The function to restrict. * @returns {Function} Returns the new shortable function. */ function shortOut(func) { var count = 0, lastCalled = 0; return function() { var stamp = nativeNow(), remaining = HOT_SPAN - (stamp - lastCalled); lastCalled = stamp; if (remaining > 0) { if (++count >= HOT_COUNT) { return arguments[0]; } } else { count = 0; } return func.apply(undefined, arguments); }; } /** * A specialized version of `_.shuffle` which mutates and sets the size of `array`. * * @private * @param {Array} array The array to shuffle. * @param {number} [size=array.length] The size of `array`. * @returns {Array} Returns `array`. */ function shuffleSelf(array, size) { var index = -1, length = array.length, lastIndex = length - 1; size = size === undefined ? length : size; while (++index < size) { var rand = baseRandom(index, lastIndex), value = array[rand]; array[rand] = array[index]; array[index] = value; } array.length = size; return array; } /** * Converts `string` to a property path array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the property path array. */ var stringToPath = memoizeCapped(function(string) { var result = []; if (string.charCodeAt(0) === 46 /* . */) { result.push(''); } string.replace(rePropName, function(match, number, quote, subString) { result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); }); return result; }); /** * Converts `value` to a string key if it's not a string or symbol. * * @private * @param {*} value The value to inspect. * @returns {string|symbol} Returns the key. */ function toKey(value) { if (typeof value == 'string' || isSymbol(value)) { return value; } var result = (value + ''); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** * Converts `func` to its source code. * * @private * @param {Function} func The function to convert. * @returns {string} Returns the source code. */ function toSource(func) { if (func != null) { try { return funcToString.call(func); } catch (e) {} try { return (func + ''); } catch (e) {} } return ''; } /** * Updates wrapper `details` based on `bitmask` flags. * * @private * @returns {Array} details The details to modify. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @returns {Array} Returns `details`. */ function updateWrapDetails(details, bitmask) { arrayEach(wrapFlags, function(pair) { var value = '_.' + pair[0]; if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { details.push(value); } }); return details.sort(); } /** * Creates a clone of `wrapper`. * * @private * @param {Object} wrapper The wrapper to clone. * @returns {Object} Returns the cloned wrapper. */ function wrapperClone(wrapper) { if (wrapper instanceof LazyWrapper) { return wrapper.clone(); } var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); result.__actions__ = copyArray(wrapper.__actions__); result.__index__ = wrapper.__index__; result.__values__ = wrapper.__values__; return result; } /*------------------------------------------------------------------------*/ /** * Creates an array of elements split into groups the length of `size`. * If `array` can't be split evenly, the final chunk will be the remaining * elements. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to process. * @param {number} [size=1] The length of each chunk * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the new array of chunks. * @example * * _.chunk(['a', 'b', 'c', 'd'], 2); * // => [['a', 'b'], ['c', 'd']] * * _.chunk(['a', 'b', 'c', 'd'], 3); * // => [['a', 'b', 'c'], ['d']] */ function chunk(array, size, guard) { if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { size = 1; } else { size = nativeMax(toInteger(size), 0); } var length = array == null ? 0 : array.length; if (!length || size < 1) { return []; } var index = 0, resIndex = 0, result = Array(nativeCeil(length / size)); while (index < length) { result[resIndex++] = baseSlice(array, index, (index += size)); } return result; } /** * Creates an array with all falsey values removed. The values `false`, `null`, * `0`, `""`, `undefined`, and `NaN` are falsey. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to compact. * @returns {Array} Returns the new array of filtered values. * @example * * _.compact([0, 1, false, 2, '', 3]); * // => [1, 2, 3] */ function compact(array) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value) { result[resIndex++] = value; } } return result; } /** * Creates a new array concatenating `array` with any additional arrays * and/or values. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to concatenate. * @param {...*} [values] The values to concatenate. * @returns {Array} Returns the new concatenated array. * @example * * var array = [1]; * var other = _.concat(array, 2, [3], [[4]]); * * console.log(other); * // => [1, 2, 3, [4]] * * console.log(array); * // => [1] */ function concat() { var length = arguments.length; if (!length) { return []; } var args = Array(length - 1), array = arguments[0], index = length; while (index--) { args[index - 1] = arguments[index]; } return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); } /** * Creates an array of `array` values not included in the other given arrays * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. The order and references of result values are * determined by the first array. * * **Note:** Unlike `_.pullAll`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @returns {Array} Returns the new array of filtered values. * @see _.without, _.xor * @example * * _.difference([2, 1], [2, 3]); * // => [1] */ var difference = baseRest(function(array, values) { return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) : []; }); /** * This method is like `_.difference` except that it accepts `iteratee` which * is invoked for each element of `array` and `values` to generate the criterion * by which they're compared. The order and references of result values are * determined by the first array. The iteratee is invoked with one argument: * (value). * * **Note:** Unlike `_.pullAllBy`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [1.2] * * // The `_.property` iteratee shorthand. * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); * // => [{ 'x': 2 }] */ var differenceBy = baseRest(function(array, values) { var iteratee = last(values); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) : []; }); /** * This method is like `_.difference` except that it accepts `comparator` * which is invoked to compare elements of `array` to `values`. The order and * references of result values are determined by the first array. The comparator * is invoked with two arguments: (arrVal, othVal). * * **Note:** Unlike `_.pullAllWith`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); * // => [{ 'x': 2, 'y': 1 }] */ var differenceWith = baseRest(function(array, values) { var comparator = last(values); if (isArrayLikeObject(comparator)) { comparator = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) : []; }); /** * Creates a slice of `array` with `n` elements dropped from the beginning. * * @static * @memberOf _ * @since 0.5.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to drop. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.drop([1, 2, 3]); * // => [2, 3] * * _.drop([1, 2, 3], 2); * // => [3] * * _.drop([1, 2, 3], 5); * // => [] * * _.drop([1, 2, 3], 0); * // => [1, 2, 3] */ function drop(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, n < 0 ? 0 : n, length); } /** * Creates a slice of `array` with `n` elements dropped from the end. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to drop. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.dropRight([1, 2, 3]); * // => [1, 2] * * _.dropRight([1, 2, 3], 2); * // => [1] * * _.dropRight([1, 2, 3], 5); * // => [] * * _.dropRight([1, 2, 3], 0); * // => [1, 2, 3] */ function dropRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, 0, n < 0 ? 0 : n); } /** * Creates a slice of `array` excluding elements dropped from the end. * Elements are dropped until `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.dropRightWhile(users, function(o) { return !o.active; }); * // => objects for ['barney'] * * // The `_.matches` iteratee shorthand. * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); * // => objects for ['barney', 'fred'] * * // The `_.matchesProperty` iteratee shorthand. * _.dropRightWhile(users, ['active', false]); * // => objects for ['barney'] * * // The `_.property` iteratee shorthand. * _.dropRightWhile(users, 'active'); * // => objects for ['barney', 'fred', 'pebbles'] */ function dropRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true, true) : []; } /** * Creates a slice of `array` excluding elements dropped from the beginning. * Elements are dropped until `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.dropWhile(users, function(o) { return !o.active; }); * // => objects for ['pebbles'] * * // The `_.matches` iteratee shorthand. * _.dropWhile(users, { 'user': 'barney', 'active': false }); * // => objects for ['fred', 'pebbles'] * * // The `_.matchesProperty` iteratee shorthand. * _.dropWhile(users, ['active', false]); * // => objects for ['pebbles'] * * // The `_.property` iteratee shorthand. * _.dropWhile(users, 'active'); * // => objects for ['barney', 'fred', 'pebbles'] */ function dropWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true) : []; } /** * Fills elements of `array` with `value` from `start` up to, but not * including, `end`. * * **Note:** This method mutates `array`. * * @static * @memberOf _ * @since 3.2.0 * @category Array * @param {Array} array The array to fill. * @param {*} value The value to fill `array` with. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns `array`. * @example * * var array = [1, 2, 3]; * * _.fill(array, 'a'); * console.log(array); * // => ['a', 'a', 'a'] * * _.fill(Array(3), 2); * // => [2, 2, 2] * * _.fill([4, 6, 8, 10], '*', 1, 3); * // => [4, '*', '*', 10] */ function fill(array, value, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { start = 0; end = length; } return baseFill(array, value, start, end); } /** * This method is like `_.find` except that it returns the index of the first * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ * @since 1.1.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=0] The index to search from. * @returns {number} Returns the index of the found element, else `-1`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.findIndex(users, function(o) { return o.user == 'barney'; }); * // => 0 * * // The `_.matches` iteratee shorthand. * _.findIndex(users, { 'user': 'fred', 'active': false }); * // => 1 * * // The `_.matchesProperty` iteratee shorthand. * _.findIndex(users, ['active', false]); * // => 0 * * // The `_.property` iteratee shorthand. * _.findIndex(users, 'active'); * // => 2 */ function findIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseFindIndex(array, getIteratee(predicate, 3), index); } /** * This method is like `_.findIndex` except that it iterates over elements * of `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=array.length-1] The index to search from. * @returns {number} Returns the index of the found element, else `-1`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); * // => 2 * * // The `_.matches` iteratee shorthand. * _.findLastIndex(users, { 'user': 'barney', 'active': true }); * // => 0 * * // The `_.matchesProperty` iteratee shorthand. * _.findLastIndex(users, ['active', false]); * // => 2 * * // The `_.property` iteratee shorthand. * _.findLastIndex(users, 'active'); * // => 0 */ function findLastIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length - 1; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = fromIndex < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return baseFindIndex(array, getIteratee(predicate, 3), index, true); } /** * Flattens `array` a single level deep. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to flatten. * @returns {Array} Returns the new flattened array. * @example * * _.flatten([1, [2, [3, [4]], 5]]); * // => [1, 2, [3, [4]], 5] */ function flatten(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, 1) : []; } /** * Recursively flattens `array`. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to flatten. * @returns {Array} Returns the new flattened array. * @example * * _.flattenDeep([1, [2, [3, [4]], 5]]); * // => [1, 2, 3, 4, 5] */ function flattenDeep(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, INFINITY) : []; } /** * Recursively flatten `array` up to `depth` times. * * @static * @memberOf _ * @since 4.4.0 * @category Array * @param {Array} array The array to flatten. * @param {number} [depth=1] The maximum recursion depth. * @returns {Array} Returns the new flattened array. * @example * * var array = [1, [2, [3, [4]], 5]]; * * _.flattenDepth(array, 1); * // => [1, 2, [3, [4]], 5] * * _.flattenDepth(array, 2); * // => [1, 2, 3, [4], 5] */ function flattenDepth(array, depth) { var length = array == null ? 0 : array.length; if (!length) { return []; } depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(array, depth); } /** * The inverse of `_.toPairs`; this method returns an object composed * from key-value `pairs`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} pairs The key-value pairs. * @returns {Object} Returns the new object. * @example * * _.fromPairs([['a', 1], ['b', 2]]); * // => { 'a': 1, 'b': 2 } */ function fromPairs(pairs) { var index = -1, length = pairs == null ? 0 : pairs.length, result = {}; while (++index < length) { var pair = pairs[index]; result[pair[0]] = pair[1]; } return result; } /** * Gets the first element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @alias first * @category Array * @param {Array} array The array to query. * @returns {*} Returns the first element of `array`. * @example * * _.head([1, 2, 3]); * // => 1 * * _.head([]); * // => undefined */ function head(array) { return (array && array.length) ? array[0] : undefined; } /** * Gets the index at which the first occurrence of `value` is found in `array` * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. If `fromIndex` is negative, it's used as the * offset from the end of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=0] The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.indexOf([1, 2, 1, 2], 2); * // => 1 * * // Search from the `fromIndex`. * _.indexOf([1, 2, 1, 2], 2, 2); * // => 3 */ function indexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseIndexOf(array, value, index); } /** * Gets all but the last element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @returns {Array} Returns the slice of `array`. * @example * * _.initial([1, 2, 3]); * // => [1, 2] */ function initial(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 0, -1) : []; } /** * Creates an array of unique values that are included in all given arrays * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. The order and references of result values are * determined by the first array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of intersecting values. * @example * * _.intersection([2, 1], [2, 3]); * // => [2] */ var intersection = baseRest(function(arrays) { var mapped = arrayMap(arrays, castArrayLikeObject); return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped) : []; }); /** * This method is like `_.intersection` except that it accepts `iteratee` * which is invoked for each element of each `arrays` to generate the criterion * by which they're compared. The order and references of result values are * determined by the first array. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of intersecting values. * @example * * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [2.1] * * // The `_.property` iteratee shorthand. * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }] */ var intersectionBy = baseRest(function(arrays) { var iteratee = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); if (iteratee === last(mapped)) { iteratee = undefined; } else { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, getIteratee(iteratee, 2)) : []; }); /** * This method is like `_.intersection` except that it accepts `comparator` * which is invoked to compare elements of `arrays`. The order and references * of result values are determined by the first array. The comparator is * invoked with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of intersecting values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.intersectionWith(objects, others, _.isEqual); * // => [{ 'x': 1, 'y': 2 }] */ var intersectionWith = baseRest(function(arrays) { var comparator = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); comparator = typeof comparator == 'function' ? comparator : undefined; if (comparator) { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, undefined, comparator) : []; }); /** * Converts all elements in `array` into a string separated by `separator`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to convert. * @param {string} [separator=','] The element separator. * @returns {string} Returns the joined string. * @example * * _.join(['a', 'b', 'c'], '~'); * // => 'a~b~c' */ function join(array, separator) { return array == null ? '' : nativeJoin.call(array, separator); } /** * Gets the last element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @returns {*} Returns the last element of `array`. * @example * * _.last([1, 2, 3]); * // => 3 */ function last(array) { var length = array == null ? 0 : array.length; return length ? array[length - 1] : undefined; } /** * This method is like `_.indexOf` except that it iterates over elements of * `array` from right to left. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=array.length-1] The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.lastIndexOf([1, 2, 1, 2], 2); * // => 3 * * // Search from the `fromIndex`. * _.lastIndexOf([1, 2, 1, 2], 2, 2); * // => 1 */ function lastIndexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return value === value ? strictLastIndexOf(array, value, index) : baseFindIndex(array, baseIsNaN, index, true); } /** * Gets the element at index `n` of `array`. If `n` is negative, the nth * element from the end is returned. * * @static * @memberOf _ * @since 4.11.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=0] The index of the element to return. * @returns {*} Returns the nth element of `array`. * @example * * var array = ['a', 'b', 'c', 'd']; * * _.nth(array, 1); * // => 'b' * * _.nth(array, -2); * // => 'c'; */ function nth(array, n) { return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; } /** * Removes all given values from `array` using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` * to remove elements from an array by predicate. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to modify. * @param {...*} [values] The values to remove. * @returns {Array} Returns `array`. * @example * * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * * _.pull(array, 'a', 'c'); * console.log(array); * // => ['b', 'b'] */ var pull = baseRest(pullAll); /** * This method is like `_.pull` except that it accepts an array of values to remove. * * **Note:** Unlike `_.difference`, this method mutates `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @returns {Array} Returns `array`. * @example * * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * * _.pullAll(array, ['a', 'c']); * console.log(array); * // => ['b', 'b'] */ function pullAll(array, values) { return (array && array.length && values && values.length) ? basePullAll(array, values) : array; } /** * This method is like `_.pullAll` except that it accepts `iteratee` which is * invoked for each element of `array` and `values` to generate the criterion * by which they're compared. The iteratee is invoked with one argument: (value). * * **Note:** Unlike `_.differenceBy`, this method mutates `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns `array`. * @example * * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; * * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); * console.log(array); * // => [{ 'x': 2 }] */ function pullAllBy(array, values, iteratee) { return (array && array.length && values && values.length) ? basePullAll(array, values, getIteratee(iteratee, 2)) : array; } /** * This method is like `_.pullAll` except that it accepts `comparator` which * is invoked to compare elements of `array` to `values`. The comparator is * invoked with two arguments: (arrVal, othVal). * * **Note:** Unlike `_.differenceWith`, this method mutates `array`. * * @static * @memberOf _ * @since 4.6.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns `array`. * @example * * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; * * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); * console.log(array); * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] */ function pullAllWith(array, values, comparator) { return (array && array.length && values && values.length) ? basePullAll(array, values, undefined, comparator) : array; } /** * Removes elements from `array` corresponding to `indexes` and returns an * array of removed elements. * * **Note:** Unlike `_.at`, this method mutates `array`. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to modify. * @param {...(number|number[])} [indexes] The indexes of elements to remove. * @returns {Array} Returns the new array of removed elements. * @example * * var array = ['a', 'b', 'c', 'd']; * var pulled = _.pullAt(array, [1, 3]); * * console.log(array); * // => ['a', 'c'] * * console.log(pulled); * // => ['b', 'd'] */ var pullAt = flatRest(function(array, indexes) { var length = array == null ? 0 : array.length, result = baseAt(array, indexes); basePullAt(array, arrayMap(indexes, function(index) { return isIndex(index, length) ? +index : index; }).sort(compareAscending)); return result; }); /** * Removes all elements from `array` that `predicate` returns truthy for * and returns an array of the removed elements. The predicate is invoked * with three arguments: (value, index, array). * * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` * to pull elements from an array by value. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to modify. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new array of removed elements. * @example * * var array = [1, 2, 3, 4]; * var evens = _.remove(array, function(n) { * return n % 2 == 0; * }); * * console.log(array); * // => [1, 3] * * console.log(evens); * // => [2, 4] */ function remove(array, predicate) { var result = []; if (!(array && array.length)) { return result; } var index = -1, indexes = [], length = array.length; predicate = getIteratee(predicate, 3); while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result.push(value); indexes.push(index); } } basePullAt(array, indexes); return result; } /** * Reverses `array` so that the first element becomes the last, the second * element becomes the second to last, and so on. * * **Note:** This method mutates `array` and is based on * [`Array#reverse`](https://mdn.io/Array/reverse). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @returns {Array} Returns `array`. * @example * * var array = [1, 2, 3]; * * _.reverse(array); * // => [3, 2, 1] * * console.log(array); * // => [3, 2, 1] */ function reverse(array) { return array == null ? array : nativeReverse.call(array); } /** * Creates a slice of `array` from `start` up to, but not including, `end`. * * **Note:** This method is used instead of * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are * returned. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to slice. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the slice of `array`. */ function slice(array, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { start = 0; end = length; } else { start = start == null ? 0 : toInteger(start); end = end === undefined ? length : toInteger(end); } return baseSlice(array, start, end); } /** * Uses a binary search to determine the lowest index at which `value` * should be inserted into `array` in order to maintain its sort order. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * _.sortedIndex([30, 50], 40); * // => 1 */ function sortedIndex(array, value) { return baseSortedIndex(array, value); } /** * This method is like `_.sortedIndex` except that it accepts `iteratee` * which is invoked for `value` and each element of `array` to compute their * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * var objects = [{ 'x': 4 }, { 'x': 5 }]; * * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); * // => 0 * * // The `_.property` iteratee shorthand. * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); * // => 0 */ function sortedIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); } /** * This method is like `_.indexOf` except that it performs a binary * search on a sorted `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.sortedIndexOf([4, 5, 5, 5, 6], 5); * // => 1 */ function sortedIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value); if (index < length && eq(array[index], value)) { return index; } } return -1; } /** * This method is like `_.sortedIndex` except that it returns the highest * index at which `value` should be inserted into `array` in order to * maintain its sort order. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * _.sortedLastIndex([4, 5, 5, 5, 6], 5); * // => 4 */ function sortedLastIndex(array, value) { return baseSortedIndex(array, value, true); } /** * This method is like `_.sortedLastIndex` except that it accepts `iteratee` * which is invoked for `value` and each element of `array` to compute their * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * var objects = [{ 'x': 4 }, { 'x': 5 }]; * * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); * // => 1 * * // The `_.property` iteratee shorthand. * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); * // => 1 */ function sortedLastIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); } /** * This method is like `_.lastIndexOf` except that it performs a binary * search on a sorted `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); * // => 3 */ function sortedLastIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value, true) - 1; if (eq(array[index], value)) { return index; } } return -1; } /** * This method is like `_.uniq` except that it's designed and optimized * for sorted arrays. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @returns {Array} Returns the new duplicate free array. * @example * * _.sortedUniq([1, 1, 2]); * // => [1, 2] */ function sortedUniq(array) { return (array && array.length) ? baseSortedUniq(array) : []; } /** * This method is like `_.uniqBy` except that it's designed and optimized * for sorted arrays. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); * // => [1.1, 2.3] */ function sortedUniqBy(array, iteratee) { return (array && array.length) ? baseSortedUniq(array, getIteratee(iteratee, 2)) : []; } /** * Gets all but the first element of `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to query. * @returns {Array} Returns the slice of `array`. * @example * * _.tail([1, 2, 3]); * // => [2, 3] */ function tail(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 1, length) : []; } /** * Creates a slice of `array` with `n` elements taken from the beginning. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to take. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.take([1, 2, 3]); * // => [1] * * _.take([1, 2, 3], 2); * // => [1, 2] * * _.take([1, 2, 3], 5); * // => [1, 2, 3] * * _.take([1, 2, 3], 0); * // => [] */ function take(array, n, guard) { if (!(array && array.length)) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, 0, n < 0 ? 0 : n); } /** * Creates a slice of `array` with `n` elements taken from the end. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to take. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.takeRight([1, 2, 3]); * // => [3] * * _.takeRight([1, 2, 3], 2); * // => [2, 3] * * _.takeRight([1, 2, 3], 5); * // => [1, 2, 3] * * _.takeRight([1, 2, 3], 0); * // => [] */ function takeRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, n < 0 ? 0 : n, length); } /** * Creates a slice of `array` with elements taken from the end. Elements are * taken until `predicate` returns falsey. The predicate is invoked with * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.takeRightWhile(users, function(o) { return !o.active; }); * // => objects for ['fred', 'pebbles'] * * // The `_.matches` iteratee shorthand. * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); * // => objects for ['pebbles'] * * // The `_.matchesProperty` iteratee shorthand. * _.takeRightWhile(users, ['active', false]); * // => objects for ['fred', 'pebbles'] * * // The `_.property` iteratee shorthand. * _.takeRightWhile(users, 'active'); * // => [] */ function takeRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), false, true) : []; } /** * Creates a slice of `array` with elements taken from the beginning. Elements * are taken until `predicate` returns falsey. The predicate is invoked with * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.takeWhile(users, function(o) { return !o.active; }); * // => objects for ['barney', 'fred'] * * // The `_.matches` iteratee shorthand. * _.takeWhile(users, { 'user': 'barney', 'active': false }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.takeWhile(users, ['active', false]); * // => objects for ['barney', 'fred'] * * // The `_.property` iteratee shorthand. * _.takeWhile(users, 'active'); * // => [] */ function takeWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3)) : []; } /** * Creates an array of unique values, in order, from all given arrays using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of combined values. * @example * * _.union([2], [1, 2]); * // => [2, 1] */ var union = baseRest(function(arrays) { return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); }); /** * This method is like `_.union` except that it accepts `iteratee` which is * invoked for each element of each `arrays` to generate the criterion by * which uniqueness is computed. Result values are chosen from the first * array in which the value occurs. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of combined values. * @example * * _.unionBy([2.1], [1.2, 2.3], Math.floor); * // => [2.1, 1.2] * * // The `_.property` iteratee shorthand. * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }, { 'x': 2 }] */ var unionBy = baseRest(function(arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); }); /** * This method is like `_.union` except that it accepts `comparator` which * is invoked to compare elements of `arrays`. Result values are chosen from * the first array in which the value occurs. The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of combined values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.unionWith(objects, others, _.isEqual); * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ var unionWith = baseRest(function(arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); }); /** * Creates a duplicate-free version of an array, using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons, in which only the first occurrence of each element * is kept. The order of result values is determined by the order they occur * in the array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @returns {Array} Returns the new duplicate free array. * @example * * _.uniq([2, 1, 2]); * // => [2, 1] */ function uniq(array) { return (array && array.length) ? baseUniq(array) : []; } /** * This method is like `_.uniq` except that it accepts `iteratee` which is * invoked for each element in `array` to generate the criterion by which * uniqueness is computed. The order of result values is determined by the * order they occur in the array. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * _.uniqBy([2.1, 1.2, 2.3], Math.floor); * // => [2.1, 1.2] * * // The `_.property` iteratee shorthand. * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }, { 'x': 2 }] */ function uniqBy(array, iteratee) { return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; } /** * This method is like `_.uniq` except that it accepts `comparator` which * is invoked to compare elements of `array`. The order of result values is * determined by the order they occur in the array.The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.uniqWith(objects, _.isEqual); * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] */ function uniqWith(array, comparator) { comparator = typeof comparator == 'function' ? comparator : undefined; return (array && array.length) ? baseUniq(array, undefined, comparator) : []; } /** * This method is like `_.zip` except that it accepts an array of grouped * elements and creates an array regrouping the elements to their pre-zip * configuration. * * @static * @memberOf _ * @since 1.2.0 * @category Array * @param {Array} array The array of grouped elements to process. * @returns {Array} Returns the new array of regrouped elements. * @example * * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); * // => [['a', 1, true], ['b', 2, false]] * * _.unzip(zipped); * // => [['a', 'b'], [1, 2], [true, false]] */ function unzip(array) { if (!(array && array.length)) { return []; } var length = 0; array = arrayFilter(array, function(group) { if (isArrayLikeObject(group)) { length = nativeMax(group.length, length); return true; } }); return baseTimes(length, function(index) { return arrayMap(array, baseProperty(index)); }); } /** * This method is like `_.unzip` except that it accepts `iteratee` to specify * how regrouped values should be combined. The iteratee is invoked with the * elements of each group: (...group). * * @static * @memberOf _ * @since 3.8.0 * @category Array * @param {Array} array The array of grouped elements to process. * @param {Function} [iteratee=_.identity] The function to combine * regrouped values. * @returns {Array} Returns the new array of regrouped elements. * @example * * var zipped = _.zip([1, 2], [10, 20], [100, 200]); * // => [[1, 10, 100], [2, 20, 200]] * * _.unzipWith(zipped, _.add); * // => [3, 30, 300] */ function unzipWith(array, iteratee) { if (!(array && array.length)) { return []; } var result = unzip(array); if (iteratee == null) { return result; } return arrayMap(result, function(group) { return apply(iteratee, undefined, group); }); } /** * Creates an array excluding all given values using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * **Note:** Unlike `_.pull`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {...*} [values] The values to exclude. * @returns {Array} Returns the new array of filtered values. * @see _.difference, _.xor * @example * * _.without([2, 1, 2, 3], 1, 2); * // => [3] */ var without = baseRest(function(array, values) { return isArrayLikeObject(array) ? baseDifference(array, values) : []; }); /** * Creates an array of unique values that is the * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) * of the given arrays. The order of result values is determined by the order * they occur in the arrays. * * @static * @memberOf _ * @since 2.4.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of filtered values. * @see _.difference, _.without * @example * * _.xor([2, 1], [2, 3]); * // => [1, 3] */ var xor = baseRest(function(arrays) { return baseXor(arrayFilter(arrays, isArrayLikeObject)); }); /** * This method is like `_.xor` except that it accepts `iteratee` which is * invoked for each element of each `arrays` to generate the criterion by * which by which they're compared. The order of result values is determined * by the order they occur in the arrays. The iteratee is invoked with one * argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [1.2, 3.4] * * // The `_.property` iteratee shorthand. * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 2 }] */ var xorBy = baseRest(function(arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); }); /** * This method is like `_.xor` except that it accepts `comparator` which is * invoked to compare elements of `arrays`. The order of result values is * determined by the order they occur in the arrays. The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.xorWith(objects, others, _.isEqual); * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ var xorWith = baseRest(function(arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); }); /** * Creates an array of grouped elements, the first of which contains the * first elements of the given arrays, the second of which contains the * second elements of the given arrays, and so on. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to process. * @returns {Array} Returns the new array of grouped elements. * @example * * _.zip(['a', 'b'], [1, 2], [true, false]); * // => [['a', 1, true], ['b', 2, false]] */ var zip = baseRest(unzip); /** * This method is like `_.fromPairs` except that it accepts two arrays, * one of property identifiers and one of corresponding values. * * @static * @memberOf _ * @since 0.4.0 * @category Array * @param {Array} [props=[]] The property identifiers. * @param {Array} [values=[]] The property values. * @returns {Object} Returns the new object. * @example * * _.zipObject(['a', 'b'], [1, 2]); * // => { 'a': 1, 'b': 2 } */ function zipObject(props, values) { return baseZipObject(props || [], values || [], assignValue); } /** * This method is like `_.zipObject` except that it supports property paths. * * @static * @memberOf _ * @since 4.1.0 * @category Array * @param {Array} [props=[]] The property identifiers. * @param {Array} [values=[]] The property values. * @returns {Object} Returns the new object. * @example * * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } */ function zipObjectDeep(props, values) { return baseZipObject(props || [], values || [], baseSet); } /** * This method is like `_.zip` except that it accepts `iteratee` to specify * how grouped values should be combined. The iteratee is invoked with the * elements of each group: (...group). * * @static * @memberOf _ * @since 3.8.0 * @category Array * @param {...Array} [arrays] The arrays to process. * @param {Function} [iteratee=_.identity] The function to combine * grouped values. * @returns {Array} Returns the new array of grouped elements. * @example * * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { * return a + b + c; * }); * // => [111, 222] */ var zipWith = baseRest(function(arrays) { var length = arrays.length, iteratee = length > 1 ? arrays[length - 1] : undefined; iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; return unzipWith(arrays, iteratee); }); /*------------------------------------------------------------------------*/ /** * Creates a `lodash` wrapper instance that wraps `value` with explicit method * chain sequences enabled. The result of such sequences must be unwrapped * with `_#value`. * * @static * @memberOf _ * @since 1.3.0 * @category Seq * @param {*} value The value to wrap. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var users = [ * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'pebbles', 'age': 1 } * ]; * * var youngest = _ * .chain(users) * .sortBy('age') * .map(function(o) { * return o.user + ' is ' + o.age; * }) * .head() * .value(); * // => 'pebbles is 1' */ function chain(value) { var result = lodash(value); result.__chain__ = true; return result; } /** * This method invokes `interceptor` and returns `value`. The interceptor * is invoked with one argument; (value). The purpose of this method is to * "tap into" a method chain sequence in order to modify intermediate results. * * @static * @memberOf _ * @since 0.1.0 * @category Seq * @param {*} value The value to provide to `interceptor`. * @param {Function} interceptor The function to invoke. * @returns {*} Returns `value`. * @example * * _([1, 2, 3]) * .tap(function(array) { * // Mutate input array. * array.pop(); * }) * .reverse() * .value(); * // => [2, 1] */ function tap(value, interceptor) { interceptor(value); return value; } /** * This method is like `_.tap` except that it returns the result of `interceptor`. * The purpose of this method is to "pass thru" values replacing intermediate * results in a method chain sequence. * * @static * @memberOf _ * @since 3.0.0 * @category Seq * @param {*} value The value to provide to `interceptor`. * @param {Function} interceptor The function to invoke. * @returns {*} Returns the result of `interceptor`. * @example * * _(' abc ') * .chain() * .trim() * .thru(function(value) { * return [value]; * }) * .value(); * // => ['abc'] */ function thru(value, interceptor) { return interceptor(value); } /** * This method is the wrapper version of `_.at`. * * @name at * @memberOf _ * @since 1.0.0 * @category Seq * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; * * _(object).at(['a[0].b.c', 'a[1]']).value(); * // => [3, 4] */ var wrapperAt = flatRest(function(paths) { var length = paths.length, start = length ? paths[0] : 0, value = this.__wrapped__, interceptor = function(object) { return baseAt(object, paths); }; if (length > 1 || this.__actions__.length || !(value instanceof LazyWrapper) || !isIndex(start)) { return this.thru(interceptor); } value = value.slice(start, +start + (length ? 1 : 0)); value.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined }); return new LodashWrapper(value, this.__chain__).thru(function(array) { if (length && !array.length) { array.push(undefined); } return array; }); }); /** * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. * * @name chain * @memberOf _ * @since 0.1.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var users = [ * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 } * ]; * * // A sequence without explicit chaining. * _(users).head(); * // => { 'user': 'barney', 'age': 36 } * * // A sequence with explicit chaining. * _(users) * .chain() * .head() * .pick('user') * .value(); * // => { 'user': 'barney' } */ function wrapperChain() { return chain(this); } /** * Executes the chain sequence and returns the wrapped result. * * @name commit * @memberOf _ * @since 3.2.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var array = [1, 2]; * var wrapped = _(array).push(3); * * console.log(array); * // => [1, 2] * * wrapped = wrapped.commit(); * console.log(array); * // => [1, 2, 3] * * wrapped.last(); * // => 3 * * console.log(array); * // => [1, 2, 3] */ function wrapperCommit() { return new LodashWrapper(this.value(), this.__chain__); } /** * Gets the next value on a wrapped object following the * [iterator protocol](https://mdn.io/iteration_protocols#iterator). * * @name next * @memberOf _ * @since 4.0.0 * @category Seq * @returns {Object} Returns the next iterator value. * @example * * var wrapped = _([1, 2]); * * wrapped.next(); * // => { 'done': false, 'value': 1 } * * wrapped.next(); * // => { 'done': false, 'value': 2 } * * wrapped.next(); * // => { 'done': true, 'value': undefined } */ function wrapperNext() { if (this.__values__ === undefined) { this.__values__ = toArray(this.value()); } var done = this.__index__ >= this.__values__.length, value = done ? undefined : this.__values__[this.__index__++]; return { 'done': done, 'value': value }; } /** * Enables the wrapper to be iterable. * * @name Symbol.iterator * @memberOf _ * @since 4.0.0 * @category Seq * @returns {Object} Returns the wrapper object. * @example * * var wrapped = _([1, 2]); * * wrapped[Symbol.iterator]() === wrapped; * // => true * * Array.from(wrapped); * // => [1, 2] */ function wrapperToIterator() { return this; } /** * Creates a clone of the chain sequence planting `value` as the wrapped value. * * @name plant * @memberOf _ * @since 3.2.0 * @category Seq * @param {*} value The value to plant. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * function square(n) { * return n * n; * } * * var wrapped = _([1, 2]).map(square); * var other = wrapped.plant([3, 4]); * * other.value(); * // => [9, 16] * * wrapped.value(); * // => [1, 4] */ function wrapperPlant(value) { var result, parent = this; while (parent instanceof baseLodash) { var clone = wrapperClone(parent); clone.__index__ = 0; clone.__values__ = undefined; if (result) { previous.__wrapped__ = clone; } else { result = clone; } var previous = clone; parent = parent.__wrapped__; } previous.__wrapped__ = value; return result; } /** * This method is the wrapper version of `_.reverse`. * * **Note:** This method mutates the wrapped array. * * @name reverse * @memberOf _ * @since 0.1.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var array = [1, 2, 3]; * * _(array).reverse().value() * // => [3, 2, 1] * * console.log(array); * // => [3, 2, 1] */ function wrapperReverse() { var value = this.__wrapped__; if (value instanceof LazyWrapper) { var wrapped = value; if (this.__actions__.length) { wrapped = new LazyWrapper(this); } wrapped = wrapped.reverse(); wrapped.__actions__.push({ 'func': thru, 'args': [reverse], 'thisArg': undefined }); return new LodashWrapper(wrapped, this.__chain__); } return this.thru(reverse); } /** * Executes the chain sequence to resolve the unwrapped value. * * @name value * @memberOf _ * @since 0.1.0 * @alias toJSON, valueOf * @category Seq * @returns {*} Returns the resolved unwrapped value. * @example * * _([1, 2, 3]).value(); * // => [1, 2, 3] */ function wrapperValue() { return baseWrapperValue(this.__wrapped__, this.__actions__); } /*------------------------------------------------------------------------*/ /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The corresponding value of * each key is the number of times the key was returned by `iteratee`. The * iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 0.5.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * _.countBy([6.1, 4.2, 6.3], Math.floor); * // => { '4': 1, '6': 2 } * * // The `_.property` iteratee shorthand. * _.countBy(['one', 'two', 'three'], 'length'); * // => { '3': 2, '5': 1 } */ var countBy = createAggregator(function(result, value, key) { if (hasOwnProperty.call(result, key)) { ++result[key]; } else { baseAssignValue(result, key, 1); } }); /** * Checks if `predicate` returns truthy for **all** elements of `collection`. * Iteration is stopped once `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index|key, collection). * * **Note:** This method returns `true` for * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of * elements of empty collections. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false`. * @example * * _.every([true, 1, null, 'yes'], Boolean); * // => false * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': false } * ]; * * // The `_.matches` iteratee shorthand. * _.every(users, { 'user': 'barney', 'active': false }); * // => false * * // The `_.matchesProperty` iteratee shorthand. * _.every(users, ['active', false]); * // => true * * // The `_.property` iteratee shorthand. * _.every(users, 'active'); * // => false */ function every(collection, predicate, guard) { var func = isArray(collection) ? arrayEvery : baseEvery; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } /** * Iterates over elements of `collection`, returning an array of all elements * `predicate` returns truthy for. The predicate is invoked with three * arguments: (value, index|key, collection). * * **Note:** Unlike `_.remove`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new filtered array. * @see _.reject * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': true }, * { 'user': 'fred', 'age': 40, 'active': false } * ]; * * _.filter(users, function(o) { return !o.active; }); * // => objects for ['fred'] * * // The `_.matches` iteratee shorthand. * _.filter(users, { 'age': 36, 'active': true }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.filter(users, ['active', false]); * // => objects for ['fred'] * * // The `_.property` iteratee shorthand. * _.filter(users, 'active'); * // => objects for ['barney'] * * // Combining several predicates using `_.overEvery` or `_.overSome`. * _.filter(users, _.overSome([{ 'age': 36 }, ['age', 40]])); * // => objects for ['fred', 'barney'] */ function filter(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, getIteratee(predicate, 3)); } /** * Iterates over elements of `collection`, returning the first element * `predicate` returns truthy for. The predicate is invoked with three * arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=0] The index to search from. * @returns {*} Returns the matched element, else `undefined`. * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': true }, * { 'user': 'fred', 'age': 40, 'active': false }, * { 'user': 'pebbles', 'age': 1, 'active': true } * ]; * * _.find(users, function(o) { return o.age < 40; }); * // => object for 'barney' * * // The `_.matches` iteratee shorthand. * _.find(users, { 'age': 1, 'active': true }); * // => object for 'pebbles' * * // The `_.matchesProperty` iteratee shorthand. * _.find(users, ['active', false]); * // => object for 'fred' * * // The `_.property` iteratee shorthand. * _.find(users, 'active'); * // => object for 'barney' */ var find = createFind(findIndex); /** * This method is like `_.find` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @category Collection * @param {Array|Object} collection The collection to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=collection.length-1] The index to search from. * @returns {*} Returns the matched element, else `undefined`. * @example * * _.findLast([1, 2, 3, 4], function(n) { * return n % 2 == 1; * }); * // => 3 */ var findLast = createFind(findLastIndex); /** * Creates a flattened array of values by running each element in `collection` * thru `iteratee` and flattening the mapped results. The iteratee is invoked * with three arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [n, n]; * } * * _.flatMap([1, 2], duplicate); * // => [1, 1, 2, 2] */ function flatMap(collection, iteratee) { return baseFlatten(map(collection, iteratee), 1); } /** * This method is like `_.flatMap` except that it recursively flattens the * mapped results. * * @static * @memberOf _ * @since 4.7.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [[[n, n]]]; * } * * _.flatMapDeep([1, 2], duplicate); * // => [1, 1, 2, 2] */ function flatMapDeep(collection, iteratee) { return baseFlatten(map(collection, iteratee), INFINITY); } /** * This method is like `_.flatMap` except that it recursively flattens the * mapped results up to `depth` times. * * @static * @memberOf _ * @since 4.7.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {number} [depth=1] The maximum recursion depth. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [[[n, n]]]; * } * * _.flatMapDepth([1, 2], duplicate, 2); * // => [[1, 1], [2, 2]] */ function flatMapDepth(collection, iteratee, depth) { depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(map(collection, iteratee), depth); } /** * Iterates over elements of `collection` and invokes `iteratee` for each element. * The iteratee is invoked with three arguments: (value, index|key, collection). * Iteratee functions may exit iteration early by explicitly returning `false`. * * **Note:** As with other "Collections" methods, objects with a "length" * property are iterated like arrays. To avoid this behavior use `_.forIn` * or `_.forOwn` for object iteration. * * @static * @memberOf _ * @since 0.1.0 * @alias each * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array|Object} Returns `collection`. * @see _.forEachRight * @example * * _.forEach([1, 2], function(value) { * console.log(value); * }); * // => Logs `1` then `2`. * * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { * console.log(key); * }); * // => Logs 'a' then 'b' (iteration order is not guaranteed). */ function forEach(collection, iteratee) { var func = isArray(collection) ? arrayEach : baseEach; return func(collection, getIteratee(iteratee, 3)); } /** * This method is like `_.forEach` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @alias eachRight * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array|Object} Returns `collection`. * @see _.forEach * @example * * _.forEachRight([1, 2], function(value) { * console.log(value); * }); * // => Logs `2` then `1`. */ function forEachRight(collection, iteratee) { var func = isArray(collection) ? arrayEachRight : baseEachRight; return func(collection, getIteratee(iteratee, 3)); } /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The order of grouped values * is determined by the order they occur in `collection`. The corresponding * value of each key is an array of elements responsible for generating the * key. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * _.groupBy([6.1, 4.2, 6.3], Math.floor); * // => { '4': [4.2], '6': [6.1, 6.3] } * * // The `_.property` iteratee shorthand. * _.groupBy(['one', 'two', 'three'], 'length'); * // => { '3': ['one', 'two'], '5': ['three'] } */ var groupBy = createAggregator(function(result, value, key) { if (hasOwnProperty.call(result, key)) { result[key].push(value); } else { baseAssignValue(result, key, [value]); } }); /** * Checks if `value` is in `collection`. If `collection` is a string, it's * checked for a substring of `value`, otherwise * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * is used for equality comparisons. If `fromIndex` is negative, it's used as * the offset from the end of `collection`. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object|string} collection The collection to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=0] The index to search from. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. * @returns {boolean} Returns `true` if `value` is found, else `false`. * @example * * _.includes([1, 2, 3], 1); * // => true * * _.includes([1, 2, 3], 1, 2); * // => false * * _.includes({ 'a': 1, 'b': 2 }, 1); * // => true * * _.includes('abcd', 'bc'); * // => true */ function includes(collection, value, fromIndex, guard) { collection = isArrayLike(collection) ? collection : values(collection); fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; var length = collection.length; if (fromIndex < 0) { fromIndex = nativeMax(length + fromIndex, 0); } return isString(collection) ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) : (!!length && baseIndexOf(collection, value, fromIndex) > -1); } /** * Invokes the method at `path` of each element in `collection`, returning * an array of the results of each invoked method. Any additional arguments * are provided to each invoked method. If `path` is a function, it's invoked * for, and `this` bound to, each element in `collection`. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Array|Function|string} path The path of the method to invoke or * the function invoked per iteration. * @param {...*} [args] The arguments to invoke each method with. * @returns {Array} Returns the array of results. * @example * * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); * // => [[1, 5, 7], [1, 2, 3]] * * _.invokeMap([123, 456], String.prototype.split, ''); * // => [['1', '2', '3'], ['4', '5', '6']] */ var invokeMap = baseRest(function(collection, path, args) { var index = -1, isFunc = typeof path == 'function', result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function(value) { result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); }); return result; }); /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The corresponding value of * each key is the last element responsible for generating the key. The * iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * var array = [ * { 'dir': 'left', 'code': 97 }, * { 'dir': 'right', 'code': 100 } * ]; * * _.keyBy(array, function(o) { * return String.fromCharCode(o.code); * }); * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } * * _.keyBy(array, 'dir'); * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } */ var keyBy = createAggregator(function(result, value, key) { baseAssignValue(result, key, value); }); /** * Creates an array of values by running each element in `collection` thru * `iteratee`. The iteratee is invoked with three arguments: * (value, index|key, collection). * * Many lodash methods are guarded to work as iteratees for methods like * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. * * The guarded methods are: * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, * `template`, `trim`, `trimEnd`, `trimStart`, and `words` * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new mapped array. * @example * * function square(n) { * return n * n; * } * * _.map([4, 8], square); * // => [16, 64] * * _.map({ 'a': 4, 'b': 8 }, square); * // => [16, 64] (iteration order is not guaranteed) * * var users = [ * { 'user': 'barney' }, * { 'user': 'fred' } * ]; * * // The `_.property` iteratee shorthand. * _.map(users, 'user'); * // => ['barney', 'fred'] */ function map(collection, iteratee) { var func = isArray(collection) ? arrayMap : baseMap; return func(collection, getIteratee(iteratee, 3)); } /** * This method is like `_.sortBy` except that it allows specifying the sort * orders of the iteratees to sort by. If `orders` is unspecified, all values * are sorted in ascending order. Otherwise, specify an order of "desc" for * descending or "asc" for ascending sort order of corresponding values. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] * The iteratees to sort by. * @param {string[]} [orders] The sort orders of `iteratees`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. * @returns {Array} Returns the new sorted array. * @example * * var users = [ * { 'user': 'fred', 'age': 48 }, * { 'user': 'barney', 'age': 34 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'barney', 'age': 36 } * ]; * * // Sort by `user` in ascending order and by `age` in descending order. * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] */ function orderBy(collection, iteratees, orders, guard) { if (collection == null) { return []; } if (!isArray(iteratees)) { iteratees = iteratees == null ? [] : [iteratees]; } orders = guard ? undefined : orders; if (!isArray(orders)) { orders = orders == null ? [] : [orders]; } return baseOrderBy(collection, iteratees, orders); } /** * Creates an array of elements split into two groups, the first of which * contains elements `predicate` returns truthy for, the second of which * contains elements `predicate` returns falsey for. The predicate is * invoked with one argument: (value). * * @static * @memberOf _ * @since 3.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the array of grouped elements. * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': true }, * { 'user': 'pebbles', 'age': 1, 'active': false } * ]; * * _.partition(users, function(o) { return o.active; }); * // => objects for [['fred'], ['barney', 'pebbles']] * * // The `_.matches` iteratee shorthand. * _.partition(users, { 'age': 1, 'active': false }); * // => objects for [['pebbles'], ['barney', 'fred']] * * // The `_.matchesProperty` iteratee shorthand. * _.partition(users, ['active', false]); * // => objects for [['barney', 'pebbles'], ['fred']] * * // The `_.property` iteratee shorthand. * _.partition(users, 'active'); * // => objects for [['fred'], ['barney', 'pebbles']] */ var partition = createAggregator(function(result, value, key) { result[key ? 0 : 1].push(value); }, function() { return [[], []]; }); /** * Reduces `collection` to a value which is the accumulated result of running * each element in `collection` thru `iteratee`, where each successive * invocation is supplied the return value of the previous. If `accumulator` * is not given, the first element of `collection` is used as the initial * value. The iteratee is invoked with four arguments: * (accumulator, value, index|key, collection). * * Many lodash methods are guarded to work as iteratees for methods like * `_.reduce`, `_.reduceRight`, and `_.transform`. * * The guarded methods are: * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, * and `sortBy` * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The initial value. * @returns {*} Returns the accumulated value. * @see _.reduceRight * @example * * _.reduce([1, 2], function(sum, n) { * return sum + n; * }, 0); * // => 3 * * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { * (result[value] || (result[value] = [])).push(key); * return result; * }, {}); * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) */ function reduce(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduce : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); } /** * This method is like `_.reduce` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The initial value. * @returns {*} Returns the accumulated value. * @see _.reduce * @example * * var array = [[0, 1], [2, 3], [4, 5]]; * * _.reduceRight(array, function(flattened, other) { * return flattened.concat(other); * }, []); * // => [4, 5, 2, 3, 0, 1] */ function reduceRight(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduceRight : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); } /** * The opposite of `_.filter`; this method returns the elements of `collection` * that `predicate` does **not** return truthy for. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new filtered array. * @see _.filter * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': true } * ]; * * _.reject(users, function(o) { return !o.active; }); * // => objects for ['fred'] * * // The `_.matches` iteratee shorthand. * _.reject(users, { 'age': 40, 'active': true }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.reject(users, ['active', false]); * // => objects for ['fred'] * * // The `_.property` iteratee shorthand. * _.reject(users, 'active'); * // => objects for ['barney'] */ function reject(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, negate(getIteratee(predicate, 3))); } /** * Gets a random element from `collection`. * * @static * @memberOf _ * @since 2.0.0 * @category Collection * @param {Array|Object} collection The collection to sample. * @returns {*} Returns the random element. * @example * * _.sample([1, 2, 3, 4]); * // => 2 */ function sample(collection) { var func = isArray(collection) ? arraySample : baseSample; return func(collection); } /** * Gets `n` random elements at unique keys from `collection` up to the * size of `collection`. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to sample. * @param {number} [n=1] The number of elements to sample. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the random elements. * @example * * _.sampleSize([1, 2, 3], 2); * // => [3, 1] * * _.sampleSize([1, 2, 3], 4); * // => [2, 3, 1] */ function sampleSize(collection, n, guard) { if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } var func = isArray(collection) ? arraySampleSize : baseSampleSize; return func(collection, n); } /** * Creates an array of shuffled values, using a version of the * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to shuffle. * @returns {Array} Returns the new shuffled array. * @example * * _.shuffle([1, 2, 3, 4]); * // => [4, 1, 3, 2] */ function shuffle(collection) { var func = isArray(collection) ? arrayShuffle : baseShuffle; return func(collection); } /** * Gets the size of `collection` by returning its length for array-like * values or the number of own enumerable string keyed properties for objects. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object|string} collection The collection to inspect. * @returns {number} Returns the collection size. * @example * * _.size([1, 2, 3]); * // => 3 * * _.size({ 'a': 1, 'b': 2 }); * // => 2 * * _.size('pebbles'); * // => 7 */ function size(collection) { if (collection == null) { return 0; } if (isArrayLike(collection)) { return isString(collection) ? stringSize(collection) : collection.length; } var tag = getTag(collection); if (tag == mapTag || tag == setTag) { return collection.size; } return baseKeys(collection).length; } /** * Checks if `predicate` returns truthy for **any** element of `collection`. * Iteration is stopped once `predicate` returns truthy. The predicate is * invoked with three arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. * @example * * _.some([null, 0, 'yes', false], Boolean); * // => true * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false } * ]; * * // The `_.matches` iteratee shorthand. * _.some(users, { 'user': 'barney', 'active': false }); * // => false * * // The `_.matchesProperty` iteratee shorthand. * _.some(users, ['active', false]); * // => true * * // The `_.property` iteratee shorthand. * _.some(users, 'active'); * // => true */ function some(collection, predicate, guard) { var func = isArray(collection) ? arraySome : baseSome; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } /** * Creates an array of elements, sorted in ascending order by the results of * running each element in a collection thru each iteratee. This method * performs a stable sort, that is, it preserves the original sort order of * equal elements. The iteratees are invoked with one argument: (value). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {...(Function|Function[])} [iteratees=[_.identity]] * The iteratees to sort by. * @returns {Array} Returns the new sorted array. * @example * * var users = [ * { 'user': 'fred', 'age': 48 }, * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 30 }, * { 'user': 'barney', 'age': 34 } * ]; * * _.sortBy(users, [function(o) { return o.user; }]); * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 30]] * * _.sortBy(users, ['user', 'age']); * // => objects for [['barney', 34], ['barney', 36], ['fred', 30], ['fred', 48]] */ var sortBy = baseRest(function(collection, iteratees) { if (collection == null) { return []; } var length = iteratees.length; if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { iteratees = []; } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { iteratees = [iteratees[0]]; } return baseOrderBy(collection, baseFlatten(iteratees, 1), []); }); /*------------------------------------------------------------------------*/ /** * Gets the timestamp of the number of milliseconds that have elapsed since * the Unix epoch (1 January 1970 00:00:00 UTC). * * @static * @memberOf _ * @since 2.4.0 * @category Date * @returns {number} Returns the timestamp. * @example * * _.defer(function(stamp) { * console.log(_.now() - stamp); * }, _.now()); * // => Logs the number of milliseconds it took for the deferred invocation. */ var now = ctxNow || function() { return root.Date.now(); }; /*------------------------------------------------------------------------*/ /** * The opposite of `_.before`; this method creates a function that invokes * `func` once it's called `n` or more times. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {number} n The number of calls before `func` is invoked. * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * var saves = ['profile', 'settings']; * * var done = _.after(saves.length, function() { * console.log('done saving!'); * }); * * _.forEach(saves, function(type) { * asyncSave({ 'type': type, 'complete': done }); * }); * // => Logs 'done saving!' after the two async saves have completed. */ function after(n, func) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function() { if (--n < 1) { return func.apply(this, arguments); } }; } /** * Creates a function that invokes `func`, with up to `n` arguments, * ignoring any additional arguments. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to cap arguments for. * @param {number} [n=func.length] The arity cap. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new capped function. * @example * * _.map(['6', '8', '10'], _.ary(parseInt, 1)); * // => [6, 8, 10] */ function ary(func, n, guard) { n = guard ? undefined : n; n = (func && n == null) ? func.length : n; return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); } /** * Creates a function that invokes `func`, with the `this` binding and arguments * of the created function, while it's called less than `n` times. Subsequent * calls to the created function return the result of the last `func` invocation. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {number} n The number of calls at which `func` is no longer invoked. * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * jQuery(element).on('click', _.before(5, addContactToList)); * // => Allows adding up to 4 contacts to the list. */ function before(n, func) { var result; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function() { if (--n > 0) { result = func.apply(this, arguments); } if (n <= 1) { func = undefined; } return result; }; } /** * Creates a function that invokes `func` with the `this` binding of `thisArg` * and `partials` prepended to the arguments it receives. * * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, * may be used as a placeholder for partially applied arguments. * * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" * property of bound functions. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to bind. * @param {*} thisArg The `this` binding of `func`. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new bound function. * @example * * function greet(greeting, punctuation) { * return greeting + ' ' + this.user + punctuation; * } * * var object = { 'user': 'fred' }; * * var bound = _.bind(greet, object, 'hi'); * bound('!'); * // => 'hi fred!' * * // Bound with placeholders. * var bound = _.bind(greet, object, _, '!'); * bound('hi'); * // => 'hi fred!' */ var bind = baseRest(function(func, thisArg, partials) { var bitmask = WRAP_BIND_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bind)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(func, bitmask, thisArg, partials, holders); }); /** * Creates a function that invokes the method at `object[key]` with `partials` * prepended to the arguments it receives. * * This method differs from `_.bind` by allowing bound functions to reference * methods that may be redefined or don't yet exist. See * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) * for more details. * * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * @static * @memberOf _ * @since 0.10.0 * @category Function * @param {Object} object The object to invoke the method on. * @param {string} key The key of the method. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new bound function. * @example * * var object = { * 'user': 'fred', * 'greet': function(greeting, punctuation) { * return greeting + ' ' + this.user + punctuation; * } * }; * * var bound = _.bindKey(object, 'greet', 'hi'); * bound('!'); * // => 'hi fred!' * * object.greet = function(greeting, punctuation) { * return greeting + 'ya ' + this.user + punctuation; * }; * * bound('!'); * // => 'hiya fred!' * * // Bound with placeholders. * var bound = _.bindKey(object, 'greet', _, '!'); * bound('hi'); * // => 'hiya fred!' */ var bindKey = baseRest(function(object, key, partials) { var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bindKey)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(key, bitmask, object, partials, holders); }); /** * Creates a function that accepts arguments of `func` and either invokes * `func` returning its result, if at least `arity` number of arguments have * been provided, or returns a function that accepts the remaining `func` * arguments, and so on. The arity of `func` may be specified if `func.length` * is not sufficient. * * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, * may be used as a placeholder for provided arguments. * * **Note:** This method doesn't set the "length" property of curried functions. * * @static * @memberOf _ * @since 2.0.0 * @category Function * @param {Function} func The function to curry. * @param {number} [arity=func.length] The arity of `func`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new curried function. * @example * * var abc = function(a, b, c) { * return [a, b, c]; * }; * * var curried = _.curry(abc); * * curried(1)(2)(3); * // => [1, 2, 3] * * curried(1, 2)(3); * // => [1, 2, 3] * * curried(1, 2, 3); * // => [1, 2, 3] * * // Curried with placeholders. * curried(1)(_, 3)(2); * // => [1, 2, 3] */ function curry(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curry.placeholder; return result; } /** * This method is like `_.curry` except that arguments are applied to `func` * in the manner of `_.partialRight` instead of `_.partial`. * * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for provided arguments. * * **Note:** This method doesn't set the "length" property of curried functions. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to curry. * @param {number} [arity=func.length] The arity of `func`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new curried function. * @example * * var abc = function(a, b, c) { * return [a, b, c]; * }; * * var curried = _.curryRight(abc); * * curried(3)(2)(1); * // => [1, 2, 3] * * curried(2, 3)(1); * // => [1, 2, 3] * * curried(1, 2, 3); * // => [1, 2, 3] * * // Curried with placeholders. * curried(3)(1, _)(2); * // => [1, 2, 3] */ function curryRight(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curryRight.placeholder; return result; } /** * Creates a debounced function that delays invoking `func` until after `wait` * milliseconds have elapsed since the last time the debounced function was * invoked. The debounced function comes with a `cancel` method to cancel * delayed `func` invocations and a `flush` method to immediately invoke them. * Provide `options` to indicate whether `func` should be invoked on the * leading and/or trailing edge of the `wait` timeout. The `func` is invoked * with the last arguments provided to the debounced function. Subsequent * calls to the debounced function return the result of the last `func` * invocation. * * **Note:** If `leading` and `trailing` options are `true`, `func` is * invoked on the trailing edge of the timeout only if the debounced function * is invoked more than once during the `wait` timeout. * * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred * until to the next tick, similar to `setTimeout` with a timeout of `0`. * * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) * for details over the differences between `_.debounce` and `_.throttle`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to debounce. * @param {number} [wait=0] The number of milliseconds to delay. * @param {Object} [options={}] The options object. * @param {boolean} [options.leading=false] * Specify invoking on the leading edge of the timeout. * @param {number} [options.maxWait] * The maximum time `func` is allowed to be delayed before it's invoked. * @param {boolean} [options.trailing=true] * Specify invoking on the trailing edge of the timeout. * @returns {Function} Returns the new debounced function. * @example * * // Avoid costly calculations while the window size is in flux. * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); * * // Invoke `sendMail` when clicked, debouncing subsequent calls. * jQuery(element).on('click', _.debounce(sendMail, 300, { * 'leading': true, * 'trailing': false * })); * * // Ensure `batchLog` is invoked once after 1 second of debounced calls. * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); * var source = new EventSource('/stream'); * jQuery(source).on('message', debounced); * * // Cancel the trailing debounced invocation. * jQuery(window).on('popstate', debounced.cancel); */ function debounce(func, wait, options) { var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } wait = toNumber(wait) || 0; if (isObject(options)) { leading = !!options.leading; maxing = 'maxWait' in options; maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; trailing = 'trailing' in options ? !!options.trailing : trailing; } function invokeFunc(time) { var args = lastArgs, thisArg = lastThis; lastArgs = lastThis = undefined; lastInvokeTime = time; result = func.apply(thisArg, args); return result; } function leadingEdge(time) { // Reset any `maxWait` timer. lastInvokeTime = time; // Start the timer for the trailing edge. timerId = setTimeout(timerExpired, wait); // Invoke the leading edge. return leading ? invokeFunc(time) : result; } function remainingWait(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, timeWaiting = wait - timeSinceLastCall; return maxing ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting; } function shouldInvoke(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime; // Either this is the first call, activity has stopped and we're at the // trailing edge, the system time has gone backwards and we're treating // it as the trailing edge, or we've hit the `maxWait` limit. return (lastCallTime === undefined || (timeSinceLastCall >= wait) || (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); } function timerExpired() { var time = now(); if (shouldInvoke(time)) { return trailingEdge(time); } // Restart the timer. timerId = setTimeout(timerExpired, remainingWait(time)); } function trailingEdge(time) { timerId = undefined; // Only invoke if we have `lastArgs` which means `func` has been // debounced at least once. if (trailing && lastArgs) { return invokeFunc(time); } lastArgs = lastThis = undefined; return result; } function cancel() { if (timerId !== undefined) { clearTimeout(timerId); } lastInvokeTime = 0; lastArgs = lastCallTime = lastThis = timerId = undefined; } function flush() { return timerId === undefined ? result : trailingEdge(now()); } function debounced() { var time = now(), isInvoking = shouldInvoke(time); lastArgs = arguments; lastThis = this; lastCallTime = time; if (isInvoking) { if (timerId === undefined) { return leadingEdge(lastCallTime); } if (maxing) { // Handle invocations in a tight loop. clearTimeout(timerId); timerId = setTimeout(timerExpired, wait); return invokeFunc(lastCallTime); } } if (timerId === undefined) { timerId = setTimeout(timerExpired, wait); } return result; } debounced.cancel = cancel; debounced.flush = flush; return debounced; } /** * Defers invoking the `func` until the current call stack has cleared. Any * additional arguments are provided to `func` when it's invoked. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to defer. * @param {...*} [args] The arguments to invoke `func` with. * @returns {number} Returns the timer id. * @example * * _.defer(function(text) { * console.log(text); * }, 'deferred'); * // => Logs 'deferred' after one millisecond. */ var defer = baseRest(function(func, args) { return baseDelay(func, 1, args); }); /** * Invokes `func` after `wait` milliseconds. Any additional arguments are * provided to `func` when it's invoked. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @param {...*} [args] The arguments to invoke `func` with. * @returns {number} Returns the timer id. * @example * * _.delay(function(text) { * console.log(text); * }, 1000, 'later'); * // => Logs 'later' after one second. */ var delay = baseRest(function(func, wait, args) { return baseDelay(func, toNumber(wait) || 0, args); }); /** * Creates a function that invokes `func` with arguments reversed. * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to flip arguments for. * @returns {Function} Returns the new flipped function. * @example * * var flipped = _.flip(function() { * return _.toArray(arguments); * }); * * flipped('a', 'b', 'c', 'd'); * // => ['d', 'c', 'b', 'a'] */ function flip(func) { return createWrap(func, WRAP_FLIP_FLAG); } /** * Creates a function that memoizes the result of `func`. If `resolver` is * provided, it determines the cache key for storing the result based on the * arguments provided to the memoized function. By default, the first argument * provided to the memoized function is used as the map cache key. The `func` * is invoked with the `this` binding of the memoized function. * * **Note:** The cache is exposed as the `cache` property on the memoized * function. Its creation may be customized by replacing the `_.memoize.Cache` * constructor with one whose instances implement the * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) * method interface of `clear`, `delete`, `get`, `has`, and `set`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to have its output memoized. * @param {Function} [resolver] The function to resolve the cache key. * @returns {Function} Returns the new memoized function. * @example * * var object = { 'a': 1, 'b': 2 }; * var other = { 'c': 3, 'd': 4 }; * * var values = _.memoize(_.values); * values(object); * // => [1, 2] * * values(other); * // => [3, 4] * * object.a = 2; * values(object); * // => [1, 2] * * // Modify the result cache. * values.cache.set(object, ['a', 'b']); * values(object); * // => ['a', 'b'] * * // Replace `_.memoize.Cache`. * _.memoize.Cache = WeakMap; */ function memoize(func, resolver) { if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { throw new TypeError(FUNC_ERROR_TEXT); } var memoized = function() { var args = arguments, key = resolver ? resolver.apply(this, args) : args[0], cache = memoized.cache; if (cache.has(key)) { return cache.get(key); } var result = func.apply(this, args); memoized.cache = cache.set(key, result) || cache; return result; }; memoized.cache = new (memoize.Cache || MapCache); return memoized; } // Expose `MapCache`. memoize.Cache = MapCache; /** * Creates a function that negates the result of the predicate `func`. The * `func` predicate is invoked with the `this` binding and arguments of the * created function. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} predicate The predicate to negate. * @returns {Function} Returns the new negated function. * @example * * function isEven(n) { * return n % 2 == 0; * } * * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); * // => [1, 3, 5] */ function negate(predicate) { if (typeof predicate != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return function() { var args = arguments; switch (args.length) { case 0: return !predicate.call(this); case 1: return !predicate.call(this, args[0]); case 2: return !predicate.call(this, args[0], args[1]); case 3: return !predicate.call(this, args[0], args[1], args[2]); } return !predicate.apply(this, args); }; } /** * Creates a function that is restricted to invoking `func` once. Repeat calls * to the function return the value of the first invocation. The `func` is * invoked with the `this` binding and arguments of the created function. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * var initialize = _.once(createApplication); * initialize(); * initialize(); * // => `createApplication` is invoked once */ function once(func) { return before(2, func); } /** * Creates a function that invokes `func` with its arguments transformed. * * @static * @since 4.0.0 * @memberOf _ * @category Function * @param {Function} func The function to wrap. * @param {...(Function|Function[])} [transforms=[_.identity]] * The argument transforms. * @returns {Function} Returns the new function. * @example * * function doubled(n) { * return n * 2; * } * * function square(n) { * return n * n; * } * * var func = _.overArgs(function(x, y) { * return [x, y]; * }, [square, doubled]); * * func(9, 3); * // => [81, 6] * * func(10, 5); * // => [100, 10] */ var overArgs = castRest(function(func, transforms) { transforms = (transforms.length == 1 && isArray(transforms[0])) ? arrayMap(transforms[0], baseUnary(getIteratee())) : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); var funcsLength = transforms.length; return baseRest(function(args) { var index = -1, length = nativeMin(args.length, funcsLength); while (++index < length) { args[index] = transforms[index].call(this, args[index]); } return apply(func, this, args); }); }); /** * Creates a function that invokes `func` with `partials` prepended to the * arguments it receives. This method is like `_.bind` except it does **not** * alter the `this` binding. * * The `_.partial.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * **Note:** This method doesn't set the "length" property of partially * applied functions. * * @static * @memberOf _ * @since 0.2.0 * @category Function * @param {Function} func The function to partially apply arguments to. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new partially applied function. * @example * * function greet(greeting, name) { * return greeting + ' ' + name; * } * * var sayHelloTo = _.partial(greet, 'hello'); * sayHelloTo('fred'); * // => 'hello fred' * * // Partially applied with placeholders. * var greetFred = _.partial(greet, _, 'fred'); * greetFred('hi'); * // => 'hi fred' */ var partial = baseRest(function(func, partials) { var holders = replaceHolders(partials, getHolder(partial)); return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); }); /** * This method is like `_.partial` except that partially applied arguments * are appended to the arguments it receives. * * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * **Note:** This method doesn't set the "length" property of partially * applied functions. * * @static * @memberOf _ * @since 1.0.0 * @category Function * @param {Function} func The function to partially apply arguments to. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new partially applied function. * @example * * function greet(greeting, name) { * return greeting + ' ' + name; * } * * var greetFred = _.partialRight(greet, 'fred'); * greetFred('hi'); * // => 'hi fred' * * // Partially applied with placeholders. * var sayHelloTo = _.partialRight(greet, 'hello', _); * sayHelloTo('fred'); * // => 'hello fred' */ var partialRight = baseRest(function(func, partials) { var holders = replaceHolders(partials, getHolder(partialRight)); return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); }); /** * Creates a function that invokes `func` with arguments arranged according * to the specified `indexes` where the argument value at the first index is * provided as the first argument, the argument value at the second index is * provided as the second argument, and so on. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to rearrange arguments for. * @param {...(number|number[])} indexes The arranged argument indexes. * @returns {Function} Returns the new function. * @example * * var rearged = _.rearg(function(a, b, c) { * return [a, b, c]; * }, [2, 0, 1]); * * rearged('b', 'c', 'a') * // => ['a', 'b', 'c'] */ var rearg = flatRest(function(func, indexes) { return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); }); /** * Creates a function that invokes `func` with the `this` binding of the * created function and arguments from `start` and beyond provided as * an array. * * **Note:** This method is based on the * [rest parameter](https://mdn.io/rest_parameters). * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @returns {Function} Returns the new function. * @example * * var say = _.rest(function(what, names) { * return what + ' ' + _.initial(names).join(', ') + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); * }); * * say('hello', 'fred', 'barney', 'pebbles'); * // => 'hello fred, barney, & pebbles' */ function rest(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start === undefined ? start : toInteger(start); return baseRest(func, start); } /** * Creates a function that invokes `func` with the `this` binding of the * create function and an array of arguments much like * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). * * **Note:** This method is based on the * [spread operator](https://mdn.io/spread_operator). * * @static * @memberOf _ * @since 3.2.0 * @category Function * @param {Function} func The function to spread arguments over. * @param {number} [start=0] The start position of the spread. * @returns {Function} Returns the new function. * @example * * var say = _.spread(function(who, what) { * return who + ' says ' + what; * }); * * say(['fred', 'hello']); * // => 'fred says hello' * * var numbers = Promise.all([ * Promise.resolve(40), * Promise.resolve(36) * ]); * * numbers.then(_.spread(function(x, y) { * return x + y; * })); * // => a Promise of 76 */ function spread(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start == null ? 0 : nativeMax(toInteger(start), 0); return baseRest(function(args) { var array = args[start], otherArgs = castSlice(args, 0, start); if (array) { arrayPush(otherArgs, array); } return apply(func, this, otherArgs); }); } /** * Creates a throttled function that only invokes `func` at most once per * every `wait` milliseconds. The throttled function comes with a `cancel` * method to cancel delayed `func` invocations and a `flush` method to * immediately invoke them. Provide `options` to indicate whether `func` * should be invoked on the leading and/or trailing edge of the `wait` * timeout. The `func` is invoked with the last arguments provided to the * throttled function. Subsequent calls to the throttled function return the * result of the last `func` invocation. * * **Note:** If `leading` and `trailing` options are `true`, `func` is * invoked on the trailing edge of the timeout only if the throttled function * is invoked more than once during the `wait` timeout. * * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred * until to the next tick, similar to `setTimeout` with a timeout of `0`. * * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) * for details over the differences between `_.throttle` and `_.debounce`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to throttle. * @param {number} [wait=0] The number of milliseconds to throttle invocations to. * @param {Object} [options={}] The options object. * @param {boolean} [options.leading=true] * Specify invoking on the leading edge of the timeout. * @param {boolean} [options.trailing=true] * Specify invoking on the trailing edge of the timeout. * @returns {Function} Returns the new throttled function. * @example * * // Avoid excessively updating the position while scrolling. * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); * * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); * jQuery(element).on('click', throttled); * * // Cancel the trailing throttled invocation. * jQuery(window).on('popstate', throttled.cancel); */ function throttle(func, wait, options) { var leading = true, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (isObject(options)) { leading = 'leading' in options ? !!options.leading : leading; trailing = 'trailing' in options ? !!options.trailing : trailing; } return debounce(func, wait, { 'leading': leading, 'maxWait': wait, 'trailing': trailing }); } /** * Creates a function that accepts up to one argument, ignoring any * additional arguments. * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to cap arguments for. * @returns {Function} Returns the new capped function. * @example * * _.map(['6', '8', '10'], _.unary(parseInt)); * // => [6, 8, 10] */ function unary(func) { return ary(func, 1); } /** * Creates a function that provides `value` to `wrapper` as its first * argument. Any additional arguments provided to the function are appended * to those provided to the `wrapper`. The wrapper is invoked with the `this` * binding of the created function. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {*} value The value to wrap. * @param {Function} [wrapper=identity] The wrapper function. * @returns {Function} Returns the new function. * @example * * var p = _.wrap(_.escape, function(func, text) { * return '

' + func(text) + '

'; * }); * * p('fred, barney, & pebbles'); * // => '

fred, barney, & pebbles

' */ function wrap(value, wrapper) { return partial(castFunction(wrapper), value); } /*------------------------------------------------------------------------*/ /** * Casts `value` as an array if it's not one. * * @static * @memberOf _ * @since 4.4.0 * @category Lang * @param {*} value The value to inspect. * @returns {Array} Returns the cast array. * @example * * _.castArray(1); * // => [1] * * _.castArray({ 'a': 1 }); * // => [{ 'a': 1 }] * * _.castArray('abc'); * // => ['abc'] * * _.castArray(null); * // => [null] * * _.castArray(undefined); * // => [undefined] * * _.castArray(); * // => [] * * var array = [1, 2, 3]; * console.log(_.castArray(array) === array); * // => true */ function castArray() { if (!arguments.length) { return []; } var value = arguments[0]; return isArray(value) ? value : [value]; } /** * Creates a shallow clone of `value`. * * **Note:** This method is loosely based on the * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) * and supports cloning arrays, array buffers, booleans, date objects, maps, * numbers, `Object` objects, regexes, sets, strings, symbols, and typed * arrays. The own enumerable properties of `arguments` objects are cloned * as plain objects. An empty object is returned for uncloneable values such * as error objects, functions, DOM nodes, and WeakMaps. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to clone. * @returns {*} Returns the cloned value. * @see _.cloneDeep * @example * * var objects = [{ 'a': 1 }, { 'b': 2 }]; * * var shallow = _.clone(objects); * console.log(shallow[0] === objects[0]); * // => true */ function clone(value) { return baseClone(value, CLONE_SYMBOLS_FLAG); } /** * This method is like `_.clone` except that it accepts `customizer` which * is invoked to produce the cloned value. If `customizer` returns `undefined`, * cloning is handled by the method instead. The `customizer` is invoked with * up to four arguments; (value [, index|key, object, stack]). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to clone. * @param {Function} [customizer] The function to customize cloning. * @returns {*} Returns the cloned value. * @see _.cloneDeepWith * @example * * function customizer(value) { * if (_.isElement(value)) { * return value.cloneNode(false); * } * } * * var el = _.cloneWith(document.body, customizer); * * console.log(el === document.body); * // => false * console.log(el.nodeName); * // => 'BODY' * console.log(el.childNodes.length); * // => 0 */ function cloneWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); } /** * This method is like `_.clone` except that it recursively clones `value`. * * @static * @memberOf _ * @since 1.0.0 * @category Lang * @param {*} value The value to recursively clone. * @returns {*} Returns the deep cloned value. * @see _.clone * @example * * var objects = [{ 'a': 1 }, { 'b': 2 }]; * * var deep = _.cloneDeep(objects); * console.log(deep[0] === objects[0]); * // => false */ function cloneDeep(value) { return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); } /** * This method is like `_.cloneWith` except that it recursively clones `value`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to recursively clone. * @param {Function} [customizer] The function to customize cloning. * @returns {*} Returns the deep cloned value. * @see _.cloneWith * @example * * function customizer(value) { * if (_.isElement(value)) { * return value.cloneNode(true); * } * } * * var el = _.cloneDeepWith(document.body, customizer); * * console.log(el === document.body); * // => false * console.log(el.nodeName); * // => 'BODY' * console.log(el.childNodes.length); * // => 20 */ function cloneDeepWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); } /** * Checks if `object` conforms to `source` by invoking the predicate * properties of `source` with the corresponding property values of `object`. * * **Note:** This method is equivalent to `_.conforms` when `source` is * partially applied. * * @static * @memberOf _ * @since 4.14.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property predicates to conform to. * @returns {boolean} Returns `true` if `object` conforms, else `false`. * @example * * var object = { 'a': 1, 'b': 2 }; * * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); * // => true * * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); * // => false */ function conformsTo(object, source) { return source == null || baseConformsTo(object, source, keys(source)); } /** * Performs a * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * comparison between two values to determine if they are equivalent. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * var object = { 'a': 1 }; * var other = { 'a': 1 }; * * _.eq(object, object); * // => true * * _.eq(object, other); * // => false * * _.eq('a', 'a'); * // => true * * _.eq('a', Object('a')); * // => false * * _.eq(NaN, NaN); * // => true */ function eq(value, other) { return value === other || (value !== value && other !== other); } /** * Checks if `value` is greater than `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than `other`, * else `false`. * @see _.lt * @example * * _.gt(3, 1); * // => true * * _.gt(3, 3); * // => false * * _.gt(1, 3); * // => false */ var gt = createRelationalOperation(baseGt); /** * Checks if `value` is greater than or equal to `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than or equal to * `other`, else `false`. * @see _.lte * @example * * _.gte(3, 1); * // => true * * _.gte(3, 3); * // => true * * _.gte(1, 3); * // => false */ var gte = createRelationalOperation(function(value, other) { return value >= other; }); /** * Checks if `value` is likely an `arguments` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an `arguments` object, * else `false`. * @example * * _.isArguments(function() { return arguments; }()); * // => true * * _.isArguments([1, 2, 3]); * // => false */ var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && !propertyIsEnumerable.call(value, 'callee'); }; /** * Checks if `value` is classified as an `Array` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array, else `false`. * @example * * _.isArray([1, 2, 3]); * // => true * * _.isArray(document.body.children); * // => false * * _.isArray('abc'); * // => false * * _.isArray(_.noop); * // => false */ var isArray = Array.isArray; /** * Checks if `value` is classified as an `ArrayBuffer` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. * @example * * _.isArrayBuffer(new ArrayBuffer(2)); * // => true * * _.isArrayBuffer(new Array(2)); * // => false */ var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; /** * Checks if `value` is array-like. A value is considered array-like if it's * not a function and has a `value.length` that's an integer greater than or * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is array-like, else `false`. * @example * * _.isArrayLike([1, 2, 3]); * // => true * * _.isArrayLike(document.body.children); * // => true * * _.isArrayLike('abc'); * // => true * * _.isArrayLike(_.noop); * // => false */ function isArrayLike(value) { return value != null && isLength(value.length) && !isFunction(value); } /** * This method is like `_.isArrayLike` except that it also checks if `value` * is an object. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array-like object, * else `false`. * @example * * _.isArrayLikeObject([1, 2, 3]); * // => true * * _.isArrayLikeObject(document.body.children); * // => true * * _.isArrayLikeObject('abc'); * // => false * * _.isArrayLikeObject(_.noop); * // => false */ function isArrayLikeObject(value) { return isObjectLike(value) && isArrayLike(value); } /** * Checks if `value` is classified as a boolean primitive or object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. * @example * * _.isBoolean(false); * // => true * * _.isBoolean(null); * // => false */ function isBoolean(value) { return value === true || value === false || (isObjectLike(value) && baseGetTag(value) == boolTag); } /** * Checks if `value` is a buffer. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. * @example * * _.isBuffer(new Buffer(2)); * // => true * * _.isBuffer(new Uint8Array(2)); * // => false */ var isBuffer = nativeIsBuffer || stubFalse; /** * Checks if `value` is classified as a `Date` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a date object, else `false`. * @example * * _.isDate(new Date); * // => true * * _.isDate('Mon April 23 2012'); * // => false */ var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; /** * Checks if `value` is likely a DOM element. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. * @example * * _.isElement(document.body); * // => true * * _.isElement(''); * // => false */ function isElement(value) { return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); } /** * Checks if `value` is an empty object, collection, map, or set. * * Objects are considered empty if they have no own enumerable string keyed * properties. * * Array-like values such as `arguments` objects, arrays, buffers, strings, or * jQuery-like collections are considered empty if they have a `length` of `0`. * Similarly, maps and sets are considered empty if they have a `size` of `0`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is empty, else `false`. * @example * * _.isEmpty(null); * // => true * * _.isEmpty(true); * // => true * * _.isEmpty(1); * // => true * * _.isEmpty([1, 2, 3]); * // => false * * _.isEmpty({ 'a': 1 }); * // => false */ function isEmpty(value) { if (value == null) { return true; } if (isArrayLike(value) && (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || isBuffer(value) || isTypedArray(value) || isArguments(value))) { return !value.length; } var tag = getTag(value); if (tag == mapTag || tag == setTag) { return !value.size; } if (isPrototype(value)) { return !baseKeys(value).length; } for (var key in value) { if (hasOwnProperty.call(value, key)) { return false; } } return true; } /** * Performs a deep comparison between two values to determine if they are * equivalent. * * **Note:** This method supports comparing arrays, array buffers, booleans, * date objects, error objects, maps, numbers, `Object` objects, regexes, * sets, strings, symbols, and typed arrays. `Object` objects are compared * by their own, not inherited, enumerable properties. Functions and DOM * nodes are compared by strict equality, i.e. `===`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * var object = { 'a': 1 }; * var other = { 'a': 1 }; * * _.isEqual(object, other); * // => true * * object === other; * // => false */ function isEqual(value, other) { return baseIsEqual(value, other); } /** * This method is like `_.isEqual` except that it accepts `customizer` which * is invoked to compare values. If `customizer` returns `undefined`, comparisons * are handled by the method instead. The `customizer` is invoked with up to * six arguments: (objValue, othValue [, index|key, object, other, stack]). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * function isGreeting(value) { * return /^h(?:i|ello)$/.test(value); * } * * function customizer(objValue, othValue) { * if (isGreeting(objValue) && isGreeting(othValue)) { * return true; * } * } * * var array = ['hello', 'goodbye']; * var other = ['hi', 'goodbye']; * * _.isEqualWith(array, other, customizer); * // => true */ function isEqualWith(value, other, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; var result = customizer ? customizer(value, other) : undefined; return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; } /** * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, * `SyntaxError`, `TypeError`, or `URIError` object. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an error object, else `false`. * @example * * _.isError(new Error); * // => true * * _.isError(Error); * // => false */ function isError(value) { if (!isObjectLike(value)) { return false; } var tag = baseGetTag(value); return tag == errorTag || tag == domExcTag || (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); } /** * Checks if `value` is a finite primitive number. * * **Note:** This method is based on * [`Number.isFinite`](https://mdn.io/Number/isFinite). * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. * @example * * _.isFinite(3); * // => true * * _.isFinite(Number.MIN_VALUE); * // => true * * _.isFinite(Infinity); * // => false * * _.isFinite('3'); * // => false */ function isFinite(value) { return typeof value == 'number' && nativeIsFinite(value); } /** * Checks if `value` is classified as a `Function` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a function, else `false`. * @example * * _.isFunction(_); * // => true * * _.isFunction(/abc/); * // => false */ function isFunction(value) { if (!isObject(value)) { return false; } // The use of `Object#toString` avoids issues with the `typeof` operator // in Safari 9 which returns 'object' for typed arrays and other constructors. var tag = baseGetTag(value); return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; } /** * Checks if `value` is an integer. * * **Note:** This method is based on * [`Number.isInteger`](https://mdn.io/Number/isInteger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an integer, else `false`. * @example * * _.isInteger(3); * // => true * * _.isInteger(Number.MIN_VALUE); * // => false * * _.isInteger(Infinity); * // => false * * _.isInteger('3'); * // => false */ function isInteger(value) { return typeof value == 'number' && value == toInteger(value); } /** * Checks if `value` is a valid array-like length. * * **Note:** This method is loosely based on * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. * @example * * _.isLength(3); * // => true * * _.isLength(Number.MIN_VALUE); * // => false * * _.isLength(Infinity); * // => false * * _.isLength('3'); * // => false */ function isLength(value) { return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; } /** * Checks if `value` is the * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an object, else `false`. * @example * * _.isObject({}); * // => true * * _.isObject([1, 2, 3]); * // => true * * _.isObject(_.noop); * // => true * * _.isObject(null); * // => false */ function isObject(value) { var type = typeof value; return value != null && (type == 'object' || type == 'function'); } /** * Checks if `value` is object-like. A value is object-like if it's not `null` * and has a `typeof` result of "object". * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is object-like, else `false`. * @example * * _.isObjectLike({}); * // => true * * _.isObjectLike([1, 2, 3]); * // => true * * _.isObjectLike(_.noop); * // => false * * _.isObjectLike(null); * // => false */ function isObjectLike(value) { return value != null && typeof value == 'object'; } /** * Checks if `value` is classified as a `Map` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a map, else `false`. * @example * * _.isMap(new Map); * // => true * * _.isMap(new WeakMap); * // => false */ var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; /** * Performs a partial deep comparison between `object` and `source` to * determine if `object` contains equivalent property values. * * **Note:** This method is equivalent to `_.matches` when `source` is * partially applied. * * Partial comparisons will match empty array and empty object `source` * values against any array or object value, respectively. See `_.isEqual` * for a list of supported value comparisons. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @returns {boolean} Returns `true` if `object` is a match, else `false`. * @example * * var object = { 'a': 1, 'b': 2 }; * * _.isMatch(object, { 'b': 2 }); * // => true * * _.isMatch(object, { 'b': 1 }); * // => false */ function isMatch(object, source) { return object === source || baseIsMatch(object, source, getMatchData(source)); } /** * This method is like `_.isMatch` except that it accepts `customizer` which * is invoked to compare values. If `customizer` returns `undefined`, comparisons * are handled by the method instead. The `customizer` is invoked with five * arguments: (objValue, srcValue, index|key, object, source). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if `object` is a match, else `false`. * @example * * function isGreeting(value) { * return /^h(?:i|ello)$/.test(value); * } * * function customizer(objValue, srcValue) { * if (isGreeting(objValue) && isGreeting(srcValue)) { * return true; * } * } * * var object = { 'greeting': 'hello' }; * var source = { 'greeting': 'hi' }; * * _.isMatchWith(object, source, customizer); * // => true */ function isMatchWith(object, source, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseIsMatch(object, source, getMatchData(source), customizer); } /** * Checks if `value` is `NaN`. * * **Note:** This method is based on * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for * `undefined` and other non-number values. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. * @example * * _.isNaN(NaN); * // => true * * _.isNaN(new Number(NaN)); * // => true * * isNaN(undefined); * // => true * * _.isNaN(undefined); * // => false */ function isNaN(value) { // An `NaN` primitive is the only value that is not equal to itself. // Perform the `toStringTag` check first to avoid errors with some // ActiveX objects in IE. return isNumber(value) && value != +value; } /** * Checks if `value` is a pristine native function. * * **Note:** This method can't reliably detect native functions in the presence * of the core-js package because core-js circumvents this kind of detection. * Despite multiple requests, the core-js maintainer has made it clear: any * attempt to fix the detection will be obstructed. As a result, we're left * with little choice but to throw an error. Unfortunately, this also affects * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), * which rely on core-js. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a native function, * else `false`. * @example * * _.isNative(Array.prototype.push); * // => true * * _.isNative(_); * // => false */ function isNative(value) { if (isMaskable(value)) { throw new Error(CORE_ERROR_TEXT); } return baseIsNative(value); } /** * Checks if `value` is `null`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `null`, else `false`. * @example * * _.isNull(null); * // => true * * _.isNull(void 0); * // => false */ function isNull(value) { return value === null; } /** * Checks if `value` is `null` or `undefined`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is nullish, else `false`. * @example * * _.isNil(null); * // => true * * _.isNil(void 0); * // => true * * _.isNil(NaN); * // => false */ function isNil(value) { return value == null; } /** * Checks if `value` is classified as a `Number` primitive or object. * * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are * classified as numbers, use the `_.isFinite` method. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a number, else `false`. * @example * * _.isNumber(3); * // => true * * _.isNumber(Number.MIN_VALUE); * // => true * * _.isNumber(Infinity); * // => true * * _.isNumber('3'); * // => false */ function isNumber(value) { return typeof value == 'number' || (isObjectLike(value) && baseGetTag(value) == numberTag); } /** * Checks if `value` is a plain object, that is, an object created by the * `Object` constructor or one with a `[[Prototype]]` of `null`. * * @static * @memberOf _ * @since 0.8.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. * @example * * function Foo() { * this.a = 1; * } * * _.isPlainObject(new Foo); * // => false * * _.isPlainObject([1, 2, 3]); * // => false * * _.isPlainObject({ 'x': 0, 'y': 0 }); * // => true * * _.isPlainObject(Object.create(null)); * // => true */ function isPlainObject(value) { if (!isObjectLike(value) || baseGetTag(value) != objectTag) { return false; } var proto = getPrototype(value); if (proto === null) { return true; } var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; return typeof Ctor == 'function' && Ctor instanceof Ctor && funcToString.call(Ctor) == objectCtorString; } /** * Checks if `value` is classified as a `RegExp` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. * @example * * _.isRegExp(/abc/); * // => true * * _.isRegExp('/abc/'); * // => false */ var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; /** * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 * double precision number which isn't the result of a rounded unsafe integer. * * **Note:** This method is based on * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. * @example * * _.isSafeInteger(3); * // => true * * _.isSafeInteger(Number.MIN_VALUE); * // => false * * _.isSafeInteger(Infinity); * // => false * * _.isSafeInteger('3'); * // => false */ function isSafeInteger(value) { return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; } /** * Checks if `value` is classified as a `Set` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a set, else `false`. * @example * * _.isSet(new Set); * // => true * * _.isSet(new WeakSet); * // => false */ var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; /** * Checks if `value` is classified as a `String` primitive or object. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a string, else `false`. * @example * * _.isString('abc'); * // => true * * _.isString(1); * // => false */ function isString(value) { return typeof value == 'string' || (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); } /** * Checks if `value` is classified as a `Symbol` primitive or object. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. * @example * * _.isSymbol(Symbol.iterator); * // => true * * _.isSymbol('abc'); * // => false */ function isSymbol(value) { return typeof value == 'symbol' || (isObjectLike(value) && baseGetTag(value) == symbolTag); } /** * Checks if `value` is classified as a typed array. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. * @example * * _.isTypedArray(new Uint8Array); * // => true * * _.isTypedArray([]); * // => false */ var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; /** * Checks if `value` is `undefined`. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. * @example * * _.isUndefined(void 0); * // => true * * _.isUndefined(null); * // => false */ function isUndefined(value) { return value === undefined; } /** * Checks if `value` is classified as a `WeakMap` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. * @example * * _.isWeakMap(new WeakMap); * // => true * * _.isWeakMap(new Map); * // => false */ function isWeakMap(value) { return isObjectLike(value) && getTag(value) == weakMapTag; } /** * Checks if `value` is classified as a `WeakSet` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. * @example * * _.isWeakSet(new WeakSet); * // => true * * _.isWeakSet(new Set); * // => false */ function isWeakSet(value) { return isObjectLike(value) && baseGetTag(value) == weakSetTag; } /** * Checks if `value` is less than `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than `other`, * else `false`. * @see _.gt * @example * * _.lt(1, 3); * // => true * * _.lt(3, 3); * // => false * * _.lt(3, 1); * // => false */ var lt = createRelationalOperation(baseLt); /** * Checks if `value` is less than or equal to `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than or equal to * `other`, else `false`. * @see _.gte * @example * * _.lte(1, 3); * // => true * * _.lte(3, 3); * // => true * * _.lte(3, 1); * // => false */ var lte = createRelationalOperation(function(value, other) { return value <= other; }); /** * Converts `value` to an array. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to convert. * @returns {Array} Returns the converted array. * @example * * _.toArray({ 'a': 1, 'b': 2 }); * // => [1, 2] * * _.toArray('abc'); * // => ['a', 'b', 'c'] * * _.toArray(1); * // => [] * * _.toArray(null); * // => [] */ function toArray(value) { if (!value) { return []; } if (isArrayLike(value)) { return isString(value) ? stringToArray(value) : copyArray(value); } if (symIterator && value[symIterator]) { return iteratorToArray(value[symIterator]()); } var tag = getTag(value), func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); return func(value); } /** * Converts `value` to a finite number. * * @static * @memberOf _ * @since 4.12.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted number. * @example * * _.toFinite(3.2); * // => 3.2 * * _.toFinite(Number.MIN_VALUE); * // => 5e-324 * * _.toFinite(Infinity); * // => 1.7976931348623157e+308 * * _.toFinite('3.2'); * // => 3.2 */ function toFinite(value) { if (!value) { return value === 0 ? value : 0; } value = toNumber(value); if (value === INFINITY || value === -INFINITY) { var sign = (value < 0 ? -1 : 1); return sign * MAX_INTEGER; } return value === value ? value : 0; } /** * Converts `value` to an integer. * * **Note:** This method is loosely based on * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toInteger(3.2); * // => 3 * * _.toInteger(Number.MIN_VALUE); * // => 0 * * _.toInteger(Infinity); * // => 1.7976931348623157e+308 * * _.toInteger('3.2'); * // => 3 */ function toInteger(value) { var result = toFinite(value), remainder = result % 1; return result === result ? (remainder ? result - remainder : result) : 0; } /** * Converts `value` to an integer suitable for use as the length of an * array-like object. * * **Note:** This method is based on * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toLength(3.2); * // => 3 * * _.toLength(Number.MIN_VALUE); * // => 0 * * _.toLength(Infinity); * // => 4294967295 * * _.toLength('3.2'); * // => 3 */ function toLength(value) { return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; } /** * Converts `value` to a number. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to process. * @returns {number} Returns the number. * @example * * _.toNumber(3.2); * // => 3.2 * * _.toNumber(Number.MIN_VALUE); * // => 5e-324 * * _.toNumber(Infinity); * // => Infinity * * _.toNumber('3.2'); * // => 3.2 */ function toNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } if (isObject(value)) { var other = typeof value.valueOf == 'function' ? value.valueOf() : value; value = isObject(other) ? (other + '') : other; } if (typeof value != 'string') { return value === 0 ? value : +value; } value = value.replace(reTrim, ''); var isBinary = reIsBinary.test(value); return (isBinary || reIsOctal.test(value)) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : (reIsBadHex.test(value) ? NAN : +value); } /** * Converts `value` to a plain object flattening inherited enumerable string * keyed properties of `value` to own properties of the plain object. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to convert. * @returns {Object} Returns the converted plain object. * @example * * function Foo() { * this.b = 2; * } * * Foo.prototype.c = 3; * * _.assign({ 'a': 1 }, new Foo); * // => { 'a': 1, 'b': 2 } * * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); * // => { 'a': 1, 'b': 2, 'c': 3 } */ function toPlainObject(value) { return copyObject(value, keysIn(value)); } /** * Converts `value` to a safe integer. A safe integer can be compared and * represented correctly. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toSafeInteger(3.2); * // => 3 * * _.toSafeInteger(Number.MIN_VALUE); * // => 0 * * _.toSafeInteger(Infinity); * // => 9007199254740991 * * _.toSafeInteger('3.2'); * // => 3 */ function toSafeInteger(value) { return value ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) : (value === 0 ? value : 0); } /** * Converts `value` to a string. An empty string is returned for `null` * and `undefined` values. The sign of `-0` is preserved. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {string} Returns the converted string. * @example * * _.toString(null); * // => '' * * _.toString(-0); * // => '-0' * * _.toString([1, 2, 3]); * // => '1,2,3' */ function toString(value) { return value == null ? '' : baseToString(value); } /*------------------------------------------------------------------------*/ /** * Assigns own enumerable string keyed properties of source objects to the * destination object. Source objects are applied from left to right. * Subsequent sources overwrite property assignments of previous sources. * * **Note:** This method mutates `object` and is loosely based on * [`Object.assign`](https://mdn.io/Object/assign). * * @static * @memberOf _ * @since 0.10.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.assignIn * @example * * function Foo() { * this.a = 1; * } * * function Bar() { * this.c = 3; * } * * Foo.prototype.b = 2; * Bar.prototype.d = 4; * * _.assign({ 'a': 0 }, new Foo, new Bar); * // => { 'a': 1, 'c': 3 } */ var assign = createAssigner(function(object, source) { if (isPrototype(source) || isArrayLike(source)) { copyObject(source, keys(source), object); return; } for (var key in source) { if (hasOwnProperty.call(source, key)) { assignValue(object, key, source[key]); } } }); /** * This method is like `_.assign` except that it iterates over own and * inherited source properties. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @alias extend * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.assign * @example * * function Foo() { * this.a = 1; * } * * function Bar() { * this.c = 3; * } * * Foo.prototype.b = 2; * Bar.prototype.d = 4; * * _.assignIn({ 'a': 0 }, new Foo, new Bar); * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } */ var assignIn = createAssigner(function(object, source) { copyObject(source, keysIn(source), object); }); /** * This method is like `_.assignIn` except that it accepts `customizer` * which is invoked to produce the assigned values. If `customizer` returns * `undefined`, assignment is handled by the method instead. The `customizer` * is invoked with five arguments: (objValue, srcValue, key, object, source). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @alias extendWith * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @see _.assignWith * @example * * function customizer(objValue, srcValue) { * return _.isUndefined(objValue) ? srcValue : objValue; * } * * var defaults = _.partialRight(_.assignInWith, customizer); * * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { copyObject(source, keysIn(source), object, customizer); }); /** * This method is like `_.assign` except that it accepts `customizer` * which is invoked to produce the assigned values. If `customizer` returns * `undefined`, assignment is handled by the method instead. The `customizer` * is invoked with five arguments: (objValue, srcValue, key, object, source). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @see _.assignInWith * @example * * function customizer(objValue, srcValue) { * return _.isUndefined(objValue) ? srcValue : objValue; * } * * var defaults = _.partialRight(_.assignWith, customizer); * * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var assignWith = createAssigner(function(object, source, srcIndex, customizer) { copyObject(source, keys(source), object, customizer); }); /** * Creates an array of values corresponding to `paths` of `object`. * * @static * @memberOf _ * @since 1.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Array} Returns the picked values. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; * * _.at(object, ['a[0].b.c', 'a[1]']); * // => [3, 4] */ var at = flatRest(baseAt); /** * Creates an object that inherits from the `prototype` object. If a * `properties` object is given, its own enumerable string keyed properties * are assigned to the created object. * * @static * @memberOf _ * @since 2.3.0 * @category Object * @param {Object} prototype The object to inherit from. * @param {Object} [properties] The properties to assign to the object. * @returns {Object} Returns the new object. * @example * * function Shape() { * this.x = 0; * this.y = 0; * } * * function Circle() { * Shape.call(this); * } * * Circle.prototype = _.create(Shape.prototype, { * 'constructor': Circle * }); * * var circle = new Circle; * circle instanceof Circle; * // => true * * circle instanceof Shape; * // => true */ function create(prototype, properties) { var result = baseCreate(prototype); return properties == null ? result : baseAssign(result, properties); } /** * Assigns own and inherited enumerable string keyed properties of source * objects to the destination object for all destination properties that * resolve to `undefined`. Source objects are applied from left to right. * Once a property is set, additional values of the same property are ignored. * * **Note:** This method mutates `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.defaultsDeep * @example * * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var defaults = baseRest(function(object, sources) { object = Object(object); var index = -1; var length = sources.length; var guard = length > 2 ? sources[2] : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { length = 1; } while (++index < length) { var source = sources[index]; var props = keysIn(source); var propsIndex = -1; var propsLength = props.length; while (++propsIndex < propsLength) { var key = props[propsIndex]; var value = object[key]; if (value === undefined || (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { object[key] = source[key]; } } } return object; }); /** * This method is like `_.defaults` except that it recursively assigns * default properties. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 3.10.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.defaults * @example * * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); * // => { 'a': { 'b': 2, 'c': 3 } } */ var defaultsDeep = baseRest(function(args) { args.push(undefined, customDefaultsMerge); return apply(mergeWith, undefined, args); }); /** * This method is like `_.find` except that it returns the key of the first * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ * @since 1.1.0 * @category Object * @param {Object} object The object to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {string|undefined} Returns the key of the matched element, * else `undefined`. * @example * * var users = { * 'barney': { 'age': 36, 'active': true }, * 'fred': { 'age': 40, 'active': false }, * 'pebbles': { 'age': 1, 'active': true } * }; * * _.findKey(users, function(o) { return o.age < 40; }); * // => 'barney' (iteration order is not guaranteed) * * // The `_.matches` iteratee shorthand. * _.findKey(users, { 'age': 1, 'active': true }); * // => 'pebbles' * * // The `_.matchesProperty` iteratee shorthand. * _.findKey(users, ['active', false]); * // => 'fred' * * // The `_.property` iteratee shorthand. * _.findKey(users, 'active'); * // => 'barney' */ function findKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); } /** * This method is like `_.findKey` except that it iterates over elements of * a collection in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {string|undefined} Returns the key of the matched element, * else `undefined`. * @example * * var users = { * 'barney': { 'age': 36, 'active': true }, * 'fred': { 'age': 40, 'active': false }, * 'pebbles': { 'age': 1, 'active': true } * }; * * _.findLastKey(users, function(o) { return o.age < 40; }); * // => returns 'pebbles' assuming `_.findKey` returns 'barney' * * // The `_.matches` iteratee shorthand. * _.findLastKey(users, { 'age': 36, 'active': true }); * // => 'barney' * * // The `_.matchesProperty` iteratee shorthand. * _.findLastKey(users, ['active', false]); * // => 'fred' * * // The `_.property` iteratee shorthand. * _.findLastKey(users, 'active'); * // => 'pebbles' */ function findLastKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); } /** * Iterates over own and inherited enumerable string keyed properties of an * object and invokes `iteratee` for each property. The iteratee is invoked * with three arguments: (value, key, object). Iteratee functions may exit * iteration early by explicitly returning `false`. * * @static * @memberOf _ * @since 0.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forInRight * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forIn(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). */ function forIn(object, iteratee) { return object == null ? object : baseFor(object, getIteratee(iteratee, 3), keysIn); } /** * This method is like `_.forIn` except that it iterates over properties of * `object` in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forIn * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forInRight(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. */ function forInRight(object, iteratee) { return object == null ? object : baseForRight(object, getIteratee(iteratee, 3), keysIn); } /** * Iterates over own enumerable string keyed properties of an object and * invokes `iteratee` for each property. The iteratee is invoked with three * arguments: (value, key, object). Iteratee functions may exit iteration * early by explicitly returning `false`. * * @static * @memberOf _ * @since 0.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forOwnRight * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forOwn(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'a' then 'b' (iteration order is not guaranteed). */ function forOwn(object, iteratee) { return object && baseForOwn(object, getIteratee(iteratee, 3)); } /** * This method is like `_.forOwn` except that it iterates over properties of * `object` in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forOwn * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forOwnRight(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. */ function forOwnRight(object, iteratee) { return object && baseForOwnRight(object, getIteratee(iteratee, 3)); } /** * Creates an array of function property names from own enumerable properties * of `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to inspect. * @returns {Array} Returns the function names. * @see _.functionsIn * @example * * function Foo() { * this.a = _.constant('a'); * this.b = _.constant('b'); * } * * Foo.prototype.c = _.constant('c'); * * _.functions(new Foo); * // => ['a', 'b'] */ function functions(object) { return object == null ? [] : baseFunctions(object, keys(object)); } /** * Creates an array of function property names from own and inherited * enumerable properties of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to inspect. * @returns {Array} Returns the function names. * @see _.functions * @example * * function Foo() { * this.a = _.constant('a'); * this.b = _.constant('b'); * } * * Foo.prototype.c = _.constant('c'); * * _.functionsIn(new Foo); * // => ['a', 'b', 'c'] */ function functionsIn(object) { return object == null ? [] : baseFunctions(object, keysIn(object)); } /** * Gets the value at `path` of `object`. If the resolved value is * `undefined`, the `defaultValue` is returned in its place. * * @static * @memberOf _ * @since 3.7.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the property to get. * @param {*} [defaultValue] The value returned for `undefined` resolved values. * @returns {*} Returns the resolved value. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.get(object, 'a[0].b.c'); * // => 3 * * _.get(object, ['a', '0', 'b', 'c']); * // => 3 * * _.get(object, 'a.b.c', 'default'); * // => 'default' */ function get(object, path, defaultValue) { var result = object == null ? undefined : baseGet(object, path); return result === undefined ? defaultValue : result; } /** * Checks if `path` is a direct property of `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @returns {boolean} Returns `true` if `path` exists, else `false`. * @example * * var object = { 'a': { 'b': 2 } }; * var other = _.create({ 'a': _.create({ 'b': 2 }) }); * * _.has(object, 'a'); * // => true * * _.has(object, 'a.b'); * // => true * * _.has(object, ['a', 'b']); * // => true * * _.has(other, 'a'); * // => false */ function has(object, path) { return object != null && hasPath(object, path, baseHas); } /** * Checks if `path` is a direct or inherited property of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @returns {boolean} Returns `true` if `path` exists, else `false`. * @example * * var object = _.create({ 'a': _.create({ 'b': 2 }) }); * * _.hasIn(object, 'a'); * // => true * * _.hasIn(object, 'a.b'); * // => true * * _.hasIn(object, ['a', 'b']); * // => true * * _.hasIn(object, 'b'); * // => false */ function hasIn(object, path) { return object != null && hasPath(object, path, baseHasIn); } /** * Creates an object composed of the inverted keys and values of `object`. * If `object` contains duplicate values, subsequent values overwrite * property assignments of previous values. * * @static * @memberOf _ * @since 0.7.0 * @category Object * @param {Object} object The object to invert. * @returns {Object} Returns the new inverted object. * @example * * var object = { 'a': 1, 'b': 2, 'c': 1 }; * * _.invert(object); * // => { '1': 'c', '2': 'b' } */ var invert = createInverter(function(result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } result[value] = key; }, constant(identity)); /** * This method is like `_.invert` except that the inverted object is generated * from the results of running each element of `object` thru `iteratee`. The * corresponding inverted value of each inverted key is an array of keys * responsible for generating the inverted value. The iteratee is invoked * with one argument: (value). * * @static * @memberOf _ * @since 4.1.0 * @category Object * @param {Object} object The object to invert. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Object} Returns the new inverted object. * @example * * var object = { 'a': 1, 'b': 2, 'c': 1 }; * * _.invertBy(object); * // => { '1': ['a', 'c'], '2': ['b'] } * * _.invertBy(object, function(value) { * return 'group' + value; * }); * // => { 'group1': ['a', 'c'], 'group2': ['b'] } */ var invertBy = createInverter(function(result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } if (hasOwnProperty.call(result, value)) { result[value].push(key); } else { result[value] = [key]; } }, getIteratee); /** * Invokes the method at `path` of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the method to invoke. * @param {...*} [args] The arguments to invoke the method with. * @returns {*} Returns the result of the invoked method. * @example * * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; * * _.invoke(object, 'a[0].b.c.slice', 1, 3); * // => [2, 3] */ var invoke = baseRest(baseInvoke); /** * Creates an array of the own enumerable property names of `object`. * * **Note:** Non-object values are coerced to objects. See the * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) * for more details. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.keys(new Foo); * // => ['a', 'b'] (iteration order is not guaranteed) * * _.keys('hi'); * // => ['0', '1'] */ function keys(object) { return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); } /** * Creates an array of the own and inherited enumerable property names of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @memberOf _ * @since 3.0.0 * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.keysIn(new Foo); * // => ['a', 'b', 'c'] (iteration order is not guaranteed) */ function keysIn(object) { return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); } /** * The opposite of `_.mapValues`; this method creates an object with the * same values as `object` and keys generated by running each own enumerable * string keyed property of `object` thru `iteratee`. The iteratee is invoked * with three arguments: (value, key, object). * * @static * @memberOf _ * @since 3.8.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns the new mapped object. * @see _.mapValues * @example * * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { * return key + value; * }); * // => { 'a1': 1, 'b2': 2 } */ function mapKeys(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function(value, key, object) { baseAssignValue(result, iteratee(value, key, object), value); }); return result; } /** * Creates an object with the same keys as `object` and values generated * by running each own enumerable string keyed property of `object` thru * `iteratee`. The iteratee is invoked with three arguments: * (value, key, object). * * @static * @memberOf _ * @since 2.4.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns the new mapped object. * @see _.mapKeys * @example * * var users = { * 'fred': { 'user': 'fred', 'age': 40 }, * 'pebbles': { 'user': 'pebbles', 'age': 1 } * }; * * _.mapValues(users, function(o) { return o.age; }); * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) * * // The `_.property` iteratee shorthand. * _.mapValues(users, 'age'); * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) */ function mapValues(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function(value, key, object) { baseAssignValue(result, key, iteratee(value, key, object)); }); return result; } /** * This method is like `_.assign` except that it recursively merges own and * inherited enumerable string keyed properties of source objects into the * destination object. Source properties that resolve to `undefined` are * skipped if a destination value exists. Array and plain object properties * are merged recursively. Other objects and value types are overridden by * assignment. Source objects are applied from left to right. Subsequent * sources overwrite property assignments of previous sources. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 0.5.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @example * * var object = { * 'a': [{ 'b': 2 }, { 'd': 4 }] * }; * * var other = { * 'a': [{ 'c': 3 }, { 'e': 5 }] * }; * * _.merge(object, other); * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } */ var merge = createAssigner(function(object, source, srcIndex) { baseMerge(object, source, srcIndex); }); /** * This method is like `_.merge` except that it accepts `customizer` which * is invoked to produce the merged values of the destination and source * properties. If `customizer` returns `undefined`, merging is handled by the * method instead. The `customizer` is invoked with six arguments: * (objValue, srcValue, key, object, source, stack). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} customizer The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * function customizer(objValue, srcValue) { * if (_.isArray(objValue)) { * return objValue.concat(srcValue); * } * } * * var object = { 'a': [1], 'b': [2] }; * var other = { 'a': [3], 'b': [4] }; * * _.mergeWith(object, other, customizer); * // => { 'a': [1, 3], 'b': [2, 4] } */ var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { baseMerge(object, source, srcIndex, customizer); }); /** * The opposite of `_.pick`; this method creates an object composed of the * own and inherited enumerable property paths of `object` that are not omitted. * * **Note:** This method is considerably slower than `_.pick`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The source object. * @param {...(string|string[])} [paths] The property paths to omit. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.omit(object, ['a', 'c']); * // => { 'b': '2' } */ var omit = flatRest(function(object, paths) { var result = {}; if (object == null) { return result; } var isDeep = false; paths = arrayMap(paths, function(path) { path = castPath(path, object); isDeep || (isDeep = path.length > 1); return path; }); copyObject(object, getAllKeysIn(object), result); if (isDeep) { result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); } var length = paths.length; while (length--) { baseUnset(result, paths[length]); } return result; }); /** * The opposite of `_.pickBy`; this method creates an object composed of * the own and inherited enumerable string keyed properties of `object` that * `predicate` doesn't return truthy for. The predicate is invoked with two * arguments: (value, key). * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The source object. * @param {Function} [predicate=_.identity] The function invoked per property. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.omitBy(object, _.isNumber); * // => { 'b': '2' } */ function omitBy(object, predicate) { return pickBy(object, negate(getIteratee(predicate))); } /** * Creates an object composed of the picked `object` properties. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The source object. * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.pick(object, ['a', 'c']); * // => { 'a': 1, 'c': 3 } */ var pick = flatRest(function(object, paths) { return object == null ? {} : basePick(object, paths); }); /** * Creates an object composed of the `object` properties `predicate` returns * truthy for. The predicate is invoked with two arguments: (value, key). * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The source object. * @param {Function} [predicate=_.identity] The function invoked per property. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.pickBy(object, _.isNumber); * // => { 'a': 1, 'c': 3 } */ function pickBy(object, predicate) { if (object == null) { return {}; } var props = arrayMap(getAllKeysIn(object), function(prop) { return [prop]; }); predicate = getIteratee(predicate); return basePickBy(object, props, function(value, path) { return predicate(value, path[0]); }); } /** * This method is like `_.get` except that if the resolved value is a * function it's invoked with the `this` binding of its parent object and * its result is returned. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the property to resolve. * @param {*} [defaultValue] The value returned for `undefined` resolved values. * @returns {*} Returns the resolved value. * @example * * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; * * _.result(object, 'a[0].b.c1'); * // => 3 * * _.result(object, 'a[0].b.c2'); * // => 4 * * _.result(object, 'a[0].b.c3', 'default'); * // => 'default' * * _.result(object, 'a[0].b.c3', _.constant('default')); * // => 'default' */ function result(object, path, defaultValue) { path = castPath(path, object); var index = -1, length = path.length; // Ensure the loop is entered when path is empty. if (!length) { length = 1; object = undefined; } while (++index < length) { var value = object == null ? undefined : object[toKey(path[index])]; if (value === undefined) { index = length; value = defaultValue; } object = isFunction(value) ? value.call(object) : value; } return object; } /** * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, * it's created. Arrays are created for missing index properties while objects * are created for all other missing properties. Use `_.setWith` to customize * `path` creation. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 3.7.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @returns {Object} Returns `object`. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.set(object, 'a[0].b.c', 4); * console.log(object.a[0].b.c); * // => 4 * * _.set(object, ['x', '0', 'y', 'z'], 5); * console.log(object.x[0].y.z); * // => 5 */ function set(object, path, value) { return object == null ? object : baseSet(object, path, value); } /** * This method is like `_.set` except that it accepts `customizer` which is * invoked to produce the objects of `path`. If `customizer` returns `undefined` * path creation is handled by the method instead. The `customizer` is invoked * with three arguments: (nsValue, key, nsObject). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * var object = {}; * * _.setWith(object, '[0][1]', 'a', Object); * // => { '0': { '1': 'a' } } */ function setWith(object, path, value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseSet(object, path, value, customizer); } /** * Creates an array of own enumerable string keyed-value pairs for `object` * which can be consumed by `_.fromPairs`. If `object` is a map or set, its * entries are returned. * * @static * @memberOf _ * @since 4.0.0 * @alias entries * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the key-value pairs. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.toPairs(new Foo); * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) */ var toPairs = createToPairs(keys); /** * Creates an array of own and inherited enumerable string keyed-value pairs * for `object` which can be consumed by `_.fromPairs`. If `object` is a map * or set, its entries are returned. * * @static * @memberOf _ * @since 4.0.0 * @alias entriesIn * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the key-value pairs. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.toPairsIn(new Foo); * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) */ var toPairsIn = createToPairs(keysIn); /** * An alternative to `_.reduce`; this method transforms `object` to a new * `accumulator` object which is the result of running each of its own * enumerable string keyed properties thru `iteratee`, with each invocation * potentially mutating the `accumulator` object. If `accumulator` is not * provided, a new object with the same `[[Prototype]]` will be used. The * iteratee is invoked with four arguments: (accumulator, value, key, object). * Iteratee functions may exit iteration early by explicitly returning `false`. * * @static * @memberOf _ * @since 1.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The custom accumulator value. * @returns {*} Returns the accumulated value. * @example * * _.transform([2, 3, 4], function(result, n) { * result.push(n *= n); * return n % 2 == 0; * }, []); * // => [4, 9] * * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { * (result[value] || (result[value] = [])).push(key); * }, {}); * // => { '1': ['a', 'c'], '2': ['b'] } */ function transform(object, iteratee, accumulator) { var isArr = isArray(object), isArrLike = isArr || isBuffer(object) || isTypedArray(object); iteratee = getIteratee(iteratee, 4); if (accumulator == null) { var Ctor = object && object.constructor; if (isArrLike) { accumulator = isArr ? new Ctor : []; } else if (isObject(object)) { accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; } else { accumulator = {}; } } (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { return iteratee(accumulator, value, index, object); }); return accumulator; } /** * Removes the property at `path` of `object`. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to unset. * @returns {boolean} Returns `true` if the property is deleted, else `false`. * @example * * var object = { 'a': [{ 'b': { 'c': 7 } }] }; * _.unset(object, 'a[0].b.c'); * // => true * * console.log(object); * // => { 'a': [{ 'b': {} }] }; * * _.unset(object, ['a', '0', 'b', 'c']); * // => true * * console.log(object); * // => { 'a': [{ 'b': {} }] }; */ function unset(object, path) { return object == null ? true : baseUnset(object, path); } /** * This method is like `_.set` except that accepts `updater` to produce the * value to set. Use `_.updateWith` to customize `path` creation. The `updater` * is invoked with one argument: (value). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.6.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {Function} updater The function to produce the updated value. * @returns {Object} Returns `object`. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.update(object, 'a[0].b.c', function(n) { return n * n; }); * console.log(object.a[0].b.c); * // => 9 * * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); * console.log(object.x[0].y.z); * // => 0 */ function update(object, path, updater) { return object == null ? object : baseUpdate(object, path, castFunction(updater)); } /** * This method is like `_.update` except that it accepts `customizer` which is * invoked to produce the objects of `path`. If `customizer` returns `undefined` * path creation is handled by the method instead. The `customizer` is invoked * with three arguments: (nsValue, key, nsObject). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.6.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {Function} updater The function to produce the updated value. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * var object = {}; * * _.updateWith(object, '[0][1]', _.constant('a'), Object); * // => { '0': { '1': 'a' } } */ function updateWith(object, path, updater, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); } /** * Creates an array of the own enumerable string keyed property values of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property values. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.values(new Foo); * // => [1, 2] (iteration order is not guaranteed) * * _.values('hi'); * // => ['h', 'i'] */ function values(object) { return object == null ? [] : baseValues(object, keys(object)); } /** * Creates an array of the own and inherited enumerable string keyed property * values of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @memberOf _ * @since 3.0.0 * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property values. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.valuesIn(new Foo); * // => [1, 2, 3] (iteration order is not guaranteed) */ function valuesIn(object) { return object == null ? [] : baseValues(object, keysIn(object)); } /*------------------------------------------------------------------------*/ /** * Clamps `number` within the inclusive `lower` and `upper` bounds. * * @static * @memberOf _ * @since 4.0.0 * @category Number * @param {number} number The number to clamp. * @param {number} [lower] The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the clamped number. * @example * * _.clamp(-10, -5, 5); * // => -5 * * _.clamp(10, -5, 5); * // => 5 */ function clamp(number, lower, upper) { if (upper === undefined) { upper = lower; lower = undefined; } if (upper !== undefined) { upper = toNumber(upper); upper = upper === upper ? upper : 0; } if (lower !== undefined) { lower = toNumber(lower); lower = lower === lower ? lower : 0; } return baseClamp(toNumber(number), lower, upper); } /** * Checks if `n` is between `start` and up to, but not including, `end`. If * `end` is not specified, it's set to `start` with `start` then set to `0`. * If `start` is greater than `end` the params are swapped to support * negative ranges. * * @static * @memberOf _ * @since 3.3.0 * @category Number * @param {number} number The number to check. * @param {number} [start=0] The start of the range. * @param {number} end The end of the range. * @returns {boolean} Returns `true` if `number` is in the range, else `false`. * @see _.range, _.rangeRight * @example * * _.inRange(3, 2, 4); * // => true * * _.inRange(4, 8); * // => true * * _.inRange(4, 2); * // => false * * _.inRange(2, 2); * // => false * * _.inRange(1.2, 2); * // => true * * _.inRange(5.2, 4); * // => false * * _.inRange(-3, -2, -6); * // => true */ function inRange(number, start, end) { start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } number = toNumber(number); return baseInRange(number, start, end); } /** * Produces a random number between the inclusive `lower` and `upper` bounds. * If only one argument is provided a number between `0` and the given number * is returned. If `floating` is `true`, or either `lower` or `upper` are * floats, a floating-point number is returned instead of an integer. * * **Note:** JavaScript follows the IEEE-754 standard for resolving * floating-point values which can produce unexpected results. * * @static * @memberOf _ * @since 0.7.0 * @category Number * @param {number} [lower=0] The lower bound. * @param {number} [upper=1] The upper bound. * @param {boolean} [floating] Specify returning a floating-point number. * @returns {number} Returns the random number. * @example * * _.random(0, 5); * // => an integer between 0 and 5 * * _.random(5); * // => also an integer between 0 and 5 * * _.random(5, true); * // => a floating-point number between 0 and 5 * * _.random(1.2, 5.2); * // => a floating-point number between 1.2 and 5.2 */ function random(lower, upper, floating) { if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { upper = floating = undefined; } if (floating === undefined) { if (typeof upper == 'boolean') { floating = upper; upper = undefined; } else if (typeof lower == 'boolean') { floating = lower; lower = undefined; } } if (lower === undefined && upper === undefined) { lower = 0; upper = 1; } else { lower = toFinite(lower); if (upper === undefined) { upper = lower; lower = 0; } else { upper = toFinite(upper); } } if (lower > upper) { var temp = lower; lower = upper; upper = temp; } if (floating || lower % 1 || upper % 1) { var rand = nativeRandom(); return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); } return baseRandom(lower, upper); } /*------------------------------------------------------------------------*/ /** * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the camel cased string. * @example * * _.camelCase('Foo Bar'); * // => 'fooBar' * * _.camelCase('--foo-bar--'); * // => 'fooBar' * * _.camelCase('__FOO_BAR__'); * // => 'fooBar' */ var camelCase = createCompounder(function(result, word, index) { word = word.toLowerCase(); return result + (index ? capitalize(word) : word); }); /** * Converts the first character of `string` to upper case and the remaining * to lower case. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to capitalize. * @returns {string} Returns the capitalized string. * @example * * _.capitalize('FRED'); * // => 'Fred' */ function capitalize(string) { return upperFirst(toString(string).toLowerCase()); } /** * Deburrs `string` by converting * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) * letters to basic Latin letters and removing * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to deburr. * @returns {string} Returns the deburred string. * @example * * _.deburr('déjà vu'); * // => 'deja vu' */ function deburr(string) { string = toString(string); return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); } /** * Checks if `string` ends with the given target string. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to inspect. * @param {string} [target] The string to search for. * @param {number} [position=string.length] The position to search up to. * @returns {boolean} Returns `true` if `string` ends with `target`, * else `false`. * @example * * _.endsWith('abc', 'c'); * // => true * * _.endsWith('abc', 'b'); * // => false * * _.endsWith('abc', 'b', 2); * // => true */ function endsWith(string, target, position) { string = toString(string); target = baseToString(target); var length = string.length; position = position === undefined ? length : baseClamp(toInteger(position), 0, length); var end = position; position -= target.length; return position >= 0 && string.slice(position, end) == target; } /** * Converts the characters "&", "<", ">", '"', and "'" in `string` to their * corresponding HTML entities. * * **Note:** No other characters are escaped. To escape additional * characters use a third-party library like [_he_](https://mths.be/he). * * Though the ">" character is escaped for symmetry, characters like * ">" and "/" don't need escaping in HTML and have no special meaning * unless they're part of a tag or unquoted attribute value. See * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) * (under "semi-related fun fact") for more details. * * When working with HTML you should always * [quote attribute values](http://wonko.com/post/html-escaping) to reduce * XSS vectors. * * @static * @since 0.1.0 * @memberOf _ * @category String * @param {string} [string=''] The string to escape. * @returns {string} Returns the escaped string. * @example * * _.escape('fred, barney, & pebbles'); * // => 'fred, barney, & pebbles' */ function escape(string) { string = toString(string); return (string && reHasUnescapedHtml.test(string)) ? string.replace(reUnescapedHtml, escapeHtmlChar) : string; } /** * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to escape. * @returns {string} Returns the escaped string. * @example * * _.escapeRegExp('[lodash](https://lodash.com/)'); * // => '\[lodash\]\(https://lodash\.com/\)' */ function escapeRegExp(string) { string = toString(string); return (string && reHasRegExpChar.test(string)) ? string.replace(reRegExpChar, '\\$&') : string; } /** * Converts `string` to * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the kebab cased string. * @example * * _.kebabCase('Foo Bar'); * // => 'foo-bar' * * _.kebabCase('fooBar'); * // => 'foo-bar' * * _.kebabCase('__FOO_BAR__'); * // => 'foo-bar' */ var kebabCase = createCompounder(function(result, word, index) { return result + (index ? '-' : '') + word.toLowerCase(); }); /** * Converts `string`, as space separated words, to lower case. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the lower cased string. * @example * * _.lowerCase('--Foo-Bar--'); * // => 'foo bar' * * _.lowerCase('fooBar'); * // => 'foo bar' * * _.lowerCase('__FOO_BAR__'); * // => 'foo bar' */ var lowerCase = createCompounder(function(result, word, index) { return result + (index ? ' ' : '') + word.toLowerCase(); }); /** * Converts the first character of `string` to lower case. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the converted string. * @example * * _.lowerFirst('Fred'); * // => 'fred' * * _.lowerFirst('FRED'); * // => 'fRED' */ var lowerFirst = createCaseFirst('toLowerCase'); /** * Pads `string` on the left and right sides if it's shorter than `length`. * Padding characters are truncated if they can't be evenly divided by `length`. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.pad('abc', 8); * // => ' abc ' * * _.pad('abc', 8, '_-'); * // => '_-abc_-_' * * _.pad('abc', 3); * // => 'abc' */ function pad(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; if (!length || strLength >= length) { return string; } var mid = (length - strLength) / 2; return ( createPadding(nativeFloor(mid), chars) + string + createPadding(nativeCeil(mid), chars) ); } /** * Pads `string` on the right side if it's shorter than `length`. Padding * characters are truncated if they exceed `length`. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.padEnd('abc', 6); * // => 'abc ' * * _.padEnd('abc', 6, '_-'); * // => 'abc_-_' * * _.padEnd('abc', 3); * // => 'abc' */ function padEnd(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (string + createPadding(length - strLength, chars)) : string; } /** * Pads `string` on the left side if it's shorter than `length`. Padding * characters are truncated if they exceed `length`. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.padStart('abc', 6); * // => ' abc' * * _.padStart('abc', 6, '_-'); * // => '_-_abc' * * _.padStart('abc', 3); * // => 'abc' */ function padStart(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (createPadding(length - strLength, chars) + string) : string; } /** * Converts `string` to an integer of the specified radix. If `radix` is * `undefined` or `0`, a `radix` of `10` is used unless `value` is a * hexadecimal, in which case a `radix` of `16` is used. * * **Note:** This method aligns with the * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. * * @static * @memberOf _ * @since 1.1.0 * @category String * @param {string} string The string to convert. * @param {number} [radix=10] The radix to interpret `value` by. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {number} Returns the converted integer. * @example * * _.parseInt('08'); * // => 8 * * _.map(['6', '08', '10'], _.parseInt); * // => [6, 8, 10] */ function parseInt(string, radix, guard) { if (guard || radix == null) { radix = 0; } else if (radix) { radix = +radix; } return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); } /** * Repeats the given string `n` times. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to repeat. * @param {number} [n=1] The number of times to repeat the string. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {string} Returns the repeated string. * @example * * _.repeat('*', 3); * // => '***' * * _.repeat('abc', 2); * // => 'abcabc' * * _.repeat('abc', 0); * // => '' */ function repeat(string, n, guard) { if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } return baseRepeat(toString(string), n); } /** * Replaces matches for `pattern` in `string` with `replacement`. * * **Note:** This method is based on * [`String#replace`](https://mdn.io/String/replace). * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to modify. * @param {RegExp|string} pattern The pattern to replace. * @param {Function|string} replacement The match replacement. * @returns {string} Returns the modified string. * @example * * _.replace('Hi Fred', 'Fred', 'Barney'); * // => 'Hi Barney' */ function replace() { var args = arguments, string = toString(args[0]); return args.length < 3 ? string : string.replace(args[1], args[2]); } /** * Converts `string` to * [snake case](https://en.wikipedia.org/wiki/Snake_case). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the snake cased string. * @example * * _.snakeCase('Foo Bar'); * // => 'foo_bar' * * _.snakeCase('fooBar'); * // => 'foo_bar' * * _.snakeCase('--FOO-BAR--'); * // => 'foo_bar' */ var snakeCase = createCompounder(function(result, word, index) { return result + (index ? '_' : '') + word.toLowerCase(); }); /** * Splits `string` by `separator`. * * **Note:** This method is based on * [`String#split`](https://mdn.io/String/split). * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to split. * @param {RegExp|string} separator The separator pattern to split by. * @param {number} [limit] The length to truncate results to. * @returns {Array} Returns the string segments. * @example * * _.split('a-b-c', '-', 2); * // => ['a', 'b'] */ function split(string, separator, limit) { if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { separator = limit = undefined; } limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; if (!limit) { return []; } string = toString(string); if (string && ( typeof separator == 'string' || (separator != null && !isRegExp(separator)) )) { separator = baseToString(separator); if (!separator && hasUnicode(string)) { return castSlice(stringToArray(string), 0, limit); } } return string.split(separator, limit); } /** * Converts `string` to * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). * * @static * @memberOf _ * @since 3.1.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the start cased string. * @example * * _.startCase('--foo-bar--'); * // => 'Foo Bar' * * _.startCase('fooBar'); * // => 'Foo Bar' * * _.startCase('__FOO_BAR__'); * // => 'FOO BAR' */ var startCase = createCompounder(function(result, word, index) { return result + (index ? ' ' : '') + upperFirst(word); }); /** * Checks if `string` starts with the given target string. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to inspect. * @param {string} [target] The string to search for. * @param {number} [position=0] The position to search from. * @returns {boolean} Returns `true` if `string` starts with `target`, * else `false`. * @example * * _.startsWith('abc', 'a'); * // => true * * _.startsWith('abc', 'b'); * // => false * * _.startsWith('abc', 'b', 1); * // => true */ function startsWith(string, target, position) { string = toString(string); position = position == null ? 0 : baseClamp(toInteger(position), 0, string.length); target = baseToString(target); return string.slice(position, position + target.length) == target; } /** * Creates a compiled template function that can interpolate data properties * in "interpolate" delimiters, HTML-escape interpolated data properties in * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data * properties may be accessed as free variables in the template. If a setting * object is given, it takes precedence over `_.templateSettings` values. * * **Note:** In the development build `_.template` utilizes * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) * for easier debugging. * * For more information on precompiling templates see * [lodash's custom builds documentation](https://lodash.com/custom-builds). * * For more information on Chrome extension sandboxes see * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). * * @static * @since 0.1.0 * @memberOf _ * @category String * @param {string} [string=''] The template string. * @param {Object} [options={}] The options object. * @param {RegExp} [options.escape=_.templateSettings.escape] * The HTML "escape" delimiter. * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] * The "evaluate" delimiter. * @param {Object} [options.imports=_.templateSettings.imports] * An object to import into the template as free variables. * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] * The "interpolate" delimiter. * @param {string} [options.sourceURL='lodash.templateSources[n]'] * The sourceURL of the compiled template. * @param {string} [options.variable='obj'] * The data object variable name. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the compiled template function. * @example * * // Use the "interpolate" delimiter to create a compiled template. * var compiled = _.template('hello <%= user %>!'); * compiled({ 'user': 'fred' }); * // => 'hello fred!' * * // Use the HTML "escape" delimiter to escape data property values. * var compiled = _.template('<%- value %>'); * compiled({ 'value': '